PatrickHaller/the-stack-python-100k · Datasets at Hugging Face

66751b94fff83bdacd031d0bcc851fdda5cb0daf

3,172

py

Python

snark/synnetdb.py

hiraokusky/snark

e3080d6d005cd126751efb3e25f158ee258cbc08

[ "Apache-2.0" ]

6

2018-12-22T13:15:50.000Z

2020-04-12T14:18:34.000Z

snark/synnetdb.py

hiraokusky/snark

e3080d6d005cd126751efb3e25f158ee258cbc08

[ "Apache-2.0" ]

null

snark/synnetdb.py

hiraokusky/snark

e3080d6d005cd126751efb3e25f158ee258cbc08

[ "Apache-2.0" ]

null

""" Copyright 2019 hiraokusky Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ import pandas as pd import numpy as np import re import json import sys,os # pip install git+https://github.com/hiraokusky/snark from snark import wordnetdb, kanadb class SynNetDb: """ wordnetを簡単に処理するための一時記憶 RDF DBも併せて処理する word in synset . 同義語, 個物化 synset isa synset . 抽象化, 属性 synset hasa synset . 部分/属性/材質/所有(目的語を抱えている状態の主語) synset then synset . 状態遷移(主語から主語へ移る), 条件つきの場合は条件の付いたsynsetができる """ startdict = None v = False def __init__(self, opts=''): self.v = 'v' in opts def load_file(self, path): self.startdict = pd.read_csv(path) self.startdict = self.startdict.fillna('') def save_file(self, path): self.startdict.to_csv(path, index=False) def load_same_words_from_db(self, path, key): wn = wordnetdb.WordNetDb(path) cur = wn.get_same_words_by_lemma(key) for c in cur: self.add_link(c[3], 'in', c[1]) def select(self, key): d = self.startdict res = d[d['synset1'] == key] return res def select_link(self, key, link='isa'): d = self.startdict res = d[(d['synset1'] == key) & (d['link'] == link)] l = [] for r in res.values: l.append(r[2]) return l def select_link_ref(self, key, link='isa'): d = self.startdict res = d[(d['synset2'] == key) & (d['link'] == link)] l = [] for r in res.values: l.append(r[0]) return l def select_isa(self, key): """ isaリンクとinリンクを持つ全synsetを取得する Returns ------- [synset, ...] """ d = self.startdict res = d[(d['synset1'] == key) & ((d['link'] == 'in') | (d['link'] == 'isa'))] l = [] for r in res.values: l.append(r[2]) return l def select_same(self, key): """ keyと同じinを持つ全synsetを取得する Returns ------- [(synset, [word, ...]), ...] """ isa = self.select_link(key, 'in') res = [] for i in isa: ref = self.select_link_ref(i, 'in') res.append((i, ref)) return res def add_link(self, synset1, link, synset2): """ リンクを追加する同じデータがあれば追加しない """ d = self.startdict res = d[(d['synset1'] == synset1) & (d['link'] == link) & (d['synset2'] == synset2) ] if len(res) == 0: tmp_se = pd.Series([synset1, link, synset2], index=['synset1', 'link', 'synset2']) self.startdict = self.startdict.append(tmp_se, ignore_index=True)

27.582609

94

0.571248

1d2bd351e185a5bd4eb5d1af9d4607073ca56545

429

py

Python

scripts_ufes/paper.py

lmlima/DropoutRL

00db2e901c320cf12c60c5039561999d45591bd1

[ "BSD-3-Clause" ]

null

scripts_ufes/paper.py

lmlima/DropoutRL

00db2e901c320cf12c60c5039561999d45591bd1

[ "BSD-3-Clause" ]

null

scripts_ufes/paper.py

lmlima/DropoutRL

00db2e901c320cf12c60c5039561999d45591bd1

[ "BSD-3-Clause" ]

null

import pandas as pd import numpy as np import matplotlib.pyplot as plt from mpl_toolkits.mplot3d import Axes3D from sklearn.preprocessing import MinMaxScaler from scripts_ufes.data.evasao.gen_discrete_student import plot3d_state_discrete def fig3(): df = pd.read_pickle("tmp/data/xmeans/2/pca_data_discretization.dataframe.pkl") view = {'elev': 62, 'azim': -32} plot3d_state_discrete(df, output='/tmp', view=view)

30.642857

82

0.780886

4bccacf5aa62294eed7144f7a62e1fd8e056c579

1,238

py

Python

src/test/resource/simpleWebInPython2.py

SmallTianTian/sse

cfbbb2d7d7795519345ce19ee4b0599c212cbcf9

[ "Apache-2.0" ]

null

src/test/resource/simpleWebInPython2.py

SmallTianTian/sse

cfbbb2d7d7795519345ce19ee4b0599c212cbcf9

[ "Apache-2.0" ]

1

2018-02-20T10:17:20.000Z

src/test/resource/simpleWebInPython2.py

SmallTianTian/sse

cfbbb2d7d7795519345ce19ee4b0599c212cbcf9

[ "Apache-2.0" ]

1

2019-06-25T08:41:57.000Z

#coding=utf-8 from wsgiref.simple_server import make_server import time import sys def sse_content(): file_name = sys.path[0] + '/SSENormText.txt' with open(file_name, 'r') as f: return f.readlines() sse_content = sse_content() def application(environ, start_response): if environ['PATH_INFO'] == '/sse_without_cookie': return sse_without_cookie(environ, start_response) start_response('200 OK',[('Content-Type','text/html')]) return '<h1>Hello, web! </h1>' def sse_without_cookie(environ, start_response): charset = environ['HTTP_ACCEPT_CHARSET'] if environ.has_key('HTTP_ACCEPT_CHARSET') else 'UTF-8' start_response('200 OK',[('Content-Type','text/event-stream'), ('charset', charset)]) last_event_id = 'id: ' + environ['HTTP_LAST_EVENT_ID'] + '\n' if environ.has_key('HTTP_LAST_EVENT_ID') else None start_in_content = sse_content.index(last_event_id) if last_event_id else 0 content = sse_content[start_in_content:] for item in content: time.sleep(1) yield item.decode('utf-8').encode(charset) if __name__ == '__main__': httpd = make_server('', 8888, application) print("Serving HTTP on port 8888...") # 开始监听HTTP请求: httpd.serve_forever()

36.411765

116

0.699515

aeb64ebb8f1e363a30bcd327dd4302e75c8c9d3c

8,032

py

Python

tests/unit/configure/test_TableConfigCompleter.py

shane-breeze/AlphaTwirl

59dbd5348af31d02e133d43fd5bfaad6b99a155e

[ "BSD-3-Clause" ]

null

tests/unit/configure/test_TableConfigCompleter.py

shane-breeze/AlphaTwirl

59dbd5348af31d02e133d43fd5bfaad6b99a155e

[ "BSD-3-Clause" ]

null

tests/unit/configure/test_TableConfigCompleter.py

shane-breeze/AlphaTwirl

59dbd5348af31d02e133d43fd5bfaad6b99a155e

[ "BSD-3-Clause" ]

null

# Tai Sakuma <tai.sakuma@gmail.com> import pytest try: import unittest.mock as mock except ImportError: import mock from alphatwirl.configure import TableConfigCompleter ##__________________________________________________________________|| class MockDefaultSummary: pass class MockSummary2: pass class MockWeight: pass class MockBinning: pass ##__________________________________________________________________|| defaultWeight = MockWeight() @pytest.fixture() def obj(): return TableConfigCompleter( defaultSummaryClass=MockDefaultSummary, defaultWeight=defaultWeight, defaultOutDir='tmp' ) ##__________________________________________________________________|| def test_repr(obj): repr(obj) ##__________________________________________________________________|| binning1 = MockBinning() binning2 = MockBinning() @pytest.mark.parametrize('arg, expected', [ pytest.param( dict(), dict( keyAttrNames=(), keyIndices=None, binnings=None, keyOutColumnNames=(), valAttrNames=None, valIndices=None, summaryClass=MockDefaultSummary, valOutColumnNames=('n', 'nvar'), weight=defaultWeight, sort=True, nevents=None, outFile=True, outFileName='tbl_n.txt', outFilePath='tmp/tbl_n.txt', ), id='empty' ), pytest.param( dict( keyAttrNames=('met_pt', ), binnings=(binning1, ), ), dict( keyAttrNames=('met_pt',), keyIndices=None, binnings=(binning1, ), keyOutColumnNames=('met_pt',), valAttrNames=None, valIndices=None, summaryClass=MockDefaultSummary, valOutColumnNames=('n', 'nvar'), weight=defaultWeight, sort=True, nevents=None, outFile=True, outFileName='tbl_n.met_pt.txt', outFilePath='tmp/tbl_n.met_pt.txt', ), id='simple' ), pytest.param( dict( keyAttrNames=( ), binnings=( ) ), dict( keyAttrNames=(), keyIndices=None, binnings=(), keyOutColumnNames=(), valAttrNames=None, valIndices=None, summaryClass=MockDefaultSummary, valOutColumnNames=('n', 'nvar'), weight=defaultWeight, sort=True, nevents=None, outFile=True, outFileName='tbl_n.txt', outFilePath='tmp/tbl_n.txt', ), id='empty-key' ), pytest.param( dict( keyAttrNames=( ), binnings=( ), summaryClass=MockSummary2, ), dict( keyAttrNames=(), keyIndices=None, binnings=(), keyOutColumnNames=(), valAttrNames=None, valIndices=None, summaryClass=MockSummary2, valOutColumnNames=(), weight=defaultWeight, sort=True, nevents=None, outFile=True, outFileName='tbl_MockSummary2.txt', outFilePath='tmp/tbl_MockSummary2.txt', ), id='summary-class-empty-key-empty-val' ), pytest.param( dict( keyAttrNames=('key1', 'key2'), binnings=(binning1, binning2), summaryClass=MockSummary2, ), dict( keyAttrNames=('key1', 'key2'), keyIndices=None, binnings=(binning1, binning2), keyOutColumnNames=('key1', 'key2'), valAttrNames=None, valIndices=None, summaryClass=MockSummary2, valOutColumnNames=(), weight=defaultWeight, sort=True, nevents=None, outFile=True, outFileName='tbl_MockSummary2.key1.key2.txt', outFilePath='tmp/tbl_MockSummary2.key1.key2.txt', ), id='summary-class-2-keys-empty-vals' ), pytest.param( dict( keyAttrNames=('key1', 'key2'), binnings=(binning1, binning2), valAttrNames=('val1', 'val2'), summaryClass=MockSummary2, ), dict( keyAttrNames=('key1', 'key2'), keyIndices=None, binnings=(binning1, binning2), keyOutColumnNames=('key1', 'key2'), valAttrNames=('val1', 'val2'), valIndices=None, summaryClass=MockSummary2, valOutColumnNames=('val1', 'val2'), weight=defaultWeight, sort=True, nevents=None, outFile=True, outFileName='tbl_MockSummary2.key1.key2.val1.val2.txt', outFilePath='tmp/tbl_MockSummary2.key1.key2.val1.val2.txt', ), id='summary-class-2-keys-2-vals' ), pytest.param( dict( keyAttrNames=('key1', 'key2'), binnings=(binning1, binning2), keyIndices=(None, 1), valAttrNames=('val1', 'val2'), summaryClass=MockSummary2, ), dict( keyAttrNames=('key1', 'key2'), keyIndices=(None, 1), binnings=(binning1, binning2), keyOutColumnNames=('key1', 'key2'), valAttrNames=('val1', 'val2'), valIndices=None, summaryClass=MockSummary2, valOutColumnNames=('val1', 'val2'), weight=defaultWeight, sort=True, nevents=None, outFile=True, outFileName='tbl_MockSummary2.key1.key2-1.val1.val2.txt', outFilePath='tmp/tbl_MockSummary2.key1.key2-1.val1.val2.txt', ), id='summary-class-2-keys-2-vals-key-indices' ), pytest.param( dict( keyAttrNames=('key1', 'key2'), binnings=(binning1, binning2), valAttrNames=('val1', 'val2'), summaryClass=MockSummary2, valIndices=(2, None), ), dict( keyAttrNames=('key1', 'key2'), keyIndices=None, binnings=(binning1, binning2), keyOutColumnNames=('key1', 'key2'), valAttrNames=('val1', 'val2'), valIndices=(2, None), summaryClass=MockSummary2, valOutColumnNames=('val1', 'val2'), weight=defaultWeight, sort=True, nevents=None, outFile=True, outFileName='tbl_MockSummary2.key1.key2.val1-2.val2.txt', outFilePath='tmp/tbl_MockSummary2.key1.key2.val1-2.val2.txt', ), id='summary-class-2-keys-2-vals-val-indices' ), pytest.param( dict( keyAttrNames=('key1', 'key2'), binnings=(binning1, binning2), keyIndices=(None, 1), valAttrNames=('val1', 'val2'), summaryClass=MockSummary2, valIndices=(2, 3), ), dict( keyAttrNames=('key1', 'key2'), keyIndices=(None, 1), binnings=(binning1, binning2), keyOutColumnNames=('key1', 'key2'), valAttrNames=('val1', 'val2'), valIndices=(2, 3), summaryClass=MockSummary2, valOutColumnNames=('val1', 'val2'), weight=defaultWeight, sort=True, nevents=None, outFile=True, outFileName='tbl_MockSummary2.key1.key2-1.val1-2.val2-3.txt', outFilePath='tmp/tbl_MockSummary2.key1.key2-1.val1-2.val2-3.txt', ), id='summary-class-2-keys-2-vals-key-indices-val-indices' ), ]) def test_complete(obj, arg, expected): actual = obj.complete(arg) assert expected == actual assert arg is not actual ##__________________________________________________________________||

29.748148

77

0.538347

cd864ed1e821fec7a935af7feab16b488f0dec3d

738

py

Python

scripts/despacify.py

kennethreitz/em

9565bdde0b1acfb53d849cc526aea7ec1acf6217

[ "0BSD" ]

198

2016-03-10T06:43:47.000Z

2017-07-13T19:35:14.000Z

scripts/despacify.py

not-kennethreitz/em-keyboard

9565bdde0b1acfb53d849cc526aea7ec1acf6217

[ "0BSD" ]

22

2016-03-10T23:29:36.000Z

2017-07-03T00:55:06.000Z

scripts/despacify.py

not-kennethreitz/em-keyboard

9565bdde0b1acfb53d849cc526aea7ec1acf6217

[ "0BSD" ]

24

2016-05-16T19:42:41.000Z

2017-07-27T15:15:03.000Z

""" Replace spaces in emoji keywords with underscores """ from __future__ import annotations import json from em import parse_emojis INPUT_EMOJILIB_PATH = "em/emoji-en-US.json" OUTPUT_EMOJI_PATH = "em/emojis.json" def save_emojis(data: dict[str, list[str]], filename: str) -> None: with open(filename, "w") as outfile: json.dump(data, outfile, indent=None, separators=(",", ":")) def main() -> None: data = parse_emojis(INPUT_EMOJILIB_PATH) for emoji, keywords in data.items(): keywords = [keyword.replace(" ", "_") for keyword in keywords] data[emoji] = keywords save_emojis(data, OUTPUT_EMOJI_PATH) print(f"Emojis saved to {OUTPUT_EMOJI_PATH}") if __name__ == "__main__": main()

24.6

70

0.685637

366891a03d3e99a5ba0a4d3bbacec240e73a1fae

116

py

Python

simeng/test_objects/moving_point.py

OWigginsHay/simulation_engine

bb2ab5578d05b0235fd90e4b858f5e83b20257cc

[ "MIT" ]

null

simeng/test_objects/moving_point.py

OWigginsHay/simulation_engine

bb2ab5578d05b0235fd90e4b858f5e83b20257cc

[ "MIT" ]

2

2021-12-01T16:58:37.000Z

2021-12-03T23:11:56.000Z

simeng/test_objects/moving_point.py

OWigginsHay/simulation_engine

bb2ab5578d05b0235fd90e4b858f5e83b20257cc

[ "MIT" ]

null

from ..object import Object class MovingPoint(Object): def behaviour(self): return super().behaviour()

19.333333

34

0.689655

a6df7e3bbb0fb4efe2e64f3c1fc7754bbf23b97a

4,105

py

Python

Plots/Bar/NCL_bar_7.py

NCAR/GeoCAT-examples

fba1b045ba5145fa48cf2f3c1e3b3c7c863b0b5b

[ "Apache-2.0" ]

42

2020-03-03T16:19:30.000Z

2022-03-18T09:03:26.000Z

Plots/Bar/NCL_bar_7.py

netgodz/GeoCAT-examples

5ed9a1d68b69a921d0f1fee1160e109853926ed9

[ "Apache-2.0" ]

351

2019-12-20T22:10:47.000Z

2022-03-16T20:46:09.000Z

Plots/Bar/NCL_bar_7.py

netgodz/GeoCAT-examples

5ed9a1d68b69a921d0f1fee1160e109853926ed9

[ "Apache-2.0" ]

32

2020-01-06T21:18:48.000Z

2022-03-31T13:45:01.000Z

""" NCL_bar_7.py =============== This script illustrates the following concepts: - Drawing filled bars - Filling the bars in a bar plot with different colors - Setting the minimum/maximum value of the Y axis in a bar plot - Adding text to a plot - Rotating text 45 degrees - Drawing a custom legend See following URLs to see the reproduced NCL plot & script: - Original NCL script: https://www.ncl.ucar.edu/Applications/Scripts/bar_7.ncl - Original NCL plot: https://www.ncl.ucar.edu/Applications/Images/bar_7_1_lg.png and https://www.ncl.ucar.edu/Applications/Images/bar_7_2_lg.png """ ############################################################################### # Import packages: import numpy as np import matplotlib.pyplot as plt from geocat.viz import util as gvutil ############################################################################### # Generate data: x = [1, 2, 3, 4, 5, 6, 7, 8] data = [154900, 56600, 40000, 30200, 29700, 24400, 21700, 13900] labels = [ 'Lung', 'Colon/rectum', 'Breast', 'Prostate', 'Pancreas', 'Non-Hodgkin\'s Lymphoma', 'Leukemias', 'Ovary' ] ############################################################################### # Create the custom color list. color_list = [ 'firebrick', 'red', 'orange', 'green', 'navy', 'blue', 'skyblue', 'slateblue' ] ############################################################################### # Specify some plot settings to use in both plots: # Title settings title = 'Estimated Cancer Deaths for 2002' title_fontsize = 16 # Axis Settings plot_y_max = 180_000 ############################################################################### # Plot 1 (Bar chart): # Generate figure (set its size (width, height) in inches) and axes plt.figure(1, figsize=(6, 5)) ax = plt.gca() # Bar-plot the data plt.bar(x, data, color=color_list, edgecolor='black') plt.title(title, fontsize=title_fontsize, y=1.04) # Add a rotated label to each bar. for k, label in enumerate(labels): plt.text(x[k], data[k] + 2000, label, rotation=45) # Use geocat.viz.util convenience function to set axes limits & tick values without calling several matplotlib functions gvutil.set_axes_limits_and_ticks(ax, ylim=(0, plot_y_max), xticks=[], yticks=np.linspace(0, plot_y_max, 7)) # Use geocat.viz.util convenience function to add minor and major tick lines gvutil.add_major_minor_ticks(ax, x_minor_per_major=0, y_minor_per_major=3, labelsize=12) # Draw plot on the screen. plt.show() ############################################################################### # Plot 2 (Bar chart with a legend): # Generate figure (set its size (width, height) in inches) and axes plt.figure(2, figsize=(6, 5)) ax = plt.gca() # Bar-plot the data bar_handle = plt.bar(x, data, color=color_list, edgecolor='black') # Reverse the legend ordering to match NCL bars_reversed = bar_handle[::-1] labels_reversed = labels[::-1] # Add the legend plt.legend(bars_reversed, labels_reversed) # Use geocat.viz.util convenience function to set axes limits & tick values without calling several matplotlib functions gvutil.set_axes_limits_and_ticks(ax, ylim=(0, plot_y_max), xticks=[], yticks=np.linspace(0, plot_y_max, 7)) # Use geocat.viz.util convenience function to add minor and major tick lines gvutil.add_major_minor_ticks(ax, x_minor_per_major=0, y_minor_per_major=3, labelsize=12) # Use geocat.viz.util convenience function to set titles and labels without calling several matplotlib functions gvutil.set_titles_and_labels(ax, maintitle=title, maintitlefontsize=title_fontsize, ylabel="Number of Deaths") # Show the plot plt.tight_layout() plt.show()

34.495798

148

0.568331

f461b5ea3f7d8fdc3436b93aac92e5a01a276662

398

py

Python

apps/discussion/urls.py

umairqadir97/learning-management-system

9924326e77146830f3fb05a9d86f876f86c4d9b8

[ "MIT" ]

7

2020-06-03T15:31:44.000Z

2021-11-21T21:19:59.000Z

apps/discussion/urls.py

umairqadir97/learning-management-system

9924326e77146830f3fb05a9d86f876f86c4d9b8

[ "MIT" ]

null

apps/discussion/urls.py

umairqadir97/learning-management-system

9924326e77146830f3fb05a9d86f876f86c4d9b8

[ "MIT" ]

10

2020-11-06T00:40:01.000Z

2022-01-12T03:20:14.000Z

from django.conf.urls import url, include from . import views from rest_framework import routers router = routers.DefaultRouter() router.register('topics', views.TopicViewSet) router.register('entries', views.EntryViewSet) # router.register('replies', views.ReplyViewSet) urlpatterns = [ # url(r'^', views.TopicListView.as_view(), name='list_topic'), url(r'^', include(router.urls)), ]

24.875

66

0.738693

6cc23801008d1402a598c1c7a3af190e1fb1e8db

447

py

Python

hw_asr/model/__init__.py

s-isaev/HW.01.ASR

12963865ed29cbb29e33658f25f7da20f67d8421

[ "MIT" ]

null

hw_asr/model/__init__.py

s-isaev/HW.01.ASR

12963865ed29cbb29e33658f25f7da20f67d8421

[ "MIT" ]

null

hw_asr/model/__init__.py

s-isaev/HW.01.ASR

12963865ed29cbb29e33658f25f7da20f67d8421

[ "MIT" ]

null

from hw_asr.model.baseline_model import BaselineModel from hw_asr.model.overfit_model import OverfitModel from hw_asr.model.model_01 import Model01 from hw_asr.model.model_02 import Model02 from hw_asr.model.pet_conv_batchnorm_model import PetConvBatchnormModel from hw_asr.model.conv_batchnorm_model import ConvBatchnormModel __all__ = [ "BaselineModel", "OverfitModel", "Model01", "Model02", "PetConvBatchnormModel", "ConvBatchnormModel" ]

40.636364

104

0.841163

28b482cfa404b067c39cddf1feca2ecec93b75da

470

py

Python

rapport/sentence_tokenizer.py

oceandelee/tac

62ffbcb31b374a9fa83a1ee6010b2e00f2de8a7c

[ "MIT" ]

2

2021-10-17T00:49:16.000Z

2021-10-17T00:49:23.000Z

rapport/sentence_tokenizer.py

oceandelee/tac

62ffbcb31b374a9fa83a1ee6010b2e00f2de8a7c

[ "MIT" ]

null

rapport/sentence_tokenizer.py

oceandelee/tac

62ffbcb31b374a9fa83a1ee6010b2e00f2de8a7c

[ "MIT" ]

null

"""Tokenize sentences""" import os import sys import nltk from nltk.tokenize import sent_tokenize nltk.data.path.append("/home/max/nltk_data") infile = f"data/all.txt" outfile = f"data/sents.txt" with open(outfile, 'w', encoding="utf-8") as output: with open(infile, encoding="utf-8", errors="backslashreplace") as f: for line in f: sentences = sent_tokenize(line) for sent in sentences: output.write(sent + "\n")

24.736842

72

0.653191

b831e28f53cf6c4f24e6f0208acf486fa4d39390

1,702

py

Python

config/settings/test.py

scottbarnes/foxtail

b9faf95ad622d7aa967288698018202cc22b4893

[ "MIT" ]

5

2021-01-17T22:55:24.000Z

2021-01-18T21:05:18.000Z

config/settings/test.py

scottbarnes/foxtail

b9faf95ad622d7aa967288698018202cc22b4893

[ "MIT" ]

null

config/settings/test.py

scottbarnes/foxtail

b9faf95ad622d7aa967288698018202cc22b4893

[ "MIT" ]

null

""" With these settings, tests run faster. """ from .base import * # noqa from .base import env # GENERAL # ------------------------------------------------------------------------------ # https://docs.djangoproject.com/en/dev/ref/settings/#secret-key SECRET_KEY = env( "DJANGO_SECRET_KEY", default="DYA3L39SFqVYVdYCpbnEEvv8DnYjNZuDA38OxTn2GVyqQWJtaz2K2AzB0XUJWTqG", ) # https://docs.djangoproject.com/en/dev/ref/settings/#test-runner TEST_RUNNER = "django.test.runner.DiscoverRunner" # CACHES # ------------------------------------------------------------------------------ # https://docs.djangoproject.com/en/dev/ref/settings/#caches CACHES = { "default": { "BACKEND": "django.core.cache.backends.locmem.LocMemCache", "LOCATION": "", } } # PASSWORDS # ------------------------------------------------------------------------------ # https://docs.djangoproject.com/en/dev/ref/settings/#password-hashers PASSWORD_HASHERS = ["django.contrib.auth.hashers.MD5PasswordHasher"] # TEMPLATES # ------------------------------------------------------------------------------ TEMPLATES[-1]["OPTIONS"]["loaders"] = [ # type: ignore[index] # noqa F405 ( "django.template.loaders.cached.Loader", [ "django.template.loaders.filesystem.Loader", "django.template.loaders.app_directories.Loader", ], ) ] # EMAIL # ------------------------------------------------------------------------------ # https://docs.djangoproject.com/en/dev/ref/settings/#email-backend EMAIL_BACKEND = "django.core.mail.backends.locmem.EmailBackend" # Your stuff... # ------------------------------------------------------------------------------

32.730769

80

0.49765

84929dabe0abe8606d0d1cbc75f4ebb2cc37d708

1,363

py

Python

tests/components/zwave_mqtt/test_switch.py

silvertoken/core

9b8688b0fc624e7bfcb6cac81bcdadd9d2b4be79

[ "Apache-2.0" ]

2

2020-03-06T14:18:59.000Z

2020-03-06T14:24:43.000Z

tests/components/zwave_mqtt/test_switch.py

silvertoken/core

9b8688b0fc624e7bfcb6cac81bcdadd9d2b4be79

[ "Apache-2.0" ]

5

2021-02-08T20:55:25.000Z

2022-03-12T00:51:18.000Z

tests/components/zwave_mqtt/test_switch.py

silvertoken/core

9b8688b0fc624e7bfcb6cac81bcdadd9d2b4be79

[ "Apache-2.0" ]

1

2020-05-18T09:13:52.000Z

"""Test Z-Wave Switches.""" from .common import setup_zwave async def test_switch(hass, generic_data, sent_messages, switch_msg): """Test setting up config entry.""" receive_message = await setup_zwave(hass, fixture=generic_data) # Test loaded state = hass.states.get("switch.smart_plug_switch") assert state is not None assert state.state == "off" # Test turning on await hass.services.async_call( "switch", "turn_on", {"entity_id": "switch.smart_plug_switch"}, blocking=True ) assert len(sent_messages) == 1 msg = sent_messages[0] assert msg["topic"] == "OpenZWave/1/command/setvalue/" assert msg["payload"] == {"Value": True, "ValueIDKey": 541671440} # Feedback on state switch_msg.decode() switch_msg.payload["Value"] = True switch_msg.encode() receive_message(switch_msg) await hass.async_block_till_done() state = hass.states.get("switch.smart_plug_switch") assert state is not None assert state.state == "on" # Test turning off await hass.services.async_call( "switch", "turn_off", {"entity_id": "switch.smart_plug_switch"}, blocking=True ) assert len(sent_messages) == 2 msg = sent_messages[1] assert msg["topic"] == "OpenZWave/1/command/setvalue/" assert msg["payload"] == {"Value": False, "ValueIDKey": 541671440}

32.452381

86

0.674982

336b8439066526aaabf09a1774d133bb22c7a5be

27,946

py

Python

alex/applications/PublicTransportInfoCS/crws_enums.py

oplatek/alex

73af644ec35c8a1cd0c37cd478c2afc1db717e0b

[ "Apache-2.0" ]

184

2015-02-11T04:14:41.000Z

2022-03-24T21:43:58.000Z

alex/applications/PublicTransportInfoCS/crws_enums.py

oplatek/alex

73af644ec35c8a1cd0c37cd478c2afc1db717e0b

[ "Apache-2.0" ]

69

2015-01-11T04:57:22.000Z

2019-04-24T10:25:56.000Z

alex/applications/PublicTransportInfoCS/crws_enums.py

oplatek/alex

73af644ec35c8a1cd0c37cd478c2afc1db717e0b

[ "Apache-2.0" ]

61

2015-03-04T10:52:13.000Z

2022-03-04T12:14:06.000Z

#!/usr/bin/env python # -*- coding: utf-8 -*- """ Various enums, semi-automatically adapted from the CHAPS CRWS enum list written in C#. Comments come originally from the CRWS description and are in Czech. """ def enum(**enums): return type('Enum', (), enums) # priznaky pozadavku na podrobnosti vracenych dat TTDETAILS = enum( # vracet pevne kody FIXED_CODES=1L << 0, # vracet u pevnych kodu take pole sDescExt FIXED_CODES_DESC_EXT=1L << 1 | 1L << 0, # u datumovych poznamek davat omezeni od zacatku platnosti jizdniho radu, tj. nikoli od dneska REM_DATE_ALL=1L << 2, # pri vypoctu datumove poznamky sloucit varianty vlaku na useku (viz take REM_DISJOINT_VARIANTS) REM_MERGE_VARIANTS=1L << 3, # vracet k jedn. poznamkam i legendu znacek pouzitych v poznamkach (pro tisk) REM_LEGEND=1L << 4, # vracet hlavickove info o vlacich (TrainInfo - cislo, nazev, typ, ..) TRAIN_INFO=1L << 5, # vracet URL informacni soubory stanic (viz StationInfo.sInfoFile) INFO_FILES=1L << 6, # vracet informace pro rezervace (rezervacni klice, priznak moznosti predrezervace) RESERV=1L << 7, # vracet souradnice COOR=1L << 8, # vracet plne nazvy stanic vcetne statu a okresu (REG.ALWAYS) ST_NAMES_REG_ALWAYS=1L << 9, # misto informacniho souboru stanice davat text s linkami na zastavce (jen u JR autobusu a MHD) ST_LINES=1L << 10, # vracet vsechny stanice na trase spojeni (nejen prestupni) (zahrnuje i ROUTE_CHANGE) ROUTE_USED=1L << 11, # vracet stanice nastupu a vystupu (prestupni stanice) ROUTE_CHANGE=1L << 22, # vracet pocatecni a koncovou stanici kazdeho pouziteho spoje ROUTE_FROMTO=1L << 12, # vracet celou trasu pouzitych spoju (zahrnuje i ROUTE_USED a ROUTE_FROMTO) ROUTE_FULL=1L << 13, # vracet celou trasu pouzitych spoju jen v pripade, ze jizdni rad je vlakovy, jinak se ridi dle vlajek ROUTE_USED, ROUTE_CHANGE, ROUTE_FROMTO a ROUTE_FULL ROUTE_FULL_TRAIN=1L << 14, # vracet na draze take zalamane vedeni (TrainRouteInfo.adCoorX a TrainRouteInfo.adCoorY) ROUTE_COOR=1L << 15, # vracet poznamky k celemu spojeni; funguje bez ohledu na REMMASK # (nema vliv na poznamky k jednotlivym vlakum spojeni - ty se ridi parametrem iRemMask, viz enum REMMASK) # v poznamkach vsak mohou byt pouzity znacky TT; pro tisk pak je uzitecna legenda (RemarksList.aoLegend) REMARKS=1L << 16, # vracet i poznamku "jede denne"? (je ucinne pouze, pokud je soucasne zapnute REMARKS) REMARKS_DAILY=1L << 17, # vracet i seznam dopravcu? (je ucinne pouze, pokud je soucasne zapnute REMARKS, vyjimkou je pole DepartureTrain.sOwner) REMARKS_OWNERS=1L << 18, # nevracet v ramci poznamek ke spojeni datumove omezeni nikdy (souvisi se soucasne zapnutym REMARKS) REMARKS_SKIPDATE=1L << 19, # vracet v ramci poznamek ke spojeni take data o vylukach a mimoradnostech, # viz take REMMASK.EXCLUSION_DATA a REMMASK.EXCEPTION_DATA (souvisi se soucasne zapnutym REMARKS) REMARKS_EXCLUSION_DATA=1L << 24, # vratit v poznamkach ke spojeni take umelou poznamku typu REMMASK.DATE_FLAGS s priznaky jizdy (souvisi se soucasne zapnutym REMARKS) DATE_FLAGS=1L << 20, # vracet priznak moznosti polohy vlaku (viz take DELAY_CD_ONLY, DELAY_ARRDEP) DELAY=1L << 21, # pro odjezdove/prijezdove tabule: rezim CD: natvrdo davat smerovani dle pozadavku CD (max. 3 stanice) a vytvorit sestavu na 24 hodin DEP_TABLE_CD=1 << 23, # vracet sumarni legendu znacek na urovni celkoveho seznamu spojeni (pro tisk, obsahuje znacky pouzite v poznamkach i u stanic/spoju) LEGEND_ALL=1L << 25, # ma smysl jen ve spojeni s LEGEND_ALL, indikuje omezeni zahrnuti pevnych kodu jen na nastupni a vystupni stanici LEGEND_FROMTO_ONLY=1L << 26, # ma smysl jen ve spojeni s LEGEND_ALL, prikazuje pridat do legendy i znacky, ktere nejsou v TT fontu, resp. nejsou substituovany do ikony # kody na draze, ktere obsahuji cislo (typicky nastupiste a tar. pasma) se ale nezahrnuji LEGEND_ADD_NON_TT=1L << 27, # ma smysl jen ve spojeni s LEGEND_ALL, prikazuje nepridavat do legendy pevne kody hlavicky spoje LEGEND_SKIP_TRAIN=1L << 29, # v parametru iStation je ve skutecnosti na vstupu klic stanice (uplatni se ve funkci GetTrainDataInfo) KEY_IN_STATION=1L << 28, # nezahrnovat ve vystupu prime vozy (vyhledani spoje dle masky, odjezdy/prijezdy, spojeni) NO_CARS=1L << 30, # nezahrnovat ve vystupu spoje soukromych dopravcu, kteri nemaji smlouvu s CD (vyhledani spoje dle masky, odjezdy/prijezdy) CD_ONLY=1L << 31, # nevracet jednotlive spoje, ale od kazde linky jen jednoho reprezentanta SEARCH_LINES=1L << 32, # vracet v TrainInfo.sInfo informaci o lince/vedeni spoje LINE_IN_INFO=1L << 33, # vracet spoje po kazde variante smerovani dle ZJR (jen JR typu MHD) ZJR_DIRS=1L << 34, # vracet ve StationInfo take aiTrTypeID (viz take obdobny priznak v TTINFODETAILS) TRTYPEID_STATION=1L << 35, # nedavat duplicitni spoje (kontroluje se jen sNum1) TRAININFO_SKIPDUP=1L << 36, # cisla stanovist (ArrDepTrainInfo.sStand a DepartureTrain.sStand/sTrack) STANDS=1L << 37, # linky IDS pro vlaky (ArrDepTrainInfo.sIDSLine a DepartureTrain.sIDSLine) IDS_LINES=1L << 38, # ceny (jizdne) PRICES=1L << 39, # obe ceny i s detaily (zahrnuje i PRICE2) PRICE1=1L << 40, # pouze jedna cena do ConnectionInfo.sPrice, jen jako string (bez detailu - useku), jen je-li uplna (za celou trasu) PRICE2=1L << 41, # celkova cena formatovana jako pro www (bez detailu - useku) # - je-li soucasne zapnuto PRICE1 i PRICE2, pak se vraci celkova cena formatovana jako pro www, ale jen pokud je znama za celou trasu # vracet u spojeni take cilovou obec? DEST_CITY=1L << 42, # vracet u jednotlivych spojeni ID kombinace (ma smysl, jen pokud se muze u spojeni lisit) CONN_COMBID=1L << 43, # v pripade volani funkce SearchConnectionInfo2 pro spojeni s prestupy bez zadanych prestupnich mist zkusit nejprve otipovat prestupy CONN2_SET_CHANGE=1L << 44, # pri hledani spoje (linky) akceptovat jen presnou shodu s maskou, tj. neakceptovat podretezec MATCH_EXACT=1L << 45, # vracet v ramci ZJRInfo take pole aoAltDirections s alternativnimi smery ZJR ZJR_ALT_DIR=1L << 46, # vracet v ramci ZJRInfo davat smery i ze vsech zastavek uzlu MERGE_ST=1L << 47, # vracet spoje po kazde variante smerovani linky LINE_DIRS=1L << 48, # vracet priznak moznosti polohy vlaku a zpozdeni jen pro vlaky dopravce CD (plati jen soucasne s DELAY) DELAY_CD_ONLY=1L << 49, # pri vyhledani N odjezdu/prijezdu do budoucna zahrnout na zacatek i zpozdene spoje (plati jen soucasne s DELAY) DELAY_ARRDEP=1L << 50, # pri vypoctu datumove poznamky davat omezeni u variant vlaku disjunktne (potlacuje REM_MERGE_VARIANTS) REM_DISJOINT_VARIANTS=1L << 51, ) # priznaky pozadavku na podrobnosti k objektu typu TimetableObjectInfo TTINFODETAILS = enum( ITEM=1 << 0, # vratit pole oItem STATIONS=1 << 1, # vratit pole aoStations LINES_ITEM=1 << 2, # vratit sumar linek v sLines (jen pro JR typu MHD a Bus) LINES_STATION=1 << 3, # vratit sumar linek ve StationInfo.sInfoFile (jen pro JR typu MHD a Bus) TRTYPEID_ITEM=1 << 4, # vratit sumar ID druhu prostredku u polozky TRTYPEID_STATION=1 << 5, # vratit sumar ID druhu prostredku u stanic COOR=1 << 6, # vratit souradnice STCOUNT=1 << 7, # vratit pocet fyzickych stanic objektu STATE_ITEM=1 << 8, # vratit vysvetleni statu v sState STATE_ITEM_ALWAYS=1 << 9, # vratit vysvetleni statu v sState, i kdyz neni primo v nazvu objektu uveden REGION_ITEM=1 << 10, # vratit vysvetleni okresu v sRegion REGION_ITEM_ALWAYS=1 << 11, # vratit vysvetleni okresu v sRegion, i kdyz neni primo v nazvu objektu uveden REGION_DELETE=1 << 12, # vymazat data o regionu z nazvu objektu/adresy, idealne kombinovat s iRegMode:=REG.NONE LINES_BRIEF=1 << 13, # zkraceny sumar linek (jen ve spojitosti s LINES_ITEM a LINES_STATION) TYPE_ITEM=1 << 14, # vratit typ objektu v sType LINES_ITEM_MHD=1 << 15, # vratit sumar linek v sLines jen pro objekty z JR typu MHD (jen ve spojitosti s LINES_ITEM) REGION_NEEDED=1 << 16, # vratit v bRegion priznak, zdali je region pro rozliseni objektu nutny (jen ve spojitosti s REGION_ITEM_ALWAYS) TR_CATEGORY=1 << 17, # vratit v sTrCategory druhy dopravy (aplikuje se jen na kombinacich, ktere zahrnuji vlaky i busy) STATIONSEXT=1 << 18 | 1 << 1 # vratit pole aoStations jen pokud se vraci prvky seznamu stanic (LISTID.STATIONSEXT) ) # kategorie dopravy TRCAT = enum( ALL=0, # nerozliseno TRAIN=1, # vlaky BUS=2, # linkove autobusy CITY=3, # MHD AIR=4, # letadla SHIP=5 # lode ) # podkategorie dopravy (jen vybrane, rozsiruje se prubezne dle potreby) TRSUBCAT = enum( ALL=0, PRAHA=1, BRNO=2, OSTRAVA=3, CESBUD=4 ) # jazyky TTLANG = enum( CZECH=0, ENGLISH=1, GERMAN=2, SLOVAK=3, POLISH=4, COUNT=5, ) # ID zakladnich virtualnich seznamu LISTID = enum( CITY=1, # mesta a obce CITYPART=2, # mestske casti STATIONSEXT=3, # vsechny stanice + nejaka rozsireni (realne byva dekorovan cislem kategorie a podkategorie, viz iListID) ADDRESS=8, # symbolicky seznam adres: ve skutecnosti neni soucasti JR, ale je obsluhovan serverem adres STATIONS=9 # symbolicky seznam fyzickych stanic: nelze jej pouzit ke globalnimu vyhledavani! # - lze jej pouzit pouze na pozici GlobalListItemInfo.iListID, # v tomto pripade musi klient nastavit do GlobalListItemInfo.iItem index stanice dle StationInfo.iStation ) # kody vyjimek, ktere posila primo jadro (jizdni rad) TTERR = enum( # pri nacitani dat doslo k chybe LOAD=1, # pri nacitani dat doslo k vyjimce LOAD_EX=2, # pri paralelnim nacitani jizdnich radu se nektery nenacetl LOAD_MULTI=3, # nacitani dat prave probiha, nelze jej spustit soucasne znovu LOAD_RUNNING=4, # chybný index stanice BAD_ST_INDEX=5, # chybný index spoje BAD_TR_INDEX=6, # chybný index jizdniho radu BAD_TT_INDEX=7, # chybný index seznamu BAD_VIRT_LIST_INDEX=8, # chybny index objektu BAD_VIRT_LIST_ITEM_INDEX=9, # chybný index poznamky spoje BAD_TR_REM_INDEX=10, # substituce s ID nebyla nalezena BAD_SUBST_ID=11, # ocekava se 32-mista unikatni identifikace kombinace COMB_GUID_EXPECTED=12, # prazdne ID kombinace COMB_ID_EXPECTED=13, # chybný index globalniho seznamu BAD_GLOBAL_LIST_INDEX=14, # chybny index polozky globalniho seznamu BAD_GLOBAL_LIST_ITEM_INDEX=15, # pri pokusu o nacteni konfiguracniho souboru doslo k vyjimce TT_CONFIG=16, # kombinace pro zadane absolutni ID nebyla nalezena COMB_GUID_NOT_FOUND=17, # kombinace pro zadane ID nebyla nalezena COMB_NOT_FOUND=18, # chybna hlavicka datoveho souboru BAD_DATA_FILE_HEADER=19, # chyba CRC datoveho souboru BAD_DATA_FILE_CRC=20, # neplatny handle seznamu spojeni CONN_HANDLE_BAD=21, # seznam spojeni jiz byl uvolnen, provedte nove hledani CONN_HANDLE_RELEASED=22, # k seznamu spojeni s danym handle se prave pristupuje, zkuste to za chvili CONN_HANDLE_LOCKED=23, # jako cilovy seznam pro kopirovani spojeni nelze zadat bezny seznam (pouze kosik spojeni) CONN_HANDLE_STANDARD=24, # handle seznamu spojeni neodpovida pracovnimu procesu CONN_HANDLE_WORKER_BAD=25, # spojeni se zadanym ID nebylo nalezeno BAD_CONN_ID=26, # kombinaci nelze pro dany ucel pouzit BAD_COMB_USAGE=27, # chybne datum BAD_DATE=28, # chybny popis BAD_AUX_DESC=29, # chybny popis spoje nebo spoj nenalezen BAD_AUX_DESC2=30, # chybny parametr funkce BAD_FUNC_PARAM=31, ) # kody klientskych vyjimek CRWS CLIENTEXCEPTION_CODE = enum( # Neplatné ID uživatele (GUID) INVALIDUSERID=1000, # Neplatný přístupový kód (handle) seznamu spojení (evidentne spatny - napr. neni kladny nebo neodpovida absolutnimu ID kombinace) INVALIDCONNHANDLE=1001, # Neplatné ID kombinace (GUID) INVALIDCOMBGUID=1002, # Přístupový kód (handle) seznamu spojení již není platný, proveďte nové hledání spojení CONNHANDLETIMEOUT=1003, # Nepovolená kombinace "{0}". (nema na ni prava nebo zadal nesmysl) INVALIDCOMBID=1005, # Nemáte nastavena práva na žádnou kombinaci. NOCOMBINATIONENABLED=1006, # Právě probíhá restart serveru jízdních řádů. Zopakujte prosím požadavek později. APPRESTART=1007, # (zjištění polohy vlaku:) Informace o vlaku {0} nejsou k dispozici. {1} NOINFO=1010, # (zjištění polohy spoje:) Informace o spoji {0} nejsou k dispozici. {1} NOBUSINFO=1011, # (zjištění polohy vlaku:) Poloha vlaku není k dispozici. Zkuste to prosím později. TRAINPOSITION=1012, # (zjištění polohy spoje:) Poloha spoje není k dispozici. Zkuste to prosím později. BUSPOSITION=1013, # (zjištění polohy spoje:) Chybný řetězec pro zjištění polohy spoje ({0}). DELAYQUERYSOURCE=1016, # (zjištění polohy spoje:) Prázdný řetězec pro zjištění polohy spoje. DELAYQUERYSOURCEEMPTY=1017, # (info o mimořádnosti nebo výluce:) Chybný řetězec pro zjištění informace o mimořádnosti nebo výluce ({0}). EXCLUSIONQUERYSOURCE=1030, # (info o mimořádnosti nebo výluce:) Prázdný řetězec pro zjištění informace o mimořádnosti nebo výluce. EXCLUSIONQUERYSOURCEEMPTY=1031, # (info o mimořádnosti nebo výluce:) Informace o mimořádnosti nebo výluce {0} nejsou k dispozici. {1} NOEXCLUSIONINFO=1032, # (info o mimořádnosti nebo výluce:) Informace o mimořádnosti nebo výluce nejsou k dispozici. Zkuste to prosím později. EXCLUSIONINFO=1033, # obecna chyba, zkuste pozdeji TRYLATER=1020, ) # bitove priznaky ke stanicim ST = enum( CHANGE=0x1, # prestupni stanice INTL=0x2, # zahranicni stanice REG=0x4, # vkladat region do nazvu STATE=0x8, # vkladat stat do nazvu RESERV=0x10, # ve stanici pojizdi vlak s rezervacemi EXTERNLINK=0x20, # obsahuje externi hrany PREFCHANGE=0x40, # preferovany prestupni bod CAPITAL=0x80, # je v hlavnim meste statu REGION2=0x100, # je v krajskem meste REGION3=0x200, # je v okresnim meste LOWDECK=0x400, # bezbarierova TERM=0x800, # konecna SKIP_CITY=0x1000, # nezahrnovat do obce PPS=0x2000, # vlakova PPS GC=0x4000, # ma garantovane prestupy LOWDECK_CHANGE=0x8000 # bezbarierova pro prestup ) # rezimy vkladani regionu (stat,okres) do nazvu REG = enum( SMART=0, # vkladat regiony dle potreby ALWAYS=1, # vkladat regiony i staty vzdy NO=2, # nevkladat nikdy ALWAYS_SMART=3, # vkladat regiony vzdy, jsou-li k dispozici ALWAYS_REDUCED=4 # vkladat regiony vzdy, staty skryvat vzdy, je-li region k dispozici ) # priznaky kombinace jizdnich radu COMBFLAGS = enum( # krajske mesto REGION=1 << 0, # IDS IDS=1 << 1, # pouzit jako vychozi nazev kombinace zkracenou verzi BRIEF_NAME=1 << 2, # nenabizet v panelu nabidek HIDE=1 << 3, # lze pozadovat zadani adresy HAS_ADDRESS=1 << 4, # nahrat kombinaci, i kdyz je prosla LOAD_OLD=1 << 5, # pripravit dopredu graf site pro pokryti BUILD_GRAPH=1 << 6 ) # priznaky jednotliveho jizdniho radu TIMETABLE_FLAGS = enum( # k dispozici jsou data o souradnicich zastavek HAS_MAP=1 << 0, # k dispozici jsou data o vedeni spoju mezi zastavkami (z priznaku vyplyva i HAS_MAP) HAS_ARCS=1 << 1, # k dispozici je graf pokryti site (z priznaku vyplyva i HAS_ARCS) HAS_COVER=1 << 2, ) # zpusob hledani v globalnim seznamu objektu SEARCHMODE = enum( NONE=0, # prazdny priznak EXACT=1 << 0, # vracet pri presne shode jen ji CITY_AND_PART=1 << 1, # navic pri presne shode obce hledat jeste presnou shodu casti (plati jen ve spojeni s EXACT) SCAN_ALL_LISTS=1 << 2, # prochazet vsechny seznamy do vycerpani max. poctu NO_ADD_EQUAL=1 << 3, # nepridavat objekt z dalsiho seznamu, pokud se mapuje do stejnych zastavek # jako jiz pridany se stejnym jmenem z drivejsiho seznamu SCAN_ALL_LEVELS=1 << 4, # hledat shodu se zadanou maskou od zacatku, # pokud nenaplnim pozadovany pocet, tak od druheho slova, atd. SORT_LIST_ID=1 << 5, # tridit po seznamech (plati jen ve spojeni s SCAN_ALL_LEVELS) # normalne je shoda na nultem slove ve vsech seznamech, pak na prvnim slove ve vsech seznamech, atd. SKIP_CITY_ALIAS=1 << 6, # pokud je to mozne, nezarazovat aliasy obci a casti obci ALLOW_ADDRESS=1 << 7, # je-li konfigurovan pristup k serveru adres, zkus na zaver resit jeste jako adresu # aplikuje se jen v pripade, ze se hleda bez omezeni na konkretni seznam nebo s omezenim na seznam LISTID.ADDRESS # a soucasne prislusna kombinace JR adresy pripousti USE_PRIORITY=1 << 8, # pouzit prioritni nabidku (aplikuje se jen pri hledani, ktere neni omezeno na jeden seznam, tj. iListID==0) FORCE_ADDRESS_REG=1 << 9, # pozadovat od serveru adres, aby okres daval za nazvem obce nebo casti vzdy a nikoli jen v pripade nejednoznacnosti nazvu # - je to nutnost v pripade pouziti priznaku TTINFODETAILS.REGION_ITEM_ALWAYS # - nasledne lze ovsem okres vymazat pomoci TTINFODETAILS.REGION_DELETE # - server adres vraci v tomto pripade zavazne okresy a velkymi pismeny a nezavazne malymi CHECK_UNIQUE_ONLY=1 << 10, # ma smysl jen ve spojeni s vyhledavanim do ObjectsInfo, je-li zapnuto, tak se # - v pripade, za masce hovi vice moznosti, vrati se v ObjectsInfo.aoMasks hodnota null a v iStatus se vrati STATUS_NOT_UNIQUE # - dale pak v pripade, ze maska je jednoznacna a iTTInfoDetails je nenulove, vyplni take ObjectsInfo.oTimetableObject NO_ADD_EQUAL_NAME=1 << 11, # nepridavat objekt z dalsiho seznamu se stejnym nazvem USE_COOR_VICINITY=1 << 12 # vracet body v blizkosti souradnice # - souradnice pro hledani se zadava jako soucast masky za znakem § # - interni priznak, jeho nastaveni na vstupu se ignoruje ) # masky poznamek ke spojum REMMASK = enum( NONE=0, # prazdna maska LINE_NAME=0x1, # nazev linky OWNER=0x2, # dopravce DATE=0x4, # datumove omezeni INFO=0x8, # informacni poznamka INFO_IMPORTANT=0x10, # dulezita informacni poznamka LINE=0x20, # informacni poznamka k lince RESERV=0x40, # poznamka o povinne rezervaci RESERV2=0x80, # poznamka o volitelne rezervaci DIRECTCARS=0x100, # poznamka o primem voze OWNER_WWW=0x200, # je-li zadana (a soucasne i OWNER), # tak se do nazvu dopravce nageneruje link na www dopravce DATE_FLAGS=0x400, # vratit take umelou poznamku z datumovych vlajek # je nezavisla na ostatnich maskach OWNER_NUM=0x800, # je-li zadana (a soucasne i OWNER), # tak se misto nazvu dopravce nageneruje jeho cislo EXCLUSION=0x1000, # informace o vyluce EXCLUSION_DATA=0x2000, # informace o vyluce jako data # polozky oddelene znakem pipe: # 0 - trat # 1 - usek # 2 - priznak, ze vyluka je PRED spojenim (0 nebo 1) # 3 - index pocatecni stanice do drahy spoje nebo -1 u spojeni # 4 - index koncove stanice do drahy spoje nebo -1 u spojeni # 5 - ID vyluky, ID opatreni, datum - parametry pro ziskani podrobnosti o vyluce (oddelovac carka) EXCEPTION_DATA=0x4000, # informace o mimoradnosti jako data # polozky odde)lene znakem pipe: # 0 - trat # 1 - usek # 2 - pricina # 3 - datum a cas platnosti od # 4 - datum a cas platnosti do # 5 - datum a cas aktualizace zaznamu o mimoradnosti # 6 - priznak, ze mimoradnost je PRED spojenim (0 nebo 1) # 7 - index pocatecni stanice do drahy spoje nebo -1 u spojeni # 8 - index koncove stanice do drahy spoje nebo -1 u spojeni # 9 - ID mimoradnosti - parametr pro ziskani podrobnosti o mimoradnosti DELAY_QUERY=0x8000, # dotaz na polohu vlaku pro nasledne volani funkce DelayQuery AUX_DESC=0x10000, # popis vlaku pro nasledne volani funkce MapTrainDataInfoAuxDesc nebo MapConnectionAuxDesc # (vlozi se referencni usek dle dotazu) AUX_DESC_FULL=0x20000, # popis vlaku pro nasledne volani funkce MapTrainDataInfoAuxDesc nebo MapConnectionAuxDesc # (vlozi se usek za celou drahu vlaku) # veskere informacni poznamky ALLINFO=0x8 | 0x10 | 0x20 | 0x40 | 0x80 | 0x100 | 0x1000, # ...navic nazev linky, doprace a datumove omezeni ALL=0x1 | 0x2 | 0x4 | 0x8 | 0x10 | 0x20 | 0x40 | 0x80 | 0x100 | 0x1000, ) # priznaky typu spoje (viz. TrainInfo.iFlags) # (mohou byt pouzity i dalsi bity, zde jsou vyvedeny vybrane staticke hodnoty) VF = enum( INTLONLY=0x80000000, # vnitrostatni preprava vyloucena INTL=0x40000000, # mezinarodni spoj (ne ciste domaci) VAR=0x10000000, # varianta vlaku CARS=0x8000000, # primy vuz HASBEDS=0x2000000, # veze take lehatka nebo luzka HASONLYBEDS=0x1000000, # veze jen lehatka nebo luzka RESERV=0x800000, # je predmetem rezervace NOLINEDIR=0x400000, # nepouzivat pro generovani vedeni linky LINEDIRBACK=0x200000, # jede smerem ZPET LOWDECK=0x100000 # nizkopodlazni spoj (bezbarierovy pristup) ) # priznaky na draze ROUTE_FLAGS = enum( EMPTY=0, # prazdna hodnota NO_EXIT=1 << 0, # neni vystup NO_ENTER=1 << 1, # neni nastup PARA=1 << 2, # priznak paragraf ZOLL=1 << 3, # hranicni bod (zde v zasade jen indikuje, ze neni nastup ani vystup) CHANGE_INFO=1 << 4, # priznak, ze k zastaveni se vaze omezeni prestupu REMARK=1 << 5, # priznak, za k zastaveni je poznamka PPS=1 << 6 # vlakova pohranicni prechodova stanice (zastaveni je neverejne a tedy by se nemelo zobrazovat) ) # absolutni pevne kody pro hledani spojeni FCS = enum( WHEELCHAIR=1, # pro cestující na vozíku CHILDREN=2, # pro cestující s dětmi BIKE=3, # pro cestující s kolem CD=4, # vlak Českých drah NOT_HISTORICAL=5, # není zvláštní historický vlak CD_ONLY=6, # vlak ČD a smluvních dopravců NOT_RESERVE=7 # vlak bez povinne rezervace ) # souradnicove systemy pro vzajemnou konverzi COOR = enum( EMPTY= -1, S42=0, JTSK=1, UTM=2, WGS84=3, # svetove souradnice v radianech (jako X je zde zem. delka a jako Y pak sirka) WGS84_D=4, # svetove souradnice ve stupnich (jako X je zde zem. sirka a jako Y pak delka) MERCATOR=5, PUWG_2000=6, DEFAULT=4 # souradny system, v kterem jsou drzena data v pameti ) # navratovy typ pro hledani spojeni/odjezdu/ZJR (hodnota iResult) EXFUNCTIONRESULT = enum( OK=0, # vyhledane objekty byly unikatni a postoupilo se tedy ke hledani spojeni/odjezdu/ZJR a ziskaly se nejake vysledky NOT_FOUND=1 << 0, # vyhledane objekty byly unikatni a postoupilo se tedy ke hledani spojeni/odjezdu/ZJR, avsak nic se nenaslo DATE_OUT_OF_RANGE=1 << 1, # datum pro hledani je mimo pripustny rozsah FROM_TO_OVERLAP=1 << 4, # prekryti Z/Pres/Do (stejne objekty) FROM_ERROR=1 << 5, # chyba hledani Z (masce neodpovida zadny objekt) FROM_NOT_UNIQUE=1 << 6, # vyhledany nejake objekty Z, ale zadani neni jednoznacne FROM_MISSING=1 << 7, # Z chybi a dle kontextu by melo byt pritomne FROM_BAD=1 << 8, # k Z nebyly nalezeny zadne pouzitelne stanice, viz ObjectsInfo.iStatus TO_ERROR=1 << 10, # chyba hledani Do (masce neodpovida zadny objekt) TO_NOT_UNIQUE=1 << 11, # vyhledany nejake objekty Do, ale zadani neni jednoznacne TO_MISSING=1 << 12, # Do chybi a dle kontextu by melo byt pritomne TO_BAD=1 << 13, # k Do nebyly nalezeny zadne pouzitelne stanice, viz ObjectsInfo.iStatus VIA_ERROR=1 << 15, # chyba hledani Pres (masce neodpovida zadny objekt) VIA_NOT_UNIQUE=1 << 16, # vyhledany nejake objekty Pres, ale zadani neni jednoznacne VIA_MISSING=1 << 17, # Pres chybi a dle kontextu by melo byt pritomne VIA_BAD=1 << 18, # k Pres nebyly nalezeny zadne pouzitelne stanice, viz ObjectsInfo.iStatus CHANGE_ERROR=1 << 20, # chyba hledani Prestup (masce neodpovida zadny objekt) CHANGE_NOT_UNIQUE=1 << 21, # vyhledany nejake objekty Prestup, ale zadani neni jednoznacne CHANGE_MISSING=1 << 22, # Prestup chybi a dle kontextu by melo byt pritomne CHANGE_BAD=1 << 23, # k Prestup nebyly nalezeny zadne pouzitelne stanice, viz ObjectsInfo.iStatus ) # typ odchylky od nejkratsi cesty DELTAMAX = enum( NO=0, # nezadana PERCENT=1, # v procentech METERS=2 # v metrech ) # priznak pouziti lehatek/luzek BEDS = enum( USEANY=0, # pouzivat bez omezeni ONLYBEDS=1, # cestovat pouze s lehatkem/luzkem NOBEDS=2 # pouze mista k sezeni ) # stav reseni objektu v ObjectsInfo OBJECT_STATUS = enum( # objekt je v poradku OK=0, # zadny objekt dle masky nebyl nalezen NOT_FOUND=1, # indikuje, ze nabidka objektu neni jednoznacna NOT_UNIQUE=2, # indikuje, ze k prislusne souradnici nejsou v blizkosti zastavky pro hledani spojeni COOR_BAD=3, # indikuje, ze k prislusnemu objektu nejsou zastavky pro hledani spojeni # (mozne priciny - jizdni rad v dany den jizdy neplati # nebo nesplnuji omezeni na bezbarierovy pristup # nebo bylo zadano omezeni na dopravni prostredky a zadne na objektu nestoji) OBJECT_BAD=4 ) # globalni priznak k napocitanemu jizdnemu TTGP = enum( ALL_OK=0, # cena je k dispozici pro cely usek PART_OK=1, # cena je k dispozici pro cast cesty MISSING=2 # cena chybi ) # vycet stavu pro sluzbu poloha spoje SVCSTATE = enum( CRSERVER= -1, # vraci primo CRServer CZ=0, SK=1, TELMAX1=2, MAX=1 # jen pro pohodli kodu ) # priznaky odjezdove tabule DEP_TABLE = enum( SHOW_STAND=1 << 0, # zobrazovat pole pro nastupiste/stanoviste (i kdyz v konkretnim vystupu nemusi byt zadano) SHOW_TRACK=1 << 1, # zobrazovat pole pro kolej (i kdyz v konkretnim vystupu nemusi byt zadana) BUILT_FROM_TT=1 << 2, # vyrobena na zaklade jizdniho radu (nebyla primo importovana) POS_USED=1 << 3 # pri sestaveni byly pro prislusny jizdni rad k dispozici polohy (zpozdeni) spoju # (tento priznak muze byt pouzit jen soucasne s BUILT_FROM_TT) ) # ruzne konstanty class CRCONST: # zdroje zpozdeni # Ceske drahy DELAY_CD = "CD:" # ZSR DELAY_ZSR = "ZSR:" # TELMAX DELAY_TELMAX1 = "TELMAX1:" # interni zpozdeni (vklada se take kategorie a podkategorie) DELAY_INTERN = "X{0}_{1}:" # rozsirene interni zpozdeni (vklada se take kategorie a podkategorie), # zde se daji oproti DELAY_INTERN nasledne zadat i rozsirene masky, odelovac mezi polozkami je vzdy carka DELAY_INTERN_EXT = "Y{0}_{1}:" # zdroje vyluk a mimoradnosti # Ceske drahy EXCEPTIONEXCLUSION_CD = "CD:"

47.527211

164

0.686431

5b1e251e4bad0c54f3b506360177143da63c29d4

5,466

py

Python

pajbot/modules/lastfm.py

JoachimFlottorp/pajbot

4fb88c403dedb20d95be80e38da72be1ed064901

[ "MIT" ]

128

2015-12-28T01:02:30.000Z

2019-05-24T21:20:50.000Z

pajbot/modules/lastfm.py

JoachimFlottorp/pajbot

4fb88c403dedb20d95be80e38da72be1ed064901

[ "MIT" ]

277

2015-05-03T18:48:57.000Z

2019-05-23T17:41:28.000Z

pajbot/modules/lastfm.py

JoachimFlottorp/pajbot

4fb88c403dedb20d95be80e38da72be1ed064901

[ "MIT" ]

96

2015-08-07T18:49:50.000Z

2019-05-20T19:49:27.000Z

import logging from pajbot.models.command import Command, CommandExample from pajbot.modules import BaseModule, ModuleSetting from pajbot.streamhelper import StreamHelper log = logging.getLogger(__name__) class LastfmModule(BaseModule): ID = __name__.split(".")[-1] NAME = "LastFM module" DESCRIPTION = "This uses the LastFM api to fetch the current artist and songname that the streamer is listening to on spotify or youtube." CATEGORY = "Feature" SETTINGS = [ ModuleSetting( key="api_key", label="LastFM Api Key", type="text", required=True, placeholder="i.e. abcedfg1235hfhafafajhf", default="", ), ModuleSetting( key="username", label="LastFM Username", type="text", required=True, placeholder="i.e. anniefuchsia", default="", ), ModuleSetting( key="no_song", label="Message to send when no song is playing | Available arguments: {source}, {streamer}", type="text", required=True, placeholder="{source}, {streamer} isn't playing any music right now... FeelsBadMan", default="{source}, {streamer} isn't playing any music right now... FeelsBadMan", ), ModuleSetting( key="current_song", label="Message to send when a song is playing | Available arguments: {source}, {streamer}, {song}", type="text", required=True, placeholder="{source}, Current song is 🎵 🎶 {song} 🎶 🎵", default="{source}, Current song is 🎵 🎶 {song} 🎶 🎵", ), ModuleSetting( key="cannot_fetch_song", label="Message to send when unable to fetch the song | Availably arguments: {source}", type="text", required=True, placeholder="{source}, I'm having trouble fetching the song name... Please try again FeelsBadMan", default="{source}, I'm having trouble fetching the song name... Please try again FeelsBadMan", ), ModuleSetting( key="global_cd", label="Global cooldown (seconds)", type="number", required=True, placeholder="", default=30, constraints={"min_value": 0, "max_value": 120}, ), ModuleSetting( key="user_cd", label="Per-user cooldown (seconds)", type="number", required=True, placeholder="", default=60, constraints={"min_value": 0, "max_value": 240}, ), ModuleSetting( key="online_only", label="Only allow the LastFM commands to be run while the stream is online", type="boolean", required=True, default=True, ), ] def load_commands(self, **options): # TODO: Aliases should be set in settings? # This way, it can be run alongside other modules self.commands["song"] = Command.raw_command( self.song, delay_all=self.settings["global_cd"], delay_user=self.settings["user_cd"], description="Check what that is playing on the stream", examples=[ CommandExample( None, "Check the current song", chat="user:!song\n" "bot: " + self.settings["current_song"].format( source="pajlada", streamer=StreamHelper.get_streamer(), song="Adele - Hello", ), description="Bot mentions the name of the song and the artist currently playing on stream", ).parse() ], ) self.commands["currentsong"] = self.commands["song"] self.commands["nowplaying"] = self.commands["song"] self.commands["playing"] = self.commands["song"] def song(self, bot, source, **rest): if self.settings["online_only"] and not self.bot.is_online: return False try: import pylast except ImportError: log.error("Missing required library for the LastFM Module: pylast") return False API_KEY = self.settings["api_key"] lastfmname = self.settings["username"] if len(API_KEY) < 10 or len(lastfmname) < 2: log.warning("You need to set up the Last FM API stuff in the Module settings.") return False try: network = pylast.LastFMNetwork(api_key=API_KEY, api_secret="", username=lastfmname, password_hash="") user = network.get_user(lastfmname) currentTrack = user.get_now_playing() if currentTrack is None: bot.me(self.settings["no_song"].format(source=source, streamer=self.bot.streamer_display)) else: bot.me( self.settings["current_song"].format( source=source, streamer=self.bot.streamer_display, song=currentTrack ) ) except pylast.WSError: log.error("LastFm username not found") except IndexError: bot.me(self.settings["cannot_fetch_song"].format(source=source))

37.696552

142

0.54775

f00e3d6bea506d4dd608e78520a24690393eddca

1,582

py

Python

deploy/shakenfist_ci/tests/test_system_namespace.py

shakenfist/shakenfist

fc8e5fec21bfc3f0ddb9952822c1a8dfdddcc546

[ "Apache-2.0" ]

24

2020-07-20T23:47:52.000Z

2022-02-10T05:12:01.000Z

deploy/shakenfist_ci/tests/test_system_namespace.py

shakenfist/shakenfist

fc8e5fec21bfc3f0ddb9952822c1a8dfdddcc546

[ "Apache-2.0" ]

637

2020-06-19T06:57:30.000Z

2022-03-31T08:58:54.000Z

deploy/shakenfist_ci/tests/test_system_namespace.py

shakenfist/shakenfist

fc8e5fec21bfc3f0ddb9952822c1a8dfdddcc546

[ "Apache-2.0" ]

7

2020-07-14T20:48:40.000Z

2021-12-18T10:06:51.000Z

import time from shakenfist_client import apiclient from shakenfist_ci import base class TestSystemNamespace(base.BaseTestCase): def test_system_namespace(self): self.assertEqual('system', self.system_client.namespace) net = self.system_client.allocate_network( '192.168.242.0/24', True, True, 'ci-system-net') nets = [] for n in self.system_client.get_networks(): nets.append(n['uuid']) self.assertIn(net['uuid'], nets) inst = self.system_client.create_instance( 'cirros', 1, 1024, [ { 'network_uuid': net['uuid'] } ], [ { 'size': 8, 'base': 'sf://upload/system/cirros', 'type': 'disk' } ], None, None) self.assertIsNotNone(inst['uuid']) self.assertIsNotNone(inst['node']) insts = [] for i in self.system_client.get_instances(): insts.append(i['uuid']) self.assertIn(inst['uuid'], insts) self.system_client.delete_instance(inst['uuid']) start_time = time.time() while time.time() - start_time < 300: if not list(self.system_client.get_instances()): break time.sleep(5) self.system_client.delete_network(net['uuid']) self.assertRaises( apiclient.ResourceCannotBeDeletedException, self.system_client.delete_namespace, None)

28.763636

64

0.536662

71a62f6b3b8b61350718210302532f2890cf9978

58,578

py

Python

sdk/storage/azure-storage-file-share/tests/test_file.py

tzhanl/azure-sdk-for-python

18cd03f4ab8fd76cc0498f03e80fbc99f217c96e

[ "MIT" ]

null

sdk/storage/azure-storage-file-share/tests/test_file.py

tzhanl/azure-sdk-for-python

18cd03f4ab8fd76cc0498f03e80fbc99f217c96e

[ "MIT" ]

null

sdk/storage/azure-storage-file-share/tests/test_file.py

tzhanl/azure-sdk-for-python

18cd03f4ab8fd76cc0498f03e80fbc99f217c96e

[ "MIT" ]

null

# coding: utf-8 # ------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See License.txt in the project root for # license information. # -------------------------------------------------------------------------- import base64 import os import unittest from datetime import datetime, timedelta import requests import pytest from azure.core import MatchConditions from azure.core.exceptions import HttpResponseError, ResourceNotFoundError, ResourceExistsError from azure.storage.fileshare import ( generate_account_sas, generate_file_sas, ShareFileClient, ShareServiceClient, ContentSettings, FileSasPermissions, AccessPolicy, ResourceTypes, AccountSasPermissions, StorageErrorCode, NTFSAttributes) from filetestcase import ( FileTestCase, TestMode, record, ) # ------------------------------------------------------------------------------ TEST_SHARE_PREFIX = 'share' TEST_DIRECTORY_PREFIX = 'dir' TEST_FILE_PREFIX = 'file' INPUT_FILE_PATH = 'file_input.temp.dat' OUTPUT_FILE_PATH = 'file_output.temp.dat' LARGE_FILE_SIZE = 64 * 1024 + 5 # ------------------------------------------------------------------------------ class StorageFileTest(FileTestCase): def setUp(self): super(StorageFileTest, self).setUp() url = self.get_file_url() credential = self.get_shared_key_credential() # test chunking functionality by reducing the threshold # for chunking and the size of each chunk, otherwise # the tests would take too long to execute self.fsc = ShareServiceClient(url, credential=credential, max_range_size=4 * 1024) self.share_name = self.get_resource_name('utshare') if not self.is_playback(): self.fsc.create_share(self.share_name) self.short_byte_data = self.get_random_bytes(1024) remote_url = self.get_remote_file_url() remote_credential = self.get_remote_shared_key_credential() self.fsc2 = ShareServiceClient(remote_url, credential=remote_credential) self.remote_share_name = None def tearDown(self): if not self.is_playback(): try: self.fsc.delete_share(self.share_name, delete_snapshots='include') except: pass if self.remote_share_name: try: self.fs2.delete_share(self.remote_share_name, delete_snapshots='include') except: pass if os.path.isfile(INPUT_FILE_PATH): try: os.remove(INPUT_FILE_PATH) except: pass if os.path.isfile(OUTPUT_FILE_PATH): try: os.remove(OUTPUT_FILE_PATH) except: pass return super(StorageFileTest, self).tearDown() # --Helpers----------------------------------------------------------------- def _get_file_reference(self): return self.get_resource_name(TEST_FILE_PREFIX) def _create_file(self, file_name=None): file_name = self._get_file_reference() if file_name is None else file_name share_client = self.fsc.get_share_client(self.share_name) file_client = share_client.get_file_client(file_name) file_client.upload_file(self.short_byte_data) return file_client def _create_empty_file(self, file_name=None, file_size=2048): file_name = self._get_file_reference() if file_name is None else file_name share_client = self.fsc.get_share_client(self.share_name) file_client = share_client.get_file_client(file_name) file_client.create_file(file_size) return file_client def _get_file_client(self): file_name = self._get_file_reference() share_client = self.fsc.get_share_client(self.share_name) file_client = share_client.get_file_client(file_name) return file_client def _create_remote_share(self): self.remote_share_name = self.get_resource_name('remoteshare') remote_share = self.fsc2.get_share_client(self.remote_share_name) try: remote_share.create_share() except ResourceExistsError: pass return remote_share def _create_remote_file(self, file_data=None): if not file_data: file_data = b'12345678' * 1024 * 1024 source_file_name = self._get_file_reference() remote_share = self.fsc2.get_share_client(self.remote_share_name) remote_file = remote_share.get_file_client(source_file_name) remote_file.upload_file(file_data) return remote_file def _wait_for_async_copy(self, share_name, file_path): count = 0 share_client = self.fsc.get_share_client(share_name) file_client = share_client.get_file_client(file_path) properties = file_client.get_file_properties() while properties.copy.status != 'success': count = count + 1 if count > 10: self.fail('Timed out waiting for async copy to complete.') self.sleep(6) properties = file_client.get_file_properties() self.assertEqual(properties.copy.status, 'success') def assertFileEqual(self, file_client, expected_data): actual_data = file_client.download_file().readall() self.assertEqual(actual_data, expected_data) class NonSeekableFile(object): def __init__(self, wrapped_file): self.wrapped_file = wrapped_file def write(self, data): self.wrapped_file.write(data) def read(self, count): return self.wrapped_file.read(count) # --Test cases for files ---------------------------------------------- @record def test_make_file_url(self): # Arrange share = self.fsc.get_share_client("vhds") file_client = share.get_file_client("vhd_dir/my.vhd") # Act res = file_client.url # Assert self.assertEqual(res, 'https://' + self.settings.STORAGE_ACCOUNT_NAME + '.file.core.windows.net/vhds/vhd_dir/my.vhd') @record def test_make_file_url_no_directory(self): # Arrange share = self.fsc.get_share_client("vhds") file_client = share.get_file_client("my.vhd") # Act res = file_client.url # Assert self.assertEqual(res, 'https://' + self.settings.STORAGE_ACCOUNT_NAME + '.file.core.windows.net/vhds/my.vhd') @record def test_make_file_url_with_protocol(self): # Arrange url = self.get_file_url().replace('https', 'http') fsc = ShareServiceClient(url, credential=self.settings.STORAGE_ACCOUNT_KEY) share = fsc.get_share_client("vhds") file_client = share.get_file_client("vhd_dir/my.vhd") # Act res = file_client.url # Assert self.assertEqual(res, 'http://' + self.settings.STORAGE_ACCOUNT_NAME + '.file.core.windows.net/vhds/vhd_dir/my.vhd') @record def test_make_file_url_with_sas(self): # Arrange sas = '?sv=2015-04-05&st=2015-04-29T22%3A18%3A26Z&se=2015-04-30T02%3A23%3A26Z&sr=b&sp=rw&sip=168.1.5.60-168.1.5.70&spr=https&sig=Z%2FRHIX5Xcg0Mq2rqI3OlWTjEg2tYkboXr1P9ZUXDtkk%3D' file_client = ShareFileClient( self.get_file_url(), share_name="vhds", file_path="vhd_dir/my.vhd", credential=sas ) # Act res = file_client.url # Assert self.assertEqual(res, 'https://' + self.settings.STORAGE_ACCOUNT_NAME + '.file.core.windows.net/vhds/vhd_dir/my.vhd{}'.format(sas)) @record def test_create_file(self): # Arrange file_name = self._get_file_reference() file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) # Act resp = file_client.create_file(1024, file_attributes="hidden") # Assert props = file_client.get_file_properties() self.assertIsNotNone(props) self.assertEqual(props.etag, resp['etag']) self.assertEqual(props.last_modified, resp['last_modified']) @record def test_create_file_with_metadata(self): # Arrange metadata = {'hello': 'world', 'number': '42'} file_name = self._get_file_reference() file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) # Act resp = file_client.create_file(1024, metadata=metadata) # Assert props = file_client.get_file_properties() self.assertIsNotNone(props) self.assertEqual(props.etag, resp['etag']) self.assertEqual(props.last_modified, resp['last_modified']) self.assertDictEqual(props.metadata, metadata) def test_create_file_when_file_permission_is_too_long(self): file_client = self._get_file_client() permission = str(self.get_random_bytes(8 * 1024 + 1)) with self.assertRaises(ValueError): file_client.create_file(1024, file_permission=permission) @record def test_create_file_with_invalid_file_permission(self): # Arrange file_name = self._get_file_client() with self.assertRaises(HttpResponseError): file_name.create_file(1024, file_permission="abcde") @record def test_create_file_will_set_all_smb_properties(self): # Arrange file_client = self._get_file_client() # Act file_client.create_file(1024) file_properties = file_client.get_file_properties() # Assert self.assertIsNotNone(file_properties) self.assertIsNotNone(file_properties.change_time) self.assertIsNotNone(file_properties.creation_time) self.assertIsNotNone(file_properties.file_attributes) self.assertIsNotNone(file_properties.last_write_time) @record def test_file_exists(self): # Arrange file_client = self._create_file() # Act exists = file_client.get_file_properties() # Assert self.assertTrue(exists) @record def test_file_not_exists(self): # Arrange file_name = self._get_file_reference() file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path="missingdir/" + file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) # Act with self.assertRaises(ResourceNotFoundError): file_client.get_file_properties() # Assert @record def test_file_exists_with_snapshot(self): # Arrange file_client = self._create_file() share_client = self.fsc.get_share_client(self.share_name) snapshot = share_client.create_snapshot() file_client.delete_file() # Act snapshot_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_client.file_name, snapshot=snapshot, credential=self.settings.STORAGE_ACCOUNT_KEY) props = snapshot_client.get_file_properties() # Assert self.assertTrue(props) @record def test_file_not_exists_with_snapshot(self): # Arrange share_client = self.fsc.get_share_client(self.share_name) snapshot = share_client.create_snapshot() file_client = self._create_file() # Act snapshot_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_client.file_name, snapshot=snapshot, credential=self.settings.STORAGE_ACCOUNT_KEY) # Assert with self.assertRaises(ResourceNotFoundError): snapshot_client.get_file_properties() @record def test_resize_file(self): # Arrange file_client = self._create_file() # Act file_client.resize_file(5) # Assert props = file_client.get_file_properties() self.assertEqual(props.size, 5) @record def test_set_file_properties(self): # Arrange file_client = self._create_file() # Act content_settings = ContentSettings( content_language='spanish', content_disposition='inline') resp = file_client.set_http_headers(content_settings=content_settings) # Assert properties = file_client.get_file_properties() self.assertEqual(properties.content_settings.content_language, content_settings.content_language) self.assertEqual(properties.content_settings.content_disposition, content_settings.content_disposition) self.assertIsNotNone(properties.last_write_time) self.assertIsNotNone(properties.creation_time) self.assertIsNotNone(properties.permission_key) @record def test_set_file_properties_with_file_permission(self): # Arrange file_client = self._create_file() properties_on_creation = file_client.get_file_properties() content_settings = ContentSettings( content_language='spanish', content_disposition='inline') ntfs_attributes = NTFSAttributes(archive=True, temporary=True) last_write_time = properties_on_creation.last_write_time + timedelta(hours=3) creation_time = properties_on_creation.creation_time + timedelta(hours=3) # Act file_client.set_http_headers( content_settings=content_settings, file_attributes=ntfs_attributes, file_last_write_time=last_write_time, file_creation_time=creation_time, ) # Assert properties = file_client.get_file_properties() self.assertEqual(properties.content_settings.content_language, content_settings.content_language) self.assertEqual(properties.content_settings.content_disposition, content_settings.content_disposition) self.assertEqual(properties.creation_time, creation_time) self.assertEqual(properties.last_write_time, last_write_time) self.assertIn("Archive", properties.file_attributes) self.assertIn("Temporary", properties.file_attributes) @record def test_get_file_properties(self): # Arrange file_client = self._create_file() # Act properties = file_client.get_file_properties() # Assert self.assertIsNotNone(properties) self.assertEqual(properties.size, len(self.short_byte_data)) @record def test_get_file_properties_with_snapshot(self): # Arrange file_client = self._create_file() metadata = {"test1": "foo", "test2": "bar"} file_client.set_file_metadata(metadata) share_client = self.fsc.get_share_client(self.share_name) snapshot = share_client.create_snapshot() metadata2 = {"test100": "foo100", "test200": "bar200"} file_client.set_file_metadata(metadata2) # Act file_props = file_client.get_file_properties() snapshot_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_client.file_name, snapshot=snapshot, credential=self.settings.STORAGE_ACCOUNT_KEY) snapshot_props = snapshot_client.get_file_properties() # Assert self.assertIsNotNone(file_props) self.assertIsNotNone(snapshot_props) self.assertEqual(file_props.size, snapshot_props.size) self.assertDictEqual(metadata, snapshot_props.metadata) @record def test_get_file_metadata_with_snapshot(self): # Arrange file_client = self._create_file() metadata = {"test1": "foo", "test2": "bar"} file_client.set_file_metadata(metadata) share_client = self.fsc.get_share_client(self.share_name) snapshot = share_client.create_snapshot() snapshot_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_client.file_name, snapshot=snapshot, credential=self.settings.STORAGE_ACCOUNT_KEY) metadata2 = {"test100": "foo100", "test200": "bar200"} file_client.set_file_metadata(metadata2) # Act file_metadata = file_client.get_file_properties().metadata file_snapshot_metadata = snapshot_client.get_file_properties().metadata # Assert self.assertDictEqual(metadata2, file_metadata) self.assertDictEqual(metadata, file_snapshot_metadata) @record def test_get_file_properties_with_non_existing_file(self): # Arrange file_name = self._get_file_reference() file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) # Act with self.assertRaises(ResourceNotFoundError): file_client.get_file_properties() # Assert @record def test_get_file_metadata(self): # Arrange file_client = self._create_file() # Act md = file_client.get_file_properties().metadata # Assert self.assertIsNotNone(md) self.assertEqual(0, len(md)) @record def test_set_file_metadata_with_upper_case(self): # Arrange metadata = {'hello': 'world', 'number': '42', 'UP': 'UPval'} file_client = self._create_file() # Act file_client.set_file_metadata(metadata) # Assert md = file_client.get_file_properties().metadata self.assertEqual(3, len(md)) self.assertEqual(md['hello'], 'world') self.assertEqual(md['number'], '42') self.assertEqual(md['UP'], 'UPval') self.assertFalse('up' in md) @record def test_delete_file_with_existing_file(self): # Arrange file_client = self._create_file() # Act file_client.delete_file() # Assert with self.assertRaises(ResourceNotFoundError): file_client.get_file_properties() @record def test_delete_file_with_non_existing_file(self): # Arrange file_name = self._get_file_reference() file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) # Act with self.assertRaises(ResourceNotFoundError): file_client.delete_file() # Assert @record def test_update_range(self): # Arrange file_client = self._create_file() # Act data = b'abcdefghijklmnop' * 32 file_client.upload_range(data, offset=0, length=512) # Assert content = file_client.download_file().readall() self.assertEqual(len(data), 512) self.assertEqual(data, content[:512]) self.assertEqual(self.short_byte_data[512:], content[512:]) @record def test_update_range_with_md5(self): # Arrange file_client = self._create_file() # Act data = b'abcdefghijklmnop' * 32 file_client.upload_range(data, offset=0, length=512, validate_content=True) # Assert @record def test_update_range_from_file_url_when_source_file_does_not_have_enough_bytes(self): # Arrange source_file_name = 'testfile1' source_file_client = self._create_file(source_file_name) destination_file_name = 'filetoupdate' destination_file_client = self._create_file(destination_file_name) # generate SAS for the source file sas_token_for_source_file = generate_file_sas( source_file_client.account_name, source_file_client.share_name, source_file_client.file_path, source_file_client.credential.account_key, ) source_file_url = source_file_client.url + '?' + sas_token_for_source_file # Act with self.assertRaises(HttpResponseError): # when the source file has less bytes than 2050, throw exception destination_file_client.upload_range_from_url(source_file_url, offset=0, length=2050, source_offset=0) @record def test_update_range_from_file_url(self): # Arrange source_file_name = 'testfile' source_file_client = self._create_file(file_name=source_file_name) data = b'abcdefghijklmnop' * 32 resp = source_file_client.upload_range(data, offset=0, length=512) destination_file_name = 'filetoupdate' destination_file_client = self._create_empty_file(file_name=destination_file_name) # generate SAS for the source file sas_token_for_source_file = generate_file_sas( source_file_client.account_name, source_file_client.share_name, source_file_client.file_path, source_file_client.credential.account_key, FileSasPermissions(read=True), expiry=datetime.utcnow() + timedelta(hours=1)) source_file_url = source_file_client.url + '?' + sas_token_for_source_file # Act destination_file_client.upload_range_from_url(source_file_url, offset=0, length=512, source_offset=0, source_etag=resp['etag'], source_match_condition=MatchConditions.IfNotModified) # Assert # To make sure the range of the file is actually updated file_ranges = destination_file_client.get_ranges() file_content = destination_file_client.download_file(offset=0, length=512).readall() self.assertEquals(1, len(file_ranges)) self.assertEquals(0, file_ranges[0].get('start')) self.assertEquals(511, file_ranges[0].get('end')) self.assertEquals(data, file_content) @record def test_update_big_range_from_file_url(self): # Arrange source_file_name = 'testfile1' end = 1048575 source_file_client = self._create_empty_file(file_name=source_file_name, file_size=1024 * 1024) data = b'abcdefghijklmnop' * 65536 source_file_client.upload_range(data, offset=0, length=end+1) destination_file_name = 'filetoupdate1' destination_file_client = self._create_empty_file(file_name=destination_file_name, file_size=1024 * 1024) # generate SAS for the source file sas_token_for_source_file = generate_file_sas( source_file_client.account_name, source_file_client.share_name, source_file_client.file_path, source_file_client.credential.account_key, FileSasPermissions(read=True), expiry=datetime.utcnow() + timedelta(hours=1)) source_file_url = source_file_client.url + '?' + sas_token_for_source_file # Act destination_file_client.upload_range_from_url(source_file_url, offset=0, length=end+1, source_offset=0) # Assert # To make sure the range of the file is actually updated file_ranges = destination_file_client.get_ranges() file_content = destination_file_client.download_file(offset=0, length=end + 1).readall() self.assertEquals(1, len(file_ranges)) self.assertEquals(0, file_ranges[0].get('start')) self.assertEquals(end, file_ranges[0].get('end')) self.assertEquals(data, file_content) @record def test_clear_range(self): # Arrange # TODO: update swagger and fix this test pytest.skip("TODO: fix swagger!") file_client = self._create_file() # Act resp = file_client.clear_range(offset=0, length=512) # Assert content = file_client.download_file().readall() self.assertEqual(b'\x00' * 512, content[:512]) self.assertEqual(self.short_byte_data[512:], content[512:]) @record def test_update_file_unicode(self): # Arrange file_client = self._create_file() # Act data = u'abcdefghijklmnop' * 32 file_client.upload_range(data, offset=0, length=512) encoded = data.encode('utf-8') # Assert content = file_client.download_file().readall() self.assertEqual(encoded, content[:512]) self.assertEqual(self.short_byte_data[512:], content[512:]) # Assert @record def test_list_ranges_none(self): # Arrange file_name = self._get_file_reference() file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) file_client.create_file(1024) # Act ranges = file_client.get_ranges() # Assert self.assertIsNotNone(ranges) self.assertEqual(len(ranges), 0) @record def test_list_ranges_2(self): # Arrange file_name = self._get_file_reference() file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) file_client.create_file(2048) data = b'abcdefghijklmnop' * 32 resp1 = file_client.upload_range(data, offset=0, length=512) resp2 = file_client.upload_range(data, offset=1024, length=512) # Act ranges = file_client.get_ranges() # Assert self.assertIsNotNone(ranges) self.assertEqual(len(ranges), 2) self.assertEqual(ranges[0]['start'], 0) self.assertEqual(ranges[0]['end'], 511) self.assertEqual(ranges[1]['start'], 1024) self.assertEqual(ranges[1]['end'], 1535) @record def test_list_ranges_none_from_snapshot(self): # Arrange file_name = self._get_file_reference() file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) file_client.create_file(1024) share_client = self.fsc.get_share_client(self.share_name) snapshot = share_client.create_snapshot() snapshot_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_client.file_name, snapshot=snapshot, credential=self.settings.STORAGE_ACCOUNT_KEY) file_client.delete_file() # Act ranges = snapshot_client.get_ranges() # Assert self.assertIsNotNone(ranges) self.assertEqual(len(ranges), 0) @record def test_list_ranges_2_from_snapshot(self): # Arrange file_name = self._get_file_reference() file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) file_client.create_file(2048) data = b'abcdefghijklmnop' * 32 resp1 = file_client.upload_range(data, offset=0, length=512) resp2 = file_client.upload_range(data, offset=1024, length=512) share_client = self.fsc.get_share_client(self.share_name) snapshot = share_client.create_snapshot() snapshot_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_client.file_name, snapshot=snapshot, credential=self.settings.STORAGE_ACCOUNT_KEY) file_client.delete_file() # Act ranges = snapshot_client.get_ranges() # Assert self.assertIsNotNone(ranges) self.assertEqual(len(ranges), 2) self.assertEqual(ranges[0]['start'], 0) self.assertEqual(ranges[0]['end'], 511) self.assertEqual(ranges[1]['start'], 1024) self.assertEqual(ranges[1]['end'], 1535) @record def test_copy_file_with_existing_file(self): # Arrange source_client = self._create_file() file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path='file1copy', credential=self.settings.STORAGE_ACCOUNT_KEY) # Act copy = file_client.start_copy_from_url(source_client.url) # Assert self.assertIsNotNone(copy) self.assertEqual(copy['copy_status'], 'success') self.assertIsNotNone(copy['copy_id']) copy_file = file_client.download_file().readall() self.assertEqual(copy_file, self.short_byte_data) @record def test_copy_file_async_private_file(self): # Arrange self._create_remote_share() source_file = self._create_remote_file() # Act target_file_name = 'targetfile' file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=target_file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) with self.assertRaises(HttpResponseError) as e: file_client.start_copy_from_url(source_file.url) # Assert self.assertEqual(e.exception.error_code, StorageErrorCode.cannot_verify_copy_source) @record def test_copy_file_async_private_file_with_sas(self): # Arrange data = b'12345678' * 1024 * 1024 self._create_remote_share() source_file = self._create_remote_file(file_data=data) sas_token = generate_file_sas( source_file.account_name, source_file.share_name, source_file.file_path, source_file.credential.account_key, permission=FileSasPermissions(read=True), expiry=datetime.utcnow() + timedelta(hours=1), ) source_url = source_file.url + '?' + sas_token # Act target_file_name = 'targetfile' file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=target_file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) copy_resp = file_client.start_copy_from_url(source_url) # Assert self.assertTrue(copy_resp['copy_status'] in ['success', 'pending']) self._wait_for_async_copy(self.share_name, target_file_name) actual_data = file_client.download_file().readall() self.assertEqual(actual_data, data) @record def test_abort_copy_file(self): # Arrange data = b'12345678' * 1024 * 1024 self._create_remote_share() source_file = self._create_remote_file(file_data=data) sas_token = generate_file_sas( source_file.account_name, source_file.share_name, source_file.file_path, source_file.credential.account_key, permission=FileSasPermissions(read=True), expiry=datetime.utcnow() + timedelta(hours=1), ) source_url = source_file.url + '?' + sas_token # Act target_file_name = 'targetfile' file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=target_file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) copy_resp = file_client.start_copy_from_url(source_url) self.assertEqual(copy_resp['copy_status'], 'pending') file_client.abort_copy(copy_resp) # Assert target_file = file_client.download_file() self.assertEqual(target_file.readall(), b'') self.assertEqual(target_file.properties.copy.status, 'aborted') @record def test_abort_copy_file_with_synchronous_copy_fails(self): # Arrange source_file = self._create_file() # Act target_file_name = 'targetfile' file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=target_file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) copy_resp = file_client.start_copy_from_url(source_file.url) with self.assertRaises(HttpResponseError): file_client.abort_copy(copy_resp) # Assert self.assertEqual(copy_resp['copy_status'], 'success') @record def test_unicode_get_file_unicode_name(self): # Arrange file_name = '啊齄丂狛狜' file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) file_client.upload_file(b'hello world') # Act content = file_client.download_file().readall() # Assert self.assertEqual(content, b'hello world') @record def test_file_unicode_data(self): # Arrange file_name = self._get_file_reference() file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) # Act data = u'hello world啊齄丂狛狜'.encode('utf-8') file_client.upload_file(data) # Assert content = file_client.download_file().readall() self.assertEqual(content, data) @record def test_file_unicode_data_and_file_attributes(self): # Arrange file_client = self._get_file_client() # Act data = u'hello world啊齄丂狛狜'.encode('utf-8') file_client.upload_file(data, file_attributes=NTFSAttributes(temporary=True)) # Assert content = file_client.download_file().readall() properties = file_client.get_file_properties() self.assertEqual(content, data) self.assertIn('Temporary', properties.file_attributes) @record def test_unicode_get_file_binary_data(self): # Arrange base64_data = 'AAECAwQFBgcICQoLDA0ODxAREhMUFRYXGBkaGxwdHh8gISIjJCUmJygpKissLS4vMDEyMzQ1Njc4OTo7PD0+P0BBQkNERUZHSElKS0xNTk9QUVJTVFVWV1hZWltcXV5fYGFiY2RlZmdoaWprbG1ub3BxcnN0dXZ3eHl6e3x9fn+AgYKDhIWGh4iJiouMjY6PkJGSk5SVlpeYmZqbnJ2en6ChoqOkpaanqKmqq6ytrq+wsbKztLW2t7i5uru8vb6/wMHCw8TFxsfIycrLzM3Oz9DR0tPU1dbX2Nna29zd3t/g4eLj5OXm5+jp6uvs7e7v8PHy8/T19vf4+fr7/P3+/wABAgMEBQYHCAkKCwwNDg8QERITFBUWFxgZGhscHR4fICEiIyQlJicoKSorLC0uLzAxMjM0NTY3ODk6Ozw9Pj9AQUJDREVGR0hJSktMTU5PUFFSU1RVVldYWVpbXF1eX2BhYmNkZWZnaGlqa2xtbm9wcXJzdHV2d3h5ent8fX5/gIGCg4SFhoeIiYqLjI2Oj5CRkpOUlZaXmJmam5ydnp+goaKjpKWmp6ipqqusra6vsLGys7S1tre4ubq7vL2+v8DBwsPExcbHyMnKy8zNzs/Q0dLT1NXW19jZ2tvc3d7f4OHi4+Tl5ufo6err7O3u7/Dx8vP09fb3+Pn6+/z9/v8AAQIDBAUGBwgJCgsMDQ4PEBESExQVFhcYGRobHB0eHyAhIiMkJSYnKCkqKywtLi8wMTIzNDU2Nzg5Ojs8PT4/QEFCQ0RFRkdISUpLTE1OT1BRUlNUVVZXWFlaW1xdXl9gYWJjZGVmZ2hpamtsbW5vcHFyc3R1dnd4eXp7fH1+f4CBgoOEhYaHiImKi4yNjo+QkZKTlJWWl5iZmpucnZ6foKGio6SlpqeoqaqrrK2ur7CxsrO0tba3uLm6u7y9vr/AwcLDxMXGx8jJysvMzc7P0NHS09TV1tfY2drb3N3e3+Dh4uPk5ebn6Onq6+zt7u/w8fLz9PX29/j5+vv8/f7/AAECAwQFBgcICQoLDA0ODxAREhMUFRYXGBkaGxwdHh8gISIjJCUmJygpKissLS4vMDEyMzQ1Njc4OTo7PD0+P0BBQkNERUZHSElKS0xNTk9QUVJTVFVWV1hZWltcXV5fYGFiY2RlZmdoaWprbG1ub3BxcnN0dXZ3eHl6e3x9fn+AgYKDhIWGh4iJiouMjY6PkJGSk5SVlpeYmZqbnJ2en6ChoqOkpaanqKmqq6ytrq+wsbKztLW2t7i5uru8vb6/wMHCw8TFxsfIycrLzM3Oz9DR0tPU1dbX2Nna29zd3t/g4eLj5OXm5+jp6uvs7e7v8PHy8/T19vf4+fr7/P3+/w==' binary_data = base64.b64decode(base64_data) file_name = self._get_file_reference() file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY) file_client.upload_file(binary_data) # Act content = file_client.download_file().readall() # Assert self.assertEqual(content, binary_data) def test_create_file_from_bytes_with_progress(self): # parallel tests introduce random order of requests, can only run live if TestMode.need_recording_file(self.test_mode): return # Arrange file_name = self._get_file_reference() data = self.get_random_bytes(LARGE_FILE_SIZE) file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act progress = [] def callback(response): current = response.context['upload_stream_current'] total = response.context['data_stream_total'] if current is not None: progress.append((current, total)) response = file_client.upload_file(data, max_concurrency=2, raw_response_hook=callback) assert isinstance(response, dict) assert 'last_modified' in response assert 'etag' in response # Assert self.assertFileEqual(file_client, data) def test_create_file_from_bytes_with_index(self): # parallel tests introduce random order of requests, can only run live if TestMode.need_recording_file(self.test_mode): return # Arrange file_name = self._get_file_reference() data = self.get_random_bytes(LARGE_FILE_SIZE) index = 1024 file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act response = file_client.upload_file(data[index:], max_concurrency=2) assert isinstance(response, dict) assert 'last_modified' in response assert 'etag' in response # Assert self.assertFileEqual(file_client, data[1024:]) def test_create_file_from_bytes_with_index_and_count(self): # parallel tests introduce random order of requests, can only run live if TestMode.need_recording_file(self.test_mode): return # Arrange file_name = self._get_file_reference() data = self.get_random_bytes(LARGE_FILE_SIZE) index = 512 count = 1024 file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act response = file_client.upload_file(data[index:], length=count, max_concurrency=2) assert isinstance(response, dict) assert 'last_modified' in response assert 'etag' in response # Assert self.assertFileEqual(file_client, data[index:index + count]) def test_create_file_from_path(self): # parallel tests introduce random order of requests, can only run live if TestMode.need_recording_file(self.test_mode): return # Arrange file_name = self._get_file_reference() data = self.get_random_bytes(LARGE_FILE_SIZE) with open(INPUT_FILE_PATH, 'wb') as stream: stream.write(data) file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act with open(INPUT_FILE_PATH, 'rb') as stream: response = file_client.upload_file(stream, max_concurrency=2) assert isinstance(response, dict) assert 'last_modified' in response assert 'etag' in response # Assert self.assertFileEqual(file_client, data) def test_create_file_from_path_with_progress(self): # parallel tests introduce random order of requests, can only run live if TestMode.need_recording_file(self.test_mode): return # Arrange file_name = self._get_file_reference() data = self.get_random_bytes(LARGE_FILE_SIZE) with open(INPUT_FILE_PATH, 'wb') as stream: stream.write(data) file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act progress = [] def callback(response): current = response.context['upload_stream_current'] total = response.context['data_stream_total'] if current is not None: progress.append((current, total)) with open(INPUT_FILE_PATH, 'rb') as stream: response = file_client.upload_file(stream, max_concurrency=2, raw_response_hook=callback) assert isinstance(response, dict) assert 'last_modified' in response assert 'etag' in response # Assert self.assertFileEqual(file_client, data) self.assert_upload_progress( len(data), self.fsc._config.max_range_size, progress, unknown_size=False) def test_create_file_from_stream(self): # parallel tests introduce random order of requests, can only run live if TestMode.need_recording_file(self.test_mode): return # Arrange file_name = self._get_file_reference() data = self.get_random_bytes(LARGE_FILE_SIZE) with open(INPUT_FILE_PATH, 'wb') as stream: stream.write(data) file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act file_size = len(data) with open(INPUT_FILE_PATH, 'rb') as stream: response = file_client.upload_file(stream, max_concurrency=2) assert isinstance(response, dict) assert 'last_modified' in response assert 'etag' in response # Assert self.assertFileEqual(file_client, data[:file_size]) def test_create_file_from_stream_non_seekable(self): # parallel tests introduce random order of requests, can only run live if TestMode.need_recording_file(self.test_mode): return # Arrange file_name = self._get_file_reference() data = self.get_random_bytes(LARGE_FILE_SIZE) with open(INPUT_FILE_PATH, 'wb') as stream: stream.write(data) file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act file_size = len(data) with open(INPUT_FILE_PATH, 'rb') as stream: non_seekable_file = StorageFileTest.NonSeekableFile(stream) file_client.upload_file(non_seekable_file, length=file_size, max_concurrency=1) # Assert self.assertFileEqual(file_client, data[:file_size]) def test_create_file_from_stream_with_progress(self): # parallel tests introduce random order of requests, can only run live if TestMode.need_recording_file(self.test_mode): return # Arrange file_name = self._get_file_reference() data = self.get_random_bytes(LARGE_FILE_SIZE) with open(INPUT_FILE_PATH, 'wb') as stream: stream.write(data) file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act progress = [] def callback(response): current = response.context['upload_stream_current'] total = response.context['data_stream_total'] if current is not None: progress.append((current, total)) file_size = len(data) with open(INPUT_FILE_PATH, 'rb') as stream: file_client.upload_file(stream, max_concurrency=2, raw_response_hook=callback) # Assert self.assertFileEqual(file_client, data[:file_size]) self.assert_upload_progress( len(data), self.fsc._config.max_range_size, progress, unknown_size=False) def test_create_file_from_stream_truncated(self): # parallel tests introduce random order of requests, can only run live if TestMode.need_recording_file(self.test_mode): return # Arrange file_name = self._get_file_reference() data = self.get_random_bytes(LARGE_FILE_SIZE) with open(INPUT_FILE_PATH, 'wb') as stream: stream.write(data) file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act file_size = len(data) - 512 with open(INPUT_FILE_PATH, 'rb') as stream: file_client.upload_file(stream, length=file_size, max_concurrency=2) # Assert self.assertFileEqual(file_client, data[:file_size]) def test_create_file_from_stream_with_progress_truncated(self): # parallel tests introduce random order of requests, can only run live if TestMode.need_recording_file(self.test_mode): return # Arrange file_name = self._get_file_reference() data = self.get_random_bytes(LARGE_FILE_SIZE) with open(INPUT_FILE_PATH, 'wb') as stream: stream.write(data) file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act progress = [] def callback(response): current = response.context['upload_stream_current'] total = response.context['data_stream_total'] if current is not None: progress.append((current, total)) file_size = len(data) - 5 with open(INPUT_FILE_PATH, 'rb') as stream: file_client.upload_file(stream, length=file_size, max_concurrency=2, raw_response_hook=callback) # Assert self.assertFileEqual(file_client, data[:file_size]) self.assert_upload_progress( file_size, self.fsc._config.max_range_size, progress, unknown_size=False) @record def test_create_file_from_text(self): # Arrange file_name = self._get_file_reference() text = u'hello 啊齄丂狛狜 world' data = text.encode('utf-8') file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act file_client.upload_file(text) # Assert self.assertFileEqual(file_client, data) @record def test_create_file_from_text_with_encoding(self): # Arrange file_name = self._get_file_reference() text = u'hello 啊齄丂狛狜 world' data = text.encode('utf-16') file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act file_client.upload_file(text, encoding='UTF-16') # Assert self.assertFileEqual(file_client, data) def test_create_file_from_text_chunked_upload(self): # parallel tests introduce random order of requests, can only run live if TestMode.need_recording_file(self.test_mode): return # Arrange file_name = self._get_file_reference() data = self.get_random_text_data(LARGE_FILE_SIZE) encoded_data = data.encode('utf-8') file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act file_client.upload_file(data) # Assert self.assertFileEqual(file_client, encoded_data) @record def test_create_file_with_md5_small(self): # Arrange file_name = self._get_file_reference() data = self.get_random_bytes(512) file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act file_client.upload_file(data, validate_content=True) # Assert def test_create_file_with_md5_large(self): # parallel tests introduce random order of requests, can only run live if TestMode.need_recording_file(self.test_mode): return # Arrange file_name = self._get_file_reference() data = self.get_random_bytes(LARGE_FILE_SIZE) file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_name, credential=self.settings.STORAGE_ACCOUNT_KEY, max_range_size=4 * 1024) # Act file_client.upload_file(data, validate_content=True, max_concurrency=2) # Assert # --Test cases for sas & acl ------------------------------------------------ @record def test_sas_access_file(self): # SAS URL is calculated from storage key, so this test runs live only if TestMode.need_recording_file(self.test_mode): return # Arrange file_client = self._create_file() token = generate_file_sas( file_client.account_name, file_client.share_name, file_client.file_path, file_client.credential.account_key, permission=FileSasPermissions(read=True), expiry=datetime.utcnow() + timedelta(hours=1), ) # Act file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_client.file_name, credential=token) content = file_client.download_file().readall() # Assert self.assertEqual(self.short_byte_data, content) @record def test_sas_signed_identifier(self): # SAS URL is calculated from storage key, so this test runs live only if TestMode.need_recording_file(self.test_mode): return # Arrange file_client = self._create_file() share_client = self.fsc.get_share_client(self.share_name) access_policy = AccessPolicy() access_policy.start = datetime.utcnow() - timedelta(hours=1) access_policy.expiry = datetime.utcnow() + timedelta(hours=1) access_policy.permission = FileSasPermissions(read=True) identifiers = {'testid': access_policy} share_client.set_share_access_policy(identifiers) token = generate_file_sas( file_client.account_name, file_client.share_name, file_client.file_path, file_client.credential.account_key, policy_id='testid') # Act sas_file = ShareFileClient.from_file_url( file_client.url, credential=token) content = file_client.download_file().readall() # Assert self.assertEqual(self.short_byte_data, content) @record def test_account_sas(self): # SAS URL is calculated from storage key, so this test runs live only if TestMode.need_recording_file(self.test_mode): return # Arrange file_client = self._create_file() token = generate_account_sas( self.fsc.account_name, self.fsc.credential.account_key, ResourceTypes(object=True), AccountSasPermissions(read=True), datetime.utcnow() + timedelta(hours=1), ) # Act file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_client.file_name, credential=token) response = requests.get(file_client.url) # Assert self.assertTrue(response.ok) self.assertEqual(self.short_byte_data, response.content) @record def test_shared_read_access_file(self): # SAS URL is calculated from storage key, so this test runs live only if TestMode.need_recording_file(self.test_mode): return # Arrange file_client = self._create_file() token = generate_file_sas( file_client.account_name, file_client.share_name, file_client.file_path, file_client.credential.account_key, permission=FileSasPermissions(read=True), expiry=datetime.utcnow() + timedelta(hours=1), ) # Act file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_client.file_name, credential=token) response = requests.get(file_client.url) # Assert self.assertTrue(response.ok) self.assertEqual(self.short_byte_data, response.content) @record def test_shared_read_access_file_with_content_query_params(self): # SAS URL is calculated from storage key, so this test runs live only if TestMode.need_recording_file(self.test_mode): return # Arrange file_client = self._create_file() token = generate_file_sas( file_client.account_name, file_client.share_name, file_client.file_path, file_client.credential.account_key, permission=FileSasPermissions(read=True), expiry=datetime.utcnow() + timedelta(hours=1), cache_control='no-cache', content_disposition='inline', content_encoding='utf-8', content_language='fr', content_type='text', ) # Act file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_client.file_name, credential=token) response = requests.get(file_client.url) # Assert self.assertEqual(self.short_byte_data, response.content) self.assertEqual(response.headers['cache-control'], 'no-cache') self.assertEqual(response.headers['content-disposition'], 'inline') self.assertEqual(response.headers['content-encoding'], 'utf-8') self.assertEqual(response.headers['content-language'], 'fr') self.assertEqual(response.headers['content-type'], 'text') @record def test_shared_write_access_file(self): # SAS URL is calculated from storage key, so this test runs live only if TestMode.need_recording_file(self.test_mode): return # Arrange updated_data = b'updated file data' file_client_admin = self._create_file() token = generate_file_sas( file_client_admin.account_name, file_client_admin.share_name, file_client_admin.file_path, file_client_admin.credential.account_key, permission=FileSasPermissions(write=True), expiry=datetime.utcnow() + timedelta(hours=1), ) file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_client_admin.file_name, credential=token) # Act headers = {'x-ms-range': 'bytes=0-16', 'x-ms-write': 'update'} response = requests.put(file_client.url + '&comp=range', headers=headers, data=updated_data) # Assert self.assertTrue(response.ok) file_content = file_client_admin.download_file().readall() self.assertEqual(updated_data, file_content[:len(updated_data)]) @record def test_shared_delete_access_file(self): # SAS URL is calculated from storage key, so this test runs live only if TestMode.need_recording_file(self.test_mode): return # Arrange file_client_admin = self._create_file() token = generate_file_sas( file_client_admin.account_name, file_client_admin.share_name, file_client_admin.file_path, file_client_admin.credential.account_key, permission=FileSasPermissions(delete=True), expiry=datetime.utcnow() + timedelta(hours=1), ) file_client = ShareFileClient( self.get_file_url(), share_name=self.share_name, file_path=file_client_admin.file_name, credential=token) # Act response = requests.delete(file_client.url) # Assert self.assertTrue(response.ok) with self.assertRaises(ResourceNotFoundError): file_client_admin.download_file() # ------------------------------------------------------------------------------ if __name__ == '__main__': unittest.main()

35.609726

1,392

0.64403

6313fdfd0887c26bc8a40f39b90983631cd5639d

238,324

py

Python

tests/admin_views/tests.py

benjaoming/django

6dbe979b4d9396e1b307c7d27388c97c13beb21c

[ "BSD-3-Clause" ]

null

tests/admin_views/tests.py

benjaoming/django

6dbe979b4d9396e1b307c7d27388c97c13beb21c

[ "BSD-3-Clause" ]

null

tests/admin_views/tests.py

benjaoming/django

6dbe979b4d9396e1b307c7d27388c97c13beb21c

[ "BSD-3-Clause" ]

null

# -*- coding: utf-8 -*- from __future__ import unicode_literals import os import re import datetime import unittest from django.conf import settings, global_settings from django.core import mail from django.core.checks import Error from django.core.files import temp as tempfile from django.core.exceptions import ImproperlyConfigured from django.core.urlresolvers import (NoReverseMatch, get_script_prefix, reverse, set_script_prefix) # Register auth models with the admin. from django.contrib.auth import get_permission_codename from django.contrib.admin import ModelAdmin from django.contrib.admin.helpers import ACTION_CHECKBOX_NAME from django.contrib.admin.models import LogEntry, DELETION from django.contrib.admin.options import TO_FIELD_VAR from django.contrib.admin.templatetags.admin_static import static from django.contrib.admin.templatetags.admin_urls import add_preserved_filters from django.contrib.admin.tests import AdminSeleniumWebDriverTestCase from django.contrib.admin.utils import quote from django.contrib.admin.validation import ModelAdminValidator from django.contrib.admin.views.main import IS_POPUP_VAR from django.contrib.auth import REDIRECT_FIELD_NAME from django.contrib.auth.models import Group, User, Permission from django.contrib.contenttypes.models import ContentType from django.contrib.staticfiles.storage import staticfiles_storage from django.forms.utils import ErrorList from django.template.response import TemplateResponse from django.test import TestCase, skipUnlessDBFeature from django.test.utils import patch_logger from django.test import modify_settings, override_settings from django.utils import formats from django.utils import translation from django.utils.cache import get_max_age from django.utils.encoding import iri_to_uri, force_bytes, force_text from django.utils.html import escape from django.utils.http import urlencode from django.utils.six.moves.urllib.parse import parse_qsl, urljoin, urlparse from django.utils._os import upath from django.utils import six # local test models from .models import (Article, BarAccount, CustomArticle, EmptyModel, FooAccount, Gallery, ModelWithStringPrimaryKey, Person, Persona, Picture, Podcast, Section, Subscriber, Vodcast, Language, Collector, Widget, Grommet, DooHickey, FancyDoodad, Whatsit, Category, Post, Plot, FunkyTag, Chapter, Book, Promo, WorkHour, Employee, Question, Answer, Inquisition, Actor, FoodDelivery, RowLevelChangePermissionModel, Paper, CoverLetter, Story, OtherStory, ComplexSortedPerson, PluggableSearchPerson, Parent, Child, AdminOrderedField, AdminOrderedModelMethod, AdminOrderedAdminMethod, AdminOrderedCallable, Report, MainPrepopulated, RelatedPrepopulated, UnorderedObject, Simple, UndeletableObject, UnchangeableObject, Choice, ShortMessage, Telegram, Pizza, Topping, FilteredManager, City, Restaurant, Worker, ParentWithDependentChildren, Character, FieldOverridePost, Color2) from .admin import site, site2, CityAdmin ERROR_MESSAGE = "Please enter the correct username and password \ for a staff account. Note that both fields may be case-sensitive." ADMIN_VIEW_TEMPLATES_DIR = settings.TEMPLATE_DIRS + (os.path.join(os.path.dirname(upath(__file__)), 'templates'),) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls", USE_I18N=True, USE_L10N=False, LANGUAGE_CODE='en') class AdminViewBasicTestCase(TestCase): fixtures = ['admin-views-users.xml', 'admin-views-colors.xml', 'admin-views-fabrics.xml', 'admin-views-books.xml'] # Store the bit of the URL where the admin is registered as a class # variable. That way we can test a second AdminSite just by subclassing # this test case and changing urlbit. urlbit = 'admin' def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() formats.reset_format_cache() def assertContentBefore(self, response, text1, text2, failing_msg=None): """ Testing utility asserting that text1 appears before text2 in response content. """ self.assertEqual(response.status_code, 200) self.assertLess(response.content.index(force_bytes(text1)), response.content.index(force_bytes(text2)), failing_msg) class AdminViewBasicTest(AdminViewBasicTestCase): def test_trailing_slash_required(self): """ If you leave off the trailing slash, app should redirect and add it. """ response = self.client.get('/test_admin/%s/admin_views/article/add' % self.urlbit) self.assertRedirects(response, '/test_admin/%s/admin_views/article/add/' % self.urlbit, status_code=301) def test_admin_static_template_tag(self): """ Test that admin_static.static is pointing to the collectstatic version (as django.contrib.collectstatic is in installed apps). """ old_url = staticfiles_storage.base_url staticfiles_storage.base_url = '/test/' try: self.assertEqual(static('path'), '/test/path') finally: staticfiles_storage.base_url = old_url def test_basic_add_GET(self): """ A smoke test to ensure GET on the add_view works. """ response = self.client.get('/test_admin/%s/admin_views/section/add/' % self.urlbit) self.assertIsInstance(response, TemplateResponse) self.assertEqual(response.status_code, 200) def test_add_with_GET_args(self): response = self.client.get('/test_admin/%s/admin_views/section/add/' % self.urlbit, {'name': 'My Section'}) self.assertEqual(response.status_code, 200) self.assertContains(response, 'value="My Section"', msg_prefix="Couldn't find an input with the right value in the response") def test_basic_edit_GET(self): """ A smoke test to ensure GET on the change_view works. """ response = self.client.get('/test_admin/%s/admin_views/section/1/' % self.urlbit) self.assertIsInstance(response, TemplateResponse) self.assertEqual(response.status_code, 200) def test_basic_edit_GET_string_PK(self): """ Ensure GET on the change_view works (returns an HTTP 404 error, see #11191) when passing a string as the PK argument for a model with an integer PK field. """ response = self.client.get('/test_admin/%s/admin_views/section/abc/' % self.urlbit) self.assertEqual(response.status_code, 404) def test_basic_inheritance_GET_string_PK(self): """ Ensure GET on the change_view works on inherited models (returns an HTTP 404 error, see #19951) when passing a string as the PK argument for a model with an integer PK field. """ response = self.client.get('/test_admin/%s/admin_views/supervillain/abc/' % self.urlbit) self.assertEqual(response.status_code, 404) def test_basic_add_POST(self): """ A smoke test to ensure POST on add_view works. """ post_data = { "name": "Another Section", # inline data "article_set-TOTAL_FORMS": "3", "article_set-INITIAL_FORMS": "0", "article_set-MAX_NUM_FORMS": "0", } response = self.client.post('/test_admin/%s/admin_views/section/add/' % self.urlbit, post_data) self.assertEqual(response.status_code, 302) # redirect somewhere def test_popup_add_POST(self): """ Ensure http response from a popup is properly escaped. """ post_data = { '_popup': '1', 'title': 'title with a new\nline', 'content': 'some content', 'date_0': '2010-09-10', 'date_1': '14:55:39', } response = self.client.post('/test_admin/%s/admin_views/article/add/' % self.urlbit, post_data) self.assertEqual(response.status_code, 200) self.assertContains(response, 'dismissAddAnotherPopup') self.assertContains(response, 'title with a new\\u000Aline') # Post data for edit inline inline_post_data = { "name": "Test section", # inline data "article_set-TOTAL_FORMS": "6", "article_set-INITIAL_FORMS": "3", "article_set-MAX_NUM_FORMS": "0", "article_set-0-id": "1", # there is no title in database, give one here or formset will fail. "article_set-0-title": "Norske bostaver æøå skaper problemer", "article_set-0-content": "<p>Middle content</p>", "article_set-0-date_0": "2008-03-18", "article_set-0-date_1": "11:54:58", "article_set-0-section": "1", "article_set-1-id": "2", "article_set-1-title": "Need a title.", "article_set-1-content": "<p>Oldest content</p>", "article_set-1-date_0": "2000-03-18", "article_set-1-date_1": "11:54:58", "article_set-2-id": "3", "article_set-2-title": "Need a title.", "article_set-2-content": "<p>Newest content</p>", "article_set-2-date_0": "2009-03-18", "article_set-2-date_1": "11:54:58", "article_set-3-id": "", "article_set-3-title": "", "article_set-3-content": "", "article_set-3-date_0": "", "article_set-3-date_1": "", "article_set-4-id": "", "article_set-4-title": "", "article_set-4-content": "", "article_set-4-date_0": "", "article_set-4-date_1": "", "article_set-5-id": "", "article_set-5-title": "", "article_set-5-content": "", "article_set-5-date_0": "", "article_set-5-date_1": "", } def test_basic_edit_POST(self): """ A smoke test to ensure POST on edit_view works. """ response = self.client.post('/test_admin/%s/admin_views/section/1/' % self.urlbit, self.inline_post_data) self.assertEqual(response.status_code, 302) # redirect somewhere def test_edit_save_as(self): """ Test "save as". """ post_data = self.inline_post_data.copy() post_data.update({ '_saveasnew': 'Save+as+new', "article_set-1-section": "1", "article_set-2-section": "1", "article_set-3-section": "1", "article_set-4-section": "1", "article_set-5-section": "1", }) response = self.client.post('/test_admin/%s/admin_views/section/1/' % self.urlbit, post_data) self.assertEqual(response.status_code, 302) # redirect somewhere def test_change_list_sorting_callable(self): """ Ensure we can sort on a list_display field that is a callable (column 2 is callable_year in ArticleAdmin) """ response = self.client.get('/test_admin/%s/admin_views/article/' % self.urlbit, {'o': 2}) self.assertContentBefore(response, 'Oldest content', 'Middle content', "Results of sorting on callable are out of order.") self.assertContentBefore(response, 'Middle content', 'Newest content', "Results of sorting on callable are out of order.") def test_change_list_sorting_model(self): """ Ensure we can sort on a list_display field that is a Model method (column 3 is 'model_year' in ArticleAdmin) """ response = self.client.get('/test_admin/%s/admin_views/article/' % self.urlbit, {'o': '-3'}) self.assertContentBefore(response, 'Newest content', 'Middle content', "Results of sorting on Model method are out of order.") self.assertContentBefore(response, 'Middle content', 'Oldest content', "Results of sorting on Model method are out of order.") def test_change_list_sorting_model_admin(self): """ Ensure we can sort on a list_display field that is a ModelAdmin method (column 4 is 'modeladmin_year' in ArticleAdmin) """ response = self.client.get('/test_admin/%s/admin_views/article/' % self.urlbit, {'o': '4'}) self.assertContentBefore(response, 'Oldest content', 'Middle content', "Results of sorting on ModelAdmin method are out of order.") self.assertContentBefore(response, 'Middle content', 'Newest content', "Results of sorting on ModelAdmin method are out of order.") def test_change_list_sorting_model_admin_reverse(self): """ Ensure we can sort on a list_display field that is a ModelAdmin method in reverse order (i.e. admin_order_field uses the '-' prefix) (column 6 is 'model_year_reverse' in ArticleAdmin) """ response = self.client.get('/test_admin/%s/admin_views/article/' % self.urlbit, {'o': '6'}) self.assertContentBefore(response, '2009', '2008', "Results of sorting on ModelAdmin method are out of order.") self.assertContentBefore(response, '2008', '2000', "Results of sorting on ModelAdmin method are out of order.") # Let's make sure the ordering is right and that we don't get a # FieldError when we change to descending order response = self.client.get('/test_admin/%s/admin_views/article/' % self.urlbit, {'o': '-6'}) self.assertContentBefore(response, '2000', '2008', "Results of sorting on ModelAdmin method are out of order.") self.assertContentBefore(response, '2008', '2009', "Results of sorting on ModelAdmin method are out of order.") def test_change_list_sorting_multiple(self): p1 = Person.objects.create(name="Chris", gender=1, alive=True) p2 = Person.objects.create(name="Chris", gender=2, alive=True) p3 = Person.objects.create(name="Bob", gender=1, alive=True) link1 = reverse('admin:admin_views_person_change', args=(p1.pk,)) link2 = reverse('admin:admin_views_person_change', args=(p2.pk,)) link3 = reverse('admin:admin_views_person_change', args=(p3.pk,)) # Sort by name, gender # This hard-codes the URL because it'll fail if it runs against the # 'admin2' custom admin (which doesn't have the Person model). response = self.client.get('/test_admin/admin/admin_views/person/', {'o': '1.2'}) self.assertContentBefore(response, link3, link1) self.assertContentBefore(response, link1, link2) # Sort by gender descending, name response = self.client.get('/test_admin/admin/admin_views/person/', {'o': '-2.1'}) self.assertContentBefore(response, link2, link3) self.assertContentBefore(response, link3, link1) def test_change_list_sorting_preserve_queryset_ordering(self): """ If no ordering is defined in `ModelAdmin.ordering` or in the query string, then the underlying order of the queryset should not be changed, even if it is defined in `Modeladmin.get_queryset()`. Refs #11868, #7309. """ p1 = Person.objects.create(name="Amy", gender=1, alive=True, age=80) p2 = Person.objects.create(name="Bob", gender=1, alive=True, age=70) p3 = Person.objects.create(name="Chris", gender=2, alive=False, age=60) link1 = reverse('admin:admin_views_person_change', args=(p1.pk,)) link2 = reverse('admin:admin_views_person_change', args=(p2.pk,)) link3 = reverse('admin:admin_views_person_change', args=(p3.pk,)) # This hard-codes the URL because it'll fail if it runs against the # 'admin2' custom admin (which doesn't have the Person model). response = self.client.get('/test_admin/admin/admin_views/person/', {}) self.assertContentBefore(response, link3, link2) self.assertContentBefore(response, link2, link1) def test_change_list_sorting_model_meta(self): # Test ordering on Model Meta is respected l1 = Language.objects.create(iso='ur', name='Urdu') l2 = Language.objects.create(iso='ar', name='Arabic') link1 = reverse('admin:admin_views_language_change', args=(quote(l1.pk),)) link2 = reverse('admin:admin_views_language_change', args=(quote(l2.pk),)) response = self.client.get('/test_admin/admin/admin_views/language/', {}) self.assertContentBefore(response, link2, link1) # Test we can override with query string response = self.client.get('/test_admin/admin/admin_views/language/', {'o': '-1'}) self.assertContentBefore(response, link1, link2) def test_change_list_sorting_override_model_admin(self): # Test ordering on Model Admin is respected, and overrides Model Meta dt = datetime.datetime.now() p1 = Podcast.objects.create(name="A", release_date=dt) p2 = Podcast.objects.create(name="B", release_date=dt - datetime.timedelta(10)) link1 = reverse('admin:admin_views_podcast_change', args=(p1.pk,)) link2 = reverse('admin:admin_views_podcast_change', args=(p2.pk,)) response = self.client.get('/test_admin/admin/admin_views/podcast/', {}) self.assertContentBefore(response, link1, link2) def test_multiple_sort_same_field(self): # Check that we get the columns we expect if we have two columns # that correspond to the same ordering field dt = datetime.datetime.now() p1 = Podcast.objects.create(name="A", release_date=dt) p2 = Podcast.objects.create(name="B", release_date=dt - datetime.timedelta(10)) link1 = reverse('admin:admin_views_podcast_change', args=(quote(p1.pk),)) link2 = reverse('admin:admin_views_podcast_change', args=(quote(p2.pk),)) response = self.client.get('/test_admin/admin/admin_views/podcast/', {}) self.assertContentBefore(response, link1, link2) p1 = ComplexSortedPerson.objects.create(name="Bob", age=10) p2 = ComplexSortedPerson.objects.create(name="Amy", age=20) link1 = reverse('admin:admin_views_complexsortedperson_change', args=(p1.pk,)) link2 = reverse('admin:admin_views_complexsortedperson_change', args=(p2.pk,)) response = self.client.get('/test_admin/admin/admin_views/complexsortedperson/', {}) # Should have 5 columns (including action checkbox col) self.assertContains(response, '<th scope="col"', count=5) self.assertContains(response, 'Name') self.assertContains(response, 'Colored name') # Check order self.assertContentBefore(response, 'Name', 'Colored name') # Check sorting - should be by name self.assertContentBefore(response, link2, link1) def test_sort_indicators_admin_order(self): """ Ensures that the admin shows default sort indicators for all kinds of 'ordering' fields: field names, method on the model admin and model itself, and other callables. See #17252. """ models = [(AdminOrderedField, 'adminorderedfield'), (AdminOrderedModelMethod, 'adminorderedmodelmethod'), (AdminOrderedAdminMethod, 'adminorderedadminmethod'), (AdminOrderedCallable, 'adminorderedcallable')] for model, url in models: model.objects.create(stuff='The Last Item', order=3) model.objects.create(stuff='The First Item', order=1) model.objects.create(stuff='The Middle Item', order=2) response = self.client.get('/test_admin/admin/admin_views/%s/' % url, {}) self.assertEqual(response.status_code, 200) # Should have 3 columns including action checkbox col. self.assertContains(response, '<th scope="col"', count=3, msg_prefix=url) # Check if the correct column was selected. 2 is the index of the # 'order' column in the model admin's 'list_display' with 0 being # the implicit 'action_checkbox' and 1 being the column 'stuff'. self.assertEqual(response.context['cl'].get_ordering_field_columns(), {2: 'asc'}) # Check order of records. self.assertContentBefore(response, 'The First Item', 'The Middle Item') self.assertContentBefore(response, 'The Middle Item', 'The Last Item') def test_limited_filter(self): """Ensure admin changelist filters do not contain objects excluded via limit_choices_to. This also tests relation-spanning filters (e.g. 'color__value'). """ response = self.client.get('/test_admin/%s/admin_views/thing/' % self.urlbit) self.assertEqual(response.status_code, 200) self.assertContains(response, '<div id="changelist-filter">', msg_prefix="Expected filter not found in changelist view") self.assertNotContains(response, '<a href="?color__id__exact=3">Blue</a>', msg_prefix="Changelist filter not correctly limited by limit_choices_to") def test_relation_spanning_filters(self): response = self.client.get('/test_admin/%s/admin_views/chapterxtra1/' % self.urlbit) self.assertEqual(response.status_code, 200) self.assertContains(response, '<div id="changelist-filter">') filters = { 'chap__id__exact': dict( values=[c.id for c in Chapter.objects.all()], test=lambda obj, value: obj.chap.id == value), 'chap__title': dict( values=[c.title for c in Chapter.objects.all()], test=lambda obj, value: obj.chap.title == value), 'chap__book__id__exact': dict( values=[b.id for b in Book.objects.all()], test=lambda obj, value: obj.chap.book.id == value), 'chap__book__name': dict( values=[b.name for b in Book.objects.all()], test=lambda obj, value: obj.chap.book.name == value), 'chap__book__promo__id__exact': dict( values=[p.id for p in Promo.objects.all()], test=lambda obj, value: obj.chap.book.promo_set.filter(id=value).exists()), 'chap__book__promo__name': dict( values=[p.name for p in Promo.objects.all()], test=lambda obj, value: obj.chap.book.promo_set.filter(name=value).exists()), } for filter_path, params in filters.items(): for value in params['values']: query_string = urlencode({filter_path: value}) # ensure filter link exists self.assertContains(response, '<a href="?%s">' % query_string) # ensure link works filtered_response = self.client.get( '/test_admin/%s/admin_views/chapterxtra1/?%s' % ( self.urlbit, query_string)) self.assertEqual(filtered_response.status_code, 200) # ensure changelist contains only valid objects for obj in filtered_response.context['cl'].queryset.all(): self.assertTrue(params['test'](obj, value)) def test_incorrect_lookup_parameters(self): """Ensure incorrect lookup parameters are handled gracefully.""" response = self.client.get('/test_admin/%s/admin_views/thing/' % self.urlbit, {'notarealfield': '5'}) self.assertRedirects(response, '/test_admin/%s/admin_views/thing/?e=1' % self.urlbit) # Spanning relationships through a nonexistent related object (Refs #16716) response = self.client.get('/test_admin/%s/admin_views/thing/' % self.urlbit, {'notarealfield__whatever': '5'}) self.assertRedirects(response, '/test_admin/%s/admin_views/thing/?e=1' % self.urlbit) response = self.client.get('/test_admin/%s/admin_views/thing/' % self.urlbit, {'color__id__exact': 'StringNotInteger!'}) self.assertRedirects(response, '/test_admin/%s/admin_views/thing/?e=1' % self.urlbit) # Regression test for #18530 response = self.client.get('/test_admin/%s/admin_views/thing/' % self.urlbit, {'pub_date__gte': 'foo'}) self.assertRedirects(response, '/test_admin/%s/admin_views/thing/?e=1' % self.urlbit) def test_isnull_lookups(self): """Ensure is_null is handled correctly.""" Article.objects.create(title="I Could Go Anywhere", content="Versatile", date=datetime.datetime.now()) response = self.client.get('/test_admin/%s/admin_views/article/' % self.urlbit) self.assertContains(response, '4 articles') response = self.client.get('/test_admin/%s/admin_views/article/' % self.urlbit, {'section__isnull': 'false'}) self.assertContains(response, '3 articles') response = self.client.get('/test_admin/%s/admin_views/article/' % self.urlbit, {'section__isnull': '0'}) self.assertContains(response, '3 articles') response = self.client.get('/test_admin/%s/admin_views/article/' % self.urlbit, {'section__isnull': 'true'}) self.assertContains(response, '1 article') response = self.client.get('/test_admin/%s/admin_views/article/' % self.urlbit, {'section__isnull': '1'}) self.assertContains(response, '1 article') def test_logout_and_password_change_URLs(self): response = self.client.get('/test_admin/%s/admin_views/article/' % self.urlbit) self.assertContains(response, '<a href="/test_admin/%s/logout/">' % self.urlbit) self.assertContains(response, '<a href="/test_admin/%s/password_change/">' % self.urlbit) def test_named_group_field_choices_change_list(self): """ Ensures the admin changelist shows correct values in the relevant column for rows corresponding to instances of a model in which a named group has been used in the choices option of a field. """ link1 = reverse('admin:admin_views_fabric_change', args=(1,), current_app=self.urlbit) link2 = reverse('admin:admin_views_fabric_change', args=(2,), current_app=self.urlbit) response = self.client.get('/test_admin/%s/admin_views/fabric/' % self.urlbit) fail_msg = "Changelist table isn't showing the right human-readable values set by a model field 'choices' option named group." self.assertContains(response, '<a href="%s">Horizontal</a>' % link1, msg_prefix=fail_msg, html=True) self.assertContains(response, '<a href="%s">Vertical</a>' % link2, msg_prefix=fail_msg, html=True) def test_named_group_field_choices_filter(self): """ Ensures the filter UI shows correctly when at least one named group has been used in the choices option of a model field. """ response = self.client.get('/test_admin/%s/admin_views/fabric/' % self.urlbit) fail_msg = "Changelist filter isn't showing options contained inside a model field 'choices' option named group." self.assertContains(response, '<div id="changelist-filter">') self.assertContains(response, '<a href="?surface__exact=x">Horizontal</a>', msg_prefix=fail_msg, html=True) self.assertContains(response, '<a href="?surface__exact=y">Vertical</a>', msg_prefix=fail_msg, html=True) def test_change_list_null_boolean_display(self): Post.objects.create(public=None) # This hard-codes the URl because it'll fail if it runs # against the 'admin2' custom admin (which doesn't have the # Post model). response = self.client.get("/test_admin/admin/admin_views/post/") self.assertContains(response, 'icon-unknown.gif') def test_i18n_language_non_english_default(self): """ Check if the JavaScript i18n view returns an empty language catalog if the default language is non-English but the selected language is English. See #13388 and #3594 for more details. """ with self.settings(LANGUAGE_CODE='fr'), translation.override('en-us'): response = self.client.get('/test_admin/admin/jsi18n/') self.assertNotContains(response, 'Choisir une heure') def test_i18n_language_non_english_fallback(self): """ Makes sure that the fallback language is still working properly in cases where the selected language cannot be found. """ with self.settings(LANGUAGE_CODE='fr'), translation.override('none'): response = self.client.get('/test_admin/admin/jsi18n/') self.assertContains(response, 'Choisir une heure') def test_L10N_deactivated(self): """ Check if L10N is deactivated, the JavaScript i18n view doesn't return localized date/time formats. Refs #14824. """ with self.settings(LANGUAGE_CODE='ru', USE_L10N=False), translation.override('none'): response = self.client.get('/test_admin/admin/jsi18n/') self.assertNotContains(response, '%d.%m.%Y %H:%M:%S') self.assertContains(response, '%Y-%m-%d %H:%M:%S') def test_disallowed_filtering(self): with patch_logger('django.security.DisallowedModelAdminLookup', 'error') as calls: response = self.client.get("/test_admin/admin/admin_views/album/?owner__email__startswith=fuzzy") self.assertEqual(response.status_code, 400) self.assertEqual(len(calls), 1) # Filters are allowed if explicitly included in list_filter response = self.client.get("/test_admin/admin/admin_views/thing/?color__value__startswith=red") self.assertEqual(response.status_code, 200) response = self.client.get("/test_admin/admin/admin_views/thing/?color__value=red") self.assertEqual(response.status_code, 200) # Filters should be allowed if they involve a local field without the # need to whitelist them in list_filter or date_hierarchy. response = self.client.get("/test_admin/admin/admin_views/person/?age__gt=30") self.assertEqual(response.status_code, 200) e1 = Employee.objects.create(name='Anonymous', gender=1, age=22, alive=True, code='123') e2 = Employee.objects.create(name='Visitor', gender=2, age=19, alive=True, code='124') WorkHour.objects.create(datum=datetime.datetime.now(), employee=e1) WorkHour.objects.create(datum=datetime.datetime.now(), employee=e2) response = self.client.get("/test_admin/admin/admin_views/workhour/") self.assertEqual(response.status_code, 200) self.assertContains(response, 'employee__person_ptr__exact') response = self.client.get("/test_admin/admin/admin_views/workhour/?employee__person_ptr__exact=%d" % e1.pk) self.assertEqual(response.status_code, 200) def test_disallowed_to_field(self): with patch_logger('django.security.DisallowedModelAdminToField', 'error') as calls: response = self.client.get("/test_admin/admin/admin_views/section/", {TO_FIELD_VAR: 'missing_field'}) self.assertEqual(response.status_code, 400) self.assertEqual(len(calls), 1) # Specifying a field that is not referred by any other model registered # to this admin site should raise an exception. with patch_logger('django.security.DisallowedModelAdminToField', 'error') as calls: response = self.client.get("/test_admin/admin/admin_views/section/", {TO_FIELD_VAR: 'name'}) self.assertEqual(response.status_code, 400) self.assertEqual(len(calls), 1) # #23839 - Primary key should always be allowed, even if the referenced model isn't registered. response = self.client.get("/test_admin/admin/admin_views/notreferenced/", {TO_FIELD_VAR: 'id'}) self.assertEqual(response.status_code, 200) # #23915 - Specifying a field referenced by another model though a m2m should be allowed. response = self.client.get("/test_admin/admin/admin_views/recipe/", {TO_FIELD_VAR: 'rname'}) self.assertEqual(response.status_code, 200) # #23604, #23915 - Specifying a field referenced through a reverse m2m relationship should be allowed. response = self.client.get("/test_admin/admin/admin_views/ingredient/", {TO_FIELD_VAR: 'iname'}) self.assertEqual(response.status_code, 200) # #23329 - Specifying a field that is not referred by any other model directly registered # to this admin site but registered through inheritance should be allowed. response = self.client.get("/test_admin/admin/admin_views/referencedbyparent/", {TO_FIELD_VAR: 'name'}) self.assertEqual(response.status_code, 200) # #23431 - Specifying a field that is only referred to by a inline of a registered # model should be allowed. response = self.client.get("/test_admin/admin/admin_views/referencedbyinline/", {TO_FIELD_VAR: 'name'}) self.assertEqual(response.status_code, 200) # We also want to prevent the add and change view from leaking a # disallowed field value. with patch_logger('django.security.DisallowedModelAdminToField', 'error') as calls: response = self.client.post("/test_admin/admin/admin_views/section/add/", {TO_FIELD_VAR: 'name'}) self.assertEqual(response.status_code, 400) self.assertEqual(len(calls), 1) section = Section.objects.create() with patch_logger('django.security.DisallowedModelAdminToField', 'error') as calls: response = self.client.post("/test_admin/admin/admin_views/section/%d/" % section.pk, {TO_FIELD_VAR: 'name'}) self.assertEqual(response.status_code, 400) self.assertEqual(len(calls), 1) def test_allowed_filtering_15103(self): """ Regressions test for ticket 15103 - filtering on fields defined in a ForeignKey 'limit_choices_to' should be allowed, otherwise raw_id_fields can break. """ # Filters should be allowed if they are defined on a ForeignKey pointing to this model response = self.client.get("/test_admin/admin/admin_views/inquisition/?leader__name=Palin&leader__age=27") self.assertEqual(response.status_code, 200) def test_popup_dismiss_related(self): """ Regression test for ticket 20664 - ensure the pk is properly quoted. """ actor = Actor.objects.create(name="Palin", age=27) response = self.client.get("/test_admin/admin/admin_views/actor/?%s" % IS_POPUP_VAR) self.assertContains(response, "opener.dismissRelatedLookupPopup(window, '%s')" % actor.pk) def test_hide_change_password(self): """ Tests if the "change password" link in the admin is hidden if the User does not have a usable password set. (against 9bea85795705d015cdadc82c68b99196a8554f5c) """ user = User.objects.get(username='super') user.set_unusable_password() user.save() response = self.client.get('/test_admin/admin/') self.assertNotContains(response, reverse('admin:password_change'), msg_prefix='The "change password" link should not be displayed if a user does not have a usable password.') def test_change_view_with_show_delete_extra_context(self): """ Ensured that the 'show_delete' context variable in the admin's change view actually controls the display of the delete button. Refs #10057. """ instance = UndeletableObject.objects.create(name='foo') response = self.client.get('/test_admin/%s/admin_views/undeletableobject/%d/' % (self.urlbit, instance.pk)) self.assertNotContains(response, 'deletelink') def test_allows_attributeerror_to_bubble_up(self): """ Ensure that AttributeErrors are allowed to bubble when raised inside a change list view. Requires a model to be created so there's something to be displayed Refs: #16655, #18593, and #18747 """ Simple.objects.create() with self.assertRaises(AttributeError): self.client.get('/test_admin/%s/admin_views/simple/' % self.urlbit) def test_changelist_with_no_change_url(self): """ ModelAdmin.changelist_view shouldn't result in a NoReverseMatch if url for change_view is removed from get_urls Regression test for #20934 """ UnchangeableObject.objects.create() response = self.client.get('/test_admin/admin/admin_views/unchangeableobject/') self.assertEqual(response.status_code, 200) # Check the format of the shown object -- shouldn't contain a change link self.assertContains(response, '<th class="field-__str__">UnchangeableObject object</th>', html=True) def test_invalid_appindex_url(self): """ #21056 -- URL reversing shouldn't work for nonexistent apps. """ good_url = '/test_admin/admin/admin_views/' confirm_good_url = reverse('admin:app_list', kwargs={'app_label': 'admin_views'}) self.assertEqual(good_url, confirm_good_url) with self.assertRaises(NoReverseMatch): reverse('admin:app_list', kwargs={'app_label': 'this_should_fail'}) with self.assertRaises(NoReverseMatch): reverse('admin:app_list', args=('admin_views2',)) def test_proxy_model_content_type_is_used_for_log_entries(self): """ Log entries for proxy models should have the proxy model's content type. Regression test for #21084. """ color2_content_type = ContentType.objects.get_for_model(Color2, for_concrete_model=False) # add color2_add_url = reverse('admin:admin_views_color2_add') self.client.post(color2_add_url, {'value': 'orange'}) color2_addition_log = LogEntry.objects.all()[0] self.assertEqual(color2_content_type, color2_addition_log.content_type) # change color_id = color2_addition_log.object_id color2_change_url = reverse('admin:admin_views_color2_change', args=(color_id,)) self.client.post(color2_change_url, {'value': 'blue'}) color2_change_log = LogEntry.objects.all()[0] self.assertEqual(color2_content_type, color2_change_log.content_type) # delete color2_delete_url = reverse('admin:admin_views_color2_delete', args=(color_id,)) self.client.post(color2_delete_url) color2_delete_log = LogEntry.objects.all()[0] self.assertEqual(color2_content_type, color2_delete_log.content_type) def test_adminsite_display_site_url(self): """ #13749 - Admin should display link to front-end site 'View site' """ url = reverse('admin:index') response = self.client.get(url) self.assertEqual(response.context['site_url'], '/my-site-url/') self.assertContains(response, '<a href="/my-site-url/">View site</a>') @override_settings(TEMPLATE_DIRS=ADMIN_VIEW_TEMPLATES_DIR) class AdminCustomTemplateTests(AdminViewBasicTestCase): def test_extended_bodyclass_template_change_form(self): """ Ensure that the admin/change_form.html template uses block.super in the bodyclass block. """ response = self.client.get('/test_admin/%s/admin_views/section/add/' % self.urlbit) self.assertContains(response, 'bodyclass_consistency_check ') def test_extended_bodyclass_template_change_password(self): """ Ensure that the auth/user/change_password.html template uses block super in the bodyclass block. """ user = User.objects.get(username='super') response = self.client.get('/test_admin/%s/auth/user/%s/password/' % (self.urlbit, user.id)) self.assertContains(response, 'bodyclass_consistency_check ') def test_extended_bodyclass_template_index(self): """ Ensure that the admin/index.html template uses block.super in the bodyclass block. """ response = self.client.get('/test_admin/%s/' % self.urlbit) self.assertContains(response, 'bodyclass_consistency_check ') def test_extended_bodyclass_change_list(self): """ Ensure that the admin/change_list.html' template uses block.super in the bodyclass block. """ response = self.client.get('/test_admin/%s/admin_views/article/' % self.urlbit) self.assertContains(response, 'bodyclass_consistency_check ') def test_extended_bodyclass_template_login(self): """ Ensure that the admin/login.html template uses block.super in the bodyclass block. """ self.client.logout() response = self.client.get('/test_admin/%s/login/' % self.urlbit) self.assertContains(response, 'bodyclass_consistency_check ') def test_extended_bodyclass_template_delete_confirmation(self): """ Ensure that the admin/delete_confirmation.html template uses block.super in the bodyclass block. """ group = Group.objects.create(name="foogroup") response = self.client.get('/test_admin/%s/auth/group/%s/delete/' % (self.urlbit, group.id)) self.assertContains(response, 'bodyclass_consistency_check ') def test_extended_bodyclass_template_delete_selected_confirmation(self): """ Ensure that the admin/delete_selected_confirmation.html template uses block.super in bodyclass block. """ group = Group.objects.create(name="foogroup") post_data = { 'action': 'delete_selected', 'selected_across': '0', 'index': '0', '_selected_action': group.id } response = self.client.post('/test_admin/%s/auth/group/' % (self.urlbit), post_data) self.assertEqual(response.context['site_header'], 'Django administration') self.assertContains(response, 'bodyclass_consistency_check ') def test_filter_with_custom_template(self): """ Ensure that one can use a custom template to render an admin filter. Refs #17515. """ response = self.client.get("/test_admin/admin/admin_views/color2/") self.assertTemplateUsed(response, 'custom_filter_template.html') @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminViewFormUrlTest(TestCase): fixtures = ["admin-views-users.xml"] urlbit = "admin3" def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_change_form_URL_has_correct_value(self): """ Tests whether change_view has form_url in response.context """ response = self.client.get('/test_admin/%s/admin_views/section/1/' % self.urlbit) self.assertIn('form_url', response.context, msg='form_url not present in response.context') self.assertEqual(response.context['form_url'], 'pony') def test_initial_data_can_be_overridden(self): """ Tests that the behavior for setting initial form data can be overridden in the ModelAdmin class. Usually, the initial value is set via the GET params. """ response = self.client.get('/test_admin/%s/admin_views/restaurant/add/' % self.urlbit, {'name': 'test_value'}) # this would be the usual behaviour self.assertNotContains(response, 'value="test_value"') # this is the overridden behaviour self.assertContains(response, 'value="overridden_value"') @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminJavaScriptTest(TestCase): fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_js_minified_only_if_debug_is_false(self): """ Ensure that the minified versions of the JS files are only used when DEBUG is False. Refs #17521. """ with override_settings(DEBUG=False): response = self.client.get( '/test_admin/%s/admin_views/section/add/' % 'admin') self.assertNotContains(response, 'jquery.js') self.assertContains(response, 'jquery.min.js') self.assertNotContains(response, 'prepopulate.js') self.assertContains(response, 'prepopulate.min.js') self.assertNotContains(response, 'actions.js') self.assertContains(response, 'actions.min.js') self.assertNotContains(response, 'collapse.js') self.assertContains(response, 'collapse.min.js') self.assertNotContains(response, 'inlines.js') self.assertContains(response, 'inlines.min.js') with override_settings(DEBUG=True): response = self.client.get( '/test_admin/%s/admin_views/section/add/' % 'admin') self.assertContains(response, 'jquery.js') self.assertNotContains(response, 'jquery.min.js') self.assertContains(response, 'prepopulate.js') self.assertNotContains(response, 'prepopulate.min.js') self.assertContains(response, 'actions.js') self.assertNotContains(response, 'actions.min.js') self.assertContains(response, 'collapse.js') self.assertNotContains(response, 'collapse.min.js') self.assertContains(response, 'inlines.js') self.assertNotContains(response, 'inlines.min.js') @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class SaveAsTests(TestCase): fixtures = ['admin-views-users.xml', 'admin-views-person.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_save_as_duplication(self): """Ensure save as actually creates a new person""" post_data = {'_saveasnew': '', 'name': 'John M', 'gender': 1, 'age': 42} self.client.post('/test_admin/admin/admin_views/person/1/', post_data) self.assertEqual(len(Person.objects.filter(name='John M')), 1) self.assertEqual(len(Person.objects.filter(id=1)), 1) def test_save_as_display(self): """ Ensure that 'save as' is displayed when activated and after submitting invalid data aside save_as_new will not show us a form to overwrite the initial model. """ response = self.client.get('/test_admin/admin/admin_views/person/1/') self.assertTrue(response.context['save_as']) post_data = {'_saveasnew': '', 'name': 'John M', 'gender': 3, 'alive': 'checked'} response = self.client.post('/test_admin/admin/admin_views/person/1/', post_data) self.assertEqual(response.context['form_url'], '/test_admin/admin/admin_views/person/add/') @override_settings(ROOT_URLCONF="admin_views.urls") class CustomModelAdminTest(AdminViewBasicTestCase): urlbit = "admin2" def test_custom_admin_site_login_form(self): self.client.logout() response = self.client.get('/test_admin/admin2/', follow=True) self.assertIsInstance(response, TemplateResponse) self.assertEqual(response.status_code, 200) login = self.client.post('/test_admin/admin2/login/', { REDIRECT_FIELD_NAME: '/test_admin/admin2/', 'username': 'customform', 'password': 'secret', }, follow=True) self.assertIsInstance(login, TemplateResponse) self.assertEqual(login.status_code, 200) self.assertContains(login, 'custom form error') def test_custom_admin_site_login_template(self): self.client.logout() response = self.client.get('/test_admin/admin2/', follow=True) self.assertIsInstance(response, TemplateResponse) self.assertTemplateUsed(response, 'custom_admin/login.html') self.assertContains(response, 'Hello from a custom login template') def test_custom_admin_site_logout_template(self): response = self.client.get('/test_admin/admin2/logout/') self.assertIsInstance(response, TemplateResponse) self.assertTemplateUsed(response, 'custom_admin/logout.html') self.assertContains(response, 'Hello from a custom logout template') def test_custom_admin_site_index_view_and_template(self): try: response = self.client.get('/test_admin/admin2/') except TypeError: self.fail('AdminSite.index_template should accept a list of template paths') self.assertIsInstance(response, TemplateResponse) self.assertTemplateUsed(response, 'custom_admin/index.html') self.assertContains(response, 'Hello from a custom index template *bar*') def test_custom_admin_site_app_index_view_and_template(self): response = self.client.get('/test_admin/admin2/admin_views/') self.assertIsInstance(response, TemplateResponse) self.assertTemplateUsed(response, 'custom_admin/app_index.html') self.assertContains(response, 'Hello from a custom app_index template') def test_custom_admin_site_password_change_template(self): response = self.client.get('/test_admin/admin2/password_change/') self.assertIsInstance(response, TemplateResponse) self.assertTemplateUsed(response, 'custom_admin/password_change_form.html') self.assertContains(response, 'Hello from a custom password change form template') def test_custom_admin_site_password_change_with_extra_context(self): response = self.client.get('/test_admin/admin2/password_change/') self.assertIsInstance(response, TemplateResponse) self.assertTemplateUsed(response, 'custom_admin/password_change_form.html') self.assertContains(response, 'eggs') def test_custom_admin_site_password_change_done_template(self): response = self.client.get('/test_admin/admin2/password_change/done/') self.assertIsInstance(response, TemplateResponse) self.assertTemplateUsed(response, 'custom_admin/password_change_done.html') self.assertContains(response, 'Hello from a custom password change done template') def test_custom_admin_site_view(self): self.client.login(username='super', password='secret') response = self.client.get('/test_admin/%s/my_view/' % self.urlbit) self.assertEqual(response.content, b"Django is a magical pony!") def test_pwd_change_custom_template(self): self.client.login(username='super', password='secret') su = User.objects.get(username='super') try: response = self.client.get('/test_admin/admin4/auth/user/%s/password/' % su.pk) except TypeError: self.fail('ModelAdmin.change_user_password_template should accept a list of template paths') self.assertEqual(response.status_code, 200) def get_perm(Model, perm): """Return the permission object, for the Model""" ct = ContentType.objects.get_for_model(Model) return Permission.objects.get(content_type=ct, codename=perm) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminViewPermissionsTest(TestCase): """Tests for Admin Views Permissions.""" fixtures = ['admin-views-users.xml'] def setUp(self): """Test setup.""" # Setup permissions, for our users who can add, change, and delete. # We can't put this into the fixture, because the content type id # and the permission id could be different on each run of the test. opts = Article._meta # User who can add Articles add_user = User.objects.get(username='adduser') add_user.user_permissions.add(get_perm(Article, get_permission_codename('add', opts))) # User who can change Articles change_user = User.objects.get(username='changeuser') change_user.user_permissions.add(get_perm(Article, get_permission_codename('change', opts))) # User who can delete Articles delete_user = User.objects.get(username='deleteuser') delete_user.user_permissions.add(get_perm(Article, get_permission_codename('delete', opts))) delete_user.user_permissions.add(get_perm(Section, get_permission_codename('delete', Section._meta))) # login POST dicts self.super_login = { REDIRECT_FIELD_NAME: '/test_admin/admin/', 'username': 'super', 'password': 'secret', } self.super_email_login = { REDIRECT_FIELD_NAME: '/test_admin/admin/', 'username': 'super@example.com', 'password': 'secret', } self.super_email_bad_login = { REDIRECT_FIELD_NAME: '/test_admin/admin/', 'username': 'super@example.com', 'password': 'notsecret', } self.adduser_login = { REDIRECT_FIELD_NAME: '/test_admin/admin/', 'username': 'adduser', 'password': 'secret', } self.changeuser_login = { REDIRECT_FIELD_NAME: '/test_admin/admin/', 'username': 'changeuser', 'password': 'secret', } self.deleteuser_login = { REDIRECT_FIELD_NAME: '/test_admin/admin/', 'username': 'deleteuser', 'password': 'secret', } self.joepublic_login = { REDIRECT_FIELD_NAME: '/test_admin/admin/', 'username': 'joepublic', 'password': 'secret', } self.no_username_login = { REDIRECT_FIELD_NAME: '/test_admin/admin/', 'password': 'secret', } def test_login(self): """ Make sure only staff members can log in. Successful posts to the login page will redirect to the original url. Unsuccessful attempts will continue to render the login page with a 200 status code. """ login_url = reverse('admin:login') + '?next=/test_admin/admin/' # Super User response = self.client.get('/test_admin/admin/') self.assertEqual(response.status_code, 302) login = self.client.post(login_url, self.super_login) self.assertRedirects(login, '/test_admin/admin/') self.assertFalse(login.context) self.client.get('/test_admin/admin/logout/') # Test if user enters email address response = self.client.get('/test_admin/admin/') self.assertEqual(response.status_code, 302) login = self.client.post(login_url, self.super_email_login) self.assertContains(login, ERROR_MESSAGE) # only correct passwords get a username hint login = self.client.post(login_url, self.super_email_bad_login) self.assertContains(login, ERROR_MESSAGE) new_user = User(username='jondoe', password='secret', email='super@example.com') new_user.save() # check to ensure if there are multiple email addresses a user doesn't get a 500 login = self.client.post(login_url, self.super_email_login) self.assertContains(login, ERROR_MESSAGE) # Add User response = self.client.get('/test_admin/admin/') self.assertEqual(response.status_code, 302) login = self.client.post(login_url, self.adduser_login) self.assertRedirects(login, '/test_admin/admin/') self.assertFalse(login.context) self.client.get('/test_admin/admin/logout/') # Change User response = self.client.get('/test_admin/admin/') self.assertEqual(response.status_code, 302) login = self.client.post(login_url, self.changeuser_login) self.assertRedirects(login, '/test_admin/admin/') self.assertFalse(login.context) self.client.get('/test_admin/admin/logout/') # Delete User response = self.client.get('/test_admin/admin/') self.assertEqual(response.status_code, 302) login = self.client.post(login_url, self.deleteuser_login) self.assertRedirects(login, '/test_admin/admin/') self.assertFalse(login.context) self.client.get('/test_admin/admin/logout/') # Regular User should not be able to login. response = self.client.get('/test_admin/admin/') self.assertEqual(response.status_code, 302) login = self.client.post(login_url, self.joepublic_login) self.assertEqual(login.status_code, 200) self.assertContains(login, ERROR_MESSAGE) # Requests without username should not return 500 errors. response = self.client.get('/test_admin/admin/') self.assertEqual(response.status_code, 302) login = self.client.post(login_url, self.no_username_login) self.assertEqual(login.status_code, 200) form = login.context[0].get('form') self.assertEqual(form.errors['username'][0], 'This field is required.') def test_login_successfully_redirects_to_original_URL(self): response = self.client.get('/test_admin/admin/') self.assertEqual(response.status_code, 302) query_string = 'the-answer=42' redirect_url = '/test_admin/admin/?%s' % query_string new_next = {REDIRECT_FIELD_NAME: redirect_url} post_data = self.super_login.copy() post_data.pop(REDIRECT_FIELD_NAME) login = self.client.post( '%s?%s' % (reverse('admin:login'), urlencode(new_next)), post_data) self.assertRedirects(login, redirect_url) def test_double_login_is_not_allowed(self): """Regression test for #19327""" login_url = reverse('admin:login') + '?next=/test_admin/admin/' response = self.client.get('/test_admin/admin/') self.assertEqual(response.status_code, 302) # Establish a valid admin session login = self.client.post(login_url, self.super_login) self.assertRedirects(login, '/test_admin/admin/') self.assertFalse(login.context) # Logging in with non-admin user fails login = self.client.post(login_url, self.joepublic_login) self.assertEqual(login.status_code, 200) self.assertContains(login, ERROR_MESSAGE) # Establish a valid admin session login = self.client.post(login_url, self.super_login) self.assertRedirects(login, '/test_admin/admin/') self.assertFalse(login.context) # Logging in with admin user while already logged in login = self.client.post(login_url, self.super_login) self.assertRedirects(login, '/test_admin/admin/') self.assertFalse(login.context) self.client.get('/test_admin/admin/logout/') def test_add_view(self): """Test add view restricts access and actually adds items.""" login_url = reverse('admin:login') + '?next=/test_admin/admin/' add_dict = {'title': 'Døm ikke', 'content': '<p>great article</p>', 'date_0': '2008-03-18', 'date_1': '10:54:39', 'section': 1} # Change User should not have access to add articles self.client.get('/test_admin/admin/') self.client.post(login_url, self.changeuser_login) # make sure the view removes test cookie self.assertEqual(self.client.session.test_cookie_worked(), False) response = self.client.get('/test_admin/admin/admin_views/article/add/') self.assertEqual(response.status_code, 403) # Try POST just to make sure post = self.client.post('/test_admin/admin/admin_views/article/add/', add_dict) self.assertEqual(post.status_code, 403) self.assertEqual(Article.objects.all().count(), 3) self.client.get('/test_admin/admin/logout/') # Add user may login and POST to add view, then redirect to admin root self.client.get('/test_admin/admin/') self.client.post(login_url, self.adduser_login) addpage = self.client.get('/test_admin/admin/admin_views/article/add/') change_list_link = '&rsaquo; <a href="/test_admin/admin/admin_views/article/">Articles</a>' self.assertNotContains(addpage, change_list_link, msg_prefix='User restricted to add permission is given link to change list view in breadcrumbs.') post = self.client.post('/test_admin/admin/admin_views/article/add/', add_dict) self.assertRedirects(post, '/test_admin/admin/') self.assertEqual(Article.objects.all().count(), 4) self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].subject, 'Greetings from a created object') self.client.get('/test_admin/admin/logout/') # Super can add too, but is redirected to the change list view self.client.get('/test_admin/admin/') self.client.post(login_url, self.super_login) addpage = self.client.get('/test_admin/admin/admin_views/article/add/') self.assertContains(addpage, change_list_link, msg_prefix='Unrestricted user is not given link to change list view in breadcrumbs.') post = self.client.post('/test_admin/admin/admin_views/article/add/', add_dict) self.assertRedirects(post, '/test_admin/admin/admin_views/article/') self.assertEqual(Article.objects.all().count(), 5) self.client.get('/test_admin/admin/logout/') # 8509 - if a normal user is already logged in, it is possible # to change user into the superuser without error self.client.login(username='joepublic', password='secret') # Check and make sure that if user expires, data still persists self.client.get('/test_admin/admin/') self.client.post(login_url, self.super_login) # make sure the view removes test cookie self.assertEqual(self.client.session.test_cookie_worked(), False) def test_change_view(self): """Change view should restrict access and allow users to edit items.""" login_url = reverse('admin:login') + '?next=/test_admin/admin/' change_dict = {'title': 'Ikke fordømt', 'content': '<p>edited article</p>', 'date_0': '2008-03-18', 'date_1': '10:54:39', 'section': 1} # add user should not be able to view the list of article or change any of them self.client.get('/test_admin/admin/') self.client.post(login_url, self.adduser_login) response = self.client.get('/test_admin/admin/admin_views/article/') self.assertEqual(response.status_code, 403) response = self.client.get('/test_admin/admin/admin_views/article/1/') self.assertEqual(response.status_code, 403) post = self.client.post('/test_admin/admin/admin_views/article/1/', change_dict) self.assertEqual(post.status_code, 403) self.client.get('/test_admin/admin/logout/') # change user can view all items and edit them self.client.get('/test_admin/admin/') self.client.post(login_url, self.changeuser_login) response = self.client.get('/test_admin/admin/admin_views/article/') self.assertEqual(response.status_code, 200) response = self.client.get('/test_admin/admin/admin_views/article/1/') self.assertEqual(response.status_code, 200) post = self.client.post('/test_admin/admin/admin_views/article/1/', change_dict) self.assertRedirects(post, '/test_admin/admin/admin_views/article/') self.assertEqual(Article.objects.get(pk=1).content, '<p>edited article</p>') # one error in form should produce singular error message, multiple errors plural change_dict['title'] = '' post = self.client.post('/test_admin/admin/admin_views/article/1/', change_dict) self.assertContains(post, 'Please correct the error below.', msg_prefix='Singular error message not found in response to post with one error') change_dict['content'] = '' post = self.client.post('/test_admin/admin/admin_views/article/1/', change_dict) self.assertContains(post, 'Please correct the errors below.', msg_prefix='Plural error message not found in response to post with multiple errors') self.client.get('/test_admin/admin/logout/') # Test redirection when using row-level change permissions. Refs #11513. RowLevelChangePermissionModel.objects.create(id=1, name="odd id") RowLevelChangePermissionModel.objects.create(id=2, name="even id") for login_dict in [self.super_login, self.changeuser_login, self.adduser_login, self.deleteuser_login]: self.client.post(login_url, login_dict) response = self.client.get('/test_admin/admin/admin_views/rowlevelchangepermissionmodel/1/') self.assertEqual(response.status_code, 403) response = self.client.post('/test_admin/admin/admin_views/rowlevelchangepermissionmodel/1/', {'name': 'changed'}) self.assertEqual(RowLevelChangePermissionModel.objects.get(id=1).name, 'odd id') self.assertEqual(response.status_code, 403) response = self.client.get('/test_admin/admin/admin_views/rowlevelchangepermissionmodel/2/') self.assertEqual(response.status_code, 200) response = self.client.post('/test_admin/admin/admin_views/rowlevelchangepermissionmodel/2/', {'name': 'changed'}) self.assertEqual(RowLevelChangePermissionModel.objects.get(id=2).name, 'changed') self.assertRedirects(response, '/test_admin/admin/') self.client.get('/test_admin/admin/logout/') for login_dict in [self.joepublic_login, self.no_username_login]: self.client.post(login_url, login_dict) response = self.client.get('/test_admin/admin/admin_views/rowlevelchangepermissionmodel/1/', follow=True) self.assertEqual(response.status_code, 200) self.assertContains(response, 'login-form') response = self.client.post('/test_admin/admin/admin_views/rowlevelchangepermissionmodel/1/', {'name': 'changed'}, follow=True) self.assertEqual(RowLevelChangePermissionModel.objects.get(id=1).name, 'odd id') self.assertEqual(response.status_code, 200) self.assertContains(response, 'login-form') response = self.client.get('/test_admin/admin/admin_views/rowlevelchangepermissionmodel/2/', follow=True) self.assertEqual(response.status_code, 200) self.assertContains(response, 'login-form') response = self.client.post('/test_admin/admin/admin_views/rowlevelchangepermissionmodel/2/', {'name': 'changed again'}, follow=True) self.assertEqual(RowLevelChangePermissionModel.objects.get(id=2).name, 'changed') self.assertEqual(response.status_code, 200) self.assertContains(response, 'login-form') self.client.get('/test_admin/admin/logout/') def test_history_view(self): """History view should restrict access.""" login_url = reverse('admin:login') + '?next=/test_admin/admin/' # add user should not be able to view the list of article or change any of them self.client.get('/test_admin/admin/') self.client.post(login_url, self.adduser_login) response = self.client.get('/test_admin/admin/admin_views/article/1/history/') self.assertEqual(response.status_code, 403) self.client.get('/test_admin/admin/logout/') # change user can view all items and edit them self.client.get('/test_admin/admin/') self.client.post(login_url, self.changeuser_login) response = self.client.get('/test_admin/admin/admin_views/article/1/history/') self.assertEqual(response.status_code, 200) # Test redirection when using row-level change permissions. Refs #11513. RowLevelChangePermissionModel.objects.create(id=1, name="odd id") RowLevelChangePermissionModel.objects.create(id=2, name="even id") for login_dict in [self.super_login, self.changeuser_login, self.adduser_login, self.deleteuser_login]: self.client.post(login_url, login_dict) response = self.client.get('/test_admin/admin/admin_views/rowlevelchangepermissionmodel/1/history/') self.assertEqual(response.status_code, 403) response = self.client.get('/test_admin/admin/admin_views/rowlevelchangepermissionmodel/2/history/') self.assertEqual(response.status_code, 200) self.client.get('/test_admin/admin/logout/') for login_dict in [self.joepublic_login, self.no_username_login]: self.client.post(login_url, login_dict) response = self.client.get('/test_admin/admin/admin_views/rowlevelchangepermissionmodel/1/history/', follow=True) self.assertEqual(response.status_code, 200) self.assertContains(response, 'login-form') response = self.client.get('/test_admin/admin/admin_views/rowlevelchangepermissionmodel/2/history/', follow=True) self.assertEqual(response.status_code, 200) self.assertContains(response, 'login-form') self.client.get('/test_admin/admin/logout/') def test_conditionally_show_add_section_link(self): """ The foreign key widget should only show the "add related" button if the user has permission to add that related item. """ login_url = reverse('admin:login') + '?next=/test_admin/admin/' # Set up and log in user. url = '/test_admin/admin/admin_views/article/add/' add_link_text = ' class="add-another"' self.client.get('/test_admin/admin/') self.client.post(login_url, self.adduser_login) # The add user can't add sections yet, so they shouldn't see the "add # section" link. response = self.client.get(url) self.assertNotContains(response, add_link_text) # Allow the add user to add sections too. Now they can see the "add # section" link. add_user = User.objects.get(username='adduser') perm = get_perm(Section, get_permission_codename('add', Section._meta)) add_user.user_permissions.add(perm) response = self.client.get(url) self.assertContains(response, add_link_text) def test_custom_model_admin_templates(self): login_url = reverse('admin:login') + '?next=/test_admin/admin/' self.client.get('/test_admin/admin/') self.client.post(login_url, self.super_login) # Test custom change list template with custom extra context response = self.client.get('/test_admin/admin/admin_views/customarticle/') self.assertContains(response, "var hello = 'Hello!';") self.assertTemplateUsed(response, 'custom_admin/change_list.html') # Test custom add form template response = self.client.get('/test_admin/admin/admin_views/customarticle/add/') self.assertTemplateUsed(response, 'custom_admin/add_form.html') # Add an article so we can test delete, change, and history views post = self.client.post('/test_admin/admin/admin_views/customarticle/add/', { 'content': '<p>great article</p>', 'date_0': '2008-03-18', 'date_1': '10:54:39' }) self.assertRedirects(post, '/test_admin/admin/admin_views/customarticle/') self.assertEqual(CustomArticle.objects.all().count(), 1) article_pk = CustomArticle.objects.all()[0].pk # Test custom delete, change, and object history templates # Test custom change form template response = self.client.get('/test_admin/admin/admin_views/customarticle/%d/' % article_pk) self.assertTemplateUsed(response, 'custom_admin/change_form.html') response = self.client.get('/test_admin/admin/admin_views/customarticle/%d/delete/' % article_pk) self.assertTemplateUsed(response, 'custom_admin/delete_confirmation.html') response = self.client.post('/test_admin/admin/admin_views/customarticle/', data={ 'index': 0, 'action': ['delete_selected'], '_selected_action': ['1'], }) self.assertTemplateUsed(response, 'custom_admin/delete_selected_confirmation.html') response = self.client.get('/test_admin/admin/admin_views/customarticle/%d/history/' % article_pk) self.assertTemplateUsed(response, 'custom_admin/object_history.html') self.client.get('/test_admin/admin/logout/') def test_delete_view(self): """Delete view should restrict access and actually delete items.""" login_url = reverse('admin:login') + '?next=/test_admin/admin/' delete_dict = {'post': 'yes'} # add user should not be able to delete articles self.client.get('/test_admin/admin/') self.client.post(login_url, self.adduser_login) response = self.client.get('/test_admin/admin/admin_views/article/1/delete/') self.assertEqual(response.status_code, 403) post = self.client.post('/test_admin/admin/admin_views/article/1/delete/', delete_dict) self.assertEqual(post.status_code, 403) self.assertEqual(Article.objects.all().count(), 3) self.client.get('/test_admin/admin/logout/') # Delete user can delete self.client.get('/test_admin/admin/') self.client.post(login_url, self.deleteuser_login) response = self.client.get('/test_admin/admin/admin_views/section/1/delete/') self.assertContains(response, "<h2>Summary</h2>") self.assertContains(response, "<li>Articles: 3</li>") # test response contains link to related Article self.assertContains(response, "admin_views/article/1/") response = self.client.get('/test_admin/admin/admin_views/article/1/delete/') self.assertContains(response, "admin_views/article/1/") self.assertContains(response, "<h2>Summary</h2>") self.assertContains(response, "<li>Articles: 1</li>") self.assertEqual(response.status_code, 200) post = self.client.post('/test_admin/admin/admin_views/article/1/delete/', delete_dict) self.assertRedirects(post, '/test_admin/admin/') self.assertEqual(Article.objects.all().count(), 2) self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].subject, 'Greetings from a deleted object') article_ct = ContentType.objects.get_for_model(Article) logged = LogEntry.objects.get(content_type=article_ct, action_flag=DELETION) self.assertEqual(logged.object_id, '1') self.client.get('/test_admin/admin/logout/') def test_disabled_permissions_when_logged_in(self): self.client.login(username='super', password='secret') superuser = User.objects.get(username='super') superuser.is_active = False superuser.save() response = self.client.get('/test_admin/admin/', follow=True) self.assertContains(response, 'id="login-form"') self.assertNotContains(response, 'Log out') response = self.client.get('/test_admin/admin/secure-view/', follow=True) self.assertContains(response, 'id="login-form"') def test_disabled_staff_permissions_when_logged_in(self): self.client.login(username='super', password='secret') superuser = User.objects.get(username='super') superuser.is_staff = False superuser.save() response = self.client.get('/test_admin/admin/', follow=True) self.assertContains(response, 'id="login-form"') self.assertNotContains(response, 'Log out') response = self.client.get('/test_admin/admin/secure-view/', follow=True) self.assertContains(response, 'id="login-form"') def test_app_index_fail_early(self): """ If a user has no module perms, avoid iterating over all the modeladmins in the registry. """ login_url = reverse('admin:login') + '?next=/test_admin/admin/' opts = Article._meta change_user = User.objects.get(username='changeuser') permission = get_perm(Article, get_permission_codename('change', opts)) self.client.post(login_url, self.changeuser_login) # the user has no module permissions, because this module doesn't exist change_user.user_permissions.remove(permission) response = self.client.get('/test_admin/admin/admin_views/') self.assertEqual(response.status_code, 403) # the user now has module permissions change_user.user_permissions.add(permission) response = self.client.get('/test_admin/admin/admin_views/') self.assertEqual(response.status_code, 200) def test_shortcut_view_only_available_to_staff(self): """ Only admin users should be able to use the admin shortcut view. """ model_ctype = ContentType.objects.get_for_model(ModelWithStringPrimaryKey) obj = ModelWithStringPrimaryKey.objects.create(string_pk='foo') shortcut_url = "/test_admin/admin/r/%s/%s/" % (model_ctype.pk, obj.pk) # Not logged in: we should see the login page. response = self.client.get(shortcut_url, follow=True) self.assertTemplateUsed(response, 'admin/login.html') # Logged in? Redirect. self.client.login(username='super', password='secret') response = self.client.get(shortcut_url, follow=False) # Can't use self.assertRedirects() because User.get_absolute_url() is silly. self.assertEqual(response.status_code, 302) # Domain may depend on contrib.sites tests also run six.assertRegex(self, response.url, 'http://(testserver|example.com)/dummy/foo/') def test_has_module_permission(self): """ Ensure that has_module_permission() returns True for all users who have any permission for that module (add, change, or delete), so that the module is displayed on the admin index page. """ login_url = reverse('admin:login') + '?next=/test_admin/admin/' self.client.post(login_url, self.super_login) response = self.client.get('/test_admin/admin/') self.assertContains(response, 'admin_views') self.assertContains(response, 'Articles') self.client.get('/test_admin/admin/logout/') self.client.post(login_url, self.adduser_login) response = self.client.get('/test_admin/admin/') self.assertContains(response, 'admin_views') self.assertContains(response, 'Articles') self.client.get('/test_admin/admin/logout/') self.client.post(login_url, self.changeuser_login) response = self.client.get('/test_admin/admin/') self.assertContains(response, 'admin_views') self.assertContains(response, 'Articles') self.client.get('/test_admin/admin/logout/') self.client.post(login_url, self.deleteuser_login) response = self.client.get('/test_admin/admin/') self.assertContains(response, 'admin_views') self.assertContains(response, 'Articles') self.client.get('/test_admin/admin/logout/') def test_overriding_has_module_permission(self): """ Ensure that overriding has_module_permission() has the desired effect. In this case, it always returns False, so the module should not be displayed on the admin index page for any users. """ login_url = reverse('admin:login') + '?next=/test_admin/admin7/' self.client.post(login_url, self.super_login) response = self.client.get('/test_admin/admin7/') self.assertNotContains(response, 'admin_views') self.assertNotContains(response, 'Articles') self.client.get('/test_admin/admin7/logout/') self.client.post(login_url, self.adduser_login) response = self.client.get('/test_admin/admin7/') self.assertNotContains(response, 'admin_views') self.assertNotContains(response, 'Articles') self.client.get('/test_admin/admin7/logout/') self.client.post(login_url, self.changeuser_login) response = self.client.get('/test_admin/admin7/') self.assertNotContains(response, 'admin_views') self.assertNotContains(response, 'Articles') self.client.get('/test_admin/admin7/logout/') self.client.post(login_url, self.deleteuser_login) response = self.client.get('/test_admin/admin7/') self.assertNotContains(response, 'admin_views') self.assertNotContains(response, 'Articles') self.client.get('/test_admin/admin7/logout/') @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminViewsNoUrlTest(TestCase): """Regression test for #17333""" fixtures = ['admin-views-users.xml'] def setUp(self): opts = Report._meta # User who can change Reports change_user = User.objects.get(username='changeuser') change_user.user_permissions.add(get_perm(Report, get_permission_codename('change', opts))) # login POST dict self.changeuser_login = { REDIRECT_FIELD_NAME: '/test_admin/admin/', 'username': 'changeuser', 'password': 'secret', } def test_no_standard_modeladmin_urls(self): """Admin index views don't break when user's ModelAdmin removes standard urls""" self.client.get('/test_admin/admin/') r = self.client.post(reverse('admin:login'), self.changeuser_login) r = self.client.get('/test_admin/admin/') # we shouldn' get an 500 error caused by a NoReverseMatch self.assertEqual(r.status_code, 200) self.client.get('/test_admin/admin/logout/') @skipUnlessDBFeature('can_defer_constraint_checks') @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminViewDeletedObjectsTest(TestCase): fixtures = ['admin-views-users.xml', 'deleted-objects.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_nesting(self): """ Objects should be nested to display the relationships that cause them to be scheduled for deletion. """ pattern = re.compile(br"""<li>Plot: <a href=".+/admin_views/plot/1/">World Domination</a>\s*<ul>\s*<li>Plot details: <a href=".+/admin_views/plotdetails/1/">almost finished</a>""") response = self.client.get('/test_admin/admin/admin_views/villain/%s/delete/' % quote(1)) six.assertRegex(self, response.content, pattern) def test_cyclic(self): """ Cyclic relationships should still cause each object to only be listed once. """ one = """<li>Cyclic one: <a href="/test_admin/admin/admin_views/cyclicone/1/">I am recursive</a>""" two = """<li>Cyclic two: <a href="/test_admin/admin/admin_views/cyclictwo/1/">I am recursive too</a>""" response = self.client.get('/test_admin/admin/admin_views/cyclicone/%s/delete/' % quote(1)) self.assertContains(response, one, 1) self.assertContains(response, two, 1) def test_perms_needed(self): self.client.logout() delete_user = User.objects.get(username='deleteuser') delete_user.user_permissions.add(get_perm(Plot, get_permission_codename('delete', Plot._meta))) self.assertTrue(self.client.login(username='deleteuser', password='secret')) response = self.client.get('/test_admin/admin/admin_views/plot/%s/delete/' % quote(1)) self.assertContains(response, "your account doesn't have permission to delete the following types of objects") self.assertContains(response, "<li>plot details</li>") def test_protected(self): q = Question.objects.create(question="Why?") a1 = Answer.objects.create(question=q, answer="Because.") a2 = Answer.objects.create(question=q, answer="Yes.") response = self.client.get("/test_admin/admin/admin_views/question/%s/delete/" % quote(q.pk)) self.assertContains(response, "would require deleting the following protected related objects") self.assertContains(response, '<li>Answer: <a href="/test_admin/admin/admin_views/answer/%s/">Because.</a></li>' % a1.pk) self.assertContains(response, '<li>Answer: <a href="/test_admin/admin/admin_views/answer/%s/">Yes.</a></li>' % a2.pk) def test_not_registered(self): should_contain = """<li>Secret hideout: underground bunker""" response = self.client.get('/test_admin/admin/admin_views/villain/%s/delete/' % quote(1)) self.assertContains(response, should_contain, 1) def test_multiple_fkeys_to_same_model(self): """ If a deleted object has two relationships from another model, both of those should be followed in looking for related objects to delete. """ should_contain = """<li>Plot: <a href="/test_admin/admin/admin_views/plot/1/">World Domination</a>""" response = self.client.get('/test_admin/admin/admin_views/villain/%s/delete/' % quote(1)) self.assertContains(response, should_contain) response = self.client.get('/test_admin/admin/admin_views/villain/%s/delete/' % quote(2)) self.assertContains(response, should_contain) def test_multiple_fkeys_to_same_instance(self): """ If a deleted object has two relationships pointing to it from another object, the other object should still only be listed once. """ should_contain = """<li>Plot: <a href="/test_admin/admin/admin_views/plot/2/">World Peace</a></li>""" response = self.client.get('/test_admin/admin/admin_views/villain/%s/delete/' % quote(2)) self.assertContains(response, should_contain, 1) def test_inheritance(self): """ In the case of an inherited model, if either the child or parent-model instance is deleted, both instances are listed for deletion, as well as any relationships they have. """ should_contain = [ """<li>Villain: <a href="/test_admin/admin/admin_views/villain/3/">Bob</a>""", """<li>Super villain: <a href="/test_admin/admin/admin_views/supervillain/3/">Bob</a>""", """<li>Secret hideout: floating castle""", """<li>Super secret hideout: super floating castle!""" ] response = self.client.get('/test_admin/admin/admin_views/villain/%s/delete/' % quote(3)) for should in should_contain: self.assertContains(response, should, 1) response = self.client.get('/test_admin/admin/admin_views/supervillain/%s/delete/' % quote(3)) for should in should_contain: self.assertContains(response, should, 1) def test_generic_relations(self): """ If a deleted object has GenericForeignKeys pointing to it, those objects should be listed for deletion. """ plot = Plot.objects.get(pk=3) FunkyTag.objects.create(content_object=plot, name='hott') should_contain = """<li>Funky tag: <a href="/test_admin/admin/admin_views/funkytag/1/">hott""" response = self.client.get('/test_admin/admin/admin_views/plot/%s/delete/' % quote(3)) self.assertContains(response, should_contain) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class TestGenericRelations(TestCase): fixtures = ['admin-views-users.xml', 'deleted-objects.xml'] def setUp(self): self.client.login(username='super', password='secret') def test_generic_content_object_in_list_display(self): plot = Plot.objects.get(pk=3) FunkyTag.objects.create(content_object=plot, name='hott') response = self.client.get('/test_admin/admin/admin_views/funkytag/') self.assertContains(response, "%s</td>" % plot) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminViewStringPrimaryKeyTest(TestCase): fixtures = ['admin-views-users.xml', 'string-primary-key.xml'] def __init__(self, *args): super(AdminViewStringPrimaryKeyTest, self).__init__(*args) self.pk = """abcdefghijklmnopqrstuvwxyz ABCDEFGHIJKLMNOPQRSTUVWXYZ 1234567890 -_.!~*'() ;/?:@&=+$, <>#%" {}|\^[]`""" def setUp(self): self.client.login(username='super', password='secret') content_type_pk = ContentType.objects.get_for_model(ModelWithStringPrimaryKey).pk LogEntry.objects.log_action(100, content_type_pk, self.pk, self.pk, 2, change_message='Changed something') def tearDown(self): self.client.logout() def test_get_history_view(self): """ Retrieving the history for an object using urlencoded form of primary key should work. Refs #12349, #18550. """ response = self.client.get('/test_admin/admin/admin_views/modelwithstringprimarykey/%s/history/' % quote(self.pk)) self.assertContains(response, escape(self.pk)) self.assertContains(response, 'Changed something') self.assertEqual(response.status_code, 200) def test_get_change_view(self): "Retrieving the object using urlencoded form of primary key should work" response = self.client.get('/test_admin/admin/admin_views/modelwithstringprimarykey/%s/' % quote(self.pk)) self.assertContains(response, escape(self.pk)) self.assertEqual(response.status_code, 200) def test_changelist_to_changeform_link(self): "Link to the changeform of the object in changelist should use reverse() and be quoted -- #18072" prefix = '/test_admin/admin/admin_views/modelwithstringprimarykey/' response = self.client.get(prefix) # this URL now comes through reverse(), thus url quoting and iri_to_uri encoding pk_final_url = escape(iri_to_uri(quote(self.pk))) should_contain = """<th class="field-__str__"><a href="%s%s/">%s</a></th>""" % (prefix, pk_final_url, escape(self.pk)) self.assertContains(response, should_contain) def test_recentactions_link(self): "The link from the recent actions list referring to the changeform of the object should be quoted" response = self.client.get('/test_admin/admin/') link = reverse('admin:admin_views_modelwithstringprimarykey_change', args=(quote(self.pk),)) should_contain = """<a href="%s">%s</a>""" % (escape(link), escape(self.pk)) self.assertContains(response, should_contain) def test_recentactions_without_content_type(self): "If a LogEntry is missing content_type it will not display it in span tag under the hyperlink." response = self.client.get('/test_admin/admin/') link = reverse('admin:admin_views_modelwithstringprimarykey_change', args=(quote(self.pk),)) should_contain = """<a href="%s">%s</a>""" % (escape(link), escape(self.pk)) self.assertContains(response, should_contain) should_contain = "Model with string primary key" # capitalized in Recent Actions self.assertContains(response, should_contain) logentry = LogEntry.objects.get(content_type__name__iexact=should_contain) # http://code.djangoproject.com/ticket/10275 # if the log entry doesn't have a content type it should still be # possible to view the Recent Actions part logentry.content_type = None logentry.save() counted_presence_before = response.content.count(force_bytes(should_contain)) response = self.client.get('/test_admin/admin/') counted_presence_after = response.content.count(force_bytes(should_contain)) self.assertEqual(counted_presence_before - 1, counted_presence_after) def test_logentry_get_admin_url(self): "LogEntry.get_admin_url returns a URL to edit the entry's object or None for non-existent (possibly deleted) models" log_entry_name = "Model with string primary key" # capitalized in Recent Actions logentry = LogEntry.objects.get(content_type__name__iexact=log_entry_name) model = "modelwithstringprimarykey" desired_admin_url = "/test_admin/admin/admin_views/%s/%s/" % (model, iri_to_uri(quote(self.pk))) self.assertEqual(logentry.get_admin_url(), desired_admin_url) logentry.content_type.model = "non-existent" self.assertEqual(logentry.get_admin_url(), None) def test_deleteconfirmation_link(self): "The link from the delete confirmation page referring back to the changeform of the object should be quoted" response = self.client.get('/test_admin/admin/admin_views/modelwithstringprimarykey/%s/delete/' % quote(self.pk)) # this URL now comes through reverse(), thus url quoting and iri_to_uri encoding should_contain = """/%s/">%s</a>""" % (escape(iri_to_uri(quote(self.pk))), escape(self.pk)) self.assertContains(response, should_contain) def test_url_conflicts_with_add(self): "A model with a primary key that ends with add should be visible" add_model = ModelWithStringPrimaryKey(pk="i have something to add") add_model.save() response = self.client.get('/test_admin/admin/admin_views/modelwithstringprimarykey/%s/' % quote(add_model.pk)) should_contain = """<h1>Change model with string primary key</h1>""" self.assertContains(response, should_contain) def test_url_conflicts_with_delete(self): "A model with a primary key that ends with delete should be visible" delete_model = ModelWithStringPrimaryKey(pk="delete") delete_model.save() response = self.client.get('/test_admin/admin/admin_views/modelwithstringprimarykey/%s/' % quote(delete_model.pk)) should_contain = """<h1>Change model with string primary key</h1>""" self.assertContains(response, should_contain) def test_url_conflicts_with_history(self): "A model with a primary key that ends with history should be visible" history_model = ModelWithStringPrimaryKey(pk="history") history_model.save() response = self.client.get('/test_admin/admin/admin_views/modelwithstringprimarykey/%s/' % quote(history_model.pk)) should_contain = """<h1>Change model with string primary key</h1>""" self.assertContains(response, should_contain) def test_shortcut_view_with_escaping(self): "'View on site should' work properly with char fields" model = ModelWithStringPrimaryKey(pk='abc_123') model.save() response = self.client.get('/test_admin/admin/admin_views/modelwithstringprimarykey/%s/' % quote(model.pk)) should_contain = '/%s/" class="viewsitelink">' % model.pk self.assertContains(response, should_contain) def test_change_view_history_link(self): """Object history button link should work and contain the pk value quoted.""" url = reverse('admin:%s_modelwithstringprimarykey_change' % ModelWithStringPrimaryKey._meta.app_label, args=(quote(self.pk),)) response = self.client.get(url) self.assertEqual(response.status_code, 200) expected_link = reverse('admin:%s_modelwithstringprimarykey_history' % ModelWithStringPrimaryKey._meta.app_label, args=(quote(self.pk),)) self.assertContains(response, '<a href="%s" class="historylink"' % expected_link) def test_redirect_on_add_view_continue_button(self): """As soon as an object is added using "Save and continue editing" button, the user should be redirected to the object's change_view. In case primary key is a string containing some special characters like slash or underscore, these characters must be escaped (see #22266) """ response = self.client.post( '/test_admin/admin/admin_views/modelwithstringprimarykey/add/', { 'string_pk': '123/history', "_continue": "1", # Save and continue editing } ) self.assertEqual(response.status_code, 302) # temporary redirect self.assertEqual( response['location'], ( 'http://testserver/test_admin/admin/admin_views/' 'modelwithstringprimarykey/123_2Fhistory/' # PK is quoted ) ) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class SecureViewTests(TestCase): """ Test behavior of a view protected by the staff_member_required decorator. """ fixtures = ['admin-views-users.xml'] def tearDown(self): self.client.logout() def test_secure_view_shows_login_if_not_logged_in(self): """ Ensure that we see the admin login form. """ secure_url = '/test_admin/admin/secure-view/' response = self.client.get(secure_url) self.assertRedirects(response, '%s?next=%s' % (reverse('admin:login'), secure_url)) response = self.client.get(secure_url, follow=True) self.assertTemplateUsed(response, 'admin/login.html') self.assertEqual(response.context[REDIRECT_FIELD_NAME], secure_url) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminViewUnicodeTest(TestCase): fixtures = ['admin-views-unicode.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_unicode_edit(self): """ A test to ensure that POST on edit_view handles non-ASCII characters. """ post_data = { "name": "Test lærdommer", # inline data "chapter_set-TOTAL_FORMS": "6", "chapter_set-INITIAL_FORMS": "3", "chapter_set-MAX_NUM_FORMS": "0", "chapter_set-0-id": "1", "chapter_set-0-title": "Norske bostaver æøå skaper problemer", "chapter_set-0-content": "<p>Svært frustrerende med UnicodeDecodeError</p>", "chapter_set-1-id": "2", "chapter_set-1-title": "Kjærlighet.", "chapter_set-1-content": "<p>La kjærligheten til de lidende seire.</p>", "chapter_set-2-id": "3", "chapter_set-2-title": "Need a title.", "chapter_set-2-content": "<p>Newest content</p>", "chapter_set-3-id": "", "chapter_set-3-title": "", "chapter_set-3-content": "", "chapter_set-4-id": "", "chapter_set-4-title": "", "chapter_set-4-content": "", "chapter_set-5-id": "", "chapter_set-5-title": "", "chapter_set-5-content": "", } response = self.client.post('/test_admin/admin/admin_views/book/1/', post_data) self.assertEqual(response.status_code, 302) # redirect somewhere def test_unicode_delete(self): """ Ensure that the delete_view handles non-ASCII characters """ delete_dict = {'post': 'yes'} response = self.client.get('/test_admin/admin/admin_views/book/1/delete/') self.assertEqual(response.status_code, 200) response = self.client.post('/test_admin/admin/admin_views/book/1/delete/', delete_dict) self.assertRedirects(response, '/test_admin/admin/admin_views/book/') @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminViewListEditable(TestCase): fixtures = ['admin-views-users.xml', 'admin-views-person.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_inheritance(self): Podcast.objects.create(name="This Week in Django", release_date=datetime.date.today()) response = self.client.get('/test_admin/admin/admin_views/podcast/') self.assertEqual(response.status_code, 200) def test_inheritance_2(self): Vodcast.objects.create(name="This Week in Django", released=True) response = self.client.get('/test_admin/admin/admin_views/vodcast/') self.assertEqual(response.status_code, 200) def test_custom_pk(self): Language.objects.create(iso='en', name='English', english_name='English') response = self.client.get('/test_admin/admin/admin_views/language/') self.assertEqual(response.status_code, 200) def test_changelist_input_html(self): response = self.client.get('/test_admin/admin/admin_views/person/') # 2 inputs per object(the field and the hidden id field) = 6 # 4 management hidden fields = 4 # 4 action inputs (3 regular checkboxes, 1 checkbox to select all) # main form submit button = 1 # search field and search submit button = 2 # CSRF field = 1 # field to track 'select all' across paginated views = 1 # 6 + 4 + 4 + 1 + 2 + 1 + 1 = 19 inputs self.assertContains(response, "<input", count=19) # 1 select per object = 3 selects self.assertContains(response, "<select", count=4) def test_post_messages(self): # Ticket 12707: Saving inline editable should not show admin # action warnings data = { "form-TOTAL_FORMS": "3", "form-INITIAL_FORMS": "3", "form-MAX_NUM_FORMS": "0", "form-0-gender": "1", "form-0-id": "1", "form-1-gender": "2", "form-1-id": "2", "form-2-alive": "checked", "form-2-gender": "1", "form-2-id": "3", "_save": "Save", } response = self.client.post('/test_admin/admin/admin_views/person/', data, follow=True) self.assertEqual(len(response.context['messages']), 1) def test_post_submission(self): data = { "form-TOTAL_FORMS": "3", "form-INITIAL_FORMS": "3", "form-MAX_NUM_FORMS": "0", "form-0-gender": "1", "form-0-id": "1", "form-1-gender": "2", "form-1-id": "2", "form-2-alive": "checked", "form-2-gender": "1", "form-2-id": "3", "_save": "Save", } self.client.post('/test_admin/admin/admin_views/person/', data) self.assertEqual(Person.objects.get(name="John Mauchly").alive, False) self.assertEqual(Person.objects.get(name="Grace Hopper").gender, 2) # test a filtered page data = { "form-TOTAL_FORMS": "2", "form-INITIAL_FORMS": "2", "form-MAX_NUM_FORMS": "0", "form-0-id": "1", "form-0-gender": "1", "form-0-alive": "checked", "form-1-id": "3", "form-1-gender": "1", "form-1-alive": "checked", "_save": "Save", } self.client.post('/test_admin/admin/admin_views/person/?gender__exact=1', data) self.assertEqual(Person.objects.get(name="John Mauchly").alive, True) # test a searched page data = { "form-TOTAL_FORMS": "1", "form-INITIAL_FORMS": "1", "form-MAX_NUM_FORMS": "0", "form-0-id": "1", "form-0-gender": "1", "_save": "Save", } self.client.post('/test_admin/admin/admin_views/person/?q=john', data) self.assertEqual(Person.objects.get(name="John Mauchly").alive, False) def test_non_field_errors(self): ''' Ensure that non field errors are displayed for each of the forms in the changelist's formset. Refs #13126. ''' fd1 = FoodDelivery.objects.create(reference='123', driver='bill', restaurant='thai') fd2 = FoodDelivery.objects.create(reference='456', driver='bill', restaurant='india') fd3 = FoodDelivery.objects.create(reference='789', driver='bill', restaurant='pizza') data = { "form-TOTAL_FORMS": "3", "form-INITIAL_FORMS": "3", "form-MAX_NUM_FORMS": "0", "form-0-id": str(fd1.id), "form-0-reference": "123", "form-0-driver": "bill", "form-0-restaurant": "thai", # Same data as above: Forbidden because of unique_together! "form-1-id": str(fd2.id), "form-1-reference": "456", "form-1-driver": "bill", "form-1-restaurant": "thai", "form-2-id": str(fd3.id), "form-2-reference": "789", "form-2-driver": "bill", "form-2-restaurant": "pizza", "_save": "Save", } response = self.client.post('/test_admin/admin/admin_views/fooddelivery/', data) self.assertContains(response, '<tr><td colspan="4"><ul class="errorlist nonfield"><li>Food delivery with this Driver and Restaurant already exists.</li></ul></td></tr>', 1, html=True) data = { "form-TOTAL_FORMS": "3", "form-INITIAL_FORMS": "3", "form-MAX_NUM_FORMS": "0", "form-0-id": str(fd1.id), "form-0-reference": "123", "form-0-driver": "bill", "form-0-restaurant": "thai", # Same data as above: Forbidden because of unique_together! "form-1-id": str(fd2.id), "form-1-reference": "456", "form-1-driver": "bill", "form-1-restaurant": "thai", # Same data also. "form-2-id": str(fd3.id), "form-2-reference": "789", "form-2-driver": "bill", "form-2-restaurant": "thai", "_save": "Save", } response = self.client.post('/test_admin/admin/admin_views/fooddelivery/', data) self.assertContains(response, '<tr><td colspan="4"><ul class="errorlist nonfield"><li>Food delivery with this Driver and Restaurant already exists.</li></ul></td></tr>', 2, html=True) def test_non_form_errors(self): # test if non-form errors are handled; ticket #12716 data = { "form-TOTAL_FORMS": "1", "form-INITIAL_FORMS": "1", "form-MAX_NUM_FORMS": "0", "form-0-id": "2", "form-0-alive": "1", "form-0-gender": "2", # Ensure that the form processing understands this as a list_editable "Save" # and not an action "Go". "_save": "Save", } response = self.client.post('/test_admin/admin/admin_views/person/', data) self.assertContains(response, "Grace is not a Zombie") def test_non_form_errors_is_errorlist(self): # test if non-form errors are correctly handled; ticket #12878 data = { "form-TOTAL_FORMS": "1", "form-INITIAL_FORMS": "1", "form-MAX_NUM_FORMS": "0", "form-0-id": "2", "form-0-alive": "1", "form-0-gender": "2", "_save": "Save", } response = self.client.post('/test_admin/admin/admin_views/person/', data) non_form_errors = response.context['cl'].formset.non_form_errors() self.assertIsInstance(non_form_errors, ErrorList) self.assertEqual(str(non_form_errors), str(ErrorList(["Grace is not a Zombie"]))) def test_list_editable_ordering(self): collector = Collector.objects.create(id=1, name="Frederick Clegg") Category.objects.create(id=1, order=1, collector=collector) Category.objects.create(id=2, order=2, collector=collector) Category.objects.create(id=3, order=0, collector=collector) Category.objects.create(id=4, order=0, collector=collector) # NB: The order values must be changed so that the items are reordered. data = { "form-TOTAL_FORMS": "4", "form-INITIAL_FORMS": "4", "form-MAX_NUM_FORMS": "0", "form-0-order": "14", "form-0-id": "1", "form-0-collector": "1", "form-1-order": "13", "form-1-id": "2", "form-1-collector": "1", "form-2-order": "1", "form-2-id": "3", "form-2-collector": "1", "form-3-order": "0", "form-3-id": "4", "form-3-collector": "1", # Ensure that the form processing understands this as a list_editable "Save" # and not an action "Go". "_save": "Save", } response = self.client.post('/test_admin/admin/admin_views/category/', data) # Successful post will redirect self.assertEqual(response.status_code, 302) # Check that the order values have been applied to the right objects self.assertEqual(Category.objects.get(id=1).order, 14) self.assertEqual(Category.objects.get(id=2).order, 13) self.assertEqual(Category.objects.get(id=3).order, 1) self.assertEqual(Category.objects.get(id=4).order, 0) def test_list_editable_pagination(self): """ Ensure that pagination works for list_editable items. Refs #16819. """ UnorderedObject.objects.create(id=1, name='Unordered object #1') UnorderedObject.objects.create(id=2, name='Unordered object #2') UnorderedObject.objects.create(id=3, name='Unordered object #3') response = self.client.get('/test_admin/admin/admin_views/unorderedobject/') self.assertContains(response, 'Unordered object #3') self.assertContains(response, 'Unordered object #2') self.assertNotContains(response, 'Unordered object #1') response = self.client.get('/test_admin/admin/admin_views/unorderedobject/?p=1') self.assertNotContains(response, 'Unordered object #3') self.assertNotContains(response, 'Unordered object #2') self.assertContains(response, 'Unordered object #1') def test_list_editable_action_submit(self): # List editable changes should not be executed if the action "Go" button is # used to submit the form. data = { "form-TOTAL_FORMS": "3", "form-INITIAL_FORMS": "3", "form-MAX_NUM_FORMS": "0", "form-0-gender": "1", "form-0-id": "1", "form-1-gender": "2", "form-1-id": "2", "form-2-alive": "checked", "form-2-gender": "1", "form-2-id": "3", "index": "0", "_selected_action": ['3'], "action": ['', 'delete_selected'], } self.client.post('/test_admin/admin/admin_views/person/', data) self.assertEqual(Person.objects.get(name="John Mauchly").alive, True) self.assertEqual(Person.objects.get(name="Grace Hopper").gender, 1) def test_list_editable_action_choices(self): # List editable changes should be executed if the "Save" button is # used to submit the form - any action choices should be ignored. data = { "form-TOTAL_FORMS": "3", "form-INITIAL_FORMS": "3", "form-MAX_NUM_FORMS": "0", "form-0-gender": "1", "form-0-id": "1", "form-1-gender": "2", "form-1-id": "2", "form-2-alive": "checked", "form-2-gender": "1", "form-2-id": "3", "_save": "Save", "_selected_action": ['1'], "action": ['', 'delete_selected'], } self.client.post('/test_admin/admin/admin_views/person/', data) self.assertEqual(Person.objects.get(name="John Mauchly").alive, False) self.assertEqual(Person.objects.get(name="Grace Hopper").gender, 2) def test_list_editable_popup(self): """ Fields should not be list-editable in popups. """ response = self.client.get('/test_admin/admin/admin_views/person/') self.assertNotEqual(response.context['cl'].list_editable, ()) response = self.client.get('/test_admin/admin/admin_views/person/?%s' % IS_POPUP_VAR) self.assertEqual(response.context['cl'].list_editable, ()) def test_pk_hidden_fields(self): """ Ensure that hidden pk fields aren't displayed in the table body and that their corresponding human-readable value is displayed instead. Note that the hidden pk fields are in fact be displayed but separately (not in the table), and only once. Refs #12475. """ story1 = Story.objects.create(title='The adventures of Guido', content='Once upon a time in Djangoland...') story2 = Story.objects.create(title='Crouching Tiger, Hidden Python', content='The Python was sneaking into...') response = self.client.get('/test_admin/admin/admin_views/story/') self.assertContains(response, 'id="id_form-0-id"', 1) # Only one hidden field, in a separate place than the table. self.assertContains(response, 'id="id_form-1-id"', 1) self.assertContains(response, '<div class="hiddenfields">\n<input type="hidden" name="form-0-id" value="%d" id="id_form-0-id" /><input type="hidden" name="form-1-id" value="%d" id="id_form-1-id" />\n</div>' % (story2.id, story1.id), html=True) self.assertContains(response, '<td class="field-id">%d</td>' % story1.id, 1) self.assertContains(response, '<td class="field-id">%d</td>' % story2.id, 1) def test_pk_hidden_fields_with_list_display_links(self): """ Similarly as test_pk_hidden_fields, but when the hidden pk fields are referenced in list_display_links. Refs #12475. """ story1 = OtherStory.objects.create(title='The adventures of Guido', content='Once upon a time in Djangoland...') story2 = OtherStory.objects.create(title='Crouching Tiger, Hidden Python', content='The Python was sneaking into...') link1 = reverse('admin:admin_views_otherstory_change', args=(story1.pk,)) link2 = reverse('admin:admin_views_otherstory_change', args=(story2.pk,)) response = self.client.get('/test_admin/admin/admin_views/otherstory/') self.assertContains(response, 'id="id_form-0-id"', 1) # Only one hidden field, in a separate place than the table. self.assertContains(response, 'id="id_form-1-id"', 1) self.assertContains(response, '<div class="hiddenfields">\n<input type="hidden" name="form-0-id" value="%d" id="id_form-0-id" /><input type="hidden" name="form-1-id" value="%d" id="id_form-1-id" />\n</div>' % (story2.id, story1.id), html=True) self.assertContains(response, '<th class="field-id"><a href="%s">%d</a></th>' % (link1, story1.id), 1) self.assertContains(response, '<th class="field-id"><a href="%s">%d</a></th>' % (link2, story2.id), 1) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminSearchTest(TestCase): fixtures = ['admin-views-users', 'multiple-child-classes', 'admin-views-person'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_search_on_sibling_models(self): "Check that a search that mentions sibling models" response = self.client.get('/test_admin/admin/admin_views/recommendation/?q=bar') # confirm the search returned 1 object self.assertContains(response, "\n1 recommendation\n") def test_with_fk_to_field(self): """Ensure that the to_field GET parameter is preserved when a search is performed. Refs #10918. """ response = self.client.get('/test_admin/admin/auth/user/?q=joe&%s=id' % TO_FIELD_VAR) self.assertContains(response, "\n1 user\n") self.assertContains(response, '<input type="hidden" name="%s" value="id"/>' % TO_FIELD_VAR, html=True) def test_exact_matches(self): response = self.client.get('/test_admin/admin/admin_views/recommendation/?q=bar') # confirm the search returned one object self.assertContains(response, "\n1 recommendation\n") response = self.client.get('/test_admin/admin/admin_views/recommendation/?q=ba') # confirm the search returned zero objects self.assertContains(response, "\n0 recommendations\n") def test_beginning_matches(self): response = self.client.get('/test_admin/admin/admin_views/person/?q=Gui') # confirm the search returned one object self.assertContains(response, "\n1 person\n") self.assertContains(response, "Guido") response = self.client.get('/test_admin/admin/admin_views/person/?q=uido') # confirm the search returned zero objects self.assertContains(response, "\n0 persons\n") self.assertNotContains(response, "Guido") def test_pluggable_search(self): PluggableSearchPerson.objects.create(name="Bob", age=10) PluggableSearchPerson.objects.create(name="Amy", age=20) response = self.client.get('/test_admin/admin/admin_views/pluggablesearchperson/?q=Bob') # confirm the search returned one object self.assertContains(response, "\n1 pluggable search person\n") self.assertContains(response, "Bob") response = self.client.get('/test_admin/admin/admin_views/pluggablesearchperson/?q=20') # confirm the search returned one object self.assertContains(response, "\n1 pluggable search person\n") self.assertContains(response, "Amy") def test_reset_link(self): """ Test presence of reset link in search bar ("1 result (_x total_)"). """ # 1 query for session + 1 for fetching user # + 1 for filtered result + 1 for filtered count # + 1 for total count with self.assertNumQueries(5): response = self.client.get('/test_admin/admin/admin_views/person/?q=Gui') self.assertContains(response, """<span class="small quiet">1 result (<a href="?">3 total</a>)</span>""", html=True) def test_no_total_count(self): """ #8408 -- "Show all" should be displayed instead of the total count if ModelAdmin.show_full_result_count is False. """ # 1 query for session + 1 for fetching user # + 1 for filtered result + 1 for filtered count with self.assertNumQueries(4): response = self.client.get('/test_admin/admin/admin_views/recommendation/?q=bar') self.assertContains(response, """<span class="small quiet">1 result (<a href="?">Show all</a>)</span>""", html=True) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminInheritedInlinesTest(TestCase): fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_inline(self): "Ensure that inline models which inherit from a common parent are correctly handled by admin." foo_user = "foo username" bar_user = "bar username" name_re = re.compile(b'name="(.*?)"') # test the add case response = self.client.get('/test_admin/admin/admin_views/persona/add/') names = name_re.findall(response.content) # make sure we have no duplicate HTML names self.assertEqual(len(names), len(set(names))) # test the add case post_data = { "name": "Test Name", # inline data "accounts-TOTAL_FORMS": "1", "accounts-INITIAL_FORMS": "0", "accounts-MAX_NUM_FORMS": "0", "accounts-0-username": foo_user, "accounts-2-TOTAL_FORMS": "1", "accounts-2-INITIAL_FORMS": "0", "accounts-2-MAX_NUM_FORMS": "0", "accounts-2-0-username": bar_user, } response = self.client.post('/test_admin/admin/admin_views/persona/add/', post_data) self.assertEqual(response.status_code, 302) # redirect somewhere self.assertEqual(Persona.objects.count(), 1) self.assertEqual(FooAccount.objects.count(), 1) self.assertEqual(BarAccount.objects.count(), 1) self.assertEqual(FooAccount.objects.all()[0].username, foo_user) self.assertEqual(BarAccount.objects.all()[0].username, bar_user) self.assertEqual(Persona.objects.all()[0].accounts.count(), 2) persona_id = Persona.objects.all()[0].id foo_id = FooAccount.objects.all()[0].id bar_id = BarAccount.objects.all()[0].id # test the edit case response = self.client.get('/test_admin/admin/admin_views/persona/%d/' % persona_id) names = name_re.findall(response.content) # make sure we have no duplicate HTML names self.assertEqual(len(names), len(set(names))) post_data = { "name": "Test Name", "accounts-TOTAL_FORMS": "2", "accounts-INITIAL_FORMS": "1", "accounts-MAX_NUM_FORMS": "0", "accounts-0-username": "%s-1" % foo_user, "accounts-0-account_ptr": str(foo_id), "accounts-0-persona": str(persona_id), "accounts-2-TOTAL_FORMS": "2", "accounts-2-INITIAL_FORMS": "1", "accounts-2-MAX_NUM_FORMS": "0", "accounts-2-0-username": "%s-1" % bar_user, "accounts-2-0-account_ptr": str(bar_id), "accounts-2-0-persona": str(persona_id), } response = self.client.post('/test_admin/admin/admin_views/persona/%d/' % persona_id, post_data) self.assertEqual(response.status_code, 302) self.assertEqual(Persona.objects.count(), 1) self.assertEqual(FooAccount.objects.count(), 1) self.assertEqual(BarAccount.objects.count(), 1) self.assertEqual(FooAccount.objects.all()[0].username, "%s-1" % foo_user) self.assertEqual(BarAccount.objects.all()[0].username, "%s-1" % bar_user) self.assertEqual(Persona.objects.all()[0].accounts.count(), 2) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminActionsTest(TestCase): fixtures = ['admin-views-users.xml', 'admin-views-actions.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_model_admin_custom_action(self): "Tests a custom action defined in a ModelAdmin method" action_data = { ACTION_CHECKBOX_NAME: [1], 'action': 'mail_admin', 'index': 0, } self.client.post('/test_admin/admin/admin_views/subscriber/', action_data) self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].subject, 'Greetings from a ModelAdmin action') def test_model_admin_default_delete_action(self): "Tests the default delete action defined as a ModelAdmin method" action_data = { ACTION_CHECKBOX_NAME: [1, 2], 'action': 'delete_selected', 'index': 0, } delete_confirmation_data = { ACTION_CHECKBOX_NAME: [1, 2], 'action': 'delete_selected', 'post': 'yes', } confirmation = self.client.post('/test_admin/admin/admin_views/subscriber/', action_data) self.assertIsInstance(confirmation, TemplateResponse) self.assertContains(confirmation, "Are you sure you want to delete the selected subscribers?") self.assertContains(confirmation, "<h2>Summary</h2>") self.assertContains(confirmation, "<li>Subscribers: 3</li>") self.assertContains(confirmation, "<li>External subscribers: 1</li>") self.assertContains(confirmation, ACTION_CHECKBOX_NAME, count=2) self.client.post('/test_admin/admin/admin_views/subscriber/', delete_confirmation_data) self.assertEqual(Subscriber.objects.count(), 0) @override_settings(USE_THOUSAND_SEPARATOR=True, USE_L10N=True) def test_non_localized_pk(self): """If USE_THOUSAND_SEPARATOR is set, make sure that the ids for the objects selected for deletion are rendered without separators. Refs #14895. """ subscriber = Subscriber.objects.get(id=1) subscriber.id = 9999 subscriber.save() action_data = { ACTION_CHECKBOX_NAME: [9999, 2], 'action': 'delete_selected', 'index': 0, } response = self.client.post('/test_admin/admin/admin_views/subscriber/', action_data) self.assertTemplateUsed(response, 'admin/delete_selected_confirmation.html') self.assertContains(response, 'value="9999"') # Instead of 9,999 self.assertContains(response, 'value="2"') def test_model_admin_default_delete_action_protected(self): """ Tests the default delete action defined as a ModelAdmin method in the case where some related objects are protected from deletion. """ q1 = Question.objects.create(question="Why?") a1 = Answer.objects.create(question=q1, answer="Because.") a2 = Answer.objects.create(question=q1, answer="Yes.") q2 = Question.objects.create(question="Wherefore?") action_data = { ACTION_CHECKBOX_NAME: [q1.pk, q2.pk], 'action': 'delete_selected', 'index': 0, } response = self.client.post("/test_admin/admin/admin_views/question/", action_data) self.assertContains(response, "would require deleting the following protected related objects") self.assertContains(response, '<li>Answer: <a href="/test_admin/admin/admin_views/answer/%s/">Because.</a></li>' % a1.pk, html=True) self.assertContains(response, '<li>Answer: <a href="/test_admin/admin/admin_views/answer/%s/">Yes.</a></li>' % a2.pk, html=True) def test_model_admin_default_delete_action_no_change_url(self): """ Default delete action shouldn't break if a user's ModelAdmin removes the url for change_view. Regression test for #20640 """ obj = UnchangeableObject.objects.create() action_data = { ACTION_CHECKBOX_NAME: obj.pk, "action": "delete_selected", "index": "0", } response = self.client.post('/test_admin/admin/admin_views/unchangeableobject/', action_data) # No 500 caused by NoReverseMatch self.assertEqual(response.status_code, 200) # The page shouldn't display a link to the nonexistent change page self.assertContains(response, "<li>Unchangeable object: UnchangeableObject object</li>", 1, html=True) def test_custom_function_mail_action(self): "Tests a custom action defined in a function" action_data = { ACTION_CHECKBOX_NAME: [1], 'action': 'external_mail', 'index': 0, } self.client.post('/test_admin/admin/admin_views/externalsubscriber/', action_data) self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].subject, 'Greetings from a function action') def test_custom_function_action_with_redirect(self): "Tests a custom action defined in a function" action_data = { ACTION_CHECKBOX_NAME: [1], 'action': 'redirect_to', 'index': 0, } response = self.client.post('/test_admin/admin/admin_views/externalsubscriber/', action_data) self.assertEqual(response.status_code, 302) def test_default_redirect(self): """ Test that actions which don't return an HttpResponse are redirected to the same page, retaining the querystring (which may contain changelist information). """ action_data = { ACTION_CHECKBOX_NAME: [1], 'action': 'external_mail', 'index': 0, } url = '/test_admin/admin/admin_views/externalsubscriber/?o=1' response = self.client.post(url, action_data) self.assertRedirects(response, url) def test_custom_function_action_streaming_response(self): """Tests a custom action that returns a StreamingHttpResponse.""" action_data = { ACTION_CHECKBOX_NAME: [1], 'action': 'download', 'index': 0, } response = self.client.post('/test_admin/admin/admin_views/externalsubscriber/', action_data) content = b''.join(response.streaming_content) self.assertEqual(content, b'This is the content of the file') self.assertEqual(response.status_code, 200) def test_custom_function_action_no_perm_response(self): """Tests a custom action that returns an HttpResponse with 403 code.""" action_data = { ACTION_CHECKBOX_NAME: [1], 'action': 'no_perm', 'index': 0, } response = self.client.post('/test_admin/admin/admin_views/externalsubscriber/', action_data) self.assertEqual(response.status_code, 403) self.assertEqual(response.content, b'No permission to perform this action') def test_actions_ordering(self): """ Ensure that actions are ordered as expected. Refs #15964. """ response = self.client.get('/test_admin/admin/admin_views/externalsubscriber/') self.assertContains(response, '''<label>Action: <select name="action"> <option value="" selected="selected">---------</option> <option value="delete_selected">Delete selected external subscribers</option> <option value="redirect_to">Redirect to (Awesome action)</option> <option value="external_mail">External mail (Another awesome action)</option> <option value="download">Download subscription</option> <option value="no_perm">No permission to run</option> </select>''', html=True) def test_model_without_action(self): "Tests a ModelAdmin without any action" response = self.client.get('/test_admin/admin/admin_views/oldsubscriber/') self.assertEqual(response.context["action_form"], None) self.assertNotContains(response, '<input type="checkbox" class="action-select"', msg_prefix="Found an unexpected action toggle checkboxbox in response") self.assertNotContains(response, '<input type="checkbox" class="action-select"') def test_model_without_action_still_has_jquery(self): "Tests that a ModelAdmin without any actions still gets jQuery included in page" response = self.client.get('/test_admin/admin/admin_views/oldsubscriber/') self.assertEqual(response.context["action_form"], None) self.assertContains(response, 'jquery.min.js', msg_prefix="jQuery missing from admin pages for model with no admin actions") def test_action_column_class(self): "Tests that the checkbox column class is present in the response" response = self.client.get('/test_admin/admin/admin_views/subscriber/') self.assertNotEqual(response.context["action_form"], None) self.assertContains(response, 'action-checkbox-column') def test_multiple_actions_form(self): """ Test that actions come from the form whose submit button was pressed (#10618). """ action_data = { ACTION_CHECKBOX_NAME: [1], # Two different actions selected on the two forms... 'action': ['external_mail', 'delete_selected'], # ...but we clicked "go" on the top form. 'index': 0 } self.client.post('/test_admin/admin/admin_views/externalsubscriber/', action_data) # Send mail, don't delete. self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].subject, 'Greetings from a function action') def test_user_message_on_none_selected(self): """ User should see a warning when 'Go' is pressed and no items are selected. """ action_data = { ACTION_CHECKBOX_NAME: [], 'action': 'delete_selected', 'index': 0, } response = self.client.post('/test_admin/admin/admin_views/subscriber/', action_data) msg = """Items must be selected in order to perform actions on them. No items have been changed.""" self.assertContains(response, msg) self.assertEqual(Subscriber.objects.count(), 2) def test_user_message_on_no_action(self): """ User should see a warning when 'Go' is pressed and no action is selected. """ action_data = { ACTION_CHECKBOX_NAME: [1, 2], 'action': '', 'index': 0, } response = self.client.post('/test_admin/admin/admin_views/subscriber/', action_data) msg = """No action selected.""" self.assertContains(response, msg) self.assertEqual(Subscriber.objects.count(), 2) def test_selection_counter(self): """ Check if the selection counter is there. """ response = self.client.get('/test_admin/admin/admin_views/subscriber/') self.assertContains(response, '0 of 2 selected') def test_popup_actions(self): """ Actions should not be shown in popups. """ response = self.client.get('/test_admin/admin/admin_views/subscriber/') self.assertNotEqual(response.context["action_form"], None) response = self.client.get( '/test_admin/admin/admin_views/subscriber/?%s' % IS_POPUP_VAR) self.assertEqual(response.context["action_form"], None) def test_popup_template_response(self): """ Success on popups shall be rendered from template in order to allow easy customization. """ response = self.client.post( '/test_admin/admin/admin_views/actor/add/?%s=1' % IS_POPUP_VAR, {'name': 'Troy McClure', 'age': '55', IS_POPUP_VAR: '1'}) self.assertEqual(response.status_code, 200) self.assertEqual(response.template_name, 'admin/popup_response.html') @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class TestCustomChangeList(TestCase): fixtures = ['admin-views-users.xml'] urlbit = 'admin' def setUp(self): result = self.client.login(username='super', password='secret') self.assertEqual(result, True) def tearDown(self): self.client.logout() def test_custom_changelist(self): """ Validate that a custom ChangeList class can be used (#9749) """ # Insert some data post_data = {"name": "First Gadget"} response = self.client.post('/test_admin/%s/admin_views/gadget/add/' % self.urlbit, post_data) self.assertEqual(response.status_code, 302) # redirect somewhere # Hit the page once to get messages out of the queue message list response = self.client.get('/test_admin/%s/admin_views/gadget/' % self.urlbit) # Ensure that data is still not visible on the page response = self.client.get('/test_admin/%s/admin_views/gadget/' % self.urlbit) self.assertEqual(response.status_code, 200) self.assertNotContains(response, 'First Gadget') @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class TestInlineNotEditable(TestCase): fixtures = ['admin-views-users.xml'] def setUp(self): result = self.client.login(username='super', password='secret') self.assertEqual(result, True) def tearDown(self): self.client.logout() def test_GET_parent_add(self): """ InlineModelAdmin broken? """ response = self.client.get('/test_admin/admin/admin_views/parent/add/') self.assertEqual(response.status_code, 200) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminCustomQuerysetTest(TestCase): fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') self.pks = [EmptyModel.objects.create().id for i in range(3)] self.super_login = { REDIRECT_FIELD_NAME: '/test_admin/admin/', 'username': 'super', 'password': 'secret', } def test_changelist_view(self): response = self.client.get('/test_admin/admin/admin_views/emptymodel/') for i in self.pks: if i > 1: self.assertContains(response, 'Primary key = %s' % i) else: self.assertNotContains(response, 'Primary key = %s' % i) def test_changelist_view_count_queries(self): # create 2 Person objects Person.objects.create(name='person1', gender=1) Person.objects.create(name='person2', gender=2) # 4 queries are expected: 1 for the session, 1 for the user, # 1 for the count and 1 for the objects on the page with self.assertNumQueries(4): resp = self.client.get('/test_admin/admin/admin_views/person/') self.assertEqual(resp.context['selection_note'], '0 of 2 selected') self.assertEqual(resp.context['selection_note_all'], 'All 2 selected') # here one more count(*) query will run, because filters were applied with self.assertNumQueries(5): extra = {'q': 'not_in_name'} resp = self.client.get('/test_admin/admin/admin_views/person/', extra) self.assertEqual(resp.context['selection_note'], '0 of 0 selected') self.assertEqual(resp.context['selection_note_all'], 'All 0 selected') with self.assertNumQueries(5): extra = {'q': 'person'} resp = self.client.get('/test_admin/admin/admin_views/person/', extra) self.assertEqual(resp.context['selection_note'], '0 of 2 selected') self.assertEqual(resp.context['selection_note_all'], 'All 2 selected') with self.assertNumQueries(5): extra = {'gender__exact': '1'} resp = self.client.get('/test_admin/admin/admin_views/person/', extra) self.assertEqual(resp.context['selection_note'], '0 of 1 selected') self.assertEqual(resp.context['selection_note_all'], '1 selected') def test_change_view(self): for i in self.pks: response = self.client.get('/test_admin/admin/admin_views/emptymodel/%s/' % i) if i > 1: self.assertEqual(response.status_code, 200) else: self.assertEqual(response.status_code, 404) def test_add_model_modeladmin_defer_qs(self): # Test for #14529. defer() is used in ModelAdmin.get_queryset() # model has __unicode__ method self.assertEqual(CoverLetter.objects.count(), 0) # Emulate model instance creation via the admin post_data = { "author": "Candidate, Best", "_save": "Save", } response = self.client.post('/test_admin/admin/admin_views/coverletter/add/', post_data, follow=True) self.assertEqual(response.status_code, 200) self.assertEqual(CoverLetter.objects.count(), 1) # Message should contain non-ugly model verbose name self.assertContains( response, '<li class="success">The cover letter "Candidate, Best" was added successfully.</li>', html=True ) # model has no __unicode__ method self.assertEqual(ShortMessage.objects.count(), 0) # Emulate model instance creation via the admin post_data = { "content": "What's this SMS thing?", "_save": "Save", } response = self.client.post('/test_admin/admin/admin_views/shortmessage/add/', post_data, follow=True) self.assertEqual(response.status_code, 200) self.assertEqual(ShortMessage.objects.count(), 1) # Message should contain non-ugly model verbose name self.assertContains( response, '<li class="success">The short message "ShortMessage object" was added successfully.</li>', html=True ) def test_add_model_modeladmin_only_qs(self): # Test for #14529. only() is used in ModelAdmin.get_queryset() # model has __unicode__ method self.assertEqual(Telegram.objects.count(), 0) # Emulate model instance creation via the admin post_data = { "title": "Urgent telegram", "_save": "Save", } response = self.client.post('/test_admin/admin/admin_views/telegram/add/', post_data, follow=True) self.assertEqual(response.status_code, 200) self.assertEqual(Telegram.objects.count(), 1) # Message should contain non-ugly model verbose name self.assertContains( response, '<li class="success">The telegram "Urgent telegram" was added successfully.</li>', html=True ) # model has no __unicode__ method self.assertEqual(Paper.objects.count(), 0) # Emulate model instance creation via the admin post_data = { "title": "My Modified Paper Title", "_save": "Save", } response = self.client.post('/test_admin/admin/admin_views/paper/add/', post_data, follow=True) self.assertEqual(response.status_code, 200) self.assertEqual(Paper.objects.count(), 1) # Message should contain non-ugly model verbose name self.assertContains( response, '<li class="success">The paper "Paper object" was added successfully.</li>', html=True ) def test_edit_model_modeladmin_defer_qs(self): # Test for #14529. defer() is used in ModelAdmin.get_queryset() # model has __unicode__ method cl = CoverLetter.objects.create(author="John Doe") self.assertEqual(CoverLetter.objects.count(), 1) response = self.client.get('/test_admin/admin/admin_views/coverletter/%s/' % cl.pk) self.assertEqual(response.status_code, 200) # Emulate model instance edit via the admin post_data = { "author": "John Doe II", "_save": "Save", } response = self.client.post('/test_admin/admin/admin_views/coverletter/%s/' % cl.pk, post_data, follow=True) self.assertEqual(response.status_code, 200) self.assertEqual(CoverLetter.objects.count(), 1) # Message should contain non-ugly model verbose name. Instance # representation is set by model's __unicode__() self.assertContains( response, '<li class="success">The cover letter "John Doe II" was changed successfully.</li>', html=True ) # model has no __unicode__ method sm = ShortMessage.objects.create(content="This is expensive") self.assertEqual(ShortMessage.objects.count(), 1) response = self.client.get('/test_admin/admin/admin_views/shortmessage/%s/' % sm.pk) self.assertEqual(response.status_code, 200) # Emulate model instance edit via the admin post_data = { "content": "Too expensive", "_save": "Save", } response = self.client.post('/test_admin/admin/admin_views/shortmessage/%s/' % sm.pk, post_data, follow=True) self.assertEqual(response.status_code, 200) self.assertEqual(ShortMessage.objects.count(), 1) # Message should contain non-ugly model verbose name. The ugly(!) # instance representation is set by six.text_type() self.assertContains( response, '<li class="success">The short message "ShortMessage_Deferred_timestamp object" was changed successfully.</li>', html=True ) def test_edit_model_modeladmin_only_qs(self): # Test for #14529. only() is used in ModelAdmin.get_queryset() # model has __unicode__ method t = Telegram.objects.create(title="Frist Telegram") self.assertEqual(Telegram.objects.count(), 1) response = self.client.get('/test_admin/admin/admin_views/telegram/%s/' % t.pk) self.assertEqual(response.status_code, 200) # Emulate model instance edit via the admin post_data = { "title": "Telegram without typo", "_save": "Save", } response = self.client.post('/test_admin/admin/admin_views/telegram/%s/' % t.pk, post_data, follow=True) self.assertEqual(response.status_code, 200) self.assertEqual(Telegram.objects.count(), 1) # Message should contain non-ugly model verbose name. The instance # representation is set by model's __unicode__() self.assertContains( response, '<li class="success">The telegram "Telegram without typo" was changed successfully.</li>', html=True ) # model has no __unicode__ method p = Paper.objects.create(title="My Paper Title") self.assertEqual(Paper.objects.count(), 1) response = self.client.get('/test_admin/admin/admin_views/paper/%s/' % p.pk) self.assertEqual(response.status_code, 200) # Emulate model instance edit via the admin post_data = { "title": "My Modified Paper Title", "_save": "Save", } response = self.client.post('/test_admin/admin/admin_views/paper/%s/' % p.pk, post_data, follow=True) self.assertEqual(response.status_code, 200) self.assertEqual(Paper.objects.count(), 1) # Message should contain non-ugly model verbose name. The ugly(!) # instance representation is set by six.text_type() self.assertContains( response, '<li class="success">The paper "Paper_Deferred_author object" was changed successfully.</li>', html=True ) def test_history_view_custom_qs(self): """ Ensure that custom querysets are considered for the admin history view. Refs #21013. """ self.client.post(reverse('admin:login'), self.super_login) FilteredManager.objects.create(pk=1) FilteredManager.objects.create(pk=2) response = self.client.get('/test_admin/admin/admin_views/filteredmanager/') self.assertContains(response, "PK=1") self.assertContains(response, "PK=2") self.assertEqual(self.client.get('/test_admin/admin/admin_views/filteredmanager/1/history/').status_code, 200) self.assertEqual(self.client.get('/test_admin/admin/admin_views/filteredmanager/2/history/').status_code, 200) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminInlineFileUploadTest(TestCase): fixtures = ['admin-views-users.xml', 'admin-views-actions.xml'] urlbit = 'admin' def setUp(self): self.client.login(username='super', password='secret') # Set up test Picture and Gallery. # These must be set up here instead of in fixtures in order to allow Picture # to use a NamedTemporaryFile. tdir = tempfile.gettempdir() file1 = tempfile.NamedTemporaryFile(suffix=".file1", dir=tdir) file1.write(b'a' * (2 ** 21)) filename = file1.name file1.close() self.gallery = Gallery(name="Test Gallery") self.gallery.save() self.picture = Picture(name="Test Picture", image=filename, gallery=self.gallery) self.picture.save() def tearDown(self): self.client.logout() def test_inline_file_upload_edit_validation_error_post(self): """ Test that inline file uploads correctly display prior data (#10002). """ post_data = { "name": "Test Gallery", "pictures-TOTAL_FORMS": "2", "pictures-INITIAL_FORMS": "1", "pictures-MAX_NUM_FORMS": "0", "pictures-0-id": six.text_type(self.picture.id), "pictures-0-gallery": six.text_type(self.gallery.id), "pictures-0-name": "Test Picture", "pictures-0-image": "", "pictures-1-id": "", "pictures-1-gallery": str(self.gallery.id), "pictures-1-name": "Test Picture 2", "pictures-1-image": "", } response = self.client.post('/test_admin/%s/admin_views/gallery/%d/' % (self.urlbit, self.gallery.id), post_data) self.assertContains(response, b"Currently") @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminInlineTests(TestCase): fixtures = ['admin-views-users.xml'] def setUp(self): self.post_data = { "name": "Test Name", "widget_set-TOTAL_FORMS": "3", "widget_set-INITIAL_FORMS": "0", "widget_set-MAX_NUM_FORMS": "0", "widget_set-0-id": "", "widget_set-0-owner": "1", "widget_set-0-name": "", "widget_set-1-id": "", "widget_set-1-owner": "1", "widget_set-1-name": "", "widget_set-2-id": "", "widget_set-2-owner": "1", "widget_set-2-name": "", "doohickey_set-TOTAL_FORMS": "3", "doohickey_set-INITIAL_FORMS": "0", "doohickey_set-MAX_NUM_FORMS": "0", "doohickey_set-0-owner": "1", "doohickey_set-0-code": "", "doohickey_set-0-name": "", "doohickey_set-1-owner": "1", "doohickey_set-1-code": "", "doohickey_set-1-name": "", "doohickey_set-2-owner": "1", "doohickey_set-2-code": "", "doohickey_set-2-name": "", "grommet_set-TOTAL_FORMS": "3", "grommet_set-INITIAL_FORMS": "0", "grommet_set-MAX_NUM_FORMS": "0", "grommet_set-0-code": "", "grommet_set-0-owner": "1", "grommet_set-0-name": "", "grommet_set-1-code": "", "grommet_set-1-owner": "1", "grommet_set-1-name": "", "grommet_set-2-code": "", "grommet_set-2-owner": "1", "grommet_set-2-name": "", "whatsit_set-TOTAL_FORMS": "3", "whatsit_set-INITIAL_FORMS": "0", "whatsit_set-MAX_NUM_FORMS": "0", "whatsit_set-0-owner": "1", "whatsit_set-0-index": "", "whatsit_set-0-name": "", "whatsit_set-1-owner": "1", "whatsit_set-1-index": "", "whatsit_set-1-name": "", "whatsit_set-2-owner": "1", "whatsit_set-2-index": "", "whatsit_set-2-name": "", "fancydoodad_set-TOTAL_FORMS": "3", "fancydoodad_set-INITIAL_FORMS": "0", "fancydoodad_set-MAX_NUM_FORMS": "0", "fancydoodad_set-0-doodad_ptr": "", "fancydoodad_set-0-owner": "1", "fancydoodad_set-0-name": "", "fancydoodad_set-0-expensive": "on", "fancydoodad_set-1-doodad_ptr": "", "fancydoodad_set-1-owner": "1", "fancydoodad_set-1-name": "", "fancydoodad_set-1-expensive": "on", "fancydoodad_set-2-doodad_ptr": "", "fancydoodad_set-2-owner": "1", "fancydoodad_set-2-name": "", "fancydoodad_set-2-expensive": "on", "category_set-TOTAL_FORMS": "3", "category_set-INITIAL_FORMS": "0", "category_set-MAX_NUM_FORMS": "0", "category_set-0-order": "", "category_set-0-id": "", "category_set-0-collector": "1", "category_set-1-order": "", "category_set-1-id": "", "category_set-1-collector": "1", "category_set-2-order": "", "category_set-2-id": "", "category_set-2-collector": "1", } result = self.client.login(username='super', password='secret') self.assertEqual(result, True) self.collector = Collector(pk=1, name='John Fowles') self.collector.save() def tearDown(self): self.client.logout() def test_simple_inline(self): "A simple model can be saved as inlines" # First add a new inline self.post_data['widget_set-0-name'] = "Widget 1" collector_url = '/test_admin/admin/admin_views/collector/%d/' % self.collector.pk response = self.client.post(collector_url, self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(Widget.objects.count(), 1) self.assertEqual(Widget.objects.all()[0].name, "Widget 1") widget_id = Widget.objects.all()[0].id # Check that the PK link exists on the rendered form response = self.client.get(collector_url) self.assertContains(response, 'name="widget_set-0-id"') # Now resave that inline self.post_data['widget_set-INITIAL_FORMS'] = "1" self.post_data['widget_set-0-id'] = str(widget_id) self.post_data['widget_set-0-name'] = "Widget 1" response = self.client.post(collector_url, self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(Widget.objects.count(), 1) self.assertEqual(Widget.objects.all()[0].name, "Widget 1") # Now modify that inline self.post_data['widget_set-INITIAL_FORMS'] = "1" self.post_data['widget_set-0-id'] = str(widget_id) self.post_data['widget_set-0-name'] = "Widget 1 Updated" response = self.client.post(collector_url, self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(Widget.objects.count(), 1) self.assertEqual(Widget.objects.all()[0].name, "Widget 1 Updated") def test_explicit_autofield_inline(self): "A model with an explicit autofield primary key can be saved as inlines. Regression for #8093" # First add a new inline self.post_data['grommet_set-0-name'] = "Grommet 1" collector_url = '/test_admin/admin/admin_views/collector/%d/' % self.collector.pk response = self.client.post(collector_url, self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(Grommet.objects.count(), 1) self.assertEqual(Grommet.objects.all()[0].name, "Grommet 1") # Check that the PK link exists on the rendered form response = self.client.get(collector_url) self.assertContains(response, 'name="grommet_set-0-code"') # Now resave that inline self.post_data['grommet_set-INITIAL_FORMS'] = "1" self.post_data['grommet_set-0-code'] = str(Grommet.objects.all()[0].code) self.post_data['grommet_set-0-name'] = "Grommet 1" response = self.client.post(collector_url, self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(Grommet.objects.count(), 1) self.assertEqual(Grommet.objects.all()[0].name, "Grommet 1") # Now modify that inline self.post_data['grommet_set-INITIAL_FORMS'] = "1" self.post_data['grommet_set-0-code'] = str(Grommet.objects.all()[0].code) self.post_data['grommet_set-0-name'] = "Grommet 1 Updated" response = self.client.post(collector_url, self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(Grommet.objects.count(), 1) self.assertEqual(Grommet.objects.all()[0].name, "Grommet 1 Updated") def test_char_pk_inline(self): "A model with a character PK can be saved as inlines. Regression for #10992" # First add a new inline self.post_data['doohickey_set-0-code'] = "DH1" self.post_data['doohickey_set-0-name'] = "Doohickey 1" collector_url = '/test_admin/admin/admin_views/collector/%d/' % self.collector.pk response = self.client.post(collector_url, self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(DooHickey.objects.count(), 1) self.assertEqual(DooHickey.objects.all()[0].name, "Doohickey 1") # Check that the PK link exists on the rendered form response = self.client.get(collector_url) self.assertContains(response, 'name="doohickey_set-0-code"') # Now resave that inline self.post_data['doohickey_set-INITIAL_FORMS'] = "1" self.post_data['doohickey_set-0-code'] = "DH1" self.post_data['doohickey_set-0-name'] = "Doohickey 1" response = self.client.post(collector_url, self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(DooHickey.objects.count(), 1) self.assertEqual(DooHickey.objects.all()[0].name, "Doohickey 1") # Now modify that inline self.post_data['doohickey_set-INITIAL_FORMS'] = "1" self.post_data['doohickey_set-0-code'] = "DH1" self.post_data['doohickey_set-0-name'] = "Doohickey 1 Updated" response = self.client.post(collector_url, self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(DooHickey.objects.count(), 1) self.assertEqual(DooHickey.objects.all()[0].name, "Doohickey 1 Updated") def test_integer_pk_inline(self): "A model with an integer PK can be saved as inlines. Regression for #10992" # First add a new inline self.post_data['whatsit_set-0-index'] = "42" self.post_data['whatsit_set-0-name'] = "Whatsit 1" response = self.client.post('/test_admin/admin/admin_views/collector/1/', self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(Whatsit.objects.count(), 1) self.assertEqual(Whatsit.objects.all()[0].name, "Whatsit 1") # Check that the PK link exists on the rendered form response = self.client.get('/test_admin/admin/admin_views/collector/1/') self.assertContains(response, 'name="whatsit_set-0-index"') # Now resave that inline self.post_data['whatsit_set-INITIAL_FORMS'] = "1" self.post_data['whatsit_set-0-index'] = "42" self.post_data['whatsit_set-0-name'] = "Whatsit 1" response = self.client.post('/test_admin/admin/admin_views/collector/1/', self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(Whatsit.objects.count(), 1) self.assertEqual(Whatsit.objects.all()[0].name, "Whatsit 1") # Now modify that inline self.post_data['whatsit_set-INITIAL_FORMS'] = "1" self.post_data['whatsit_set-0-index'] = "42" self.post_data['whatsit_set-0-name'] = "Whatsit 1 Updated" response = self.client.post('/test_admin/admin/admin_views/collector/1/', self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(Whatsit.objects.count(), 1) self.assertEqual(Whatsit.objects.all()[0].name, "Whatsit 1 Updated") def test_inherited_inline(self): "An inherited model can be saved as inlines. Regression for #11042" # First add a new inline self.post_data['fancydoodad_set-0-name'] = "Fancy Doodad 1" collector_url = '/test_admin/admin/admin_views/collector/%d/' % self.collector.pk response = self.client.post(collector_url, self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(FancyDoodad.objects.count(), 1) self.assertEqual(FancyDoodad.objects.all()[0].name, "Fancy Doodad 1") doodad_pk = FancyDoodad.objects.all()[0].pk # Check that the PK link exists on the rendered form response = self.client.get(collector_url) self.assertContains(response, 'name="fancydoodad_set-0-doodad_ptr"') # Now resave that inline self.post_data['fancydoodad_set-INITIAL_FORMS'] = "1" self.post_data['fancydoodad_set-0-doodad_ptr'] = str(doodad_pk) self.post_data['fancydoodad_set-0-name'] = "Fancy Doodad 1" response = self.client.post(collector_url, self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(FancyDoodad.objects.count(), 1) self.assertEqual(FancyDoodad.objects.all()[0].name, "Fancy Doodad 1") # Now modify that inline self.post_data['fancydoodad_set-INITIAL_FORMS'] = "1" self.post_data['fancydoodad_set-0-doodad_ptr'] = str(doodad_pk) self.post_data['fancydoodad_set-0-name'] = "Fancy Doodad 1 Updated" response = self.client.post(collector_url, self.post_data) self.assertEqual(response.status_code, 302) self.assertEqual(FancyDoodad.objects.count(), 1) self.assertEqual(FancyDoodad.objects.all()[0].name, "Fancy Doodad 1 Updated") def test_ordered_inline(self): """Check that an inline with an editable ordering fields is updated correctly. Regression for #10922""" # Create some objects with an initial ordering Category.objects.create(id=1, order=1, collector=self.collector) Category.objects.create(id=2, order=2, collector=self.collector) Category.objects.create(id=3, order=0, collector=self.collector) Category.objects.create(id=4, order=0, collector=self.collector) # NB: The order values must be changed so that the items are reordered. self.post_data.update({ "name": "Frederick Clegg", "category_set-TOTAL_FORMS": "7", "category_set-INITIAL_FORMS": "4", "category_set-MAX_NUM_FORMS": "0", "category_set-0-order": "14", "category_set-0-id": "1", "category_set-0-collector": "1", "category_set-1-order": "13", "category_set-1-id": "2", "category_set-1-collector": "1", "category_set-2-order": "1", "category_set-2-id": "3", "category_set-2-collector": "1", "category_set-3-order": "0", "category_set-3-id": "4", "category_set-3-collector": "1", "category_set-4-order": "", "category_set-4-id": "", "category_set-4-collector": "1", "category_set-5-order": "", "category_set-5-id": "", "category_set-5-collector": "1", "category_set-6-order": "", "category_set-6-id": "", "category_set-6-collector": "1", }) response = self.client.post('/test_admin/admin/admin_views/collector/1/', self.post_data) # Successful post will redirect self.assertEqual(response.status_code, 302) # Check that the order values have been applied to the right objects self.assertEqual(self.collector.category_set.count(), 4) self.assertEqual(Category.objects.get(id=1).order, 14) self.assertEqual(Category.objects.get(id=2).order, 13) self.assertEqual(Category.objects.get(id=3).order, 1) self.assertEqual(Category.objects.get(id=4).order, 0) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class NeverCacheTests(TestCase): fixtures = ['admin-views-users.xml', 'admin-views-colors.xml', 'admin-views-fabrics.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_admin_index(self): "Check the never-cache status of the main index" response = self.client.get('/test_admin/admin/') self.assertEqual(get_max_age(response), 0) def test_app_index(self): "Check the never-cache status of an application index" response = self.client.get('/test_admin/admin/admin_views/') self.assertEqual(get_max_age(response), 0) def test_model_index(self): "Check the never-cache status of a model index" response = self.client.get('/test_admin/admin/admin_views/fabric/') self.assertEqual(get_max_age(response), 0) def test_model_add(self): "Check the never-cache status of a model add page" response = self.client.get('/test_admin/admin/admin_views/fabric/add/') self.assertEqual(get_max_age(response), 0) def test_model_view(self): "Check the never-cache status of a model edit page" response = self.client.get('/test_admin/admin/admin_views/section/1/') self.assertEqual(get_max_age(response), 0) def test_model_history(self): "Check the never-cache status of a model history page" response = self.client.get('/test_admin/admin/admin_views/section/1/history/') self.assertEqual(get_max_age(response), 0) def test_model_delete(self): "Check the never-cache status of a model delete page" response = self.client.get('/test_admin/admin/admin_views/section/1/delete/') self.assertEqual(get_max_age(response), 0) def test_login(self): "Check the never-cache status of login views" self.client.logout() response = self.client.get('/test_admin/admin/') self.assertEqual(get_max_age(response), 0) def test_logout(self): "Check the never-cache status of logout view" response = self.client.get('/test_admin/admin/logout/') self.assertEqual(get_max_age(response), 0) def test_password_change(self): "Check the never-cache status of the password change view" self.client.logout() response = self.client.get('/test_admin/password_change/') self.assertEqual(get_max_age(response), None) def test_password_change_done(self): "Check the never-cache status of the password change done view" response = self.client.get('/test_admin/admin/password_change/done/') self.assertEqual(get_max_age(response), None) def test_JS_i18n(self): "Check the never-cache status of the JavaScript i18n view" response = self.client.get('/test_admin/admin/jsi18n/') self.assertEqual(get_max_age(response), None) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class PrePopulatedTest(TestCase): fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_prepopulated_on(self): response = self.client.get('/test_admin/admin/admin_views/prepopulatedpost/add/') self.assertEqual(response.status_code, 200) self.assertContains(response, "id: '#id_slug',") self.assertContains(response, "field['dependency_ids'].push('#id_title');") self.assertContains(response, "id: '#id_prepopulatedsubpost_set-0-subslug',") def test_prepopulated_off(self): response = self.client.get('/test_admin/admin/admin_views/prepopulatedpost/1/') self.assertEqual(response.status_code, 200) self.assertContains(response, "A Long Title") self.assertNotContains(response, "id: '#id_slug'") self.assertNotContains(response, "field['dependency_ids'].push('#id_title');") self.assertNotContains(response, "id: '#id_prepopulatedsubpost_set-0-subslug',") @override_settings(USE_THOUSAND_SEPARATOR=True, USE_L10N=True) def test_prepopulated_maxlength_localized(self): """ Regression test for #15938: if USE_THOUSAND_SEPARATOR is set, make sure that maxLength (in the JavaScript) is rendered without separators. """ response = self.client.get('/test_admin/admin/admin_views/prepopulatedpostlargeslug/add/') self.assertContains(response, "maxLength: 1000") # instead of 1,000 @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class SeleniumAdminViewsFirefoxTests(AdminSeleniumWebDriverTestCase): available_apps = ['admin_views'] + AdminSeleniumWebDriverTestCase.available_apps fixtures = ['admin-views-users.xml'] webdriver_class = 'selenium.webdriver.firefox.webdriver.WebDriver' def test_prepopulated_fields(self): """ Ensure that the JavaScript-automated prepopulated fields work with the main form and with stacked and tabular inlines. Refs #13068, #9264, #9983, #9784. """ self.admin_login(username='super', password='secret', login_url='/test_admin/admin/') self.selenium.get('%s%s' % (self.live_server_url, '/test_admin/admin/admin_views/mainprepopulated/add/')) # Main form ---------------------------------------------------------- self.selenium.find_element_by_css_selector('#id_pubdate').send_keys('2012-02-18') self.get_select_option('#id_status', 'option two').click() self.selenium.find_element_by_css_selector('#id_name').send_keys(' this is the mAin nÀMë and it\'s awεšome') slug1 = self.selenium.find_element_by_css_selector('#id_slug1').get_attribute('value') slug2 = self.selenium.find_element_by_css_selector('#id_slug2').get_attribute('value') self.assertEqual(slug1, 'main-name-and-its-awesome-2012-02-18') self.assertEqual(slug2, 'option-two-main-name-and-its-awesome') # Stacked inlines ---------------------------------------------------- # Initial inline self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-0-pubdate').send_keys('2011-12-17') self.get_select_option('#id_relatedprepopulated_set-0-status', 'option one').click() self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-0-name').send_keys(' here is a sŤāÇkeð inline ! ') slug1 = self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-0-slug1').get_attribute('value') slug2 = self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-0-slug2').get_attribute('value') self.assertEqual(slug1, 'here-stacked-inline-2011-12-17') self.assertEqual(slug2, 'option-one-here-stacked-inline') # Add an inline self.selenium.find_elements_by_link_text('Add another Related prepopulated')[0].click() self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-1-pubdate').send_keys('1999-01-25') self.get_select_option('#id_relatedprepopulated_set-1-status', 'option two').click() self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-1-name').send_keys(' now you haVe anöther sŤāÇkeð inline with a very ... loooooooooooooooooooooooooooooooooooooooooooooooooooooooooooooooooooog text... ') slug1 = self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-1-slug1').get_attribute('value') slug2 = self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-1-slug2').get_attribute('value') self.assertEqual(slug1, 'now-you-have-another-stacked-inline-very-loooooooo') # 50 characters maximum for slug1 field self.assertEqual(slug2, 'option-two-now-you-have-another-stacked-inline-very-looooooo') # 60 characters maximum for slug2 field # Tabular inlines ---------------------------------------------------- # Initial inline self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-2-0-pubdate').send_keys('1234-12-07') self.get_select_option('#id_relatedprepopulated_set-2-0-status', 'option two').click() self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-2-0-name').send_keys('And now, with a tÃbűlaŘ inline !!!') slug1 = self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-2-0-slug1').get_attribute('value') slug2 = self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-2-0-slug2').get_attribute('value') self.assertEqual(slug1, 'and-now-tabular-inline-1234-12-07') self.assertEqual(slug2, 'option-two-and-now-tabular-inline') # Add an inline self.selenium.find_elements_by_link_text('Add another Related prepopulated')[1].click() self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-2-1-pubdate').send_keys('1981-08-22') self.get_select_option('#id_relatedprepopulated_set-2-1-status', 'option one').click() self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-2-1-name').send_keys('a tÃbűlaŘ inline with ignored ;"&*^\%$#@-/`~ characters') slug1 = self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-2-1-slug1').get_attribute('value') slug2 = self.selenium.find_element_by_css_selector('#id_relatedprepopulated_set-2-1-slug2').get_attribute('value') self.assertEqual(slug1, 'tabular-inline-ignored-characters-1981-08-22') self.assertEqual(slug2, 'option-one-tabular-inline-ignored-characters') # Save and check that everything is properly stored in the database self.selenium.find_element_by_xpath('//input[@value="Save"]').click() self.wait_page_loaded() self.assertEqual(MainPrepopulated.objects.all().count(), 1) MainPrepopulated.objects.get( name=' this is the mAin nÀMë and it\'s awεšome', pubdate='2012-02-18', status='option two', slug1='main-name-and-its-awesome-2012-02-18', slug2='option-two-main-name-and-its-awesome', ) self.assertEqual(RelatedPrepopulated.objects.all().count(), 4) RelatedPrepopulated.objects.get( name=' here is a sŤāÇkeð inline ! ', pubdate='2011-12-17', status='option one', slug1='here-stacked-inline-2011-12-17', slug2='option-one-here-stacked-inline', ) RelatedPrepopulated.objects.get( name=' now you haVe anöther sŤāÇkeð inline with a very ... loooooooooooooooooo', # 75 characters in name field pubdate='1999-01-25', status='option two', slug1='now-you-have-another-stacked-inline-very-loooooooo', slug2='option-two-now-you-have-another-stacked-inline-very-looooooo', ) RelatedPrepopulated.objects.get( name='And now, with a tÃbűlaŘ inline !!!', pubdate='1234-12-07', status='option two', slug1='and-now-tabular-inline-1234-12-07', slug2='option-two-and-now-tabular-inline', ) RelatedPrepopulated.objects.get( name='a tÃbűlaŘ inline with ignored ;"&*^\%$#@-/`~ characters', pubdate='1981-08-22', status='option one', slug1='tabular-inline-ignored-characters-1981-08-22', slug2='option-one-tabular-inline-ignored-characters', ) def test_populate_existing_object(self): """ Ensure that the prepopulation works for existing objects too, as long as the original field is empty. Refs #19082. """ # Slugs are empty to start with. item = MainPrepopulated.objects.create( name=' this is the mAin nÀMë', pubdate='2012-02-18', status='option two', slug1='', slug2='', ) self.admin_login(username='super', password='secret', login_url='/test_admin/admin/') object_url = '%s%s' % ( self.live_server_url, '/test_admin/admin/admin_views/mainprepopulated/{}/'.format(item.id)) self.selenium.get(object_url) self.selenium.find_element_by_css_selector('#id_name').send_keys(' the best') # The slugs got prepopulated since they were originally empty slug1 = self.selenium.find_element_by_css_selector('#id_slug1').get_attribute('value') slug2 = self.selenium.find_element_by_css_selector('#id_slug2').get_attribute('value') self.assertEqual(slug1, 'main-name-best-2012-02-18') self.assertEqual(slug2, 'option-two-main-name-best') # Save the object self.selenium.find_element_by_xpath('//input[@value="Save"]').click() self.wait_page_loaded() self.selenium.get(object_url) self.selenium.find_element_by_css_selector('#id_name').send_keys(' hello') # The slugs got prepopulated didn't change since they were originally not empty slug1 = self.selenium.find_element_by_css_selector('#id_slug1').get_attribute('value') slug2 = self.selenium.find_element_by_css_selector('#id_slug2').get_attribute('value') self.assertEqual(slug1, 'main-name-best-2012-02-18') self.assertEqual(slug2, 'option-two-main-name-best') def test_collapsible_fieldset(self): """ Test that the 'collapse' class in fieldsets definition allows to show/hide the appropriate field section. """ self.admin_login(username='super', password='secret', login_url='/test_admin/admin/') self.selenium.get('%s%s' % (self.live_server_url, '/test_admin/admin/admin_views/article/add/')) self.assertFalse(self.selenium.find_element_by_id('id_title').is_displayed()) self.selenium.find_elements_by_link_text('Show')[0].click() self.assertTrue(self.selenium.find_element_by_id('id_title').is_displayed()) self.assertEqual( self.selenium.find_element_by_id('fieldsetcollapser0').text, "Hide" ) def test_first_field_focus(self): """JavaScript-assisted auto-focus on first usable form field.""" # First form field has a single widget self.admin_login(username='super', password='secret', login_url='/test_admin/admin/') self.selenium.get('%s%s' % (self.live_server_url, '/test_admin/admin/admin_views/picture/add/')) self.assertEqual( self.selenium.switch_to.active_element, self.selenium.find_element_by_id('id_name') ) # First form field has a MultiWidget self.selenium.get('%s%s' % (self.live_server_url, '/test_admin/admin/admin_views/reservation/add/')) self.assertEqual( self.selenium.switch_to.active_element, self.selenium.find_element_by_id('id_start_date_0') ) def test_cancel_delete_confirmation(self): "Cancelling the deletion of an object takes the user back one page." pizza = Pizza.objects.create(name="Panucci's Double Cheese") url = reverse('admin:admin_views_pizza_change', args=(pizza.id,)) full_url = '%s%s' % (self.live_server_url, url) self.admin_login(username='super', password='secret', login_url='/test_admin/admin/') self.selenium.get(full_url) self.selenium.find_element_by_class_name('deletelink').click() self.selenium.find_element_by_class_name('cancel-link').click() self.assertEqual(self.selenium.current_url, full_url) self.assertEqual(Pizza.objects.count(), 1) def test_cancel_delete_related_confirmation(self): """ Cancelling the deletion of an object with relations takes the user back one page. """ pizza = Pizza.objects.create(name="Panucci's Double Cheese") topping1 = Topping.objects.create(name="Cheddar") topping2 = Topping.objects.create(name="Mozzarella") pizza.toppings.add(topping1, topping2) url = reverse('admin:admin_views_pizza_change', args=(pizza.id,)) full_url = '%s%s' % (self.live_server_url, url) self.admin_login(username='super', password='secret', login_url='/test_admin/admin/') self.selenium.get(full_url) self.selenium.find_element_by_class_name('deletelink').click() self.selenium.find_element_by_class_name('cancel-link').click() self.assertEqual(self.selenium.current_url, full_url) self.assertEqual(Pizza.objects.count(), 1) self.assertEqual(Topping.objects.count(), 2) class SeleniumAdminViewsChromeTests(SeleniumAdminViewsFirefoxTests): webdriver_class = 'selenium.webdriver.chrome.webdriver.WebDriver' class SeleniumAdminViewsIETests(SeleniumAdminViewsFirefoxTests): webdriver_class = 'selenium.webdriver.ie.webdriver.WebDriver' @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class ReadonlyTest(TestCase): fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_readonly_get(self): response = self.client.get('/test_admin/admin/admin_views/post/add/') self.assertEqual(response.status_code, 200) self.assertNotContains(response, 'name="posted"') # 3 fields + 2 submit buttons + 5 inline management form fields, + 2 # hidden fields for inlines + 1 field for the inline + 2 empty form self.assertContains(response, "<input", count=15) self.assertContains(response, formats.localize(datetime.date.today())) self.assertContains(response, "<label>Awesomeness level:</label>") self.assertContains(response, "Very awesome.") self.assertContains(response, "Unknown coolness.") self.assertContains(response, "foo") # Checks that multiline text in a readonly field gets <br /> tags self.assertContains(response, "Multiline<br />test<br />string") self.assertContains(response, "<p>Multiline<br />html<br />content</p>", html=True) self.assertContains(response, "InlineMultiline<br />test<br />string") self.assertContains(response, formats.localize(datetime.date.today() - datetime.timedelta(days=7))) self.assertContains(response, '<div class="form-row field-coolness">') self.assertContains(response, '<div class="form-row field-awesomeness_level">') self.assertContains(response, '<div class="form-row field-posted">') self.assertContains(response, '<div class="form-row field-value">') self.assertContains(response, '<div class="form-row">') self.assertContains(response, '<p class="help">', 3) self.assertContains(response, '<p class="help">Some help text for the title (with unicode ŠĐĆŽćžšđ)</p>', html=True) self.assertContains(response, '<p class="help">Some help text for the content (with unicode ŠĐĆŽćžšđ)</p>', html=True) self.assertContains(response, '<p class="help">Some help text for the date (with unicode ŠĐĆŽćžšđ)</p>', html=True) p = Post.objects.create(title="I worked on readonly_fields", content="Its good stuff") response = self.client.get('/test_admin/admin/admin_views/post/%d/' % p.pk) self.assertContains(response, "%d amount of cool" % p.pk) def test_readonly_post(self): data = { "title": "Django Got Readonly Fields", "content": "This is an incredible development.", "link_set-TOTAL_FORMS": "1", "link_set-INITIAL_FORMS": "0", "link_set-MAX_NUM_FORMS": "0", } response = self.client.post('/test_admin/admin/admin_views/post/add/', data) self.assertEqual(response.status_code, 302) self.assertEqual(Post.objects.count(), 1) p = Post.objects.get() self.assertEqual(p.posted, datetime.date.today()) data["posted"] = "10-8-1990" # some date that's not today response = self.client.post('/test_admin/admin/admin_views/post/add/', data) self.assertEqual(response.status_code, 302) self.assertEqual(Post.objects.count(), 2) p = Post.objects.order_by('-id')[0] self.assertEqual(p.posted, datetime.date.today()) def test_readonly_manytomany(self): "Regression test for #13004" response = self.client.get('/test_admin/admin/admin_views/pizza/add/') self.assertEqual(response.status_code, 200) def test_user_password_change_limited_queryset(self): su = User.objects.filter(is_superuser=True)[0] response = self.client.get('/test_admin/admin2/auth/user/%s/password/' % su.pk) self.assertEqual(response.status_code, 404) def test_change_form_renders_correct_null_choice_value(self): """ Regression test for #17911. """ choice = Choice.objects.create(choice=None) response = self.client.get('/test_admin/admin/admin_views/choice/%s/' % choice.pk) self.assertContains(response, '<p>No opinion</p>', html=True) self.assertNotContains(response, '<p>(None)</p>') def test_readonly_backwards_ref(self): """ Regression test for #16433 - backwards references for related objects broke if the related field is read-only due to the help_text attribute """ topping = Topping.objects.create(name='Salami') pizza = Pizza.objects.create(name='Americano') pizza.toppings.add(topping) response = self.client.get('/test_admin/admin/admin_views/topping/add/') self.assertEqual(response.status_code, 200) def test_readonly_field_overrides(self): """ Regression test for #22087 - ModelForm Meta overrides are ignored by AdminReadonlyField """ p = FieldOverridePost.objects.create(title="Test Post", content="Test Content") response = self.client.get('/test_admin/admin/admin_views/fieldoverridepost/%d/' % p.pk) self.assertEqual(response.status_code, 200) self.assertContains(response, '<p class="help">Overridden help text for the date</p>') self.assertContains(response, '<label for="id_public">Overridden public label:</label>', html=True) self.assertNotContains(response, "Some help text for the date (with unicode ŠĐĆŽćžšđ)") @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class LimitChoicesToInAdminTest(TestCase): fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_limit_choices_to_as_callable(self): """Test for ticket 2445 changes to admin.""" threepwood = Character.objects.create( username='threepwood', last_action=datetime.datetime.today() + datetime.timedelta(days=1), ) marley = Character.objects.create( username='marley', last_action=datetime.datetime.today() - datetime.timedelta(days=1), ) response = self.client.get('/test_admin/admin/admin_views/stumpjoke/add/') # The allowed option should appear twice; the limited option should not appear. self.assertContains(response, threepwood.username, count=2) self.assertNotContains(response, marley.username) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class RawIdFieldsTest(TestCase): fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_limit_choices_to(self): """Regression test for 14880""" actor = Actor.objects.create(name="Palin", age=27) Inquisition.objects.create(expected=True, leader=actor, country="England") Inquisition.objects.create(expected=False, leader=actor, country="Spain") response = self.client.get('/test_admin/admin/admin_views/sketch/add/') # Find the link m = re.search(br'<a href="([^"]*)"[^>]* id="lookup_id_inquisition"', response.content) self.assertTrue(m) # Got a match popup_url = m.groups()[0].decode().replace("&", "&") # Handle relative links popup_url = urljoin(response.request['PATH_INFO'], popup_url) # Get the popup and verify the correct objects show up in the resulting # page. This step also tests integers, strings and booleans in the # lookup query string; in model we define inquisition field to have a # limit_choices_to option that includes a filter on a string field # (inquisition__actor__name), a filter on an integer field # (inquisition__actor__age), and a filter on a boolean field # (inquisition__expected). response2 = self.client.get(popup_url) self.assertContains(response2, "Spain") self.assertNotContains(response2, "England") def test_limit_choices_to_isnull_false(self): """Regression test for 20182""" Actor.objects.create(name="Palin", age=27) Actor.objects.create(name="Kilbraken", age=50, title="Judge") response = self.client.get('/test_admin/admin/admin_views/sketch/add/') # Find the link m = re.search(br'<a href="([^"]*)"[^>]* id="lookup_id_defendant0"', response.content) self.assertTrue(m) # Got a match popup_url = m.groups()[0].decode().replace("&", "&") # Handle relative links popup_url = urljoin(response.request['PATH_INFO'], popup_url) # Get the popup and verify the correct objects show up in the resulting # page. This step tests field__isnull=0 gets parsed correctly from the # lookup query string; in model we define defendant0 field to have a # limit_choices_to option that includes "actor__title__isnull=False". response2 = self.client.get(popup_url) self.assertContains(response2, "Kilbraken") self.assertNotContains(response2, "Palin") def test_limit_choices_to_isnull_true(self): """Regression test for 20182""" Actor.objects.create(name="Palin", age=27) Actor.objects.create(name="Kilbraken", age=50, title="Judge") response = self.client.get('/test_admin/admin/admin_views/sketch/add/') # Find the link m = re.search(br'<a href="([^"]*)"[^>]* id="lookup_id_defendant1"', response.content) self.assertTrue(m) # Got a match popup_url = m.groups()[0].decode().replace("&", "&") # Handle relative links popup_url = urljoin(response.request['PATH_INFO'], popup_url) # Get the popup and verify the correct objects show up in the resulting # page. This step tests field__isnull=1 gets parsed correctly from the # lookup query string; in model we define defendant1 field to have a # limit_choices_to option that includes "actor__title__isnull=True". response2 = self.client.get(popup_url) self.assertNotContains(response2, "Kilbraken") self.assertContains(response2, "Palin") @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class UserAdminTest(TestCase): """ Tests user CRUD functionality. """ fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_save_button(self): user_count = User.objects.count() response = self.client.post('/test_admin/admin/auth/user/add/', { 'username': 'newuser', 'password1': 'newpassword', 'password2': 'newpassword', }) new_user = User.objects.order_by('-id')[0] self.assertRedirects(response, '/test_admin/admin/auth/user/%s/' % new_user.pk) self.assertEqual(User.objects.count(), user_count + 1) self.assertTrue(new_user.has_usable_password()) def test_save_continue_editing_button(self): user_count = User.objects.count() response = self.client.post('/test_admin/admin/auth/user/add/', { 'username': 'newuser', 'password1': 'newpassword', 'password2': 'newpassword', '_continue': '1', }) new_user = User.objects.order_by('-id')[0] self.assertRedirects(response, '/test_admin/admin/auth/user/%s/' % new_user.pk) self.assertEqual(User.objects.count(), user_count + 1) self.assertTrue(new_user.has_usable_password()) def test_password_mismatch(self): response = self.client.post('/test_admin/admin/auth/user/add/', { 'username': 'newuser', 'password1': 'newpassword', 'password2': 'mismatch', }) self.assertEqual(response.status_code, 200) adminform = response.context['adminform'] self.assertNotIn('password', adminform.form.errors) self.assertEqual(adminform.form.errors['password2'], ["The two password fields didn't match."]) def test_user_fk_popup(self): """Quick user addition in a FK popup shouldn't invoke view for further user customization""" response = self.client.get('/test_admin/admin/admin_views/album/add/') self.assertEqual(response.status_code, 200) self.assertContains(response, '/test_admin/admin/auth/user/add') self.assertContains(response, 'class="add-another" id="add_id_owner"') response = self.client.get('/test_admin/admin/auth/user/add/?_popup=1') self.assertEqual(response.status_code, 200) self.assertNotContains(response, 'name="_continue"') self.assertNotContains(response, 'name="_addanother"') data = { 'username': 'newuser', 'password1': 'newpassword', 'password2': 'newpassword', '_popup': '1', '_save': '1', } response = self.client.post('/test_admin/admin/auth/user/add/?_popup=1', data, follow=True) self.assertEqual(response.status_code, 200) self.assertContains(response, 'dismissAddAnotherPopup') def test_save_add_another_button(self): user_count = User.objects.count() response = self.client.post('/test_admin/admin/auth/user/add/', { 'username': 'newuser', 'password1': 'newpassword', 'password2': 'newpassword', '_addanother': '1', }) new_user = User.objects.order_by('-id')[0] self.assertRedirects(response, '/test_admin/admin/auth/user/add/') self.assertEqual(User.objects.count(), user_count + 1) self.assertTrue(new_user.has_usable_password()) def test_user_permission_performance(self): u = User.objects.all()[0] # Don't depend on a warm cache, see #17377. ContentType.objects.clear_cache() with self.assertNumQueries(10): response = self.client.get('/test_admin/admin/auth/user/%s/' % u.pk) self.assertEqual(response.status_code, 200) def test_form_url_present_in_context(self): u = User.objects.all()[0] response = self.client.get('/test_admin/admin3/auth/user/%s/password/' % u.pk) self.assertEqual(response.status_code, 200) self.assertEqual(response.context['form_url'], 'pony') @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class GroupAdminTest(TestCase): """ Tests group CRUD functionality. """ fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_save_button(self): group_count = Group.objects.count() response = self.client.post('/test_admin/admin/auth/group/add/', { 'name': 'newgroup', }) Group.objects.order_by('-id')[0] self.assertRedirects(response, '/test_admin/admin/auth/group/') self.assertEqual(Group.objects.count(), group_count + 1) def test_group_permission_performance(self): g = Group.objects.create(name="test_group") # Ensure no queries are skipped due to cached content type for Group. ContentType.objects.clear_cache() with self.assertNumQueries(8): response = self.client.get('/test_admin/admin/auth/group/%s/' % g.pk) self.assertEqual(response.status_code, 200) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class CSSTest(TestCase): fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_field_prefix_css_classes(self): """ Ensure that fields have a CSS class name with a 'field-' prefix. Refs #16371. """ response = self.client.get('/test_admin/admin/admin_views/post/add/') # The main form self.assertContains(response, 'class="form-row field-title"') self.assertContains(response, 'class="form-row field-content"') self.assertContains(response, 'class="form-row field-public"') self.assertContains(response, 'class="form-row field-awesomeness_level"') self.assertContains(response, 'class="form-row field-coolness"') self.assertContains(response, 'class="form-row field-value"') self.assertContains(response, 'class="form-row"') # The lambda function # The tabular inline self.assertContains(response, '<td class="field-url">') self.assertContains(response, '<td class="field-posted">') def test_index_css_classes(self): """ Ensure that CSS class names are used for each app and model on the admin index pages. Refs #17050. """ # General index page response = self.client.get("/test_admin/admin/") self.assertContains(response, '<div class="app-admin_views module">') self.assertContains(response, '<tr class="model-actor">') self.assertContains(response, '<tr class="model-album">') # App index page response = self.client.get("/test_admin/admin/admin_views/") self.assertContains(response, '<div class="app-admin_views module">') self.assertContains(response, '<tr class="model-actor">') self.assertContains(response, '<tr class="model-album">') def test_app_model_in_form_body_class(self): """ Ensure app and model tag are correctly read by change_form template """ response = self.client.get('/test_admin/admin/admin_views/section/add/') self.assertEqual(response.status_code, 200) self.assertContains(response, '<body class=" app-admin_views model-section ') def test_app_model_in_list_body_class(self): """ Ensure app and model tag are correctly read by change_list template """ response = self.client.get('/test_admin/admin/admin_views/section/') self.assertEqual(response.status_code, 200) self.assertContains(response, '<body class=" app-admin_views model-section ') def test_app_model_in_delete_confirmation_body_class(self): """ Ensure app and model tag are correctly read by delete_confirmation template """ response = self.client.get( '/test_admin/admin/admin_views/section/1/delete/') self.assertEqual(response.status_code, 200) self.assertContains(response, '<body class=" app-admin_views model-section ') def test_app_model_in_app_index_body_class(self): """ Ensure app and model tag are correctly read by app_index template """ response = self.client.get('/test_admin/admin/admin_views/') self.assertEqual(response.status_code, 200) self.assertContains(response, '<body class=" dashboard app-admin_views') def test_app_model_in_delete_selected_confirmation_body_class(self): """ Ensure app and model tag are correctly read by delete_selected_confirmation template """ action_data = { ACTION_CHECKBOX_NAME: [1], 'action': 'delete_selected', 'index': 0, } response = self.client.post('/test_admin/admin/admin_views/section/', action_data) self.assertEqual(response.status_code, 200) self.assertContains(response, '<body class=" app-admin_views model-section ') def test_changelist_field_classes(self): """ Cells of the change list table should contain the field name in their class attribute Refs #11195. """ Podcast.objects.create(name="Django Dose", release_date=datetime.date.today()) response = self.client.get('/test_admin/admin/admin_views/podcast/') self.assertContains( response, '<th class="field-name">') self.assertContains( response, '<td class="field-release_date nowrap">') self.assertContains( response, '<td class="action-checkbox">') try: import docutils except ImportError: docutils = None @unittest.skipUnless(docutils, "no docutils installed.") @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") @modify_settings(INSTALLED_APPS={'append': ['django.contrib.admindocs', 'django.contrib.flatpages']}) class AdminDocsTest(TestCase): fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_tags(self): response = self.client.get('/test_admin/admin/doc/tags/') # The builtin tag group exists self.assertContains(response, "<h2>Built-in tags</h2>", count=2, html=True) # A builtin tag exists in both the index and detail self.assertContains(response, '<h3 id="built_in-autoescape">autoescape</h3>', html=True) self.assertContains(response, '<li><a href="#built_in-autoescape">autoescape</a></li>', html=True) # An app tag exists in both the index and detail self.assertContains(response, '<h3 id="flatpages-get_flatpages">get_flatpages</h3>', html=True) self.assertContains(response, '<li><a href="#flatpages-get_flatpages">get_flatpages</a></li>', html=True) # The admin list tag group exists self.assertContains(response, "<h2>admin_list</h2>", count=2, html=True) # An admin list tag exists in both the index and detail self.assertContains(response, '<h3 id="admin_list-admin_actions">admin_actions</h3>', html=True) self.assertContains(response, '<li><a href="#admin_list-admin_actions">admin_actions</a></li>', html=True) def test_filters(self): response = self.client.get('/test_admin/admin/doc/filters/') # The builtin filter group exists self.assertContains(response, "<h2>Built-in filters</h2>", count=2, html=True) # A builtin filter exists in both the index and detail self.assertContains(response, '<h3 id="built_in-add">add</h3>', html=True) self.assertContains(response, '<li><a href="#built_in-add">add</a></li>', html=True) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class ValidXHTMLTests(TestCase): fixtures = ['admin-views-users.xml'] urlbit = 'admin' def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() @override_settings( TEMPLATE_CONTEXT_PROCESSORS=filter( lambda t: t != 'django.core.context_processors.i18n', global_settings.TEMPLATE_CONTEXT_PROCESSORS), USE_I18N=False, ) def test_lang_name_present(self): response = self.client.get('/test_admin/%s/admin_views/' % self.urlbit) self.assertNotContains(response, ' lang=""') self.assertNotContains(response, ' xml:lang=""') @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls", USE_THOUSAND_SEPARATOR=True, USE_L10N=True) class DateHierarchyTests(TestCase): fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): formats.reset_format_cache() def assert_non_localized_year(self, response, year): """Ensure that the year is not localized with USE_THOUSAND_SEPARATOR. Refs #15234. """ self.assertNotContains(response, formats.number_format(year)) def assert_contains_year_link(self, response, date): self.assertContains(response, '?release_date__year=%d"' % (date.year,)) def assert_contains_month_link(self, response, date): self.assertContains( response, '?release_date__month=%d&release_date__year=%d"' % ( date.month, date.year)) def assert_contains_day_link(self, response, date): self.assertContains( response, '?release_date__day=%d&' 'release_date__month=%d&release_date__year=%d"' % ( date.day, date.month, date.year)) def test_empty(self): """ Ensure that no date hierarchy links display with empty changelist. """ response = self.client.get( reverse('admin:admin_views_podcast_changelist')) self.assertNotContains(response, 'release_date__year=') self.assertNotContains(response, 'release_date__month=') self.assertNotContains(response, 'release_date__day=') def test_single(self): """ Ensure that single day-level date hierarchy appears for single object. """ DATE = datetime.date(2000, 6, 30) Podcast.objects.create(release_date=DATE) url = reverse('admin:admin_views_podcast_changelist') response = self.client.get(url) self.assert_contains_day_link(response, DATE) self.assert_non_localized_year(response, 2000) def test_within_month(self): """ Ensure that day-level links appear for changelist within single month. """ DATES = (datetime.date(2000, 6, 30), datetime.date(2000, 6, 15), datetime.date(2000, 6, 3)) for date in DATES: Podcast.objects.create(release_date=date) url = reverse('admin:admin_views_podcast_changelist') response = self.client.get(url) for date in DATES: self.assert_contains_day_link(response, date) self.assert_non_localized_year(response, 2000) def test_within_year(self): """ Ensure that month-level links appear for changelist within single year. """ DATES = (datetime.date(2000, 1, 30), datetime.date(2000, 3, 15), datetime.date(2000, 5, 3)) for date in DATES: Podcast.objects.create(release_date=date) url = reverse('admin:admin_views_podcast_changelist') response = self.client.get(url) # no day-level links self.assertNotContains(response, 'release_date__day=') for date in DATES: self.assert_contains_month_link(response, date) self.assert_non_localized_year(response, 2000) def test_multiple_years(self): """ Ensure that year-level links appear for year-spanning changelist. """ DATES = (datetime.date(2001, 1, 30), datetime.date(2003, 3, 15), datetime.date(2005, 5, 3)) for date in DATES: Podcast.objects.create(release_date=date) response = self.client.get( reverse('admin:admin_views_podcast_changelist')) # no day/month-level links self.assertNotContains(response, 'release_date__day=') self.assertNotContains(response, 'release_date__month=') for date in DATES: self.assert_contains_year_link(response, date) # and make sure GET parameters still behave correctly for date in DATES: url = '%s?release_date__year=%d' % ( reverse('admin:admin_views_podcast_changelist'), date.year) response = self.client.get(url) self.assert_contains_month_link(response, date) self.assert_non_localized_year(response, 2000) self.assert_non_localized_year(response, 2003) self.assert_non_localized_year(response, 2005) url = '%s?release_date__year=%d&release_date__month=%d' % ( reverse('admin:admin_views_podcast_changelist'), date.year, date.month) response = self.client.get(url) self.assert_contains_day_link(response, date) self.assert_non_localized_year(response, 2000) self.assert_non_localized_year(response, 2003) self.assert_non_localized_year(response, 2005) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminCustomSaveRelatedTests(TestCase): """ Ensure that one can easily customize the way related objects are saved. Refs #16115. """ fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def test_should_be_able_to_edit_related_objects_on_add_view(self): post = { 'child_set-TOTAL_FORMS': '3', 'child_set-INITIAL_FORMS': '0', 'name': 'Josh Stone', 'child_set-0-name': 'Paul', 'child_set-1-name': 'Catherine', } self.client.post('/test_admin/admin/admin_views/parent/add/', post) self.assertEqual(1, Parent.objects.count()) self.assertEqual(2, Child.objects.count()) children_names = list(Child.objects.order_by('name').values_list('name', flat=True)) self.assertEqual('Josh Stone', Parent.objects.latest('id').name) self.assertEqual(['Catherine Stone', 'Paul Stone'], children_names) def test_should_be_able_to_edit_related_objects_on_change_view(self): parent = Parent.objects.create(name='Josh Stone') paul = Child.objects.create(parent=parent, name='Paul') catherine = Child.objects.create(parent=parent, name='Catherine') post = { 'child_set-TOTAL_FORMS': '5', 'child_set-INITIAL_FORMS': '2', 'name': 'Josh Stone', 'child_set-0-name': 'Paul', 'child_set-0-id': paul.id, 'child_set-1-name': 'Catherine', 'child_set-1-id': catherine.id, } self.client.post('/test_admin/admin/admin_views/parent/%s/' % parent.id, post) children_names = list(Child.objects.order_by('name').values_list('name', flat=True)) self.assertEqual('Josh Stone', Parent.objects.latest('id').name) self.assertEqual(['Catherine Stone', 'Paul Stone'], children_names) def test_should_be_able_to_edit_related_objects_on_changelist_view(self): parent = Parent.objects.create(name='Josh Rock') Child.objects.create(parent=parent, name='Paul') Child.objects.create(parent=parent, name='Catherine') post = { 'form-TOTAL_FORMS': '1', 'form-INITIAL_FORMS': '1', 'form-MAX_NUM_FORMS': '0', 'form-0-id': parent.id, 'form-0-name': 'Josh Stone', '_save': 'Save' } self.client.post('/test_admin/admin/admin_views/parent/', post) children_names = list(Child.objects.order_by('name').values_list('name', flat=True)) self.assertEqual('Josh Stone', Parent.objects.latest('id').name) self.assertEqual(['Catherine Stone', 'Paul Stone'], children_names) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminViewLogoutTest(TestCase): fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_client_logout_url_can_be_used_to_login(self): response = self.client.get('/test_admin/admin/logout/') self.assertEqual(response.status_code, 200) self.assertTemplateUsed(response, 'registration/logged_out.html') self.assertEqual(response.request['PATH_INFO'], '/test_admin/admin/logout/') # we are now logged out response = self.client.get('/test_admin/admin/logout/') self.assertEqual(response.status_code, 302) # we should be redirected to the login page. # follow the redirect and test results. response = self.client.get('/test_admin/admin/logout/', follow=True) self.assertEqual(response.status_code, 200) self.assertTemplateUsed(response, 'admin/login.html') self.assertEqual(response.request['PATH_INFO'], '/test_admin/admin/login/') self.assertContains(response, '<input type="hidden" name="next" value="/test_admin/admin/" />') @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminUserMessageTest(TestCase): fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def send_message(self, level): """ Helper that sends a post to the dummy test methods and asserts that a message with the level has appeared in the response. """ action_data = { ACTION_CHECKBOX_NAME: [1], 'action': 'message_%s' % level, 'index': 0, } response = self.client.post('/test_admin/admin/admin_views/usermessenger/', action_data, follow=True) self.assertContains(response, '<li class="%s">Test %s</li>' % (level, level), html=True) @override_settings(MESSAGE_LEVEL=10) # Set to DEBUG for this request def test_message_debug(self): self.send_message('debug') def test_message_info(self): self.send_message('info') def test_message_success(self): self.send_message('success') def test_message_warning(self): self.send_message('warning') def test_message_error(self): self.send_message('error') def test_message_extra_tags(self): action_data = { ACTION_CHECKBOX_NAME: [1], 'action': 'message_extra_tags', 'index': 0, } response = self.client.post('/test_admin/admin/admin_views/usermessenger/', action_data, follow=True) self.assertContains(response, '<li class="extra_tag info">Test tags</li>', html=True) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminKeepChangeListFiltersTests(TestCase): fixtures = ['admin-views-users.xml'] admin_site = site def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def assertURLEqual(self, url1, url2): """ Assert that two URLs are equal despite the ordering of their querystring. Refs #22360. """ parsed_url1 = urlparse(url1) path1 = parsed_url1.path parsed_qs1 = dict(parse_qsl(parsed_url1.query)) parsed_url2 = urlparse(url2) path2 = parsed_url2.path parsed_qs2 = dict(parse_qsl(parsed_url2.query)) for parsed_qs in [parsed_qs1, parsed_qs2]: if '_changelist_filters' in parsed_qs: changelist_filters = parsed_qs['_changelist_filters'] parsed_filters = dict(parse_qsl(changelist_filters)) parsed_qs['_changelist_filters'] = parsed_filters self.assertEqual(path1, path2) self.assertEqual(parsed_qs1, parsed_qs2) def test_assert_url_equal(self): # Test equality. self.assertURLEqual( 'http://testserver/test_admin/admin/auth/user/105/?_changelist_filters=is_staff__exact%3D0%26is_superuser__exact%3D0', 'http://testserver/test_admin/admin/auth/user/105/?_changelist_filters=is_staff__exact%3D0%26is_superuser__exact%3D0' ) # Test inequality. with self.assertRaises(AssertionError): self.assertURLEqual( 'http://testserver/test_admin/admin/auth/user/105/?_changelist_filters=is_staff__exact%3D0%26is_superuser__exact%3D0', 'http://testserver/test_admin/admin/auth/user/105/?_changelist_filters=is_staff__exact%3D1%26is_superuser__exact%3D1' ) # Ignore scheme and host. self.assertURLEqual( 'http://testserver/test_admin/admin/auth/user/105/?_changelist_filters=is_staff__exact%3D0%26is_superuser__exact%3D0', '/test_admin/admin/auth/user/105/?_changelist_filters=is_staff__exact%3D0%26is_superuser__exact%3D0' ) # Ignore ordering of querystring. self.assertURLEqual( '/test_admin/admin/auth/user/?is_staff__exact=0&is_superuser__exact=0', '/test_admin/admin/auth/user/?is_superuser__exact=0&is_staff__exact=0' ) # Ignore ordering of _changelist_filters. self.assertURLEqual( '/test_admin/admin/auth/user/105/?_changelist_filters=is_staff__exact%3D0%26is_superuser__exact%3D0', '/test_admin/admin/auth/user/105/?_changelist_filters=is_superuser__exact%3D0%26is_staff__exact%3D0' ) def get_changelist_filters(self): return { 'is_superuser__exact': 0, 'is_staff__exact': 0, } def get_changelist_filters_querystring(self): return urlencode(self.get_changelist_filters()) def get_preserved_filters_querystring(self): return urlencode({ '_changelist_filters': self.get_changelist_filters_querystring() }) def get_sample_user_id(self): return 104 def get_changelist_url(self): return '%s?%s' % ( reverse('admin:auth_user_changelist', current_app=self.admin_site.name), self.get_changelist_filters_querystring(), ) def get_add_url(self): return '%s?%s' % ( reverse('admin:auth_user_add', current_app=self.admin_site.name), self.get_preserved_filters_querystring(), ) def get_change_url(self, user_id=None): if user_id is None: user_id = self.get_sample_user_id() return "%s?%s" % ( reverse('admin:auth_user_change', args=(user_id,), current_app=self.admin_site.name), self.get_preserved_filters_querystring(), ) def get_history_url(self, user_id=None): if user_id is None: user_id = self.get_sample_user_id() return "%s?%s" % ( reverse('admin:auth_user_history', args=(user_id,), current_app=self.admin_site.name), self.get_preserved_filters_querystring(), ) def get_delete_url(self, user_id=None): if user_id is None: user_id = self.get_sample_user_id() return "%s?%s" % ( reverse('admin:auth_user_delete', args=(user_id,), current_app=self.admin_site.name), self.get_preserved_filters_querystring(), ) def test_changelist_view(self): response = self.client.get(self.get_changelist_url()) self.assertEqual(response.status_code, 200) # Check the `change_view` link has the correct querystring. detail_link = re.search( '<a href="(.*?)">joepublic</a>', force_text(response.content) ) self.assertURLEqual(detail_link.group(1), self.get_change_url()) def test_change_view(self): # Get the `change_view`. response = self.client.get(self.get_change_url()) self.assertEqual(response.status_code, 200) # Check the form action. form_action = re.search( '<form enctype="multipart/form-data" action="(.*?)" method="post" id="user_form".*?>', force_text(response.content) ) self.assertURLEqual(form_action.group(1), '?%s' % self.get_preserved_filters_querystring()) # Check the history link. history_link = re.search( '<a href="(.*?)" class="historylink">History</a>', force_text(response.content) ) self.assertURLEqual(history_link.group(1), self.get_history_url()) # Check the delete link. delete_link = re.search( '<a href="(.*?)" class="deletelink">Delete</a>', force_text(response.content) ) self.assertURLEqual(delete_link.group(1), self.get_delete_url()) # Test redirect on "Save". post_data = { 'username': 'joepublic', 'last_login_0': '2007-05-30', 'last_login_1': '13:20:10', 'date_joined_0': '2007-05-30', 'date_joined_1': '13:20:10', } post_data['_save'] = 1 response = self.client.post(self.get_change_url(), data=post_data) self.assertEqual(response.status_code, 302) self.assertURLEqual( response.url, self.get_changelist_url() ) post_data.pop('_save') # Test redirect on "Save and continue". post_data['_continue'] = 1 response = self.client.post(self.get_change_url(), data=post_data) self.assertEqual(response.status_code, 302) self.assertURLEqual( response.url, self.get_change_url() ) post_data.pop('_continue') # Test redirect on "Save and add new". post_data['_addanother'] = 1 response = self.client.post(self.get_change_url(), data=post_data) self.assertEqual(response.status_code, 302) self.assertURLEqual( response.url, self.get_add_url() ) post_data.pop('_addanother') def test_add_view(self): # Get the `add_view`. response = self.client.get(self.get_add_url()) self.assertEqual(response.status_code, 200) # Check the form action. form_action = re.search( '<form enctype="multipart/form-data" action="(.*?)" method="post" id="user_form".*?>', force_text(response.content) ) self.assertURLEqual(form_action.group(1), '?%s' % self.get_preserved_filters_querystring()) post_data = { 'username': 'dummy', 'password1': 'test', 'password2': 'test', } # Test redirect on "Save". post_data['_save'] = 1 response = self.client.post(self.get_add_url(), data=post_data) self.assertEqual(response.status_code, 302) self.assertURLEqual( response.url, self.get_change_url(User.objects.latest('pk').pk) ) post_data.pop('_save') # Test redirect on "Save and continue". post_data['username'] = 'dummy2' post_data['_continue'] = 1 response = self.client.post(self.get_add_url(), data=post_data) self.assertEqual(response.status_code, 302) self.assertURLEqual( response.url, self.get_change_url(User.objects.latest('pk').pk) ) post_data.pop('_continue') # Test redirect on "Save and add new". post_data['username'] = 'dummy3' post_data['_addanother'] = 1 response = self.client.post(self.get_add_url(), data=post_data) self.assertEqual(response.status_code, 302) self.assertURLEqual( response.url, self.get_add_url() ) post_data.pop('_addanother') def test_delete_view(self): # Test redirect on "Delete". response = self.client.post(self.get_delete_url(), {'post': 'yes'}) self.assertEqual(response.status_code, 302) self.assertURLEqual( response.url, self.get_changelist_url() ) def test_url_prefix(self): context = { 'preserved_filters': self.get_preserved_filters_querystring(), 'opts': User._meta, } url = reverse('admin:auth_user_changelist', current_app=self.admin_site.name) self.assertURLEqual( self.get_changelist_url(), add_preserved_filters(context, url), ) original_prefix = get_script_prefix() try: set_script_prefix('/prefix/') url = reverse('admin:auth_user_changelist', current_app=self.admin_site.name) self.assertURLEqual( self.get_changelist_url(), add_preserved_filters(context, url), ) finally: set_script_prefix(original_prefix) class NamespacedAdminKeepChangeListFiltersTests(AdminKeepChangeListFiltersTests): admin_site = site2 @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class TestLabelVisibility(TestCase): """ #11277 -Labels of hidden fields in admin were not hidden. """ fixtures = ['admin-views-users.xml'] def setUp(self): self.client.login(username='super', password='secret') def test_all_fields_visible(self): response = self.client.get('/test_admin/admin/admin_views/emptymodelvisible/add/') self.assert_fieldline_visible(response) self.assert_field_visible(response, 'first') self.assert_field_visible(response, 'second') def test_all_fields_hidden(self): response = self.client.get('/test_admin/admin/admin_views/emptymodelhidden/add/') self.assert_fieldline_hidden(response) self.assert_field_hidden(response, 'first') self.assert_field_hidden(response, 'second') def test_mixin(self): response = self.client.get('/test_admin/admin/admin_views/emptymodelmixin/add/') self.assert_fieldline_visible(response) self.assert_field_hidden(response, 'first') self.assert_field_visible(response, 'second') def assert_field_visible(self, response, field_name): self.assertContains(response, '<div class="field-box field-%s">' % field_name) def assert_field_hidden(self, response, field_name): self.assertContains(response, '<div class="field-box field-%s hidden">' % field_name) def assert_fieldline_visible(self, response): self.assertContains(response, '<div class="form-row field-first field-second">') def assert_fieldline_hidden(self, response): self.assertContains(response, '<div class="form-row hidden') @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class AdminViewOnSiteTests(TestCase): fixtures = ['admin-views-users.xml', 'admin-views-restaurants.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_add_view_form_and_formsets_run_validation(self): """ Issue #20522 Verifying that if the parent form fails validation, the inlines also run validation even if validation is contingent on parent form data """ # The form validation should fail because 'some_required_info' is # not included on the parent form, and the family_name of the parent # does not match that of the child post_data = {"family_name": "Test1", "dependentchild_set-TOTAL_FORMS": "1", "dependentchild_set-INITIAL_FORMS": "0", "dependentchild_set-MAX_NUM_FORMS": "1", "dependentchild_set-0-id": "", "dependentchild_set-0-parent": "", "dependentchild_set-0-family_name": "Test2"} response = self.client.post('/test_admin/admin/admin_views/parentwithdependentchildren/add/', post_data) # just verifying the parent form failed validation, as expected -- # this isn't the regression test self.assertIn('some_required_info', response.context['adminform'].form.errors) # actual regression test for error_set in response.context['inline_admin_formset'].formset.errors: self.assertEqual(['Children must share a family name with their parents in this contrived test case'], error_set.get('__all__')) def test_change_view_form_and_formsets_run_validation(self): """ Issue #20522 Verifying that if the parent form fails validation, the inlines also run validation even if validation is contingent on parent form data """ pwdc = ParentWithDependentChildren.objects.create(some_required_info=6, family_name="Test1") # The form validation should fail because 'some_required_info' is # not included on the parent form, and the family_name of the parent # does not match that of the child post_data = {"family_name": "Test2", "dependentchild_set-TOTAL_FORMS": "1", "dependentchild_set-INITIAL_FORMS": "0", "dependentchild_set-MAX_NUM_FORMS": "1", "dependentchild_set-0-id": "", "dependentchild_set-0-parent": str(pwdc.id), "dependentchild_set-0-family_name": "Test1"} response = self.client.post('/test_admin/admin/admin_views/parentwithdependentchildren/%d/' % pwdc.id, post_data) # just verifying the parent form failed validation, as expected -- # this isn't the regression test self.assertIn('some_required_info', response.context['adminform'].form.errors) # actual regression test for error_set in response.context['inline_admin_formset'].formset.errors: self.assertEqual(['Children must share a family name with their parents in this contrived test case'], error_set.get('__all__')) def test_check(self): "Ensure that the view_on_site value is either a boolean or a callable" try: CityAdmin.view_on_site = True self.assertEqual(CityAdmin.check(City), []) CityAdmin.view_on_site = False self.assertEqual(CityAdmin.check(City), []) CityAdmin.view_on_site = lambda obj: obj.get_absolute_url() self.assertEqual(CityAdmin.check(City), []) CityAdmin.view_on_site = [] self.assertEqual(CityAdmin.check(City), [ Error( "The value of 'view_on_site' must be a callable or a boolean value.", hint=None, obj=CityAdmin, id='admin.E025', ), ]) finally: # Restore the original values for the benefit of other tests. CityAdmin.view_on_site = True def test_false(self): "Ensure that the 'View on site' button is not displayed if view_on_site is False" response = self.client.get('/test_admin/admin/admin_views/restaurant/1/') content_type_pk = ContentType.objects.get_for_model(Restaurant).pk self.assertNotContains(response, '"/test_admin/admin/r/%s/1/"' % content_type_pk, ) def test_true(self): "Ensure that the default behavior is followed if view_on_site is True" response = self.client.get('/test_admin/admin/admin_views/city/1/') content_type_pk = ContentType.objects.get_for_model(City).pk self.assertContains(response, '"/test_admin/admin/r/%s/1/"' % content_type_pk, ) def test_callable(self): "Ensure that the right link is displayed if view_on_site is a callable" response = self.client.get('/test_admin/admin/admin_views/worker/1/') worker = Worker.objects.get(pk=1) self.assertContains(response, '"/worker/%s/%s/"' % (worker.surname, worker.name), ) def test_missing_get_absolute_url(self): "Ensure None is returned if model doesn't have get_absolute_url" model_admin = ModelAdmin(Worker, None) self.assertIsNone(model_admin.get_view_on_site_url(Worker())) @override_settings(PASSWORD_HASHERS=('django.contrib.auth.hashers.SHA1PasswordHasher',), ROOT_URLCONF="admin_views.urls") class InlineAdminViewOnSiteTest(TestCase): fixtures = ['admin-views-users.xml', 'admin-views-restaurants.xml'] def setUp(self): self.client.login(username='super', password='secret') def tearDown(self): self.client.logout() def test_false(self): "Ensure that the 'View on site' button is not displayed if view_on_site is False" response = self.client.get('/test_admin/admin/admin_views/state/1/') content_type_pk = ContentType.objects.get_for_model(City).pk self.assertNotContains(response, '/test_admin/admin/r/%s/1/' % content_type_pk, ) def test_true(self): "Ensure that the 'View on site' button is displayed if view_on_site is True" response = self.client.get('/test_admin/admin/admin_views/city/1/') content_type_pk = ContentType.objects.get_for_model(Restaurant).pk self.assertContains(response, '/test_admin/admin/r/%s/1/' % content_type_pk, ) def test_callable(self): "Ensure that the right link is displayed if view_on_site is a callable" response = self.client.get('/test_admin/admin/admin_views/restaurant/1/') worker = Worker.objects.get(pk=1) self.assertContains(response, '"/worker_inline/%s/%s/"' % (worker.surname, worker.name), ) class AdminGenericRelationTests(TestCase): def test_generic_relation_fk_list_filter(self): """ Validates a model with a generic relation to a model with a foreign key can specify the generic+fk relationship path as a list_filter. See trac #21428. """ class GenericFKAdmin(ModelAdmin): list_filter = ('tags__content_type',) validator = ModelAdminValidator() try: validator.validate_list_filter(GenericFKAdmin, Plot) except ImproperlyConfigured: self.fail("Couldn't validate a GenericRelation -> FK path in ModelAdmin.list_filter") @override_settings(ROOT_URLCONF="admin_views.urls") class TestEtagWithAdminView(TestCase): # See https://code.djangoproject.com/ticket/16003 def test_admin(self): with self.settings(USE_ETAGS=False): response = self.client.get('/test_admin/admin/') self.assertEqual(response.status_code, 302) self.assertFalse(response.has_header('ETag')) with self.settings(USE_ETAGS=True): response = self.client.get('/test_admin/admin/') self.assertEqual(response.status_code, 302) self.assertTrue(response.has_header('ETag'))

45.74357

251

0.64894

07c7cacc89e134a0fd7bfe47314b33e0f926a649

3,292

py

Python

py/selenium/webdriver/common/desired_capabilities.py

weilandia/selenium

949f05eb9a0dad3fddbf1fb34c3b0164deba1db7

[ "Apache-2.0" ]

3

2019-04-21T14:21:16.000Z

2019-04-27T03:24:01.000Z

py/selenium/webdriver/common/desired_capabilities.py

weilandia/selenium

949f05eb9a0dad3fddbf1fb34c3b0164deba1db7

[ "Apache-2.0" ]

6

2019-09-26T23:37:05.000Z

2019-10-11T20:57:06.000Z

py/selenium/webdriver/common/desired_capabilities.py

lucianodgs/selenium

e2b2b97de0d9a6cc86563c866a9361237519159f

[ "Apache-2.0" ]

2

2019-06-27T19:40:39.000Z

2019-11-25T23:36:37.000Z

# Licensed to the Software Freedom Conservancy (SFC) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The SFC licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. """ The Desired Capabilities implementation. """ class DesiredCapabilities(object): """ Set of default supported desired capabilities. Use this as a starting point for creating a desired capabilities object for requesting remote webdrivers for connecting to selenium server or selenium grid. Usage Example:: from selenium import webdriver selenium_grid_url = "http://198.0.0.1:4444/wd/hub" # Create a desired capabilities object as a starting point. capabilities = DesiredCapabilities.FIREFOX.copy() capabilities['platform'] = "WINDOWS" capabilities['version'] = "10" # Instantiate an instance of Remote WebDriver with the desired capabilities. driver = webdriver.Remote(desired_capabilities=capabilities, command_executor=selenium_grid_url) Note: Always use '.copy()' on the DesiredCapabilities object to avoid the side effects of altering the Global class instance. """ FIREFOX = { "browserName": "firefox", "acceptInsecureCerts": True, } INTERNETEXPLORER = { "browserName": "internet explorer", "version": "", "platform": "WINDOWS", } EDGE = { "browserName": "MicrosoftEdge", "version": "", "platform": "WINDOWS" } CHROME = { "browserName": "chrome", "version": "", "platform": "ANY", } OPERA = { "browserName": "opera", "version": "", "platform": "ANY", } SAFARI = { "browserName": "safari", "version": "", "platform": "MAC", } HTMLUNIT = { "browserName": "htmlunit", "version": "", "platform": "ANY", } HTMLUNITWITHJS = { "browserName": "htmlunit", "version": "firefox", "platform": "ANY", "javascriptEnabled": True, } IPHONE = { "browserName": "iPhone", "version": "", "platform": "MAC", } IPAD = { "browserName": "iPad", "version": "", "platform": "MAC", } ANDROID = { "browserName": "android", "version": "", "platform": "ANDROID", } PHANTOMJS = { "browserName": "phantomjs", "version": "", "platform": "ANY", "javascriptEnabled": True, } WEBKITGTK = { "browserName": "MiniBrowser", "version": "", "platform": "ANY", }

25.71875

84

0.595383

3c9ba4d2fa93151744e77256710e5f58b2f35110

20,137

py

Python

bot/exts/evergreen/help.py

blankRiot96/sir-lancebot

25175a0d33886902576333756c84bd195af563ea

[ "MIT" ]

1

2022-01-06T01:23:13.000Z

bot/exts/evergreen/help.py

blankRiot96/sir-lancebot

25175a0d33886902576333756c84bd195af563ea

[ "MIT" ]

null

bot/exts/evergreen/help.py

blankRiot96/sir-lancebot

25175a0d33886902576333756c84bd195af563ea

[ "MIT" ]

null

# Help command from Python bot. All commands that will be added to there in futures should be added to here too. import asyncio import itertools import logging from contextlib import suppress from typing import List, NamedTuple, Union from discord import Colour, Embed, HTTPException, Message, Reaction, User from discord.ext import commands from discord.ext.commands import CheckFailure, Cog as DiscordCog, Command, Context from fuzzywuzzy import fuzz, process from bot import constants from bot.bot import Bot from bot.constants import Emojis from bot.utils.pagination import ( FIRST_EMOJI, LAST_EMOJI, LEFT_EMOJI, LinePaginator, RIGHT_EMOJI, ) DELETE_EMOJI = Emojis.trashcan REACTIONS = { FIRST_EMOJI: "first", LEFT_EMOJI: "back", RIGHT_EMOJI: "next", LAST_EMOJI: "end", DELETE_EMOJI: "stop", } class Cog(NamedTuple): """Show information about a Cog's name, description and commands.""" name: str description: str commands: List[Command] log = logging.getLogger(__name__) class HelpQueryNotFound(ValueError): """ Raised when a HelpSession Query doesn't match a command or cog. Contains the custom attribute of ``possible_matches``. Instances of this object contain a dictionary of any command(s) that were close to matching the query, where keys are the possible matched command names and values are the likeness match scores. """ def __init__(self, arg: str, possible_matches: dict = None): super().__init__(arg) self.possible_matches = possible_matches class HelpSession: """ An interactive session for bot and command help output. Expected attributes include: * title: str The title of the help message. * query: Union[discord.ext.commands.Bot, discord.ext.commands.Command] * description: str The description of the query. * pages: list[str] A list of the help content split into manageable pages. * message: `discord.Message` The message object that's showing the help contents. * destination: `discord.abc.Messageable` Where the help message is to be sent to. Cogs can be grouped into custom categories. All cogs with the same category will be displayed under a single category name in the help output. Custom categories are defined inside the cogs as a class attribute named `category`. A description can also be specified with the attribute `category_description`. If a description is not found in at least one cog, the default will be the regular description (class docstring) of the first cog found in the category. """ def __init__( self, ctx: Context, *command, cleanup: bool = False, only_can_run: bool = True, show_hidden: bool = False, max_lines: int = 15 ): """Creates an instance of the HelpSession class.""" self._ctx = ctx self._bot = ctx.bot self.title = "Command Help" # set the query details for the session if command: query_str = " ".join(command) self.query = self._get_query(query_str) self.description = self.query.description or self.query.help else: self.query = ctx.bot self.description = self.query.description self.author = ctx.author self.destination = ctx.channel # set the config for the session self._cleanup = cleanup self._only_can_run = only_can_run self._show_hidden = show_hidden self._max_lines = max_lines # init session states self._pages = None self._current_page = 0 self.message = None self._timeout_task = None self.reset_timeout() def _get_query(self, query: str) -> Union[Command, Cog]: """Attempts to match the provided query with a valid command or cog.""" command = self._bot.get_command(query) if command: return command # Find all cog categories that match. cog_matches = [] description = None for cog in self._bot.cogs.values(): if hasattr(cog, "category") and cog.category == query: cog_matches.append(cog) if hasattr(cog, "category_description"): description = cog.category_description # Try to search by cog name if no categories match. if not cog_matches: cog = self._bot.cogs.get(query) # Don't consider it a match if the cog has a category. if cog and not hasattr(cog, "category"): cog_matches = [cog] if cog_matches: cog = cog_matches[0] cmds = (cog.get_commands() for cog in cog_matches) # Commands of all cogs return Cog( name=cog.category if hasattr(cog, "category") else cog.qualified_name, description=description or cog.description, commands=tuple(itertools.chain.from_iterable(cmds)) # Flatten the list ) self._handle_not_found(query) def _handle_not_found(self, query: str) -> None: """ Handles when a query does not match a valid command or cog. Will pass on possible close matches along with the `HelpQueryNotFound` exception. """ # Combine command and cog names choices = list(self._bot.all_commands) + list(self._bot.cogs) result = process.extractBests(query, choices, scorer=fuzz.ratio, score_cutoff=90) raise HelpQueryNotFound(f'Query "{query}" not found.', dict(result)) async def timeout(self, seconds: int = 30) -> None: """Waits for a set number of seconds, then stops the help session.""" await asyncio.sleep(seconds) await self.stop() def reset_timeout(self) -> None: """Cancels the original timeout task and sets it again from the start.""" # cancel original if it exists if self._timeout_task: if not self._timeout_task.cancelled(): self._timeout_task.cancel() # recreate the timeout task self._timeout_task = self._bot.loop.create_task(self.timeout()) async def on_reaction_add(self, reaction: Reaction, user: User) -> None: """Event handler for when reactions are added on the help message.""" # ensure it was the relevant session message if reaction.message.id != self.message.id: return # ensure it was the session author who reacted if user.id != self.author.id: return emoji = str(reaction.emoji) # check if valid action if emoji not in REACTIONS: return self.reset_timeout() # Run relevant action method action = getattr(self, f"do_{REACTIONS[emoji]}", None) if action: await action() # remove the added reaction to prep for re-use with suppress(HTTPException): await self.message.remove_reaction(reaction, user) async def on_message_delete(self, message: Message) -> None: """Closes the help session when the help message is deleted.""" if message.id == self.message.id: await self.stop() async def prepare(self) -> None: """Sets up the help session pages, events, message and reactions.""" await self.build_pages() self._bot.add_listener(self.on_reaction_add) self._bot.add_listener(self.on_message_delete) await self.update_page() self.add_reactions() def add_reactions(self) -> None: """Adds the relevant reactions to the help message based on if pagination is required.""" # if paginating if len(self._pages) > 1: for reaction in REACTIONS: self._bot.loop.create_task(self.message.add_reaction(reaction)) # if single-page else: self._bot.loop.create_task(self.message.add_reaction(DELETE_EMOJI)) def _category_key(self, cmd: Command) -> str: """ Returns a cog name of a given command for use as a key for `sorted` and `groupby`. A zero width space is used as a prefix for results with no cogs to force them last in ordering. """ if cmd.cog: try: if cmd.cog.category: return f"**{cmd.cog.category}**" except AttributeError: pass return f"**{cmd.cog_name}**" else: return "**\u200bNo Category:**" def _get_command_params(self, cmd: Command) -> str: """ Returns the command usage signature. This is a custom implementation of `command.signature` in order to format the command signature without aliases. """ results = [] for name, param in cmd.clean_params.items(): # if argument has a default value if param.default is not param.empty: if isinstance(param.default, str): show_default = param.default else: show_default = param.default is not None # if default is not an empty string or None if show_default: results.append(f"[{name}={param.default}]") else: results.append(f"[{name}]") # if variable length argument elif param.kind == param.VAR_POSITIONAL: results.append(f"[{name}...]") # if required else: results.append(f"<{name}>") return f"{cmd.name} {' '.join(results)}" async def build_pages(self) -> None: """Builds the list of content pages to be paginated through in the help message, as a list of str.""" # Use LinePaginator to restrict embed line height paginator = LinePaginator(prefix="", suffix="", max_lines=self._max_lines) # show signature if query is a command if isinstance(self.query, commands.Command): await self._add_command_signature(paginator) if isinstance(self.query, Cog): paginator.add_line(f"**{self.query.name}**") if self.description: paginator.add_line(f"*{self.description}*") # list all children commands of the queried object if isinstance(self.query, (commands.GroupMixin, Cog)): await self._list_child_commands(paginator) self._pages = paginator.pages async def _add_command_signature(self, paginator: LinePaginator) -> None: prefix = constants.Client.prefix signature = self._get_command_params(self.query) parent = self.query.full_parent_name + " " if self.query.parent else "" paginator.add_line(f"**```{prefix}{parent}{signature}```**") aliases = [f"`{alias}`" if not parent else f"`{parent} {alias}`" for alias in self.query.aliases] aliases += [f"`{alias}`" for alias in getattr(self.query, "root_aliases", ())] aliases = ", ".join(sorted(aliases)) if aliases: paginator.add_line(f"**Can also use:** {aliases}\n") if not await self.query.can_run(self._ctx): paginator.add_line("***You cannot run this command.***\n") async def _list_child_commands(self, paginator: LinePaginator) -> None: # remove hidden commands if session is not wanting hiddens if not self._show_hidden: filtered = [c for c in self.query.commands if not c.hidden] else: filtered = self.query.commands # if after filter there are no commands, finish up if not filtered: self._pages = paginator.pages return if isinstance(self.query, Cog): grouped = (("**Commands:**", self.query.commands),) elif isinstance(self.query, commands.Command): grouped = (("**Subcommands:**", self.query.commands),) # otherwise sort and organise all commands into categories else: cat_sort = sorted(filtered, key=self._category_key) grouped = itertools.groupby(cat_sort, key=self._category_key) for category, cmds in grouped: await self._format_command_category(paginator, category, list(cmds)) async def _format_command_category(self, paginator: LinePaginator, category: str, cmds: List[Command]) -> None: cmds = sorted(cmds, key=lambda c: c.name) cat_cmds = [] for command in cmds: cat_cmds += await self._format_command(command) # state var for if the category should be added next print_cat = 1 new_page = True for details in cat_cmds: # keep details together, paginating early if it won"t fit lines_adding = len(details.split("\n")) + print_cat if paginator._linecount + lines_adding > self._max_lines: paginator._linecount = 0 new_page = True paginator.close_page() # new page so print category title again print_cat = 1 if print_cat: if new_page: paginator.add_line("") paginator.add_line(category) print_cat = 0 paginator.add_line(details) async def _format_command(self, command: Command) -> List[str]: # skip if hidden and hide if session is set to if command.hidden and not self._show_hidden: return [] # Patch to make the !help command work outside of #bot-commands again # This probably needs a proper rewrite, but this will make it work in # the mean time. try: can_run = await command.can_run(self._ctx) except CheckFailure: can_run = False # see if the user can run the command strikeout = "" if not can_run: # skip if we don't show commands they can't run if self._only_can_run: return [] strikeout = "~~" if isinstance(self.query, commands.Command): prefix = "" else: prefix = constants.Client.prefix signature = self._get_command_params(command) info = f"{strikeout}**`{prefix}{signature}`**{strikeout}" # handle if the command has no docstring short_doc = command.short_doc or "No details provided" return [f"{info}\n*{short_doc}*"] def embed_page(self, page_number: int = 0) -> Embed: """Returns an Embed with the requested page formatted within.""" embed = Embed() if isinstance(self.query, (commands.Command, Cog)) and page_number > 0: title = f'Command Help | "{self.query.name}"' else: title = self.title embed.set_author(name=title, icon_url=constants.Icons.questionmark) embed.description = self._pages[page_number] page_count = len(self._pages) if page_count > 1: embed.set_footer(text=f"Page {self._current_page+1} / {page_count}") return embed async def update_page(self, page_number: int = 0) -> None: """Sends the intial message, or changes the existing one to the given page number.""" self._current_page = page_number embed_page = self.embed_page(page_number) if not self.message: self.message = await self.destination.send(embed=embed_page) else: await self.message.edit(embed=embed_page) @classmethod async def start(cls, ctx: Context, *command, **options) -> "HelpSession": """ Create and begin a help session based on the given command context. Available options kwargs: * cleanup: Optional[bool] Set to `True` to have the message deleted on session end. Defaults to `False`. * only_can_run: Optional[bool] Set to `True` to hide commands the user can't run. Defaults to `False`. * show_hidden: Optional[bool] Set to `True` to include hidden commands. Defaults to `False`. * max_lines: Optional[int] Sets the max number of lines the paginator will add to a single page. Defaults to 20. """ session = cls(ctx, *command, **options) await session.prepare() return session async def stop(self) -> None: """Stops the help session, removes event listeners and attempts to delete the help message.""" self._bot.remove_listener(self.on_reaction_add) self._bot.remove_listener(self.on_message_delete) # ignore if permission issue, or the message doesn't exist with suppress(HTTPException, AttributeError): if self._cleanup: await self.message.delete() else: await self.message.clear_reactions() @property def is_first_page(self) -> bool: """Check if session is currently showing the first page.""" return self._current_page == 0 @property def is_last_page(self) -> bool: """Check if the session is currently showing the last page.""" return self._current_page == (len(self._pages)-1) async def do_first(self) -> None: """Event that is called when the user requests the first page.""" if not self.is_first_page: await self.update_page(0) async def do_back(self) -> None: """Event that is called when the user requests the previous page.""" if not self.is_first_page: await self.update_page(self._current_page-1) async def do_next(self) -> None: """Event that is called when the user requests the next page.""" if not self.is_last_page: await self.update_page(self._current_page+1) async def do_end(self) -> None: """Event that is called when the user requests the last page.""" if not self.is_last_page: await self.update_page(len(self._pages)-1) async def do_stop(self) -> None: """Event that is called when the user requests to stop the help session.""" await self.message.delete() class Help(DiscordCog): """Custom Embed Pagination Help feature.""" @commands.command("help") async def new_help(self, ctx: Context, *commands) -> None: """Shows Command Help.""" try: await HelpSession.start(ctx, *commands) except HelpQueryNotFound as error: embed = Embed() embed.colour = Colour.red() embed.title = str(error) if error.possible_matches: matches = "\n".join(error.possible_matches.keys()) embed.description = f"**Did you mean:**\n`{matches}`" await ctx.send(embed=embed) def unload(bot: Bot) -> None: """ Reinstates the original help command. This is run if the cog raises an exception on load, or if the extension is unloaded. """ bot.remove_command("help") bot.add_command(bot._old_help) def setup(bot: Bot) -> None: """ The setup for the help extension. This is called automatically on `bot.load_extension` being run. Stores the original help command instance on the `bot._old_help` attribute for later reinstatement, before removing it from the command registry so the new help command can be loaded successfully. If an exception is raised during the loading of the cog, `unload` will be called in order to reinstate the original help command. """ bot._old_help = bot.get_command("help") bot.remove_command("help") try: bot.add_cog(Help()) except Exception: unload(bot) raise def teardown(bot: Bot) -> None: """ The teardown for the help extension. This is called automatically on `bot.unload_extension` being run. Calls `unload` in order to reinstate the original help command. """ unload(bot)

35.767318

115

0.619059

4c63689b56d0efdbfeb93cd21dfc503f89e9bf35

6,123

py

Python

ingest_results/score.py

bzinberg/MCS

495562a0d4d0b1e3679b78f0f6fb568a1b9a9ae2

[ "Apache-2.0" ]

1

2020-03-19T18:44:01.000Z

ingest_results/score.py

bzinberg/MCS

495562a0d4d0b1e3679b78f0f6fb568a1b9a9ae2

[ "Apache-2.0" ]

null

ingest_results/score.py

bzinberg/MCS

495562a0d4d0b1e3679b78f0f6fb568a1b9a9ae2

[ "Apache-2.0" ]

null

#!/usr/bin/env python # # author: Mathieu Bernard <mathieu.a.bernard@inria.fr> """Evaluation script for the Intuitive Physics Challenge Execute the script as follow:: ./score.py input_dir output_dir The `input_dir` MUST HAVE the two subdirectories `res` and `ref` and the files `res/answer.txt` and `ref/answer.txt`. The `output_dir` MUST BE an existing directory. The file `output_dir/scores.txt` will be created (or overwritted if existing;) """ import argparse import collections import os import numpy as np from sklearn.metrics import roc_auc_score def _score_relative(submitted, reference): """Computes the relative error rate Equation 1 of https://arxiv.org/pdf/1803.07616.pdf """ N = len(submitted) score = 0 for scene in reference.keys(): sub, ref = submitted[scene], reference[scene] pos, imp = 0, 0 for k in ('1', '2', '3', '4'): if ref[k] == 1: # possible movie pos += sub[k] else: # impossible movie imp += sub[k] if pos < imp: # increment the relative error score score += 1 # cast to float in case we are running python2 return float(score) / float(N) def _score_absolute(submitted, reference): """Computes the absolute error rate Equation 2 of https://arxiv.org/pdf/1803.07616.pdf """ y_true = np.asarray([ y for k, v in sorted(reference.items()) for _, y in sorted(v.items())], dtype=np.float32) y_score = np.asarray([ y for k, v in sorted(submitted.items()) for _, y in sorted(v.items())], dtype=np.float32) return 1.0 - roc_auc_score(y_true, y_score) def score_per_block(submitted, reference): sub_occluded = {k: v for k, v in submitted.items() if 'occluded' in k} sub_visible = {k: v for k, v in submitted.items() if 'visible' in k} ref_occluded = {k: v for k, v in reference.items() if 'occluded' in k} ref_visible = {k: v for k, v in reference.items() if 'visible' in k} return { 'visible': { 'relative': _score_relative(sub_visible, ref_visible), 'absolute': _score_absolute(sub_visible, ref_visible), }, 'occluded': { 'relative': _score_relative(sub_occluded, ref_occluded), 'absolute': _score_absolute(sub_occluded, ref_occluded), }, 'all': { 'relative': _score_relative(submitted, reference), 'absolute': _score_absolute(submitted, reference), }} def score(submitted, reference): """Computes the evaluation scores The scores are computed for all scenes, visible scenes and occluded scenes. For each category the absolute and relative error rate are evaluated and returned as a dictionary. """ assert sorted(submitted.keys()) == sorted(reference.keys()) return {block: score_per_block( {k: v for k, v in submitted.items() if block in k}, {k: v for k, v in reference.items() if block in k}) for block in ('O1', 'O2', 'O3')} def load_answer(path): """Returns the content of `path`/answer.txt as a dict Returns ------- answer : dict The output dict is structured as follow:: {scene: {1: p_1, 2: p_2, 3: p_3, 4: p_4}} where p_i is the plausibility score for the associated movie. Raises ------ ValueError If `path`/answer.txt does not exist AssertionError If the answers file is badly formatted """ if not os.path.isdir(path): raise ValueError('{} does not exist'.format(path)) answer_file = os.path.join(path, 'answer.txt') if not os.path.isfile(answer_file): raise ValueError('{} does not exist'.format(answer_file)) answer = collections.defaultdict(dict) for line in open(answer_file, 'r'): split_line = line.split() assert len(split_line) == 2 plausibility = float(split_line[1]) assert 0 <= plausibility <= 1 header = split_line[0].split('/') scene_id = '/'.join(header[:-1]) movie_id = header[-1] assert movie_id in ('1', '2', '3', '4') answer[scene_id][movie_id] = plausibility for v in answer.values(): assert sorted(v.keys()) == ['1', '2', '3', '4'] return answer def build_html(submitted): header = '<!DOCTYPE html>\n<html>\n<body>\n\n<p>\n' footer = '</p></body></html>\n' html = '' for k, v in sorted(submitted.items()): for w, x in sorted(v.items()): html += '{}_{}: {}<br>\n'.format(k, w, x) return header + html + footer def parse_arguments(): """Parses command-line arguments""" parser = argparse.ArgumentParser( description='scoring program for the IntPhys challenge') parser.add_argument( 'input_dir', help='directory containing reference and submission data') parser.add_argument( 'output_dir', help='where the scores.txt file is written by the scoring program') return parser.parse_args() def main(): """Entry point of the IntPhys evaluation program""" args = parse_arguments() # load the submitted and reference data input_dir = args.input_dir submitted = load_answer(os.path.join(input_dir, 'res')) reference = load_answer(os.path.join(input_dir, 'ref')) output_dir = args.output_dir if not os.path.isdir(output_dir): raise ValueError('{} does not exist'.format(output_dir)) # build the html page with detailed results html_file = os.path.join(output_dir, 'scores.html') with open(html_file, 'w') as fout: fout.write(build_html(submitted)) # compute the scores scores = score(submitted, reference) # write the final scores.txt file scores_file = os.path.join(output_dir, 'scores.txt') with open(scores_file, 'w') as fout: for k, v in sorted(scores.items()): for w, x in v.items(): for y, z in x.items(): fout.write('{}_{}_{}: {}\n'.format(k, w, y, z)) if __name__ == '__main__': main()

28.882075

75

0.617671

772aa2ebea13466404604afafa4bb20aaf5b53b1

55,202

py

Python

run_project_tests.py

jonaslb/meson

8133a7b9a4b8f0686fbc479aa2d64e41c85a979b

[ "Apache-2.0" ]

null

run_project_tests.py

jonaslb/meson

8133a7b9a4b8f0686fbc479aa2d64e41c85a979b

[ "Apache-2.0" ]

null

run_project_tests.py

jonaslb/meson

8133a7b9a4b8f0686fbc479aa2d64e41c85a979b

[ "Apache-2.0" ]

null

#!/usr/bin/env python3 # Copyright 2012-2019 The Meson development team # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # http://www.apache.org/licenses/LICENSE-2.0 # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from concurrent.futures import ProcessPoolExecutor, CancelledError from enum import Enum from io import StringIO from pathlib import Path, PurePath import argparse import functools import itertools import json import multiprocessing import os import re import shlex import shutil import signal import subprocess import sys import tempfile import time import typing as T import xml.etree.ElementTree as ET from mesonbuild import build from mesonbuild import environment from mesonbuild import compilers from mesonbuild import mesonlib from mesonbuild import mlog from mesonbuild import mtest from mesonbuild.build import ConfigurationData from mesonbuild.mesonlib import MachineChoice, Popen_safe, TemporaryDirectoryWinProof from mesonbuild.coredata import backendlist, version as meson_version from run_tests import get_fake_options, run_configure, get_meson_script from run_tests import get_backend_commands, get_backend_args_for_dir, Backend from run_tests import ensure_backend_detects_changes from run_tests import guess_backend ALL_TESTS = ['cmake', 'common', 'native', 'warning-meson', 'failing-meson', 'failing-build', 'failing-test', 'keyval', 'platform-osx', 'platform-windows', 'platform-linux', 'java', 'C#', 'vala', 'rust', 'd', 'objective c', 'objective c++', 'fortran', 'swift', 'cuda', 'python3', 'python', 'fpga', 'frameworks', 'nasm', 'wasm' ] class BuildStep(Enum): configure = 1 build = 2 test = 3 install = 4 clean = 5 validate = 6 class TestResult(BaseException): def __init__(self, cicmds): self.msg = '' # empty msg indicates test success self.stdo = '' self.stde = '' self.mlog = '' self.cicmds = cicmds self.conftime = 0 self.buildtime = 0 self.testtime = 0 def add_step(self, step, stdo, stde, mlog='', time=0): self.step = step self.stdo += stdo self.stde += stde self.mlog += mlog if step == BuildStep.configure: self.conftime = time elif step == BuildStep.build: self.buildtime = time elif step == BuildStep.test: self.testtime = time def fail(self, msg): self.msg = msg class InstalledFile: def __init__(self, raw: T.Dict[str, str]): self.path = raw['file'] self.typ = raw['type'] self.platform = raw.get('platform', None) self.language = raw.get('language', 'c') # type: str version = raw.get('version', '') # type: str if version: self.version = version.split('.') # type: T.List[str] else: # split on '' will return [''], we want an empty list though self.version = [] def get_path(self, compiler: str, env: environment.Environment) -> T.Optional[Path]: p = Path(self.path) canonical_compiler = compiler if ((compiler in ['clang-cl', 'intel-cl']) or (env.machines.host.is_windows() and compiler in {'pgi', 'dmd', 'ldc'})): canonical_compiler = 'msvc' has_pdb = False if self.language in {'c', 'cpp'}: has_pdb = canonical_compiler == 'msvc' elif self.language == 'd': # dmd's optlink does not genearte pdb iles has_pdb = env.coredata.compilers.host['d'].linker.id in {'link', 'lld-link'} # Abort if the platform does not match matches = { 'msvc': canonical_compiler == 'msvc', 'gcc': canonical_compiler != 'msvc', 'cygwin': env.machines.host.is_cygwin(), '!cygwin': not env.machines.host.is_cygwin(), }.get(self.platform or '', True) if not matches: return None # Handle the different types if self.typ in ['file', 'dir']: return p elif self.typ == 'shared_lib': if env.machines.host.is_windows() or env.machines.host.is_cygwin(): # Windows only has foo.dll and foo-X.dll if len(self.version) > 1: return None if self.version: p = p.with_name('{}-{}'.format(p.name, self.version[0])) return p.with_suffix('.dll') p = p.with_name('lib{}'.format(p.name)) if env.machines.host.is_darwin(): # MacOS only has libfoo.dylib and libfoo.X.dylib if len(self.version) > 1: return None # pathlib.Path.with_suffix replaces, not appends suffix = '.dylib' if self.version: suffix = '.{}{}'.format(self.version[0], suffix) else: # pathlib.Path.with_suffix replaces, not appends suffix = '.so' if self.version: suffix = '{}.{}'.format(suffix, '.'.join(self.version)) return p.with_suffix(suffix) elif self.typ == 'exe': if env.machines.host.is_windows() or env.machines.host.is_cygwin(): return p.with_suffix('.exe') elif self.typ == 'pdb': if self.version: p = p.with_name('{}-{}'.format(p.name, self.version[0])) return p.with_suffix('.pdb') if has_pdb else None elif self.typ == 'implib' or self.typ == 'implibempty': if env.machines.host.is_windows() and canonical_compiler == 'msvc': # only MSVC doesn't generate empty implibs if self.typ == 'implibempty' and compiler == 'msvc': return None return p.parent / (re.sub(r'^lib', '', p.name) + '.lib') elif env.machines.host.is_windows() or env.machines.host.is_cygwin(): return p.with_suffix('.dll.a') else: return None elif self.typ == 'expr': return Path(platform_fix_name(p.as_posix(), canonical_compiler, env)) else: raise RuntimeError('Invalid installed file type {}'.format(self.typ)) return p def get_paths(self, compiler: str, env: environment.Environment, installdir: Path) -> T.List[Path]: p = self.get_path(compiler, env) if not p: return [] if self.typ == 'dir': abs_p = installdir / p if not abs_p.exists(): raise RuntimeError('{} does not exist'.format(p)) if not abs_p.is_dir(): raise RuntimeError('{} is not a directory'.format(p)) return [x.relative_to(installdir) for x in abs_p.rglob('*') if x.is_file() or x.is_symlink()] else: return [p] @functools.total_ordering class TestDef: def __init__(self, path: Path, name: T.Optional[str], args: T.List[str], skip: bool = False): self.path = path self.name = name self.args = args self.skip = skip self.env = os.environ.copy() self.installed_files = [] # type: T.List[InstalledFile] self.do_not_set_opts = [] # type: T.List[str] self.stdout = [] # type: T.List[T.Dict[str, str]] def __repr__(self) -> str: return '<{}: {:<48} [{}: {}] -- {}>'.format(type(self).__name__, str(self.path), self.name, self.args, self.skip) def display_name(self) -> str: if self.name: return '{} ({})'.format(self.path.as_posix(), self.name) return self.path.as_posix() def __lt__(self, other: object) -> bool: if isinstance(other, TestDef): # None is not sortable, so replace it with an empty string s_id = int(self.path.name.split(' ')[0]) o_id = int(other.path.name.split(' ')[0]) return (s_id, self.path, self.name or '') < (o_id, other.path, other.name or '') return NotImplemented failing_logs = [] print_debug = 'MESON_PRINT_TEST_OUTPUT' in os.environ under_ci = 'CI' in os.environ skip_scientific = under_ci and ('SKIP_SCIENTIFIC' in os.environ) do_debug = under_ci or print_debug no_meson_log_msg = 'No meson-log.txt found.' host_c_compiler = None compiler_id_map = {} # type: T.Dict[str, str] tool_vers_map = {} # type: T.Dict[str, str] class StopException(Exception): def __init__(self): super().__init__('Stopped by user') stop = False def stop_handler(signal, frame): global stop stop = True signal.signal(signal.SIGINT, stop_handler) signal.signal(signal.SIGTERM, stop_handler) def setup_commands(optbackend): global do_debug, backend, backend_flags global compile_commands, clean_commands, test_commands, install_commands, uninstall_commands backend, backend_flags = guess_backend(optbackend, shutil.which('msbuild')) compile_commands, clean_commands, test_commands, install_commands, \ uninstall_commands = get_backend_commands(backend, do_debug) # TODO try to eliminate or at least reduce this function def platform_fix_name(fname: str, canonical_compiler: str, env: environment.Environment) -> str: if '?lib' in fname: if env.machines.host.is_windows() and canonical_compiler == 'msvc': fname = re.sub(r'lib/\?lib(.*)\.', r'bin/\1.', fname) fname = re.sub(r'/\?lib/', r'/bin/', fname) elif env.machines.host.is_windows(): fname = re.sub(r'lib/\?lib(.*)\.', r'bin/lib\1.', fname) fname = re.sub(r'\?lib(.*)\.dll$', r'lib\1.dll', fname) fname = re.sub(r'/\?lib/', r'/bin/', fname) elif env.machines.host.is_cygwin(): fname = re.sub(r'lib/\?lib(.*)\.so$', r'bin/cyg\1.dll', fname) fname = re.sub(r'lib/\?lib(.*)\.', r'bin/cyg\1.', fname) fname = re.sub(r'\?lib(.*)\.dll$', r'cyg\1.dll', fname) fname = re.sub(r'/\?lib/', r'/bin/', fname) else: fname = re.sub(r'\?lib', 'lib', fname) if fname.endswith('?so'): if env.machines.host.is_windows() and canonical_compiler == 'msvc': fname = re.sub(r'lib/([^/]*)\?so$', r'bin/\1.dll', fname) fname = re.sub(r'/(?:lib|)([^/]*?)\?so$', r'/\1.dll', fname) return fname elif env.machines.host.is_windows(): fname = re.sub(r'lib/([^/]*)\?so$', r'bin/\1.dll', fname) fname = re.sub(r'/([^/]*?)\?so$', r'/\1.dll', fname) return fname elif env.machines.host.is_cygwin(): fname = re.sub(r'lib/([^/]*)\?so$', r'bin/\1.dll', fname) fname = re.sub(r'/lib([^/]*?)\?so$', r'/cyg\1.dll', fname) fname = re.sub(r'/([^/]*?)\?so$', r'/\1.dll', fname) return fname elif env.machines.host.is_darwin(): return fname[:-3] + '.dylib' else: return fname[:-3] + '.so' return fname def validate_install(test: TestDef, installdir: Path, compiler: str, env: environment.Environment) -> str: ret_msg = '' expected_raw = [] # type: T.List[Path] for i in test.installed_files: try: expected_raw += i.get_paths(compiler, env, installdir) except RuntimeError as err: ret_msg += 'Expected path error: {}\n'.format(err) expected = {x: False for x in expected_raw} found = [x.relative_to(installdir) for x in installdir.rglob('*') if x.is_file() or x.is_symlink()] # Mark all found files as found and detect unexpected files for fname in found: if fname not in expected: ret_msg += 'Extra file {} found.\n'.format(fname) continue expected[fname] = True # Check if expected files were found for p, f in expected.items(): if not f: ret_msg += 'Expected file {} missing.\n'.format(p) # List dir content on error if ret_msg != '': ret_msg += '\nInstall dir contents:\n' for i in found: ret_msg += ' - {}\n'.format(i) return ret_msg def log_text_file(logfile, testdir, stdo, stde): global stop, executor, futures logfile.write('%s\nstdout\n\n---\n' % testdir.as_posix()) logfile.write(stdo) logfile.write('\n\n---\n\nstderr\n\n---\n') logfile.write(stde) logfile.write('\n\n---\n\n') if print_debug: try: print(stdo) except UnicodeError: sanitized_out = stdo.encode('ascii', errors='replace').decode() print(sanitized_out) try: print(stde, file=sys.stderr) except UnicodeError: sanitized_err = stde.encode('ascii', errors='replace').decode() print(sanitized_err, file=sys.stderr) if stop: print("Aborting..") for f in futures: f[2].cancel() executor.shutdown() raise StopException() def bold(text): return mlog.bold(text).get_text(mlog.colorize_console()) def green(text): return mlog.green(text).get_text(mlog.colorize_console()) def red(text): return mlog.red(text).get_text(mlog.colorize_console()) def yellow(text): return mlog.yellow(text).get_text(mlog.colorize_console()) def _run_ci_include(args: T.List[str]) -> str: if not args: return 'At least one parameter required' try: data = Path(args[0]).read_text(errors='ignore', encoding='utf-8') return 'Included file {}:\n{}\n'.format(args[0], data) except Exception: return 'Failed to open {}'.format(args[0]) ci_commands = { 'ci_include': _run_ci_include } def run_ci_commands(raw_log: str) -> T.List[str]: res = [] for l in raw_log.splitlines(): if not l.startswith('!meson_ci!/'): continue cmd = shlex.split(l[11:]) if not cmd or cmd[0] not in ci_commands: continue res += ['CI COMMAND {}:\n{}\n'.format(cmd[0], ci_commands[cmd[0]](cmd[1:]))] return res def _compare_output(expected: T.List[T.Dict[str, str]], output: str, desc: str) -> str: if expected: i = iter(expected) def next_expected(i): # Get the next expected line item = next(i) how = item.get('match', 'literal') expected = item.get('line') # Simple heuristic to automatically convert path separators for # Windows: # # Any '/' appearing before 'WARNING' or 'ERROR' (i.e. a path in a # filename part of a location) is replaced with '\' (in a re: '\\' # which matches a literal '\') # # (There should probably be a way to turn this off for more complex # cases which don't fit this) if mesonlib.is_windows(): if how != "re": sub = r'\\' else: sub = r'\\\\' expected = re.sub(r'/(?=.*(WARNING|ERROR))', sub, expected) return how, expected try: how, expected = next_expected(i) for actual in output.splitlines(): if how == "re": match = bool(re.match(expected, actual)) else: match = (expected == actual) if match: how, expected = next_expected(i) # reached the end of output without finding expected return 'expected "{}" not found in {}'.format(expected, desc) except StopIteration: # matched all expected lines pass return '' def validate_output(test: TestDef, stdo: str, stde: str) -> str: return _compare_output(test.stdout, stdo, 'stdout') # There are some class variables and such that cahce # information. Clear all of these. The better solution # would be to change the code so that no state is persisted # but that would be a lot of work given that Meson was originally # coded to run as a batch process. def clear_internal_caches(): import mesonbuild.interpreterbase from mesonbuild.dependencies import CMakeDependency from mesonbuild.mesonlib import PerMachine mesonbuild.interpreterbase.FeatureNew.feature_registry = {} CMakeDependency.class_cmakeinfo = PerMachine(None, None) def run_test_inprocess(testdir): old_stdout = sys.stdout sys.stdout = mystdout = StringIO() old_stderr = sys.stderr sys.stderr = mystderr = StringIO() old_cwd = os.getcwd() os.chdir(testdir) test_log_fname = Path('meson-logs', 'testlog.txt') try: returncode_test = mtest.run_with_args(['--no-rebuild']) if test_log_fname.exists(): test_log = test_log_fname.open(errors='ignore').read() else: test_log = '' returncode_benchmark = mtest.run_with_args(['--no-rebuild', '--benchmark', '--logbase', 'benchmarklog']) finally: sys.stdout = old_stdout sys.stderr = old_stderr os.chdir(old_cwd) return max(returncode_test, returncode_benchmark), mystdout.getvalue(), mystderr.getvalue(), test_log # Build directory name must be the same so Ccache works over # consecutive invocations. def create_deterministic_builddir(test: TestDef, use_tmpdir: bool) -> str: import hashlib src_dir = test.path.as_posix() if test.name: src_dir += test.name rel_dirname = 'b ' + hashlib.sha256(src_dir.encode(errors='ignore')).hexdigest()[0:10] abs_pathname = os.path.join(tempfile.gettempdir() if use_tmpdir else os.getcwd(), rel_dirname) os.mkdir(abs_pathname) return abs_pathname def format_parameter_file(file_basename: str, test: TestDef, test_build_dir: str) -> Path: confdata = ConfigurationData() confdata.values = {'MESON_TEST_ROOT': (str(test.path.absolute()), 'base directory of current test')} template = test.path / (file_basename + '.in') destination = Path(test_build_dir) / file_basename mesonlib.do_conf_file(str(template), str(destination), confdata, 'meson') return destination def detect_parameter_files(test: TestDef, test_build_dir: str) -> (Path, Path): nativefile = test.path / 'nativefile.ini' crossfile = test.path / 'crossfile.ini' if os.path.exists(str(test.path / 'nativefile.ini.in')): nativefile = format_parameter_file('nativefile.ini', test, test_build_dir) if os.path.exists(str(test.path / 'crossfile.ini.in')): crossfile = format_parameter_file('crossfile.ini', test, test_build_dir) return nativefile, crossfile def run_test(test: TestDef, extra_args, compiler, backend, flags, commands, should_fail, use_tmp: bool): if test.skip: return None build_dir = create_deterministic_builddir(test, use_tmp) try: with TemporaryDirectoryWinProof(prefix='i ', dir=None if use_tmp else os.getcwd()) as install_dir: try: return _run_test(test, build_dir, install_dir, extra_args, compiler, backend, flags, commands, should_fail) except TestResult as r: return r finally: mlog.shutdown() # Close the log file because otherwise Windows wets itself. finally: mesonlib.windows_proof_rmtree(build_dir) def _run_test(test: TestDef, test_build_dir: str, install_dir: str, extra_args, compiler, backend, flags, commands, should_fail): compile_commands, clean_commands, install_commands, uninstall_commands = commands gen_start = time.time() # Configure in-process gen_args = [] # type: T.List[str] if 'prefix' not in test.do_not_set_opts: gen_args += ['--prefix', 'x:/usr'] if mesonlib.is_windows() else ['--prefix', '/usr'] if 'libdir' not in test.do_not_set_opts: gen_args += ['--libdir', 'lib'] gen_args += [test.path.as_posix(), test_build_dir] + flags + extra_args nativefile, crossfile = detect_parameter_files(test, test_build_dir) if nativefile.exists(): gen_args.extend(['--native-file', nativefile.as_posix()]) if crossfile.exists(): gen_args.extend(['--cross-file', crossfile.as_posix()]) (returncode, stdo, stde) = run_configure(gen_args, env=test.env) try: logfile = Path(test_build_dir, 'meson-logs', 'meson-log.txt') mesonlog = logfile.open(errors='ignore', encoding='utf-8').read() except Exception: mesonlog = no_meson_log_msg cicmds = run_ci_commands(mesonlog) testresult = TestResult(cicmds) testresult.add_step(BuildStep.configure, stdo, stde, mesonlog, time.time() - gen_start) output_msg = validate_output(test, stdo, stde) testresult.mlog += output_msg if output_msg: testresult.fail('Unexpected output while configuring.') return testresult if should_fail == 'meson': if returncode == 1: return testresult elif returncode != 0: testresult.fail('Test exited with unexpected status {}.'.format(returncode)) return testresult else: testresult.fail('Test that should have failed succeeded.') return testresult if returncode != 0: testresult.fail('Generating the build system failed.') return testresult builddata = build.load(test_build_dir) dir_args = get_backend_args_for_dir(backend, test_build_dir) # Build with subprocess def build_step(): build_start = time.time() pc, o, e = Popen_safe(compile_commands + dir_args, cwd=test_build_dir) testresult.add_step(BuildStep.build, o, e, '', time.time() - build_start) if should_fail == 'build': if pc.returncode != 0: raise testresult testresult.fail('Test that should have failed to build succeeded.') raise testresult if pc.returncode != 0: testresult.fail('Compiling source code failed.') raise testresult # Touch the meson.build file to force a regenerate def force_regenerate(): ensure_backend_detects_changes(backend) os.utime(str(test.path / 'meson.build')) # just test building build_step() # test that regeneration works for build step force_regenerate() build_step() # TBD: assert nothing gets built after the regenerate? # test that regeneration works for test step force_regenerate() # Test in-process clear_internal_caches() test_start = time.time() (returncode, tstdo, tstde, test_log) = run_test_inprocess(test_build_dir) testresult.add_step(BuildStep.test, tstdo, tstde, test_log, time.time() - test_start) if should_fail == 'test': if returncode != 0: return testresult testresult.fail('Test that should have failed to run unit tests succeeded.') return testresult if returncode != 0: testresult.fail('Running unit tests failed.') return testresult # Do installation, if the backend supports it if install_commands: env = test.env.copy() env['DESTDIR'] = install_dir # Install with subprocess pi, o, e = Popen_safe(install_commands, cwd=test_build_dir, env=env) testresult.add_step(BuildStep.install, o, e) if pi.returncode != 0: testresult.fail('Running install failed.') return testresult # Clean with subprocess env = test.env.copy() pi, o, e = Popen_safe(clean_commands + dir_args, cwd=test_build_dir, env=env) testresult.add_step(BuildStep.clean, o, e) if pi.returncode != 0: testresult.fail('Running clean failed.') return testresult # Validate installed files testresult.add_step(BuildStep.install, '', '') if not install_commands: return testresult install_msg = validate_install(test, Path(install_dir), compiler, builddata.environment) if install_msg: testresult.fail('\n' + install_msg) return testresult return testresult def gather_tests(testdir: Path, stdout_mandatory: bool) -> T.List[TestDef]: tests = [t.name for t in testdir.iterdir() if t.is_dir()] tests = [t for t in tests if not t.startswith('.')] # Filter non-tests files (dot files, etc) test_defs = [TestDef(testdir / t, None, []) for t in tests] all_tests = [] # type: T.List[TestDef] for t in test_defs: test_def = {} test_def_file = t.path / 'test.json' if test_def_file.is_file(): test_def = json.loads(test_def_file.read_text()) # Handle additional environment variables env = {} # type: T.Dict[str, str] if 'env' in test_def: assert isinstance(test_def['env'], dict) env = test_def['env'] for key, val in env.items(): val = val.replace('@ROOT@', t.path.resolve().as_posix()) val = val.replace('@PATH@', t.env.get('PATH', '')) env[key] = val # Handle installed files installed = [] # type: T.List[InstalledFile] if 'installed' in test_def: installed = [InstalledFile(x) for x in test_def['installed']] # Handle expected output stdout = test_def.get('stdout', []) if stdout_mandatory and not stdout: raise RuntimeError("{} must contain a non-empty stdout key".format(test_def_file)) # Handle the do_not_set_opts list do_not_set_opts = test_def.get('do_not_set_opts', []) # type: T.List[str] # Skip tests if the tool requirements are not met if 'tools' in test_def: assert isinstance(test_def['tools'], dict) for tool, vers_req in test_def['tools'].items(): if tool not in tool_vers_map: t.skip = True elif not mesonlib.version_compare(tool_vers_map[tool], vers_req): t.skip = True # Skip the matrix code and just update the existing test if 'matrix' not in test_def: t.env.update(env) t.installed_files = installed t.do_not_set_opts = do_not_set_opts t.stdout = stdout all_tests += [t] continue # 'matrix; entry is present, so build multiple tests from matrix definition opt_list = [] # type: T.List[T.List[T.Tuple[str, bool]]] matrix = test_def['matrix'] assert "options" in matrix for key, val in matrix["options"].items(): assert isinstance(val, list) tmp_opts = [] # type: T.List[T.Tuple[str, bool]] for i in val: assert isinstance(i, dict) assert "val" in i skip = False # Skip the matrix entry if environment variable is present if 'skip_on_env' in i: for skip_env_var in i['skip_on_env']: if skip_env_var in os.environ: skip = True # Only run the test if all compiler ID's match if 'compilers' in i: for lang, id_list in i['compilers'].items(): if lang not in compiler_id_map or compiler_id_map[lang] not in id_list: skip = True break # Add an empty matrix entry if i['val'] is None: tmp_opts += [(None, skip)] continue tmp_opts += [('{}={}'.format(key, i['val']), skip)] if opt_list: new_opt_list = [] # type: T.List[T.List[T.Tuple[str, bool]]] for i in opt_list: for j in tmp_opts: new_opt_list += [[*i, j]] opt_list = new_opt_list else: opt_list = [[x] for x in tmp_opts] # Exclude specific configurations if 'exclude' in matrix: assert isinstance(matrix['exclude'], list) new_opt_list = [] # type: T.List[T.List[T.Tuple[str, bool]]] for i in opt_list: exclude = False opt_names = [x[0] for x in i] for j in matrix['exclude']: ex_list = ['{}={}'.format(k, v) for k, v in j.items()] if all([x in opt_names for x in ex_list]): exclude = True break if not exclude: new_opt_list += [i] opt_list = new_opt_list for i in opt_list: name = ' '.join([x[0] for x in i if x[0] is not None]) opts = ['-D' + x[0] for x in i if x[0] is not None] skip = any([x[1] for x in i]) test = TestDef(t.path, name, opts, skip or t.skip) test.env.update(env) test.installed_files = installed test.do_not_set_opts = do_not_set_opts test.stdout = stdout all_tests += [test] return sorted(all_tests) def have_d_compiler(): if shutil.which("ldc2"): return True elif shutil.which("ldc"): return True elif shutil.which("gdc"): return True elif shutil.which("dmd"): # The Windows installer sometimes produces a DMD install # that exists but segfaults every time the compiler is run. # Don't know why. Don't know how to fix. Skip in this case. cp = subprocess.run(['dmd', '--version'], stdout=subprocess.PIPE, stderr=subprocess.PIPE) if cp.stdout == b'': return False return True return False def have_objc_compiler(use_tmp: bool) -> bool: with TemporaryDirectoryWinProof(prefix='b ', dir=None if use_tmp else '.') as build_dir: env = environment.Environment(None, build_dir, get_fake_options('/')) try: objc_comp = env.detect_objc_compiler(MachineChoice.HOST) except mesonlib.MesonException: return False if not objc_comp: return False env.coredata.process_new_compiler('objc', objc_comp, env) try: objc_comp.sanity_check(env.get_scratch_dir(), env) except mesonlib.MesonException: return False return True def have_objcpp_compiler(use_tmp: bool) -> bool: with TemporaryDirectoryWinProof(prefix='b ', dir=None if use_tmp else '.') as build_dir: env = environment.Environment(None, build_dir, get_fake_options('/')) try: objcpp_comp = env.detect_objcpp_compiler(MachineChoice.HOST) except mesonlib.MesonException: return False if not objcpp_comp: return False env.coredata.process_new_compiler('objcpp', objcpp_comp, env) try: objcpp_comp.sanity_check(env.get_scratch_dir(), env) except mesonlib.MesonException: return False return True def have_java(): if shutil.which('javac') and shutil.which('java'): return True return False def skippable(suite, test): # Everything is optional when not running on CI if not under_ci: return True if not suite.endswith('frameworks'): return True # this test assumptions aren't valid for Windows paths if test.endswith('38 libdir must be inside prefix'): return True # gtk-doc test may be skipped, pending upstream fixes for spaces in # filenames landing in the distro used for CI if test.endswith('10 gtk-doc'): return True # NetCDF is not in the CI Docker image if test.endswith('netcdf'): return True # MSVC doesn't link with GFortran if test.endswith('14 fortran links c'): return True # Blocks are not supported on all compilers if test.endswith('29 blocks'): return True # Scientific libraries are skippable on certain systems # See the discussion here: https://github.com/mesonbuild/meson/pull/6562 if any([x in test for x in ['17 mpi', '25 hdf5', '30 scalapack']]) and skip_scientific: return True # These create OS specific tests, and need to be skippable if any([x in test for x in ['16 sdl', '17 mpi']]): return True # We test cmake, and llvm-config. Some linux spins don't provide cmake or # don't provide either the static or shared llvm libraries (fedora and # opensuse only have the dynamic ones, for example). if test.endswith('15 llvm'): return True # This test breaks with gobject-introspection <= 1.58.1 if test.endswith('34 gir static lib'): return True # No frameworks test should be skipped on linux CI, as we expect all # prerequisites to be installed if mesonlib.is_linux(): return False # Boost test should only be skipped for windows CI build matrix entries # which don't define BOOST_ROOT if test.endswith('1 boost'): if mesonlib.is_windows(): return 'BOOST_ROOT' not in os.environ return False # Qt is provided on macOS by Homebrew if test.endswith('4 qt') and mesonlib.is_osx(): return False # Other framework tests are allowed to be skipped on other platforms return True def skip_csharp(backend) -> bool: if backend is not Backend.ninja: return True if not shutil.which('resgen'): return True if shutil.which('mcs'): return False if shutil.which('csc'): # Only support VS2017 for now. Earlier versions fail # under CI in mysterious ways. try: stdo = subprocess.check_output(['csc', '/version']) except subprocess.CalledProcessError: return True # Having incrementing version numbers would be too easy. # Microsoft reset the versioning back to 1.0 (from 4.x) # when they got the Roslyn based compiler. Thus there # is NO WAY to reliably do version number comparisons. # Only support the version that ships with VS2017. return not stdo.startswith(b'2.') return True # In Azure some setups have a broken rustc that will error out # on all compilation attempts. def has_broken_rustc() -> bool: dirname = 'brokenrusttest' if os.path.exists(dirname): mesonlib.windows_proof_rmtree(dirname) os.mkdir(dirname) open(dirname + '/sanity.rs', 'w').write('''fn main() { } ''') pc = subprocess.run(['rustc', '-o', 'sanity.exe', 'sanity.rs'], cwd=dirname, stdout = subprocess.DEVNULL, stderr = subprocess.DEVNULL) mesonlib.windows_proof_rmtree(dirname) return pc.returncode != 0 def should_skip_rust(backend: Backend) -> bool: if not shutil.which('rustc'): return True if backend is not Backend.ninja: return True if mesonlib.is_windows() and has_broken_rustc(): return True return False def detect_tests_to_run(only: T.List[str], use_tmp: bool) -> T.List[T.Tuple[str, T.List[TestDef], bool]]: """ Parameters ---------- only: list of str, optional specify names of tests to run Returns ------- gathered_tests: list of tuple of str, list of TestDef, bool tests to run """ skip_fortran = not(shutil.which('gfortran') or shutil.which('flang') or shutil.which('pgfortran') or shutil.which('ifort')) class TestCategory: def __init__(self, category: str, subdir: str, skip: bool = False, stdout_mandatory: bool = False): self.category = category # category name self.subdir = subdir # subdirectory self.skip = skip # skip condition self.stdout_mandatory = stdout_mandatory # expected stdout is mandatory for tests in this categroy all_tests = [ TestCategory('cmake', 'cmake', not shutil.which('cmake') or (os.environ.get('compiler') == 'msvc2015' and under_ci)), TestCategory('common', 'common'), TestCategory('native', 'native'), TestCategory('warning-meson', 'warning', stdout_mandatory=True), TestCategory('failing-meson', 'failing', stdout_mandatory=True), TestCategory('failing-build', 'failing build'), TestCategory('failing-test', 'failing test'), TestCategory('keyval', 'keyval'), TestCategory('platform-osx', 'osx', not mesonlib.is_osx()), TestCategory('platform-windows', 'windows', not mesonlib.is_windows() and not mesonlib.is_cygwin()), TestCategory('platform-linux', 'linuxlike', mesonlib.is_osx() or mesonlib.is_windows()), TestCategory('java', 'java', backend is not Backend.ninja or mesonlib.is_osx() or not have_java()), TestCategory('C#', 'csharp', skip_csharp(backend)), TestCategory('vala', 'vala', backend is not Backend.ninja or not shutil.which(os.environ.get('VALAC', 'valac'))), TestCategory('rust', 'rust', should_skip_rust(backend)), TestCategory('d', 'd', backend is not Backend.ninja or not have_d_compiler()), TestCategory('objective c', 'objc', backend not in (Backend.ninja, Backend.xcode) or not have_objc_compiler(options.use_tmpdir)), TestCategory('objective c++', 'objcpp', backend not in (Backend.ninja, Backend.xcode) or not have_objcpp_compiler(options.use_tmpdir)), TestCategory('fortran', 'fortran', skip_fortran or backend != Backend.ninja), TestCategory('swift', 'swift', backend not in (Backend.ninja, Backend.xcode) or not shutil.which('swiftc')), # CUDA tests on Windows: use Ninja backend: python run_project_tests.py --only cuda --backend ninja TestCategory('cuda', 'cuda', backend not in (Backend.ninja, Backend.xcode) or not shutil.which('nvcc')), TestCategory('python3', 'python3', backend is not Backend.ninja), TestCategory('python', 'python'), TestCategory('fpga', 'fpga', shutil.which('yosys') is None), TestCategory('frameworks', 'frameworks'), TestCategory('nasm', 'nasm'), TestCategory('wasm', 'wasm', shutil.which('emcc') is None or backend is not Backend.ninja), ] categories = [t.category for t in all_tests] assert categories == ALL_TESTS, 'argparse("--only", choices=ALL_TESTS) need to be updated to match all_tests categories' if only: all_tests = [t for t in all_tests if t.category in only] gathered_tests = [(t.category, gather_tests(Path('test cases', t.subdir), t.stdout_mandatory), t.skip) for t in all_tests] return gathered_tests def run_tests(all_tests: T.List[T.Tuple[str, T.List[TestDef], bool]], log_name_base: str, failfast: bool, extra_args: T.List[str], use_tmp: bool) -> T.Tuple[int, int, int]: global logfile txtname = log_name_base + '.txt' with open(txtname, 'w', encoding='utf-8', errors='ignore') as lf: logfile = lf return _run_tests(all_tests, log_name_base, failfast, extra_args, use_tmp) def _run_tests(all_tests: T.List[T.Tuple[str, T.List[TestDef], bool]], log_name_base: str, failfast: bool, extra_args: T.List[str], use_tmp: bool) -> T.Tuple[int, int, int]: global stop, executor, futures, host_c_compiler xmlname = log_name_base + '.xml' junit_root = ET.Element('testsuites') conf_time = 0 build_time = 0 test_time = 0 passing_tests = 0 failing_tests = 0 skipped_tests = 0 commands = (compile_commands, clean_commands, install_commands, uninstall_commands) try: # This fails in some CI environments for unknown reasons. num_workers = multiprocessing.cpu_count() except Exception as e: print('Could not determine number of CPUs due to the following reason:' + str(e)) print('Defaulting to using only one process') num_workers = 1 # Due to Ninja deficiency, almost 50% of build time # is spent waiting. Do something useful instead. # # Remove this once the following issue has been resolved: # https://github.com/mesonbuild/meson/pull/2082 if not mesonlib.is_windows(): # twice as fast on Windows by *not* multiplying by 2. num_workers *= 2 executor = ProcessPoolExecutor(max_workers=num_workers) for name, test_cases, skipped in all_tests: current_suite = ET.SubElement(junit_root, 'testsuite', {'name': name, 'tests': str(len(test_cases))}) print() if skipped: print(bold('Not running %s tests.' % name)) else: print(bold('Running %s tests.' % name)) print() futures = [] for t in test_cases: # Jenkins screws us over by automatically sorting test cases by name # and getting it wrong by not doing logical number sorting. (testnum, testbase) = t.path.name.split(' ', 1) testname = '%.3d %s' % (int(testnum), testbase) if t.name: testname += ' ({})'.format(t.name) should_fail = False suite_args = [] if name.startswith('failing'): should_fail = name.split('failing-')[1] if name.startswith('warning'): suite_args = ['--fatal-meson-warnings'] should_fail = name.split('warning-')[1] t.skip = skipped or t.skip result = executor.submit(run_test, t, extra_args + suite_args + t.args, host_c_compiler, backend, backend_flags, commands, should_fail, use_tmp) futures.append((testname, t, result)) for (testname, t, result) in futures: sys.stdout.flush() try: result = result.result() except CancelledError: continue if (result is None) or (('MESON_SKIP_TEST' in result.stdo) and (skippable(name, t.path.as_posix()))): print(yellow('Skipping:'), t.display_name()) current_test = ET.SubElement(current_suite, 'testcase', {'name': testname, 'classname': name}) ET.SubElement(current_test, 'skipped', {}) skipped_tests += 1 else: without_install = "" if len(install_commands) > 0 else " (without install)" if result.msg != '': print(red('Failed test{} during {}: {!r}'.format(without_install, result.step.name, t.display_name()))) print('Reason:', result.msg) failing_tests += 1 if result.step == BuildStep.configure and result.mlog != no_meson_log_msg: # For configure failures, instead of printing stdout, # print the meson log if available since it's a superset # of stdout and often has very useful information. failing_logs.append(result.mlog) elif under_ci: # Always print the complete meson log when running in # a CI. This helps debugging issues that only occur in # a hard to reproduce environment failing_logs.append(result.mlog) failing_logs.append(result.stdo) else: failing_logs.append(result.stdo) for cmd_res in result.cicmds: failing_logs.append(cmd_res) failing_logs.append(result.stde) if failfast: print("Cancelling the rest of the tests") for (_, _, res) in futures: res.cancel() else: print('Succeeded test%s: %s' % (without_install, t.display_name())) passing_tests += 1 conf_time += result.conftime build_time += result.buildtime test_time += result.testtime total_time = conf_time + build_time + test_time log_text_file(logfile, t.path, result.stdo, result.stde) current_test = ET.SubElement(current_suite, 'testcase', {'name': testname, 'classname': name, 'time': '%.3f' % total_time}) if result.msg != '': ET.SubElement(current_test, 'failure', {'message': result.msg}) stdoel = ET.SubElement(current_test, 'system-out') stdoel.text = result.stdo stdeel = ET.SubElement(current_test, 'system-err') stdeel.text = result.stde if failfast and failing_tests > 0: break print("\nTotal configuration time: %.2fs" % conf_time) print("Total build time: %.2fs" % build_time) print("Total test time: %.2fs" % test_time) ET.ElementTree(element=junit_root).write(xmlname, xml_declaration=True, encoding='UTF-8') return passing_tests, failing_tests, skipped_tests def check_file(file: Path): lines = file.read_bytes().split(b'\n') tabdetector = re.compile(br' *\t') for i, line in enumerate(lines): if re.match(tabdetector, line): raise SystemExit("File {} contains a tab indent on line {:d}. Only spaces are permitted.".format(file, i + 1)) if line.endswith(b'\r'): raise SystemExit("File {} contains DOS line ending on line {:d}. Only unix-style line endings are permitted.".format(file, i + 1)) def check_format(): check_suffixes = {'.c', '.cpp', '.cxx', '.cc', '.rs', '.f90', '.vala', '.d', '.s', '.m', '.mm', '.asm', '.java', '.txt', '.py', '.swift', '.build', '.md', } skip_dirs = { '.dub', # external deps are here '.pytest_cache', 'meson-logs', 'meson-private', 'work area', '.eggs', '_cache', # e.g. .mypy_cache 'venv', # virtualenvs have DOS line endings } for (root, _, filenames) in os.walk('.'): if any([x in root for x in skip_dirs]): continue for fname in filenames: file = Path(fname) if file.suffix.lower() in check_suffixes: if file.name in ('sitemap.txt', 'meson-test-run.txt'): continue check_file(root / file) def check_meson_commands_work(options): global backend, compile_commands, test_commands, install_commands testdir = PurePath('test cases', 'common', '1 trivial').as_posix() meson_commands = mesonlib.python_command + [get_meson_script()] with TemporaryDirectoryWinProof(prefix='b ', dir=None if options.use_tmpdir else '.') as build_dir: print('Checking that configuring works...') gen_cmd = meson_commands + [testdir, build_dir] + backend_flags + options.extra_args pc, o, e = Popen_safe(gen_cmd) if pc.returncode != 0: raise RuntimeError('Failed to configure {!r}:\n{}\n{}'.format(testdir, e, o)) print('Checking that introspect works...') pc, o, e = Popen_safe(meson_commands + ['introspect', '--targets'], cwd=build_dir) json.loads(o) if pc.returncode != 0: raise RuntimeError('Failed to introspect --targets {!r}:\n{}\n{}'.format(testdir, e, o)) print('Checking that building works...') dir_args = get_backend_args_for_dir(backend, build_dir) pc, o, e = Popen_safe(compile_commands + dir_args, cwd=build_dir) if pc.returncode != 0: raise RuntimeError('Failed to build {!r}:\n{}\n{}'.format(testdir, e, o)) print('Checking that testing works...') pc, o, e = Popen_safe(test_commands, cwd=build_dir) if pc.returncode != 0: raise RuntimeError('Failed to test {!r}:\n{}\n{}'.format(testdir, e, o)) if install_commands: print('Checking that installing works...') pc, o, e = Popen_safe(install_commands, cwd=build_dir) if pc.returncode != 0: raise RuntimeError('Failed to install {!r}:\n{}\n{}'.format(testdir, e, o)) def detect_system_compiler(options): global host_c_compiler, compiler_id_map with TemporaryDirectoryWinProof(prefix='b ', dir=None if options.use_tmpdir else '.') as build_dir: fake_opts = get_fake_options('/') if options.cross_file: fake_opts.cross_file = [options.cross_file] if options.native_file: fake_opts.native_file = [options.native_file] env = environment.Environment(None, build_dir, fake_opts) print_compilers(env, MachineChoice.HOST) if options.cross_file: print_compilers(env, MachineChoice.BUILD) for lang in sorted(compilers.all_languages): try: comp = env.compiler_from_language(lang, MachineChoice.HOST) # note compiler id for later use with test.json matrix compiler_id_map[lang] = comp.get_id() except mesonlib.MesonException: comp = None # note C compiler for later use by platform_fix_name() if lang == 'c': if comp: host_c_compiler = comp.get_id() else: raise RuntimeError("Could not find C compiler.") def print_compilers(env, machine): print() print('{} machine compilers'.format(machine.get_lower_case_name())) print() for lang in sorted(compilers.all_languages): try: comp = env.compiler_from_language(lang, machine) details = '{:<10} {} {}'.format('[' + comp.get_id() + ']', ' '.join(comp.get_exelist()), comp.get_version_string()) except mesonlib.MesonException: details = '[not found]' print('%-7s: %s' % (lang, details)) def print_tool_versions(): tools = [ { 'tool': 'ninja', 'args': ['--version'], 'regex': re.compile(r'^([0-9]+(\.[0-9]+)*(-[a-z0-9]+)?)$'), 'match_group': 1, }, { 'tool': 'cmake', 'args': ['--version'], 'regex': re.compile(r'^cmake version ([0-9]+(\.[0-9]+)*(-[a-z0-9]+)?)$'), 'match_group': 1, }, { 'tool': 'hotdoc', 'args': ['--version'], 'regex': re.compile(r'^([0-9]+(\.[0-9]+)*(-[a-z0-9]+)?)$'), 'match_group': 1, }, ] def get_version(t: dict) -> str: exe = shutil.which(t['tool']) if not exe: return 'not found' args = [t['tool']] + t['args'] pc, o, e = Popen_safe(args) if pc.returncode != 0: return '{} (invalid {} executable)'.format(exe, t['tool']) for i in o.split('\n'): i = i.strip('\n\r\t ') m = t['regex'].match(i) if m is not None: tool_vers_map[t['tool']] = m.group(t['match_group']) return '{} ({})'.format(exe, m.group(t['match_group'])) return '{} (unknown)'.format(exe) print() print('tools') print() max_width = max([len(x['tool']) for x in tools] + [7]) for tool in tools: print('{0:<{2}}: {1}'.format(tool['tool'], get_version(tool), max_width)) print() if __name__ == '__main__': parser = argparse.ArgumentParser(description="Run the test suite of Meson.") parser.add_argument('extra_args', nargs='*', help='arguments that are passed directly to Meson (remember to have -- before these).') parser.add_argument('--backend', dest='backend', choices=backendlist) parser.add_argument('--failfast', action='store_true', help='Stop running if test case fails') parser.add_argument('--no-unittests', action='store_true', help='Not used, only here to simplify run_tests.py') parser.add_argument('--only', help='name of test(s) to run', nargs='+', choices=ALL_TESTS) parser.add_argument('--cross-file', action='store', help='File describing cross compilation environment.') parser.add_argument('--native-file', action='store', help='File describing native compilation environment.') parser.add_argument('--use-tmpdir', action='store_true', help='Use tmp directory for temporary files.') options = parser.parse_args() if options.cross_file: options.extra_args += ['--cross-file', options.cross_file] if options.native_file: options.extra_args += ['--native-file', options.native_file] print('Meson build system', meson_version, 'Project Tests') print('Using python', sys.version.split('\n')[0]) setup_commands(options.backend) detect_system_compiler(options) print_tool_versions() script_dir = os.path.split(__file__)[0] if script_dir != '': os.chdir(script_dir) check_format() check_meson_commands_work(options) try: all_tests = detect_tests_to_run(options.only, options.use_tmpdir) (passing_tests, failing_tests, skipped_tests) = run_tests(all_tests, 'meson-test-run', options.failfast, options.extra_args, options.use_tmpdir) except StopException: pass print('\nTotal passed tests:', green(str(passing_tests))) print('Total failed tests:', red(str(failing_tests))) print('Total skipped tests:', yellow(str(skipped_tests))) if failing_tests > 0: print('\nMesonlogs of failing tests\n') for l in failing_logs: try: print(l, '\n') except UnicodeError: print(l.encode('ascii', errors='replace').decode(), '\n') for name, dirs, _ in all_tests: dir_names = list(set(x.path.name for x in dirs)) for k, g in itertools.groupby(dir_names, key=lambda x: x.split()[0]): tests = list(g) if len(tests) != 1: print('WARNING: The %s suite contains duplicate "%s" tests: "%s"' % (name, k, '", "'.join(tests))) raise SystemExit(failing_tests)

40.739483

152

0.591319

e8395b49c160bb3bcad92a8958f271f30d647dd7

5,364

py

Python

src/datadog_api_client/v1/model/change_widget_definition_type.py

DataDog/datadog-api-client-python

de2fc57dbde9acf4b8c8eef94ac29911227a62a2

[ "Apache-2.0" ]

32

2021-01-07T15:09:56.000Z

2022-01-30T05:49:23.000Z

src/datadog_api_client/v1/model/change_widget_definition_type.py

DataDog/datadog-api-client-python

de2fc57dbde9acf4b8c8eef94ac29911227a62a2

[ "Apache-2.0" ]

228

2020-09-03T14:03:54.000Z

2022-03-31T20:16:12.000Z

src/datadog_api_client/v1/model/change_widget_definition_type.py

DataDog/datadog-api-client-python

de2fc57dbde9acf4b8c8eef94ac29911227a62a2

[ "Apache-2.0" ]

12

2020-09-15T21:36:03.000Z

2022-03-31T17:13:17.000Z

# Unless explicitly stated otherwise all files in this repository are licensed under the Apache-2.0 License. # This product includes software developed at Datadog (https://www.datadoghq.com/). # Copyright 2019-Present Datadog, Inc. from datadog_api_client.v1.model_utils import ( # noqa: F401 ApiTypeError, ModelComposed, ModelNormal, ModelSimple, cached_property, change_keys_js_to_python, convert_js_args_to_python_args, date, datetime, file_type, none_type, ) class ChangeWidgetDefinitionType(ModelSimple): """NOTE: This class is auto generated by OpenAPI Generator. Ref: https://openapi-generator.tech Do not edit the class manually. Attributes: allowed_values (dict): The key is the tuple path to the attribute and the for var_name this is (var_name,). The value is a dict with a capitalized key describing the allowed value and an allowed value. These dicts store the allowed enum values. validations (dict): The key is the tuple path to the attribute and the for var_name this is (var_name,). The value is a dict that stores validations for max_length, min_length, max_items, min_items, exclusive_maximum, inclusive_maximum, exclusive_minimum, inclusive_minimum, and regex. additional_properties_type (tuple): A tuple of classes accepted as additional properties values. """ allowed_values = { ("value",): { "CHANGE": "change", }, } validations = {} additional_properties_type = None _nullable = False @cached_property def openapi_types(): """ This must be a method because a model may have properties that are of type self, this must run after the class is loaded Returns openapi_types (dict): The key is attribute name and the value is attribute type. """ return { "value": (str,), } discriminator = None attribute_map = {} _composed_schemas = None @convert_js_args_to_python_args def __init__(self, *args, **kwargs): """ChangeWidgetDefinitionType - a model defined in OpenAPI Note that value can be passed either in args or in kwargs, but not in both. Args: args[0] (str): Type of the change widget.. if omitted defaults to "change", must be one of ["change", ] # noqa: E501 Keyword Args: value (str): Type of the change widget.. if omitted defaults to "change", must be one of ["change", ] # noqa: E501 _check_type (bool): if True, values for parameters in openapi_types will be type checked and a TypeError will be raised if the wrong type is input. Defaults to True _path_to_item (tuple/list): This is a list of keys or values to drill down to the model in received_data when deserializing a response _spec_property_naming (bool): True if the variable names in the input data are serialized names, as specified in the OpenAPI document. False if the variable names in the input data are pythonic names, e.g. snake case (default) _configuration (Configuration): the instance to use when deserializing a file_type parameter. If passed, type conversion is attempted If omitted no type conversion is done. _visited_composed_classes (tuple): This stores a tuple of classes that we have traveled through so that if we see that class again we will not use its discriminator again. When traveling through a discriminator, the composed schema that is is traveled through is added to this set. For example if Animal has a discriminator petType and we pass in "Dog", and the class Dog allOf includes Animal, we move through Animal once using the discriminator, and pick Dog. Then in Dog, we will make an instance of the Animal class but this time we won't travel through its discriminator because we passed in _visited_composed_classes = (Animal,) """ super().__init__(kwargs) if "value" in kwargs: value = kwargs.pop("value") elif args: args = list(args) value = args.pop(0) else: value = "change" self._check_pos_args(args) self.value = value self._check_kw_args(kwargs) @classmethod @convert_js_args_to_python_args def _from_openapi_data(cls, *args, **kwargs): """Helper creating a new instance from a response.""" return cls(*args, **kwargs)

39.441176

129

0.576808

afcd06ebed3b824ea437b6dfcdf7823232577d08

5,266

py

Python

tests/test_dsl_dsbs.py

lelis-research/PyGames-synthesis

0c597243c04ce511d8ae5cfd52b1c043267b4503

[ "MIT" ]

1

2021-06-03T15:54:16.000Z

tests/test_dsl_dsbs.py

olivier-vadiaval/catcher-synthesis

0c597243c04ce511d8ae5cfd52b1c043267b4503

[ "MIT" ]

3

2021-07-26T19:58:31.000Z

2021-07-27T17:35:51.000Z

tests/test_dsl_dsbs.py

olivier-vadiaval/catcher-synthesis

0c597243c04ce511d8ae5cfd52b1c043267b4503

[ "MIT" ]

null

import unittest from src.dsl import LessThan, GreaterThan, EqualTo from unittest.mock import Mock def mockOperand(value): op = Mock() op.get_size.return_value = 1 op.interpret.return_value = value return op class TestLessThan(unittest.TestCase): def test_size_three(self): lt = LessThan.new(mockOperand(5), mockOperand(3)) self.assertEqual(lt.get_size(), 3, 'LessThan object should have size 3') def test_size_change_lessThan_size(self): # Manually change lt.size to 100 lt = LessThan.new(mockOperand(5), mockOperand(5)) lt.size = 100 self.assertEqual(lt.get_size(), 100, 'LessThan object should have size 100') def test_size_change_args_size(self): # Manually change the Operand sizes left = mockOperand(5) right = mockOperand(14) lt = LessThan.new(left, right) left.get_size.return_value = 10 right.get_size.return_value = 10 self.assertEqual(lt.get_size(), 3, 'LessThan object should have size 3') def test_interpret_true(self): lt = LessThan.new(mockOperand(3), mockOperand(10)) self.assertEqual(type(lt.interpret({})).__name__, 'bool', 'interpret method of LessThan object should return a \'bool\'') self.assertEqual(lt.interpret({}), True, 'interpret method of LessThan object should return True') def test_interpret_false(self): lt = LessThan.new(mockOperand(88), mockOperand(10)) self.assertEqual(type(lt.interpret({})).__name__, 'bool', 'interpret method of LessThan object should return a \'bool\'') self.assertEqual(lt.interpret({}), False, 'interpret method of LessThan object should return False') lt = LessThan.new(mockOperand(77), mockOperand(77)) self.assertEqual(lt.interpret({}), False, 'interpret method of LessThan object should return False') class TestGreaterThan(unittest.TestCase): def test_size_three(self): gt = GreaterThan.new(mockOperand(5), mockOperand(3)) self.assertEqual(gt.get_size(), 3, 'GreaterThan object should have size 3') def test_size_change_lessThan_size(self): # Manually change gt.size to 100 gt = GreaterThan.new(mockOperand(5), mockOperand(5)) gt.size = 100 self.assertEqual(gt.get_size(), 100, 'GreaterThan object should have size 100') def test_size_change_args_size(self): # Manually change the Operand sizes left = mockOperand(5) right = mockOperand(14) gt = GreaterThan.new(left, right) left.get_size.return_value = 10 right.get_size.return_value = 14 self.assertEqual(gt.get_size(), 3, 'GreaterThan object should have size 3') def test_interpret_true(self): gt = GreaterThan.new(mockOperand(10), mockOperand(3)) self.assertEqual(type(gt.interpret({})).__name__, 'bool', 'interpret method of GreaterThan object should return a \'bool\'') self.assertEqual(gt.interpret({}), True, 'interpret method of GreaterThan object should return True') def test_interpret_false(self): gt = GreaterThan.new(mockOperand(10), mockOperand(88)) self.assertEqual(type(gt.interpret({})).__name__, 'bool', 'interpret method of GreaterThan object should return a \'bool\'') self.assertEqual(gt.interpret({}), False, 'interpret method of GreaterThan object should return False') gt = GreaterThan.new(mockOperand(77), mockOperand(77)) self.assertEqual(gt.interpret({}), False, 'interpret method of GreaterThan object should return False') class TestEqualTo(unittest.TestCase): def test_size_three(self): eq = EqualTo.new(mockOperand(5), mockOperand(3)) self.assertEqual(eq.get_size(), 3, 'EqualTo object should have size 3') def test_size_change_lessThan_size(self): # Manually change eq.size to 100 eq = EqualTo.new(mockOperand(5), mockOperand(5)) eq.size = 100 self.assertEqual(eq.get_size(), 100, 'EqualTo object should have size 100') def test_size_change_args_size(self): # Manually change the mockOperand sizes left = mockOperand(5) right = mockOperand(14) eq = EqualTo.new(left, right) left.get_size.return_value = 50 right.get_size.return_value = 10 self.assertEqual(eq.get_size(), 3, 'EqualTo object should have size 3') def test_interpret_true(self): eq = EqualTo.new(mockOperand(60), mockOperand(60)) self.assertEqual(type(eq.interpret({})).__name__, 'bool', 'interpret method of EqualTo object should return a \'bool\'') self.assertEqual(eq.interpret({}), True, 'interpret method of EqualTo object should return True') def test_interpret_false(self): eq = EqualTo.new(mockOperand(88), mockOperand(10)) self.assertEqual(type(eq.interpret({})).__name__, 'bool', 'interpret method of EqualTo object should return a \'bool\'') self.assertEqual(eq.interpret({}), False, 'interpret method of EqualTo object should return False') eq = EqualTo.new(mockOperand(45), mockOperand(92)) self.assertEqual(eq.interpret({}), False, 'interpret method of EqualTo object should return False') if __name__ == '__main__': unittest.main()

44.627119

132

0.684201

bdb4b1b105c7eded0df4982fc2f73e6d7eb38fed

2,627

py

Python

app.py

ma76/searchApp-v2

965348b64f870b891ac114a5bb62798107f02bcc

[ "MIT" ]

null

app.py

ma76/searchApp-v2

965348b64f870b891ac114a5bb62798107f02bcc

[ "MIT" ]

2

2021-04-05T14:30:13.000Z

2021-04-05T14:35:37.000Z

app.py

ma76/searche

965348b64f870b891ac114a5bb62798107f02bcc

[ "MIT" ]

null

# import sys import os # import glob import shutil import pandas as pd # from openpyxl.workbook import Workbook import easygui # CONST OUTPUT_DIR = os.getcwd() FORMAT_DIRECTORIES_MAP = { 'text': 'notes', 'video': 'videos', 'music': 'music', 'image': 'pictures', 'zip': 'compressed', 'doc': 'documents', 'unknown': 'other' } FORMATS_EXT_MAP = { 'zip': ['rar', 'zip'], 'text': ['txt', 'md', 'csv'], 'video': ['mp4', 'mkv', 'avi'], 'music': ['mp3'], 'image': ['jpg', 'jpeg', 'png', 'gif'], 'doc': ['pdf', 'djvu', 'docx', 'xlsx'] } # helper // check smell # sift + f6 // Key Promoter X def message_box(title, errorMsg): easygui.msgbox(errorMsg, title, ok_button="Ok") def get_output_path(path): return os.path.join(OUTPUT_DIR, path) def move_file(src, dist): try: shutil.move(src, dist) except: pass def get_ext(path): return path.split(".").pop() def get_format(path): ext = get_ext(path) assert ext, 'Extenstion must be available' for format, extenstions in FORMATS_EXT_MAP.items(): if ext in extenstions: return format return 'unknown' def get_dist(format, output_dir=None): ext_dir = FORMAT_DIRECTORIES_MAP[format] ext_dir = ext_dir[0].upper() + ext_dir[1:] if output_dir is None: return get_output_path(ext_dir) return os.path.join(output_dir, ext_dir) def count_of_files(dir): for i in range(0,len(dir)-1) : count = len(os.listdir(dir[i+1])) print(f"The {dir[i+1]} directory has {count} files") # why better to have single responsibility functions def create_report_file(dir_info): try: directories = dir_info[1:] data = pd.DataFrame({ "Directory": directories, "Count of files": [len(os.listdir(directory)) for directory in directories], }) data.to_excel("./data.xlsx") print("'Data-File' is created !") except PermissionError : message_box("Error", "Please close 'Data-File' !!! ") if __name__ == '__main__': root_dir = r'test' output_dir = root_dir # or change if you want my_files =[] for (file_path,_,file_names) in os.walk(root_dir): for path in file_names: format = get_format(path) dist = get_dist(format, output_dir) os.makedirs(dist, exist_ok=True) move_file( get_output_path(os.path.join(file_path, path)), dist ) my_files.append(file_path) #print(my_files) #count_of_files(my_files) create_report_file(my_files)

26.27

88

0.60906

fc059782ca43838406f10e88ef3ab5308837ffcc

199

py

Python

mainwindow.py

aberrier/ethera

caed5058a19db629942c847280204794da063319

[ "MIT" ]

2

2018-06-08T09:10:41.000Z

2018-06-08T09:10:47.000Z

mainwindow.py

aberrier/ethera

caed5058a19db629942c847280204794da063319

[ "MIT" ]

null

mainwindow.py

aberrier/ethera

caed5058a19db629942c847280204794da063319

[ "MIT" ]

1

2019-02-06T19:22:53.000Z

# -*- coding: utf-8 -*- # Form implementation generated from reading ui file 'mainwindow.ui' # # Created by: PyQt5 UI code generator 5.10.1 # # WARNING! All changes made in this file will be lost!

22.111111

68

0.703518

e78e85c3b9c66336828e9b9fae0b23bd15dd8a66

37,625

py

Python

venv/Lib/site-packages/ebcli/operations/logsops.py

theLambda/DBH-project1

9b7b1c9bd9f6629724c53872c60b1171e9ba1fa2

[ "MIT" ]

110

2020-01-15T22:58:46.000Z

2022-03-27T20:47:33.000Z

ebcli/operations/logsops.py

QPC-database/aws-elastic-beanstalk-cli

87ad9d8bbe5e4e7cb01b1bd4392eda33cb1943f7

[ "Apache-2.0" ]

89

2020-01-15T23:18:34.000Z

2022-03-31T21:56:05.000Z

ebcli/operations/logsops.py

QPC-database/aws-elastic-beanstalk-cli

87ad9d8bbe5e4e7cb01b1bd4392eda33cb1943f7

[ "Apache-2.0" ]

50

2020-01-15T22:58:53.000Z

2022-02-11T17:39:28.000Z

# Copyright 2015 Amazon.com, Inc. or its affiliates. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"). You # may not use this file except in compliance with the License. A copy of # the License is located at # # http://aws.amazon.com/apache2.0/ # # or in the "license" file accompanying this file. This file is # distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF # ANY KIND, either express or implied. See the License for the specific # language governing permissions and limitations under the License. import calendar from datetime import datetime import os import threading import time import traceback from cement.utils.misc import minimal_logger from six import iteritems from ebcli.core import fileoperations, io from ebcli.lib import elasticbeanstalk, utils, cloudwatch from ebcli.lib.aws import MaxRetriesError from ebcli.resources.strings import strings, prompts from ebcli.resources.statics import namespaces, option_names, logs_operations_constants from ebcli.objects.exceptions import InvalidOptionsError, NotFoundError, ServiceError from ebcli.operations import commonops LOG = minimal_logger(__name__) TAIL_LOG_SIZE = 100 BEANSTALK_LOG_PREFIX = '/aws/elasticbeanstalk' def beanstalk_log_group_builder(env_name, log_group_name=None): """ Method constructs normalizes the `log_group_name` passed in by the customer. :param env_name: current environment being used :param log_group_name: One of the following - None: the method defaults to using '/aws/elasticbeanstalk/<`env_name`>' as the `log_group_name` in this case - '/aws/elasticbeanstalk/<`env_name`>/<log_group_name>': the `log_group_name` is used as is - '<log_group_name>': '/aws/elasticbeanstalk/<`env_name`>' is prefixed to the `log_group_name` :return: a normalized `log_group_name` """ log_group_name = log_group_name or deployment_logs_log_group_name(env_name) if not log_group_name.startswith(cloudwatch_log_group_prefix_for_environment(env_name)): log_group_name = '{0}/{1}/{2}'.format( BEANSTALK_LOG_PREFIX, env_name, log_group_name ).replace("//", "/") return log_group_name def cloudwatch_log_group_prefix_for_environment(env_name): """ Generates the CloudWatch logGroup prefix for the environment, `env_name`. :param env_name: An Elastic Beanstalk environment name :return: A CloudWatch logGroup name prefix of the form /aws/elasticbeanstalk/<`env_name`> """ return '{0}/{1}'.format(BEANSTALK_LOG_PREFIX, env_name) def cloudwatch_log_group_for_environment_health_streaming(env_name): """ Generates the environment-health.log CloudWatch logGroup name for the environment, `env_name`. :param env_name: An Elastic Beanstalk environment name :return: A CloudWatch logGroup name prefix of the form /aws/elasticbeanstalk/<`env_name`> """ return '{0}/{1}'.format(cloudwatch_log_group_prefix_for_environment(env_name), 'environment-health.log') def cloudwatch_log_stream_names(log_group, log_stream_name_prefix): """ Returns all of the logStream names associated with `log_group` with the prefix, `log_stream_name_prefix` if one is specified :param log_group: A CloudWatch logGroup whose logStream names to retrieve :param log_stream_name_prefix: A prefix to filter logStream names by :return: All of the logStream names associated with `log_group` with the prefix, `log_stream_name_prefix` if one is specified """ return cloudwatch.get_all_stream_names( log_group_name=log_group, log_stream_name_prefix=log_stream_name_prefix ) def deployment_logs_log_group_name(env_name): """ Determines the default deployment logGroup for the environment, `env_name` :param env_name: An Elastic Beanstalk environment name :return: 'var/log/eb-activity.log' if the environment is using a non-Windows platform, 'EBDeploy-Log' otherwise """ environment = elasticbeanstalk.get_environment(env_name=env_name) if 'windows' in environment.platform.name.lower(): log_group_suffix = 'EBDeploy-Log' elif 'Amazon Linux 2/' in environment.platform.name: log_group_suffix = "var/log/eb-engine.log" else: log_group_suffix = 'var/log/eb-activity.log' return cloudwatch_log_group_prefix_for_environment(env_name) + '/' + log_group_suffix def disable_cloudwatch_logs(app_name, env_name, cloudwatch_log_source): """ Disables CloudWatch log-streaming for the given environment if the required streaming of the specified `cloudwatch_log_source`s is not already disabled :param app_name: application name :param env_name: environment name :param cloudwatch_log_source: the source of logs. Defaults to 'instance' if value is 'None'. Use - 'instance' to disable instance log0streaming - 'health' to disable health transition log-streaming - 'all': disable streaming of all CloudWatch log sources :return None """ cloudwatch_log_source = cloudwatch_log_source or logs_operations_constants.LOG_SOURCES.INSTANCE_LOG_SOURCE configuration_settings = elasticbeanstalk.describe_configuration_settings(app_name, env_name) option_settings = [] timeout = 5 if cloudwatch_log_source in [ logs_operations_constants.LOG_SOURCES.INSTANCE_LOG_SOURCE, logs_operations_constants.LOG_SOURCES.ALL_LOG_SOURCES ]: if instance_log_streaming_enabled(app_name, env_name, config_settings=configuration_settings): option_settings.append(_instance_log_streaming_option_setting(disable=True)) io.echo(strings['cloudwatch_instance_log_streaming.disable']) timeout = 15 else: io.echo(strings['cloudwatch_instance_log_streaming.already_disabled']) if cloudwatch_log_source in [ logs_operations_constants.LOG_SOURCES.ENVIRONMENT_HEALTH_LOG_SOURCE, logs_operations_constants.LOG_SOURCES.ALL_LOG_SOURCES ]: if environment_health_streaming_enabled(app_name, env_name, config_settings=configuration_settings): io.echo(strings['cloudwatch_environment_health_log_streaming.disable']) option_settings.append(_environment_health_log_streaming_option_setting(disable=True)) else: io.echo(strings['cloudwatch_environment_health_log_streaming.already_disabled']) if option_settings: commonops.update_environment(env_name, changes=option_settings, nohang=False, timeout=timeout) def enable_cloudwatch_logs(app_name, env_name, cloudwatch_log_source): """ Enables CloudWatch log-streaming for the given environment if the required streaming of the specified `cloudwatch_log_source`s is not already enabled :param app_name: application name :param env_name: environment name :param cloudwatch_log_source: the source of logs. Defaults to 'instance' if value is 'None'. Use - 'instance' to enable instance log0streaming - 'health' to enable health transition log-streaming - 'all': enable streaming of all CloudWatch log sources :return None """ cloudwatch_log_source = cloudwatch_log_source or logs_operations_constants.LOG_SOURCES.INSTANCE_LOG_SOURCE configuration_settings = elasticbeanstalk.describe_configuration_settings(app_name, env_name) option_settings = [] timeout = 5 if cloudwatch_log_source in [ logs_operations_constants.LOG_SOURCES.ALL_LOG_SOURCES, logs_operations_constants.LOG_SOURCES.INSTANCE_LOG_SOURCE ]: if not instance_log_streaming_enabled(app_name, env_name, config_settings=configuration_settings): timeout = 15 option_settings.append(_instance_log_streaming_option_setting()) io.echo(strings['cloudwatch_instance_log_streaming.enable']) else: io.echo(strings['cloudwatch_instance_log_streaming.already_enabled']) if cloudwatch_log_source in [ logs_operations_constants.LOG_SOURCES.ALL_LOG_SOURCES, logs_operations_constants.LOG_SOURCES.ENVIRONMENT_HEALTH_LOG_SOURCE, ]: _raise_if_environment_is_not_using_enhanced_health(configuration_settings) if not environment_health_streaming_enabled( app_name, env_name, config_settings=configuration_settings ): option_settings.append(_environment_health_log_streaming_option_setting()) io.echo(strings['cloudwatch_environment_health_log_streaming.enable']) else: io.echo(strings['cloudwatch_environment_health_log_streaming.already_enabled']) if not option_settings: return _echo_link_to_cloudwatch_console(env_name) commonops.update_environment(env_name, changes=option_settings, nohang=False, timeout=timeout) def environment_health_streaming_enabled(app_name, env_name, config_settings=None): """ Checks if health transition streaming is enabled for the given environment :param app_name: application name :param env_name: environment name :param config_settings: the raw response of a call to describe_configuration_settings :return: boolean if the given environment has health transition streaming enabled """ config_settings = config_settings or elasticbeanstalk.describe_configuration_settings(app_name, env_name) stream_enabled = elasticbeanstalk.get_specific_configuration( config_settings, namespaces.CLOUDWATCH_ENVIRONMENT_HEALTH_LOGS, option_names.CLOUDWATCH_ENVIRONMENT_HEALTH_LOGS_ENABLED ) return stream_enabled == 'true' def get_cloudwatch_log_stream_events(log_group_name, stream_name, num_log_events=None): """ Gets log events from CloudWatch and appends them to a single string to output with each line prefixed with the stream name. :param log_group_name: cloudwatch logGroup :param stream_name: cloudwatch stream name :param num_log_events: number of log events to retrieve; default is cloudwatch's max: 10k or 1MB of messages :return: single string will all log events concatenated together """ full_log = [] full_log_blob = '' try: response = cloudwatch.get_log_events(log_group_name, stream_name, limit=num_log_events) for event in response.get('events', []): message = event.get('message') full_log.append('[{stream_name}] {message}'.format(stream_name=stream_name, message=message)) full_log_blob = os.linesep.join(full_log) except ServiceError as e: LOG.debug('Received service error {}'.format(e)) except Exception as e: LOG.debug('Exception raised: ' + str(e)) LOG.debug(traceback.format_exc()) return full_log_blob def get_cloudwatch_messages( log_group_name, stream_name, formatter, next_token, start_time, messages_handler, sleep_time=10 ): """ Polls periodically the logStream `stream_name` until interrupted through a KeyboardInterrupt or an unexpected exception :param log_group_name: A CloudWatch logGroup in which the logStream `stream_name` exists :param stream_name: A CloudWatch logStream to poll :param formatter: The object that formats the output to be displayed in the terminal :param next_token: The token for the next set of items to return :param start_time: The start of the time range, expressed as the number of milliseconds after Jan 1, 1970 00:00:00 UTC. Events with a time stamp earlier than this time are not included. :param messages_handler: :param sleep_time: Time in seconds to sleep before polling CloudWatch for newer events :return: None """ while True: try: messages, next_token, start_time = _get_cloudwatch_messages( log_group_name, stream_name, formatter, next_token, start_time ) if messages: messages_handler(messages) else: break except ServiceError as e: io.log_error(e) break except Exception as e: LOG.debug('Exception raised: ' + str(e)) LOG.debug(traceback.format_exc()) except KeyboardInterrupt: break _wait_to_poll_cloudwatch(sleep_time) start_time = _updated_start_time() def get_instance_log_url_mappings(env_name, info_type): """ Retrieves mappings of Beanstalk instance ids to S3 URLs on which logs are stored. :param env_name: An Elastic Beanstalk environment name :param info_type: The type of information to request. Possible values: tail, bundle :return: mappings of Beanstalk instance ids to S3 URLs """ result = elasticbeanstalk.retrieve_environment_info(env_name, info_type) instance_id_list = dict() for log in result['EnvironmentInfo']: instance_id = log['Ec2InstanceId'] url = log['Message'] instance_id_list[instance_id] = url return instance_id_list def get_logs(env_name, info_type, do_zip=False, instance_id=None): """ Obtains the set of logs from ElasticBeanstalk for the environment `env_name` from ElasticBeanstalk (and not CloudWatch) for the environment, `env_name` and determines whether to tail it or bundle/zip it. :param env_name: An Elastic Beanstalk environment name :param info_type: The type of information to request. Possible values: tail, bundle :param do_zip: Whether the information retrieved should be zipped; works only with info_type 'bundle' :param instance_id: The specific EC2 instance associated with `env_name` whose log information to retrieve :return: None """ instance_id_list = get_instance_log_url_mappings(env_name, info_type) if instance_id: instance_id_list = _updated_instance_id_list(instance_id_list, instance_id) if info_type == logs_operations_constants.INFORMATION_FORMAT.BUNDLE: _handle_bundle_logs(instance_id_list, do_zip) else: _handle_tail_logs(instance_id_list) def instance_log_streaming_enabled(app_name, env_name, config_settings=None): """ Checks if log streaming is enabled for the given environment :param app_name: application name :param env_name: environment name :param config_settings: the raw response of a call to describe_configuration_settings :return: boolean if the given environment has log streaming enabled """ config_settings = ( config_settings or elasticbeanstalk.describe_configuration_settings(app_name, env_name) ) stream_enabled = elasticbeanstalk.get_specific_configuration( config_settings, namespaces.CLOUDWATCH_LOGS, option_names.STREAM_LOGS ) return stream_enabled == 'true' def normalize_log_group_name(env_name, log_group=None, cloudwatch_log_source=None): """ Converts the given (potentially None) `log_group` name to a value that can be consumed by `describe_log_groups`. :param env_name: An Elastic Beanstalk environment name :param log_group: A value for the logGroup name specified by the customer, which is potentially None :param cloudwatch_log_source: Name of the log source `log_group` belongs to. One among: instance, environment-health :return: A normalized logGroup name """ if ( not cloudwatch_log_source or cloudwatch_log_source == logs_operations_constants.LOG_SOURCES.INSTANCE_LOG_SOURCE ): log_group = beanstalk_log_group_builder(env_name, log_group) elif cloudwatch_log_source == logs_operations_constants.LOG_SOURCES.ENVIRONMENT_HEALTH_LOG_SOURCE: if log_group: raise InvalidOptionsError( strings['logs.log_group_and_environment_health_log_source'] ) log_group = beanstalk_log_group_builder( env_name, cloudwatch_log_group_for_environment_health_streaming(env_name) ) else: raise InvalidOptionsError( strings[ 'logs.cloudwatch_log_source_argumnent_is_invalid_for_retrieval' ].format(cloudwatch_log_source) ) return log_group def paginate_cloudwatch_logs(platform_name, version, formatter=None): """ Method periodically polls CloudWatch get_log_events to retrieve the logs for the logStream `version` within the logGroup defined by `version` :param platform_name: A CloudWatch logGroup in which the logStream `version` exists :param version: A CloudWatch logStream to poll :param formatter: The object that formats the output to be displayed in the terminal :return: None """ log_group_name = _get_platform_builder_group_name(platform_name) next_token = None start_time = None messages_handler = (lambda messages: io.echo_with_pager(os.linesep.join(messages))) get_cloudwatch_messages( log_group_name, version, formatter, next_token, start_time, messages_handler, sleep_time=4 ) def raise_if_instance_log_streaming_is_not_enabled(app_name, env_name): """ Raises if CloudWatch instance log streaming is not enabled for the environment, `env_name` :param app_name: An Elastic Beanstalk application name :param env_name: An Elastic Beanstalk environment name contained within `app_name` :return: None """ if not instance_log_streaming_enabled(app_name, env_name): raise InvalidOptionsError(strings['logs.instance_log_streaming_disabled'].format(env_name)) def raise_if_environment_health_log_streaming_is_not_enabled(app_name, env_name): """ Raises if CloudWatch environment-health log streaming is not enabled for the environment, `env_name` :param app_name: An Elastic Beanstalk application name :param env_name: An Elastic Beanstalk environment name contained within `app_name` :return: None """ if not environment_health_streaming_enabled(app_name, env_name): raise InvalidOptionsError(strings['logs.environment_health_log_streaming_disabled'].format(env_name)) def resolve_log_result_type(zip_argument, all_argument): """ Determines whether logs should be tailed or bundled. :param zip_argument: Whether the customer has requested a zipped version of the logs :param all_argument: Whether the customer has requested the logs for all the instances :return: The `info_type` which is one among 'bundle' and 'tail' """ if zip_argument or all_argument: return logs_operations_constants.INFORMATION_FORMAT.BUNDLE else: return logs_operations_constants.INFORMATION_FORMAT.TAIL def retrieve_beanstalk_logs(env_name, info_type, do_zip=False, instance_id=None): """ Obtains the set of logs from ElasticBeanstalk for the environment `env_name`. :param env_name: An Elastic Beanstalk environment name :param info_type: The type of information to request. Possible values: tail, bundle :param do_zip: Whether the information retrieved should be zipped; works only with info_type 'bundle' :param instance_id: The specific EC2 instance associated with `env_name` whose log information to retrieve :return: None """ result = elasticbeanstalk.request_environment_info(env_name, info_type) request_id = result['ResponseMetadata']['RequestId'] io.echo(prompts['logs.retrieving']) commonops.wait_for_success_events( request_id, timeout_in_minutes=2, sleep_time=1, stream_events=False, log_events=True ) get_logs(env_name, info_type, do_zip=do_zip, instance_id=instance_id) def retrieve_cloudwatch_instance_logs( log_group, info_type, do_zip=False, specific_log_stream=None ): """ Retrieves CloudWatch logs for all the environment instances for the `log_group` unless `specific_log_stream` is specified. :param log_group: CloudWatch logGroup :param info_type: tail: to get the last 100 lines and returns the result to the terminal 'bundle': get all of the logs and save them to a dir under .elasticbeanstalk/logs/ :param do_zip: If True, zip the logs for the user :param specific_log_stream: Get logs for specific stream """ retrieve_cloudwatch_logs( log_group, info_type, do_zip, specific_log_stream=specific_log_stream ) def retrieve_cloudwatch_environment_health_logs( log_group, info_type, do_zip=False ): """ Retrieves the environment health information identified by the `log_group` from CloudWatch :param log_group: CloudWatch logGroup :param info_type: tail: to get the last 100 lines and returns the result to the terminal 'bundle': get all of the logs and save them to a dir under .elasticbeanstalk/logs/ :param do_zip: If True, zip the logs for the user :return: """ retrieve_cloudwatch_logs( log_group, info_type, do_zip, specific_log_stream=None, cloudwatch_log_source=logs_operations_constants.LOG_SOURCES.ENVIRONMENT_HEALTH_LOG_SOURCE ) def retrieve_cloudwatch_logs( log_group, info_type, do_zip=False, specific_log_stream=None, cloudwatch_log_source=logs_operations_constants.LOG_SOURCES.INSTANCE_LOG_SOURCE ): """ Retrieves CloudWatch logs for every stream under `log_group` unless `specific_log_stream` is specified. :param log_group: CloudWatch logGroup :param info_type: tail: to get the last 100 lines and returns the result to the terminal 'bundle': get all of the logs and save them to a dir under .elasticbeanstalk/logs/ :param do_zip: If True, zip the logs for the user :param specific_log_stream: Get logs for specific stream :param cloudwatch_log_source: the cloudwatch-log-source to pull from: instance or environment-health """ log_streams = cloudwatch.get_all_stream_names( log_group_name=log_group, log_stream_name_prefix=specific_log_stream ) if info_type == logs_operations_constants.INFORMATION_FORMAT.BUNDLE: logs_location = _setup_logs_folder(cloudwatch_log_source) for log_stream in log_streams: full_logs = get_cloudwatch_log_stream_events(log_group, log_stream) _write_full_logs_to_file(full_logs, logs_location, log_stream) if do_zip: _zip_logs_location(logs_location) else: _attempt_update_symlink_to_latest_logs_retrieved(logs_location) else: stream_logs_in_terminal(log_group, log_streams) def stream_environment_health_logs_from_cloudwatch( sleep_time=10, log_group=None, specific_log_stream=None ): """ Method streams CloudWatch logs to the terminal for the logGroup given. Since it is possible that the logGroup might match multiple logGroups, multiple threads can be spawned to switch between streams to display all of them on the same terminal. :param sleep_time: sleep time to refresh the logs from cloudwatch :param log_group: cloudwatch logGroup :param specific_log_stream: since all of our log streams are instance ids we require this if we want a single stream """ streamer = io.get_event_streamer() streamer.prompt = ' -- {0} -- (Ctrl+C to exit)'.format(log_group) start_time = None log_stream_names = cloudwatch_log_stream_names(log_group, specific_log_stream) if not log_stream_names: return latest_log_stream_name = log_stream_names[-1] other_log_stream_names = log_stream_names[:-1] for log_stream_name in other_log_stream_names: _create_log_stream_for_log_group(log_group, log_stream_name, streamer, sleep_time, start_time) _delay_subsequent_stream_creation() while True: _create_log_stream_for_log_group(log_group, latest_log_stream_name, streamer, sleep_time, start_time) _wait_to_poll_cloudwatch() def stream_instance_logs_from_cloudwatch( sleep_time=10, log_group=None, specific_log_stream=None ): """ Method streams CloudWatch logs to the terminal for the logGroup given. Since it is possible that the logGroup might match multiple logGroups, multiple threads can be spawned to switch between streams to display all of them on the same terminal. :param sleep_time: sleep time to refresh the logs from cloudwatch :param log_group: cloudwatch logGroup :param specific_log_stream: since all of our log streams are instance ids we require this if we want a single stream """ streamer = io.get_event_streamer() streamer.prompt = ' -- {0} -- (Ctrl+C to exit)'.format(log_group) start_time = None while True: log_group_names = set(cloudwatch_log_stream_names(log_group, specific_log_stream)) for log_group_name in log_group_names: _create_log_stream_for_log_group(log_group, log_group_name, streamer, sleep_time, start_time) _delay_subsequent_stream_creation() _wait_to_poll_cloudwatch() start_time = _updated_start_time() def stream_logs_in_terminal(log_group, log_streams): """ Prints logs of each of the `log_streams` to terminal using a scoll-able pager as opposed to printing all available information at once. :param log_group: name of the CloudWatch log group within which to find `stream_name` :param log_streams: the list of log streams belonging to the `log_group` whose events to print to terminal :return: None """ all_logs = '' for log_stream in log_streams: tail_logs = get_cloudwatch_log_stream_events( log_group, log_stream, num_log_events=TAIL_LOG_SIZE ) all_logs += '{linesep}{linesep}============= ' \ '{log_stream} - {log_group} ==============' \ '{linesep}{linesep}'.format( log_stream=str(log_stream), log_group=log_group, linesep=os.linesep ) all_logs += tail_logs io.echo_with_pager(all_logs) def stream_platform_logs(platform_name, version, streamer=None, sleep_time=4, log_name=None, formatter=None): """ Streams the logs of a custom platform :param platform_name: A CloudWatch logGroup in which the logStream `version` exists :param version: A CloudWatch logStream to poll :param streamer: The object that streams events to the terminal :param sleep_time: Time in seconds to sleep before polling CloudWatch for newer events :param log_name: A name used to identify the blob of output in the terminal for the logStream :param formatter: The object that formats the output to be displayed in the terminal :return: None """ log_group_name = _get_platform_builder_group_name(platform_name) wait_for_log_group_to_come_into_existence(log_group_name, sleep_time) streamer = streamer or io.get_event_streamer() if log_name: streamer.prompt = ' -- Streaming logs for %s -- (Ctrl+C to exit)' % log_name stream_single_stream(log_group_name, version, sleep_time, None, formatter) def stream_single_stream( log_group_name, stream_name, sleep_time=4, start_time=None, formatter=None, ): """ Method periodically polls CloudWatch get_log_events to retrieve the logs for the `stream_name` within the logGroup defined by `log_group_name` :param log_group_name: A CloudWatch logGroup in which `stream_name` exists :param stream_name: The CloudWatch logStream to get events from :param streamer: The object that streams events to the terminal :param sleep_time: Time in seconds to sleep before polling CloudWatch for newer events :param start_time: The start of the time range, expressed as the number of milliseconds after Jan 1, 1970 00:00:00 UTC. Events with a time stamp earlier than this time are not included. :param formatter: The object that formats the output to be displayed in the terminal :return: None """ def messages_handler(messages): messages = '{linesep}{linesep}============= ' \ '{log_stream} - {log_group} ==============' \ '{linesep}{linesep}{messages}'.format( log_stream=stream_name, log_group=log_group_name, linesep=os.linesep, messages=os.linesep.join(messages) ) io.echo(messages) get_cloudwatch_messages(log_group_name, stream_name, formatter, None, start_time, messages_handler) _wait_to_poll_cloudwatch(sleep_time) def wait_for_log_group_to_come_into_existence(log_group_name, sleep_time=10): while not cloudwatch.log_group_exists(log_group_name): _wait_to_poll_cloudwatch(sleep_time) def _attempt_update_symlink_to_latest_logs_retrieved(logs_location): if not getattr(os, 'symlink', None): LOG.debug("Couldn't create symlink to latest logs retrieved") return io.echo(strings['logs.location'].replace('{location}', logs_location)) latest_symlink_location = os.path.join( os.path.dirname(logs_location), 'latest' ) try: if os.path.islink(latest_symlink_location): os.unlink(latest_symlink_location) os.symlink(logs_location, latest_symlink_location) io.echo('Updated symlink at', latest_symlink_location) except OSError: pass def _create_log_stream_for_log_group(log_group, stream_name, streamer, sleep_time, start_time=None): cloudwatch_log_stream = threading.Thread( target=stream_single_stream, args=(log_group, stream_name, sleep_time, start_time,), ) cloudwatch_log_stream.daemon = True cloudwatch_log_stream.start() def _delay_subsequent_stream_creation(): time.sleep(0.2) def _download_logs_for_all_instances(instance_id_list, logs_location): for instance_id, url in iteritems(instance_id_list): zip_location = utils.save_file_from_url( url, logs_location, instance_id + '.zip' ) instance_folder = os.path.join(logs_location, instance_id) fileoperations.unzip_folder(zip_location, instance_folder) fileoperations.delete_file(zip_location) def _echo_link_to_cloudwatch_console(env_name): region = commonops.get_default_region() if region in ['cn-north-1', 'cn-northwest-1']: cw_link_regionalized = strings['cloudwatch-logs.bjslink'] else: cw_link_regionalized = strings['cloudwatch-logs.link'] io.echo(cw_link_regionalized.replace('{region}', region).replace('{env_name}', env_name)) def _environment_health_log_streaming_option_setting(disable=False): """ Returns a dict representation of the environment-health log streaming option setting :param disable: True if the intention is to disable the option setting :return: A dict representation of the instance log streaming option setting """ return elasticbeanstalk.create_option_setting( namespaces.CLOUDWATCH_ENVIRONMENT_HEALTH_LOGS, option_names.CLOUDWATCH_ENVIRONMENT_HEALTH_LOGS_ENABLED, 'false' if disable else 'true' ) def _get_cloudwatch_messages( log_group_name, stream_name, formatter=None, next_token=None, start_time=None ): messages = [] response = None latest_event_timestamp = start_time try: response = cloudwatch.get_log_events( log_group_name, stream_name, next_token=next_token, start_time=start_time ) except MaxRetriesError as e: LOG.debug('Received max retries') io.echo(e.message()) time.sleep(1) if response and response.get('events'): for event in response.get('events'): message = event.get('message').encode('utf8', 'replace') if formatter: timestamp = event.get('timestamp') if timestamp: latest_event_timestamp = timestamp formatted_message = formatter.format(message, stream_name) else: formatted_message = '[{1}] {0}'.format(message, stream_name) messages.append(formatted_message) next_token = response.get('nextForwardToken') return messages, next_token, latest_event_timestamp def __get_full_path_for_instance_logs(logs_location, instance_id): return '{0}/{1}.log'.format(logs_location, instance_id) def _get_platform_builder_group_name(platform_name): """ Returns the logGroup name of associated with the custom platform identified by `platform_name` :param platform_name: A custom platform whose logs to stream :return: """ return '/aws/elasticbeanstalk/platform/{}'.format(platform_name) def _handle_bundle_logs(instance_id_list, do_zip): logs_folder_name = _timestamped_directory_name() logs_location = fileoperations.get_logs_location(logs_folder_name) _download_logs_for_all_instances(instance_id_list, logs_location) fileoperations.set_user_only_permissions(logs_location) if do_zip: _handle_log_zipping(logs_location) else: io.echo(strings['logs.location'].replace('{location}', logs_location)) _attempt_update_symlink_to_latest_logs_retrieved(logs_location) def _handle_log_zipping(logs_location): logs_zip = logs_location + '.zip' fileoperations.zip_up_folder(logs_location, logs_zip) fileoperations.delete_directory(logs_location) fileoperations.set_user_only_permissions(logs_zip) io.echo( strings['logs.location'].replace( '{location}', logs_zip ) ) def _handle_tail_logs(instance_id_list): data = [] for instance_id, url in iteritems(instance_id_list): data.append('============= ' + str(instance_id) + ' ==============') log_result = utils.get_data_from_url(url) data.append(utils.decode_bytes(log_result)) io.echo_with_pager(os.linesep.join(data)) def _instance_log_streaming_option_setting(disable=False): return elasticbeanstalk.create_option_setting( namespaces.CLOUDWATCH_LOGS, option_names.STREAM_LOGS, 'false' if disable else 'true' ) def _raise_if_environment_is_not_using_enhanced_health(configuration_settings): option_settings = configuration_settings.get('OptionSettings') health_type = elasticbeanstalk.get_option_setting( option_settings, namespaces.HEALTH_SYSTEM, option_names.SYSTEM_TYPE ) if health_type != 'enhanced': raise InvalidOptionsError( strings[ 'cloudwatch_environment_health_log_streaming.enhanced_health_not_found' ] ) def _setup_logs_folder(cloudwatch_log_source): if cloudwatch_log_source == logs_operations_constants.LOG_SOURCES.INSTANCE_LOG_SOURCE: logs_folder_name = _timestamped_directory_name() else: if not os.path.exists( fileoperations.get_logs_location( logs_operations_constants.LOG_SOURCES.ENVIRONMENT_HEALTH_LOG_SOURCE ) ): os.mkdir( fileoperations.get_logs_location( logs_operations_constants.LOG_SOURCES.ENVIRONMENT_HEALTH_LOG_SOURCE ) ) logs_folder_name = os.path.join( logs_operations_constants.LOG_SOURCES.ENVIRONMENT_HEALTH_LOG_SOURCE, _timestamped_directory_name() ) os.mkdir(fileoperations.get_logs_location(logs_folder_name)) return fileoperations.get_logs_location(logs_folder_name) def _timestamped_directory_name(): return datetime.now().strftime("%y%m%d_%H%M%S") def _updated_start_time(): return calendar.timegm(datetime.utcnow().timetuple()) * 1000 def _updated_instance_id_list(instance_id_list, instance_id): try: return { instance_id: instance_id_list[instance_id] } except KeyError: raise NotFoundError(strings['beanstalk-logs.badinstance'].format(instance_id)) def _wait_to_poll_cloudwatch(sleep_time=10): time.sleep(sleep_time) def _write_full_logs_to_file(full_logs, logs_location, instance_id): full_filepath = __get_full_path_for_instance_logs(logs_location, instance_id) with open(full_filepath, 'w+') as log_file: log_file.write(full_logs) fileoperations.set_user_only_permissions(full_filepath) def _zip_logs_location(logs_location): fileoperations.zip_up_folder(logs_location, logs_location + '.zip') fileoperations.delete_directory(logs_location) logs_location += '.zip' fileoperations.set_user_only_permissions(logs_location) io.echo(strings['logs.location'].replace('{location}', logs_location))

38.353721

110

0.711389

759f0d5c5a8d55736222be260e5e83f26eb32c30

4,013

py

Python

src/brython_jinja2/interpolatedstr.py

jonathanverner/brython-jinja2

cec6e16de1750203a858d0acf590f230fc3bf848

[ "BSD-3-Clause" ]

2

2020-09-13T17:51:55.000Z

2020-11-25T18:47:12.000Z

src/brython_jinja2/interpolatedstr.py

jonathanverner/brython-jinja2

cec6e16de1750203a858d0acf590f230fc3bf848

[ "BSD-3-Clause" ]

2

2020-11-25T19:18:15.000Z

2021-06-01T21:48:12.000Z

src/brython_jinja2/interpolatedstr.py

jonathanverner/brython-jinja2

cec6e16de1750203a858d0acf590f230fc3bf848

[ "BSD-3-Clause" ]

null

""" This module provides the :class:`InterpolatedStr` class which can be used to interpolate complex strings with multiple instances of ``{{ }}``-type circular expressions. """ from .utils.events import EventMixin from .expression import parse_interpolated_str, ConstNode class InterpolatedStr(EventMixin): """ The :class:`InterpolatedStr` manages string interpolations. Use it as follows: ``` from brython_jinja2.context import Context from brython_jinja2.interpolatedstr import InterpolatedStr c = context() istr = InterpolatedStr("Hello {{name}}, {{surname}}!") assert istr.value == "Hello , !" c.name = "John" assert istr.value == "Hello John, !" c.name = "Smith" assert istr.value == "Hello John, Smith!" ``` The class tries to do some clever tricks to only evaluate the subexpressions which have changed due to a given context change. (e.g. c.name='Anne' would not affect the second expresssion in the above example). """ def __init__(self, string, start='{{', end='}}', stop_strs=[]): super().__init__() if isinstance(string, InterpolatedStr): # pylint: disable=protected-access; we are cloning ourselves, we have access to protected variables self._src = string._src self.asts = [] for ast in string.asts: self.asts.append(ast.clone()) else: self._src, self.asts = parse_interpolated_str(string, start=start, end=end, stop_strs=stop_strs) for ast_index in range(len(self.asts)): self.asts[ast_index].bind('change', lambda event, ast_index=ast_index: self._change_chandler(event, ast_index)) self._dirty = True self._dirty_vals = True self._cached_vals = [] self._cached_val = "" self.evaluate() def is_const(self): for a in self.asts: if not a.is_const(): return False return True def bind_ctx(self, context): for ast in self.asts: ast.bind_ctx(context) self._dirty = True self._cached_val = "" def clone(self): return InterpolatedStr(self) def get_ast(self, n, strip_str=True): if not strip_str: return self.asts[n] else: return self.asts[n]._rarg._children[0] def _change_chandler(self, event, ast_index): if not self._dirty_vals: if 'value' in event.data: self._cached_vals[ast_index] = event.data['value'] else: self._dirty_vals = True if self._dirty: return self._dirty = True self.emit('change', {}) @property def value(self): if self._dirty: if self._dirty_vals: self.evaluate() else: self._cached_val = "".join(self._cached_vals) return self._cached_val def evaluate(self): self._cached_val = "" self._cached_vals = [] for ast in self.asts: try: self._cached_vals.append(ast.eval()) # pylint: disable=bare-except; interpolated str must handle any exceptions when evaluating circular expressions except: self._cached_vals.append("") self._cached_val = "".join(self._cached_vals) self._dirty = False def rstrip(self): ret = self.clone() if ret.asts: node = self.get_ast(-1, strip_str=True) if isinstance(node, ConstNode): node._cached_val = node._cached_val.rstrip() return ret def __str__(self): if self._dirty: return "InterpolatedStr("+self._src+")[=dirty:"+self.value+"]" else: return "InterpolatedStr("+self._src+")[="+self.value+"]"

32.626016

127

0.573636

be6b0356a826dacfccdea774ccd93dabfcb7f8e8

2,871

gyp

Python

gyp/network-unittests.gyp

nidium/libapenetwork

d011cf41402b3936cbaef1c07b5086a1a0eab265

[ "MIT" ]

22

2016-06-28T18:12:34.000Z

2020-12-10T05:05:54.000Z

gyp/network-unittests.gyp

nidium/libapenetwork

d011cf41402b3936cbaef1c07b5086a1a0eab265

[ "MIT" ]

14

2016-10-15T19:45:00.000Z

2017-04-24T11:07:01.000Z

gyp/network-unittests.gyp

nidium/libapenetwork

d011cf41402b3936cbaef1c07b5086a1a0eab265

[ "MIT" ]

8

2016-12-08T02:40:56.000Z

2020-12-11T00:27:14.000Z

# Copyright 2016 Nidium Inc. All rights reserved. # Use of this source code is governed by a MIT license # that can be found in the LICENSE file. { 'targets': [ { 'target_name': 'unittests-settings', 'type': 'none', 'direct_dependent_settings': { 'include_dirs': [ '<(third_party_path)/gtest/googletest/include', ], 'conditions': [ ['OS=="linux"', { "link_settings": { 'libraries': [ '-lgtest_main', '-lgtest', '-ldl', '-lpthread', '-lrt' ] } }], ['OS=="mac"', { "link_settings": { 'libraries': [ 'libgtest_main.a', 'libgtest.a', ] } }] ], }, }, { 'target_name': 'network-unittests', 'type': 'executable', # When built from a different directory the current # working directory of gyp is different between # OSX and Linux. Workaround that. 'conditions': [ ['OS=="mac"', { 'product_dir': '<(libapenetwork_tests_output_path)', "xcode_settings": { 'OTHER_LDFLAGS!': [ '../build/third-party/libssl.a', '../build/third-party/libcrypto.a', ], 'OTHER_LDFLAGS': [ '<(DEPTH)/build/third-party/libssl.a', '<(DEPTH)/build/third-party/libcrypto.a', ], }, }, { 'product_dir': '../build/tests/', }] ], 'dependencies': [ 'network-unittests.gyp:unittests-settings', 'network.gyp:*', ], 'sources': [ '../tests/unittest_0.cpp', '../tests/unittest_common.cpp', '../tests/unittest_base64.cpp', '../tests/unittest_blowfish.cpp', '../tests/unittest_sha1.cpp', '../tests/unittest_buffer.cpp', '../tests/unittest_pool.cpp', '../tests/unittest_array.cpp', '../tests/unittest_hash.cpp', '../tests/unittest_netlib.cpp', '../tests/unittest_events.cpp', '../tests/unittest_timersng.cpp', '../tests/unittest_socket.cpp', '../tests/unittest_dns.cpp', '../tests/unittest_ssl.cpp', '../tests/unittest_websocket.cpp', '../tests/unittest_log.cpp', ], }] }

33.383721

68

0.40404

d5f269812bbe07294bc2865cd94c574bca1f5460

10,128

py

Python

doc/integrations/pytorch/parlai/tasks/md_gender/wikipedia.py

novium258/cortx-1

ce5b939b33b8d24d89b31807ac3bcaa8f24096bc

[ "Apache-2.0" ]

1

2020-09-27T05:00:06.000Z

doc/integrations/pytorch/parlai/tasks/md_gender/wikipedia.py

novium258/cortx-1

ce5b939b33b8d24d89b31807ac3bcaa8f24096bc

[ "Apache-2.0" ]

1

2021-08-04T11:17:39.000Z

doc/integrations/pytorch/parlai/tasks/md_gender/wikipedia.py

novium258/cortx-1

ce5b939b33b8d24d89b31807ac3bcaa8f24096bc

[ "Apache-2.0" ]

1

2021-05-03T13:27:14.000Z

#!/usr/bin/env python3 # Copyright (c) Facebook, Inc. and its affiliates. # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. from typing import Optional from parlai.core.params import ParlaiParser from parlai.core.opt import Opt from parlai.core.message import Message from parlai.core.teachers import ChunkTeacher from parlai.tasks.wikipedia.build import build from parlai.utils.misc import warn_once import parlai.tasks.md_gender.utils as gend_utils from copy import deepcopy import json import os import random import re import spacy from typing import List NLP = spacy.load('en_core_web_sm') DEBUG = False def check_if_person(text): """ Using spacy, check if the title of the Wikipedia passage is a person. """ doc = NLP(text) is_person = False ents = [ent for ent in doc.ents] for ent in ents: if ent.label_ == 'PERSON': is_person = True return is_person def get_gender(text): """ Determine gender by the count of referring pronouns in the biography (he, she, they). """ he_count = len(re.findall(' he ', text.lower())) she_count = len(re.findall(' she ', text.lower())) they_count = len(re.findall(' they ', text.lower())) if he_count == max(he_count, she_count, they_count): return gend_utils.MASC elif she_count == max(he_count, she_count, they_count): return gend_utils.FEM else: nonbinary_count = len(re.findall(' non-binary ', text.lower())) if nonbinary_count > 0: return gend_utils.NONBINARY return gend_utils.NEUTRAL class WikipediaTeacher(ChunkTeacher): """ Wikipedia gender. """ @classmethod def add_cmdline_args( cls, parser: ParlaiParser, partial_opt: Optional[Opt] = None ) -> ParlaiParser: super().add_cmdline_args(parser, partial_opt) parser = gend_utils.add_common_args(parser) agent = parser.add_argument_group('Wiki gender') agent.add_argument( '--class-task', type=str, default='all', choices=['single', 'all'], help='Rank against all possibilities vs. F/M/N/NB', ) agent.add_argument( '--mask-gendered-words', type='bool', default=False, help='Mask explicitly gendered words.', ) return parser def __init__(self, opt, shared=None): if shared is None: # set map self.opt = opt self._set_chunk_idx_to_file(opt) else: self.chunk_idx_to_file = shared['chunk_idx_to_file'] self.class_task = opt['class_task'] self.is_train = 'train' in opt['datatype'] and 'evalmode' not in opt['datatype'] self.is_valid = 'valid' in opt['datatype'] self.add_unknown_classes = ( opt['add_unknown_classes'] and self.is_train and self.class_task == 'all' ) if self.class_task == 'all': self.label_candidates = gend_utils.ALL_CANDS elif self.class_task == 'single': self.label_candidates = { 'about': [ gend_utils.FEM, gend_utils.MASC, gend_utils.NEUTRAL, gend_utils.NONBINARY, ] } self.mask_gendered_words = opt['mask_gendered_words'] if self.mask_gendered_words: male, female = gend_utils.get_explicitly_gendered_words(self.opt) self.gendered_list = male + female self.counts = { gend_utils.FEM: 0, gend_utils.MASC: 0, gend_utils.NEUTRAL: 0, gend_utils.NONBINARY: 0, } super().__init__(opt, shared) def _set_chunk_idx_to_file(self, opt): # download wikipedia data wiki_opt = deepcopy(opt) wiki_opt['task'] = 'wikipedia:full' build(wiki_opt) # now divide data into subfolders data_folder = self._get_data_folder() self.chunk_idx_to_file = {} i = 0 for subdir in os.listdir(data_folder): if subdir != 'README.md': for fle in os.listdir(os.path.join(data_folder, subdir)): self.chunk_idx_to_file[i] = os.path.join(data_folder, subdir, fle) i += 1 def _get_data_folder(self): return os.path.join(self.opt['datapath'], 'wikipedia/full/wiki_full_extracted') def get_num_samples(self, opt) -> int: """ Return the number of samples given the datatype. """ datatype = opt['datatype'] if 'train' in datatype: return 12774693, 12774693 elif 'valid' in datatype: return 7410, 7410 else: return 7441, 7441 def get_fold_chunks(self, opt) -> List[int]: # type: ignore """ Return a list of chunk IDs (integer). Given the datatype (train/test/valid), return the list of chunk IDs that correspond to that split. """ datatype = opt['datatype'] all_chunk_idxs = list(self.chunk_idx_to_file.keys()) if DEBUG: print(f'Total chunks: {len(all_chunk_idxs)}') if 'train' in datatype: return all_chunk_idxs[:-10] elif 'valid' in datatype: return all_chunk_idxs[-10:-5] else: return all_chunk_idxs[-5:] def load_from_chunk(self, chunk_idx: int): """ [Abstract] Given the chunk index, load examples from that chunk. Return a list of tuples. The function `_create_message` will take these tuples to form the Message object that is returned by the teacher. """ output = [] chunk_path = self.chunk_idx_to_file[chunk_idx] extra_data = [] with open(chunk_path) as wf: for article_json in wf: article = json.loads(article_json) title = article['title'] text = article['text'] title = title.split(' (')[0] is_person = check_if_person(title) if not is_person: continue gender = get_gender(text) label = f'ABOUT:{gender}' for par in text.split('\n'): if par: output.append((par, title, label, gender, 'about')) self.counts[gender] += 1 if self.add_unknown_classes: extra_data.append( ( par, title, f'SELF:{gend_utils.UNKNOWN}', gender, 'self', ) ) extra_data.append( ( par, title, f'PARTNER:{gend_utils.NEUTRAL}', gender, 'partner', ) ) if len(extra_data) > 0: # possibly sample unknown classes sample_rate = self.opt['unknown_temp'] if sample_rate < 1.0: to_samp = int(sample_rate * len(extra_data)) sampled = random.sample(extra_data, to_samp) output += sampled else: output += extra_data if DEBUG: print('\n\nGender count update:') for k, v in self.counts.items(): print(f'{k}: {v}') if (self.is_train and self.opt['balance']) or ( self.is_valid and self.opt['balance_valid'] ): exclude_lst = [ f'ABOUT:{gend_utils.NONBINARY}', f'SELF:{gend_utils.UNKNOWN}', f'PARTNER:{gend_utils.NEUTRAL}', ] # not enough of each of these examples to balance output = gend_utils.balance_data(output, key=2, exclude_labels=exclude_lst) if len(output) == 0: warn_once(f'CHUNK {chunk_idx} is empty') return output def _mask_gendered_words(self, text): return gend_utils.mask_gendered_words(text, self.gendered_list) def create_message(self, queue_output, entry_idx=0) -> 'Message': """ [Abstract] Given the tuple output of the queue, return an act. """ par, title, lbl, gender, class_type = queue_output if self.class_task == 'all': if class_type == 'self': labels = gend_utils.UNKNOWN_LABELS['self'] # Not True neutral else: labels = [lbl] elif self.class_task == 'single': labels = [gender] if self.mask_gendered_words: par = self._mask_gendered_words(par) return Message( { 'text': par, 'name': title, 'labels': labels, 'label_candidates': self.label_candidates[class_type], 'episode_done': True, 'id': 'Wikipedia Gender', } ) def share(self): shared = super().share() shared['chunk_idx_to_file'] = self.chunk_idx_to_file return shared def write_gender_to_file(open_file, loaded_data): prev = None for _, title, _, gender, _ in loaded_data: if title != prev: open_file.write(f'{title}\t{gender}\n') prev = title

33.647841

89

0.522314

27444ec11319d2fb81ef0d6b46492df823d8d263

1,330

py

Python

app/core/tests/test_admin.py

probal25/recipe-app-api

b4e9ca260b5406b60f74cd1e38160c1a2e831827

[ "MIT" ]

null

app/core/tests/test_admin.py

probal25/recipe-app-api

b4e9ca260b5406b60f74cd1e38160c1a2e831827

[ "MIT" ]

null

app/core/tests/test_admin.py

probal25/recipe-app-api

b4e9ca260b5406b60f74cd1e38160c1a2e831827

[ "MIT" ]

null

from django.test import TestCase, Client from django.contrib.auth import get_user_model from django.urls import reverse class AdminSiteTests(TestCase): def setUp(self): self.client = Client() self.admin_user = get_user_model().objects.create_superuser( email='admin@doit.com', password='password123' ) self.client.force_login(self.admin_user) self.user = get_user_model().objects.create_user( email='test@doit.com', password='password123', name='Test user full name' ) def test_users_listed(self): """test that users are listed on user page""" url = reverse('admin:core_user_changelist') res = self.client.get(url) self.assertContains(res, self.user.name) self.assertContains(res, self.user.email) def test_user_change_page(self): """Test that the user edit page works""" url = reverse('admin:core_user_change', args=[self.user.id]) res = self.client.get(url) self.assertEqual(res.status_code, 200) def test_create_user_page(self): """Test that the create user page works""" url = reverse('admin:core_user_add') res = self.client.get(url) self.assertEqual(res.status_code, 200)

32.439024

68

0.631579

01ef39c54462a8976563caec8401e9dfbfa9ef03

1,234

py

Python

Python3/1129-Shortest-Path-With-Alternating-Colors/soln.py

wyaadarsh/LeetCode-Solutions

3719f5cb059eefd66b83eb8ae990652f4b7fd124

[ "MIT" ]

5

2020-07-24T17:48:59.000Z

2020-12-21T05:56:00.000Z

Python3/1129-Shortest-Path-With-Alternating-Colors/soln.py

zhangyaqi1989/LeetCode-Solutions

2655a1ffc8678ad1de6c24295071308a18c5dc6e

[ "MIT" ]

null

Python3/1129-Shortest-Path-With-Alternating-Colors/soln.py

zhangyaqi1989/LeetCode-Solutions

2655a1ffc8678ad1de6c24295071308a18c5dc6e

[ "MIT" ]

2

2020-07-24T17:49:01.000Z

2020-08-31T19:57:35.000Z

class Solution: def shortestAlternatingPaths(self, n: int, red_edges: List[List[int]], blue_edges: List[List[int]]) -> List[int]: reds = collections.defaultdict(list) blues = collections.defaultdict(list) for i, j in red_edges: reds[i].append(j) for i, j in blue_edges: blues[i].append(j) # print(reds, blues) frontier = collections.deque([(v, 'r') for v in reds[0]] + [(v, 'b') for v in blues[0]]) # print(frontier) ans = [-1] * n ans[0] = 0 step = 0 seen = {(0, 'r'), (0, 'b')} for node, c in frontier: seen.add((node, c)) while frontier: step += 1 sz = len(frontier) for _ in range(sz): node, color = frontier.popleft() if ans[node] == -1: ans[node] = step nei_lst = blues if color == 'r' else reds for nei in nei_lst[node]: new_color = 'r' if color == 'b' else 'b' if (nei, new_color) not in seen: seen.add((nei, new_color)) frontier.append((nei, new_color)) return ans

38.5625

117

0.471637

39869ef2574a3c486d2236c57c19451949ab0613

41

py

Python

indra/ontology/__init__.py

zebulon2/indra

7727ddcab52ad8012eb6592635bfa114e904bd48

[ "BSD-2-Clause" ]

136

2016-02-11T22:06:37.000Z

2022-03-31T17:26:20.000Z

indra/ontology/__init__.py

zebulon2/indra

7727ddcab52ad8012eb6592635bfa114e904bd48

[ "BSD-2-Clause" ]

748

2016-02-03T16:27:56.000Z

2022-03-09T14:27:54.000Z

indra/ontology/__init__.py

zebulon2/indra

7727ddcab52ad8012eb6592635bfa114e904bd48

[ "BSD-2-Clause" ]

56

2015-08-28T14:03:44.000Z

2022-02-04T06:15:55.000Z

from .ontology_graph import IndraOntology

41

0.902439

137ab07968cb8906a54b25fc454428ca0c378bab

5,430

py

Python

openGaussBase/testcase/SQL/DML/set/Opengauss_Function_DML_Set_Case0078.py

opengauss-mirror/Yat

aef107a8304b94e5d99b4f1f36eb46755eb8919e

[ "MulanPSL-1.0" ]

null

openGaussBase/testcase/SQL/DML/set/Opengauss_Function_DML_Set_Case0078.py

opengauss-mirror/Yat

aef107a8304b94e5d99b4f1f36eb46755eb8919e

[ "MulanPSL-1.0" ]

null

openGaussBase/testcase/SQL/DML/set/Opengauss_Function_DML_Set_Case0078.py

opengauss-mirror/Yat

aef107a8304b94e5d99b4f1f36eb46755eb8919e

[ "MulanPSL-1.0" ]

null

""" Copyright (c) 2022 Huawei Technologies Co.,Ltd. openGauss is licensed under Mulan PSL v2. You can use this software according to the terms and conditions of the Mulan PSL v2. You may obtain a copy of Mulan PSL v2 at: http://license.coscl.org.cn/MulanPSL2 THIS SOFTWARE IS PROVIDED ON AN "AS IS" BASIS, WITHOUT WARRANTIES OF ANY KIND, EITHER EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO NON-INFRINGEMENT, MERCHANTABILITY OR FIT FOR A PARTICULAR PURPOSE. See the Mulan PSL v2 for more details. """ """ Case Type : 功能测试 Case Name : 管理员执行shutdown命令 Description : 1. 创建具有shutdown权限的管理员用户 2.1. 开启事务创建表，不关闭事务 2.2. 执行shutdown(默认关闭以及带关闭模式fast关闭)并执行其他sql语句 2.2. 重启数据库,检查事务里创建的表 3. 清理环境 Expect : 1. 创建成功 2.1. 成功 2.2. shutdown为默认模式时,当前连接的数据库节点关闭关闭fast试,不等待客户端中断连接，将所有活跃事务回滚并且强制断开客户端,然后关闭数据库节点 2.3. 重启成功,表不存在 3. 清理成功 History : """ import os import unittest from testcase.utils.CommonSH import CommonSH from testcase.utils.Constant import Constant from testcase.utils.Logger import Logger from yat.test import Node from yat.test import macro class Function(unittest.TestCase): def setUp(self): self.log = Logger() self.commonsh = CommonSH('dbuser') self.user = Node('dbuser') self.pwd = macro.COMMON_PASSWD self.env = macro.DB_ENV_PATH self.constant = Constant() self.log.info(f'-----{os.path.basename(__file__)} start-----') def test_shutdown(self): test = '-----step1:创建具有shutdown权限的管理员用户 expect:成功-----' self.log.info(test) cmd0 = f'''drop user if exists hong cascade; create user hong with sysadmin password '{self.pwd}';''' msg0 = self.commonsh.execut_db_sql(cmd0) self.log.info(msg0) self.assertTrue(msg0.find('CREATE ROLE') > -1) cmd1 = '''select rolname, rolsystemadmin from pg_authid where rolname = 'hong';''' msg1 = self.commonsh.execut_db_sql(cmd1) self.log.info(msg1) self.assertTrue('hong | t' in msg1, '执行失败:' + test) test = '-----shutdown默认关闭以及带关闭模式fast关闭-----' self.log.info(test) shutdown_list = ['shutdown;', 'shutdown fast;'] check = 'select sysdate;' info1 = 'SHUTDOWN' info2 = 'failed to connect' info3 = 'Broken pipe' for i in range(2): test = '-----step2.1:开启事务创建表，不关闭事务 expect:成功-----' self.log.info(test) cmd1 = '''start transaction; drop table if exists xhy; create table xhy(id int); insert into xhy values(89);''' msg1 = self.commonsh.execut_db_sql(cmd1) self.log.info(msg1) self.assertTrue('CREATE' in msg1, '执行失败:' + test) test = '-----step2.2:执行shutdown(默认关闭以及带关闭模式fast关闭)并执行其他sql语句 ' \ 'expect:shutdown为默认模式时,当前连接的数据库节点关闭;' \ '关闭fast试,不等待客户端中断连接，将所有活跃事务回滚并且强制断开客户端,然后关闭数据库节点-----' self.log.info(test) cmd2 = f''' source {self.env}; gsql -d {self.user.db_name} -U hong -W {self.pwd} \ -p {self.user.db_port} -c "{shutdown_list[i]}"''' self.log.info(cmd2) msg2 = self.user.sh(cmd2).result() self.log.info(msg2) self.assertTrue(info1 in msg2) cmd0 = f''' source {self.env}; gsql -d {self.user.db_name} -U hong -W {self.pwd} \ -p {self.user.db_port} -c "{check}"''' self.log.info(cmd0) msg0 = self.user.sh(cmd0).result() self.log.info(msg0) self.assertTrue(info2 in msg0 or info3 in msg0, '执行失败:' + test) test = '-----step2.3:重启数据库,检查事务里创建的表 expect:重启成功,表不存在-----' self.log.info(test) result = self.commonsh.execute_gsctl('restart', 'server started', '-M primary') self.assertTrue(result) result = self.commonsh.execute_gsctl('query', '', get_detail=True) self.log.info(result) self.assertTrue("Degraded" in result or "Normal" in result, '执行失败:' + test) cmd3 = f'''source {self.env} gsql -d {self.user.db_name} -U hong -W {self.pwd} \ -p {self.user.db_port} -c "select * from xhy;"''' self.log.info(cmd3) msg3 = self.user.sh(cmd3).result() self.log.info(msg3) self.assertTrue('relation "xhy" does not exist' in msg3, '执行失败:' + test) def tearDown(self): self.log.info('-----step3:清理环境-----') test_1 = '-----检查数据库状态，异常时重启数据库 expect:成功-----' self.log.info(test_1) status = self.commonsh.get_db_cluster_status() if 'Normal' or 'Degraded' not in status: status = self.commonsh.restart_db_cluster() self.log.info(status) self.assertTrue(status, '执行失败:' + test_1) test_2 = '-----删除用户 expect:成功-----' self.log.info(test_2) drop_cmd = f'drop user if exists hong cascade;' drop_res = self.commonsh.execut_db_sql(drop_cmd) self.log.info(drop_res) self.assertIn(self.constant.DROP_ROLE_SUCCESS_MSG, drop_res, '执行失败:' + test_2) self.log.info(f'-----{os.path.basename(__file__)} end-----')

37.708333

84

0.576243

78d4ef9106901c0d8826b173fe41bdac5257cdb4

20,953

py

Python

tests/probability2/empirical_distributions/empirical_distribution_marginal_test.py

rpazuki/algos

bca46326f58eb983db6efe55320bf95fcf2b895f

[ "MIT" ]

null

tests/probability2/empirical_distributions/empirical_distribution_marginal_test.py

rpazuki/algos

bca46326f58eb983db6efe55320bf95fcf2b895f

[ "MIT" ]

1

2020-08-12T06:56:59.000Z

2020-08-12T08:57:30.000Z

tests/probability2/empirical_distributions/empirical_distribution_marginal_test.py

chasing-entropy/algos

bca46326f58eb983db6efe55320bf95fcf2b895f

[ "MIT" ]

null

import pytest from probability2.empirical_distributions import DiscreteDistribution from tests.helpers import compare def test_marginals_names_exception_discrete_distribution(): # Wrong rv name with pytest.raises(ValueError): samples = {"a": 3, "b": 4, "c": 5} disc_dist = DiscreteDistribution(samples) disc_dist.marginal("X1") # Wrong rv name with pytest.raises(ValueError): samples = {("a", "x"): 4, ("a", "y"): 4, ("b", "x"): 6, ("b", "y"): 6} disc_dist = DiscreteDistribution(samples) disc_dist.marginal("X0") # Wrong rv name with pytest.raises(ValueError): samples = {("a", "x"): 4, ("a", "y"): 4, ("b", "x"): 6, ("b", "y"): 6} disc_dist = DiscreteDistribution(samples) disc_dist.marginal("X3") # Wrong rv name with pytest.raises(ValueError): samples = {("a", "x"): 4, ("a", "y"): 4, ("b", "x"): 6, ("b", "y"): 6} disc_dist = DiscreteDistribution(samples) disc_dist2 = disc_dist.marginal("X1") disc_dist2.marginal("X1") # Wrong rv name with pytest.raises(ValueError): samples = {("a", "x"): 4, ("a", "y"): 4, ("b", "x"): 6, ("b", "y"): 6} disc_dist = DiscreteDistribution(samples, names=["Y", "Z"]) disc_dist.marginal("X1") # Wrong rv name with pytest.raises(ValueError): samples = {("a", "x"): 4, ("a", "y"): 4, ("b", "x"): 6, ("b", "y"): 6} disc_dist = DiscreteDistribution(samples, names=["Y", "Z"]) disc_dist.marginal("X1") # Wrong rv name with pytest.raises(ValueError): samples = {("a", "x"): 4, ("a", "y"): 4, ("b", "x"): 6, ("b", "y"): 6} disc_dist = DiscreteDistribution(samples, names=["Y", "Z"]) disc_dist2 = disc_dist.marginal("Y") disc_dist2.marginal("Y") # Marginalize over all vars with pytest.raises(ValueError): samples = {("a", "x"): 4, ("a", "y"): 4, ("b", "x"): 6, ("b", "y"): 6} disc_dist = DiscreteDistribution(samples, names=["Y", "Z"]) disc_dist2 = disc_dist.marginal("Y", "Z") def test_marginals_names_discrete_distribution(): samples = {("a", "x"): 4, ("a", "y"): 4, ("b", "x"): 6, ("b", "y"): 6} disc_dist = DiscreteDistribution(samples) disc_dist2 = disc_dist.marginal("X1") assert all(compare(disc_dist2.names, ["X2"])) disc_dist2 = disc_dist.marginal("X2") assert all(compare(disc_dist2.names, ["X1"])) # disc_dist = DiscreteDistribution(samples, names=["Y", "Z"]) disc_dist2 = disc_dist.marginal("Y") assert all(compare(disc_dist2.names, ["Z"])) disc_dist2 = disc_dist.marginal("Z") assert all(compare(disc_dist2.names, ["Y"])) # Three levels dist. samples = { ("a", "x", 1): 4, ("a", "x", 2): 4, ("a", "y", 1): 6, ("a", "y", 2): 6, ("b", "x", 1): 8, ("b", "x", 2): 8, ("b", "y", 1): 10, ("b", "y", 2): 10, } disc_dist = DiscreteDistribution(samples) disc_dist2 = disc_dist.marginal("X1") assert all(compare(disc_dist2.names, ["X2", "X3"])) disc_dist2 = disc_dist.marginal("X2") assert all(compare(disc_dist2.names, ["X1", "X3"])) disc_dist2 = disc_dist.marginal("X3") assert all(compare(disc_dist2.names, ["X1", "X2"])) disc_dist2 = disc_dist.marginal("X1", "X3") assert all(compare(disc_dist2.names, ["X2"])) disc_dist2 = disc_dist.marginal("X2", "X3") assert all(compare(disc_dist2.names, ["X1"])) # disc_dist = DiscreteDistribution(samples, names=["Y", "Z", "W"]) disc_dist2 = disc_dist.marginal("Y") assert all(compare(disc_dist2.names, ["Z", "W"])) disc_dist2 = disc_dist.marginal("Z") assert all(compare(disc_dist2.names, ["Y", "W"])) disc_dist2 = disc_dist.marginal("W") assert all(compare(disc_dist2.names, ["Y", "Z"])) disc_dist2 = disc_dist.marginal("Y", "W") assert all(compare(disc_dist2.names, ["Z"])) disc_dist2 = disc_dist.marginal("Z", "W") assert all(compare(disc_dist2.names, ["Y"])) def test_marginals_discrete_distribution(): # Single RV dist. with pytest.raises(ValueError): disc_dist = DiscreteDistribution({"A": 2, "B": 3, "C": 4}) disc_dist.marginal("X1") # Two levels dist. samples = {(1, 1): 4, (1, 2): 4, (2, 1): 6, (2, 2): 6} disc_dist = DiscreteDistribution(samples) disc_dist2 = disc_dist.marginal("X1") assert disc_dist2.total == disc_dist.total assert all(compare(disc_dist2.keys_as_list(), [1, 2])) assert disc_dist2[1] == 10 assert disc_dist2[2] == 10 assert disc_dist2.probability(1) == 0.5 assert disc_dist2.probability(2) == 0.5 disc_dist2 = disc_dist.marginal("X2") assert disc_dist2.total == disc_dist.total assert all(compare(disc_dist2.keys_as_list(), [1, 2])) assert disc_dist2[1] == 8 assert disc_dist2[2] == 12 assert disc_dist2.probability(1) == 0.4 assert disc_dist2.probability(2) == 0.6 samples = {("a", "x"): 4, ("a", "y"): 4, ("b", "x"): 6, ("b", "y"): 6} disc_dist = DiscreteDistribution(samples) disc_dist2 = disc_dist.marginal("X1") assert disc_dist2.total == disc_dist.total assert all(compare(disc_dist2.keys_as_list(), ["x", "y"])) assert disc_dist2["x"] == 10 assert disc_dist2["y"] == 10 assert disc_dist2.probability("x") == 0.5 assert disc_dist2.probability("y") == 0.5 disc_dist2 = disc_dist.marginal("X1") assert disc_dist2.total == disc_dist.total assert all(compare(disc_dist2.keys_as_list(), ["x", "y"])) assert disc_dist2["x"] == 10 assert disc_dist2["y"] == 10 assert disc_dist2.probability("x") == 0.5 assert disc_dist2.probability("y") == 0.5 disc_dist2 = disc_dist.marginal("X2") assert disc_dist2.total == disc_dist.total assert all(compare(disc_dist2.keys_as_list(), ["a", "b"])) assert disc_dist2["a"] == 8 assert disc_dist2["b"] == 12 assert disc_dist2.probability("a") == 0.4 assert disc_dist2.probability("b") == 0.6 # Three levels dist. samples = { ("a", "x", 1): 4, ("a", "x", 2): 4, ("a", "y", 1): 6, ("a", "y", 2): 6, ("b", "x", 1): 8, ("b", "x", 2): 8, ("b", "y", 1): 10, ("b", "y", 2): 10, } disc_dist = DiscreteDistribution(samples) disc_dist2 = disc_dist.marginal("X1") assert disc_dist2.total == disc_dist.total assert all( compare(disc_dist2.keys_as_list(), [("x", 1), ("x", 2), ("y", 1), ("y", 2)]) ) assert disc_dist2[("x", 1)] == 12 assert disc_dist2[("x", 2)] == 12 assert disc_dist2[("y", 1)] == 16 assert disc_dist2[("y", 2)] == 16 assert disc_dist2.probability(("x", 1)) == 12 / 56 assert disc_dist2.probability(("x", 2)) == 12 / 56 assert disc_dist2.probability(("y", 1)) == 16 / 56 assert disc_dist2.probability(("y", 2)) == 16 / 56 disc_dist2 = disc_dist.marginal("X2") assert disc_dist2.total == disc_dist.total assert all( compare(disc_dist2.keys_as_list(), [("a", 1), ("a", 2), ("b", 1), ("b", 2)]) ) assert disc_dist2[("a", 1)] == 10 assert disc_dist2[("a", 2)] == 10 assert disc_dist2[("b", 1)] == 18 assert disc_dist2[("b", 2)] == 18 assert disc_dist2.probability(("a", 1)) == 10 / 56 assert disc_dist2.probability(("a", 2)) == 10 / 56 assert disc_dist2.probability(("b", 1)) == 18 / 56 assert disc_dist2.probability(("b", 2)) == 18 / 56 disc_dist2 = disc_dist.marginal("X3") assert disc_dist2.total == disc_dist.total assert all( compare( disc_dist2.keys_as_list(), [("a", "x"), ("a", "y"), ("b", "x"), ("b", "y")] ) ) assert disc_dist2[("a", "x")] == 8 assert disc_dist2[("a", "y")] == 12 assert disc_dist2[("b", "x")] == 16 assert disc_dist2[("b", "y")] == 20 assert disc_dist2.probability(("a", "x")) == 8 / 56 assert disc_dist2.probability(("a", "y")) == 12 / 56 assert disc_dist2.probability(("b", "x")) == 16 / 56 assert disc_dist2.probability(("b", "y")) == 20 / 56 disc_dist2 = disc_dist.marginal("X1", "X2") assert disc_dist2.total == disc_dist.total assert all(compare(disc_dist2.keys_as_list(), [1, 2])) assert disc_dist2[1] == 28 assert disc_dist2[2] == 28 assert disc_dist2.probability(1) == 28 / 56 assert disc_dist2.probability(2) == 28 / 56 disc_dist2 = disc_dist.marginal("X1", "X3") assert disc_dist2.total == disc_dist.total assert all(compare(disc_dist2.keys_as_list(), ["x", "y"])) assert disc_dist2["x"] == 24 assert disc_dist2["y"] == 32 assert disc_dist2.probability("x") == 24 / 56 assert disc_dist2.probability("y") == 32 / 56 disc_dist2 = disc_dist.marginal("X2", "X3") assert disc_dist2.total == disc_dist.total assert all(compare(disc_dist2.keys_as_list(), ["a", "b"])) assert disc_dist2["a"] == 20 assert disc_dist2["b"] == 36 assert disc_dist2.probability("a") == 20 / 56 assert disc_dist2.probability("b") == 36 / 56 # Four levels dist. samples = { ("a", "x", 1, 33): 1, ("a", "x", 2, 33): 2, ("a", "x", 1, 44): 3, ("a", "x", 2, 44): 4, ("a", "y", 1, 33): 5, ("a", "y", 2, 33): 6, ("a", "y", 1, 44): 7, ("a", "y", 2, 44): 8, ("b", "x", 1, 33): 9, ("b", "x", 2, 33): 10, ("b", "x", 1, 44): 11, ("b", "x", 2, 44): 12, ("b", "y", 1, 33): 13, ("b", "y", 2, 33): 14, ("b", "y", 1, 44): 15, ("b", "y", 2, 44): 16, } disc_dist = DiscreteDistribution(samples) disc_dist2 = disc_dist.marginal("X3") assert disc_dist2.total == disc_dist.total assert all( compare( disc_dist2.keys_as_list(), [ ("a", "x", 33), ("a", "x", 44), ("a", "y", 33), ("a", "y", 44), ("b", "x", 33), ("b", "x", 44), ("b", "y", 33), ("b", "y", 44), ], ) ) assert disc_dist2[("a", "x", 33)] == 3 assert disc_dist2[("a", "x", 44)] == 7 assert disc_dist2[("a", "y", 33)] == 11 assert disc_dist2[("a", "y", 44)] == 15 assert disc_dist2[("b", "x", 33)] == 19 assert disc_dist2[("b", "x", 44)] == 23 assert disc_dist2[("b", "y", 33)] == 27 assert disc_dist2[("b", "y", 44)] == 31 assert disc_dist2.probability(("a", "x", 33)) == 3 / 136 assert disc_dist2.probability(("a", "x", 44)) == 7 / 136 assert disc_dist2.probability(("a", "y", 33)) == 11 / 136 assert disc_dist2.probability(("a", "y", 44)) == 15 / 136 assert disc_dist2.probability(("b", "x", 33)) == 19 / 136 assert disc_dist2.probability(("b", "x", 44)) == 23 / 136 assert disc_dist2.probability(("b", "y", 33)) == 27 / 136 assert disc_dist2.probability(("b", "y", 44)) == 31 / 136 disc_dist2 = disc_dist.marginal("X4") assert disc_dist2.total == disc_dist.total assert all( compare( disc_dist2.keys_as_list(), [ ("a", "x", 1), ("a", "x", 2), ("a", "y", 1), ("a", "y", 2), ("b", "x", 1), ("b", "x", 2), ("b", "y", 1), ("b", "y", 2), ], ) ) assert disc_dist2[("a", "x", 1)] == 4 assert disc_dist2[("a", "x", 2)] == 6 assert disc_dist2[("a", "y", 1)] == 12 assert disc_dist2[("a", "y", 2)] == 14 assert disc_dist2[("b", "x", 1)] == 20 assert disc_dist2[("b", "x", 2)] == 22 assert disc_dist2[("b", "y", 1)] == 28 assert disc_dist2[("b", "y", 2)] == 30 assert disc_dist2.probability(("a", "x", 1)) == 4 / 136 assert disc_dist2.probability(("a", "x", 2)) == 6 / 136 assert disc_dist2.probability(("a", "y", 1)) == 12 / 136 assert disc_dist2.probability(("a", "y", 2)) == 14 / 136 assert disc_dist2.probability(("b", "x", 1)) == 20 / 136 assert disc_dist2.probability(("b", "x", 2)) == 22 / 136 assert disc_dist2.probability(("b", "y", 1)) == 28 / 136 assert disc_dist2.probability(("b", "y", 2)) == 30 / 136 disc_dist2 = disc_dist.marginal("X1", "X4") assert disc_dist2.total == disc_dist.total assert all( compare(disc_dist2.keys_as_list(), [("x", 1), ("x", 2), ("y", 1), ("y", 2)]) ) assert disc_dist2[("x", 1)] == 24 assert disc_dist2[("x", 2)] == 28 assert disc_dist2[("y", 1)] == 40 assert disc_dist2[("y", 2)] == 44 assert disc_dist2.probability(("x", 1)) == 24 / 136 assert disc_dist2.probability(("x", 2)) == 28 / 136 assert disc_dist2.probability(("y", 1)) == 40 / 136 assert disc_dist2.probability(("y", 2)) == 44 / 136 disc_dist2 = disc_dist.marginal("X1", "X2", "X4") assert disc_dist2.total == disc_dist.total assert all(compare(disc_dist2.keys_as_list(), [1, 2])) assert disc_dist2[1] == 64 assert disc_dist2[2] == 72 assert disc_dist2.probability(1) == 64 / 136 assert disc_dist2.probability(2) == 72 / 136 # marginalize two times disc_dist2 = disc_dist.marginal("X1", "X4") disc_dist3 = disc_dist2.marginal("X2") assert disc_dist3.total == disc_dist.total assert all(compare(disc_dist3.keys_as_list(), [1, 2])) assert disc_dist3[1] == 64 assert disc_dist3[2] == 72 assert disc_dist3.probability(1) == 64 / 136 assert disc_dist3.probability(2) == 72 / 136 # marginalize three times disc_dist2 = disc_dist.marginal("X4") disc_dist3 = disc_dist2.marginal("X3") disc_dist4 = disc_dist3.marginal("X2") assert disc_dist4.total == disc_dist.total assert all(compare(disc_dist4.keys_as_list(), ["a", "b"])) assert disc_dist4["a"] == 36 assert disc_dist4["b"] == 100 assert disc_dist4.probability("a") == 36 / 136 assert disc_dist4.probability("b") == 100 / 136 def test_marginal_by_name_discrete_distribution(): # Four levels dist. samples = { ("a", "x", 1, 33): 1, ("a", "x", 2, 33): 2, ("a", "x", 1, 44): 3, ("a", "x", 2, 44): 4, ("a", "y", 1, 33): 5, ("a", "y", 2, 33): 6, ("a", "y", 1, 44): 7, ("a", "y", 2, 44): 8, ("b", "x", 1, 33): 9, ("b", "x", 2, 33): 10, ("b", "x", 1, 44): 11, ("b", "x", 2, 44): 12, ("b", "y", 1, 33): 13, ("b", "y", 2, 33): 14, ("b", "y", 1, 44): 15, ("b", "y", 2, 44): 16, } disc_dist = DiscreteDistribution(samples, names=["Age", "Sex", "Edu", "Etn"]) disc_dist2 = disc_dist.marginal("Edu") assert disc_dist2.total == disc_dist.total assert all( compare( disc_dist2.keys_as_list(), [ ("a", "x", 33), ("a", "x", 44), ("a", "y", 33), ("a", "y", 44), ("b", "x", 33), ("b", "x", 44), ("b", "y", 33), ("b", "y", 44), ], ) ) assert disc_dist2[("a", "x", 33)] == 3 assert disc_dist2[("a", "x", 44)] == 7 assert disc_dist2[("a", "y", 33)] == 11 assert disc_dist2[("a", "y", 44)] == 15 assert disc_dist2[("b", "x", 33)] == 19 assert disc_dist2[("b", "x", 44)] == 23 assert disc_dist2[("b", "y", 33)] == 27 assert disc_dist2[("b", "y", 44)] == 31 assert disc_dist2.probability(("a", "x", 33)) == 3 / 136 assert disc_dist2.probability(("a", "x", 44)) == 7 / 136 assert disc_dist2.probability(("a", "y", 33)) == 11 / 136 assert disc_dist2.probability(("a", "y", 44)) == 15 / 136 assert disc_dist2.probability(("b", "x", 33)) == 19 / 136 assert disc_dist2.probability(("b", "x", 44)) == 23 / 136 assert disc_dist2.probability(("b", "y", 33)) == 27 / 136 assert disc_dist2.probability(("b", "y", 44)) == 31 / 136 disc_dist2 = disc_dist.marginal("Etn") assert disc_dist2.total == disc_dist.total assert all( compare( disc_dist2.keys_as_list(), [ ("a", "x", 1), ("a", "x", 2), ("a", "y", 1), ("a", "y", 2), ("b", "x", 1), ("b", "x", 2), ("b", "y", 1), ("b", "y", 2), ], ) ) assert disc_dist2[("a", "x", 1)] == 4 assert disc_dist2[("a", "x", 2)] == 6 assert disc_dist2[("a", "y", 1)] == 12 assert disc_dist2[("a", "y", 2)] == 14 assert disc_dist2[("b", "x", 1)] == 20 assert disc_dist2[("b", "x", 2)] == 22 assert disc_dist2[("b", "y", 1)] == 28 assert disc_dist2[("b", "y", 2)] == 30 assert disc_dist2.probability(("a", "x", 1)) == 4 / 136 assert disc_dist2.probability(("a", "x", 2)) == 6 / 136 assert disc_dist2.probability(("a", "y", 1)) == 12 / 136 assert disc_dist2.probability(("a", "y", 2)) == 14 / 136 assert disc_dist2.probability(("b", "x", 1)) == 20 / 136 assert disc_dist2.probability(("b", "x", 2)) == 22 / 136 assert disc_dist2.probability(("b", "y", 1)) == 28 / 136 assert disc_dist2.probability(("b", "y", 2)) == 30 / 136 disc_dist2 = disc_dist.marginal("Age", "Etn") assert disc_dist2.total == disc_dist.total assert all( compare(disc_dist2.keys_as_list(), [("x", 1), ("x", 2), ("y", 1), ("y", 2)]) ) assert disc_dist2[("x", 1)] == 24 assert disc_dist2[("x", 2)] == 28 assert disc_dist2[("y", 1)] == 40 assert disc_dist2[("y", 2)] == 44 assert disc_dist2.probability(("x", 1)) == 24 / 136 assert disc_dist2.probability(("x", 2)) == 28 / 136 assert disc_dist2.probability(("y", 1)) == 40 / 136 assert disc_dist2.probability(("y", 2)) == 44 / 136 disc_dist2 = disc_dist.marginal("Age", "Sex", "Etn") assert disc_dist2.total == disc_dist.total assert all(compare(disc_dist2.keys_as_list(), [1, 2])) assert disc_dist2[1] == 64 assert disc_dist2[2] == 72 assert disc_dist2.probability(1) == 64 / 136 assert disc_dist2.probability(2) == 72 / 136 # marginalize two times disc_dist2 = disc_dist.marginal("Age", "Etn") disc_dist3 = disc_dist2.marginal("Sex") assert disc_dist3.total == disc_dist.total assert all(compare(disc_dist3.keys_as_list(), [1, 2])) assert disc_dist3[1] == 64 assert disc_dist3[2] == 72 assert disc_dist3.probability(1) == 64 / 136 assert disc_dist3.probability(2) == 72 / 136 # marginalize three times disc_dist2 = disc_dist.marginal("Etn") disc_dist3 = disc_dist2.marginal("Edu") disc_dist4 = disc_dist3.marginal("Sex") assert disc_dist4.total == disc_dist.total assert all(compare(disc_dist4.keys_as_list(), ["a", "b"])) assert disc_dist4["a"] == 36 assert disc_dist4["b"] == 100 assert disc_dist4.probability("a") == 36 / 136 assert disc_dist4.probability("b") == 100 / 136 def test_marginals_operator_discrete_distribution(): # Four levels dist. samples = { ("a", "x", 1, 33): 1, ("a", "x", 2, 33): 2, ("a", "x", 1, 44): 3, ("a", "x", 2, 44): 4, ("a", "y", 1, 33): 5, ("a", "y", 2, 33): 6, ("a", "y", 1, 44): 7, ("a", "y", 2, 44): 8, ("b", "x", 1, 33): 9, ("b", "x", 2, 33): 10, ("b", "x", 1, 44): 11, ("b", "x", 2, 44): 12, ("b", "y", 1, 33): 13, ("b", "y", 2, 33): 14, ("b", "y", 1, 44): 15, ("b", "y", 2, 44): 16, } disc_dist = DiscreteDistribution(samples) assert (disc_dist << "X2").total == disc_dist.total assert (disc_dist << ("X2", "X3")).total == disc_dist.total assert (disc_dist << ("X2", "X3", "X4")).total == disc_dist.total assert all(compare((disc_dist << ("X1", "X2", "X4")).keys_as_list(), [1, 2])) assert all(compare((disc_dist << ("X1", "X2", "X3")).keys_as_list(), [33, 44])) assert all(compare((disc_dist << ("X2", "X3", "X4")).keys_as_list(), ["a", "b"])) assert all( compare( (disc_dist << ("X2", "X3")).keys_as_list(), [("a", 33), ("a", 44), ("b", 33), ("b", 44)], ) ) disc_dist = DiscreteDistribution(samples, names=["Age", "Sex", "Education", "City"]) assert (disc_dist << ("Age")).total == disc_dist.total assert (disc_dist << ("Sex", "Education")).total == disc_dist.total assert (disc_dist << ("Sex", "Education", "City")).total == disc_dist.total assert all(compare((disc_dist << ("Age", "Sex", "City")).keys_as_list(), [1, 2])) assert all( compare((disc_dist << ("Age", "Sex", "Education")).keys_as_list(), [33, 44]) ) assert all( compare((disc_dist << ("Sex", "Education", "City")).keys_as_list(), ["a", "b"]) ) assert all( compare( (disc_dist << ("Sex", "Education")).keys_as_list(), [("a", 33), ("a", 44), ("b", 33), ("b", 44)], ) )

36.954145

88

0.528325

37b783f71694aab22c6f84fd108982fc8d7cc22a

57,744

py

Python

test/integration/component/test_ip_reservation.py

ke4qqq/cloudstack

7e0f1cf4571f9c3f6c26b8d744d2ed102fa7a511

[ "Apache-2.0" ]

1

2015-02-06T04:17:11.000Z

test/integration/component/test_ip_reservation.py

ke4qqq/cloudstack

7e0f1cf4571f9c3f6c26b8d744d2ed102fa7a511

[ "Apache-2.0" ]

6

2020-11-16T20:44:23.000Z

2022-02-01T01:06:16.000Z

test/integration/component/test_ip_reservation.py

ke4qqq/cloudstack

7e0f1cf4571f9c3f6c26b8d744d2ed102fa7a511

[ "Apache-2.0" ]

15

2017-01-12T11:17:48.000Z

2019-04-19T10:09:31.000Z

# Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. """ Tests for IP reservation feature Test Plan: https://cwiki.apache.org/confluence/display/CLOUDSTACK/IP+Range+Reservation+within+a+Network+Test+Cases Issue Link: https://issues.apache.org/jira/browse/CLOUDSTACK-2266 Feature Specifications: https://cwiki.apache.org/confluence/display/CLOUDSTACK/FS+-+IP+Range+Reservation+within+a+Network """ from marvin.cloudstackTestCase import cloudstackTestCase, unittest from marvin.lib.utils import validateList, cleanup_resources, verifyRouterState from marvin.lib.base import (Account, Network, VirtualMachine, Router, ServiceOffering, NetworkOffering) from marvin.lib.common import (get_zone, get_template, get_domain, wait_for_cleanup, createEnabledNetworkOffering, createNetworkRulesForVM, verifyNetworkState) from marvin.codes import (PASS, FAIL, FAILED, UNKNOWN, FAULT, MASTER, NAT_RULE, STATIC_NAT_RULE) import netaddr import random from nose.plugins.attrib import attr from ddt import ddt, data def createIsolatedNetwork(self, network_offering_id, gateway=None): """Create isolated network with given network offering and gateway if provided and return""" try: isolated_network = Network.create(self.apiclient, self.testData["isolated_network"], networkofferingid=network_offering_id,accountid=self.account.name, domainid=self.domain.id,zoneid=self.zone.id, gateway=gateway, netmask='255.255.255.0' if gateway else None) except Exception as e: return [FAIL, e] return [PASS, isolated_network] def matchNetworkGuestVmCIDR(self, networkid, guestvmcidr): """List networks with given network id and check if the guestvmcidr matches with the given cidr""" networks = Network.list(self.apiclient, id=networkid, listall=True) self.assertEqual(validateList(networks)[0], PASS, "network list validation failed") self.assertEqual(str(networks[0].cidr), guestvmcidr, "guestvmcidr of network %s \ does not match with the given value %s" % (networks[0].cidr, guestvmcidr)) return def createVirtualMachine(self, network_id=None, ip_address=None): """Create and return virtual machine within network and ipaddress""" virtual_machine = VirtualMachine.create(self.apiclient, self.testData["virtual_machine"], networkids=network_id, serviceofferingid=self.service_offering.id, accountid=self.account.name, domainid=self.domain.id, ipaddress=ip_address) return virtual_machine def CreateEnabledNetworkOffering(apiclient, networkServices): """Create network offering of given test data and enable it""" result = createEnabledNetworkOffering(apiclient, networkServices) assert result[0] == PASS, "Network offering creation/enabling failed due to %s" % result[2] return result[1] @ddt class TestIpReservation(cloudstackTestCase): """Test IP Range Reservation with a Network """ @classmethod def setUpClass(cls): cls.testClient = super(TestIpReservation, cls).getClsTestClient() cls.api_client = cls.testClient.getApiClient() # Fill services from the external config file cls.testData = cls.testClient.getParsedTestDataConfig() # Get Zone, Domain and templates cls.domain = get_domain(cls.api_client) cls.zone = get_zone(cls.api_client, cls.testClient.getZoneForTests()) cls.template = get_template( cls.api_client, cls.zone.id, cls.testData["ostype"] ) if cls.template == FAILED: assert False, "get_template() failed to return template with description %s" % cls.testData["ostype"] cls.testData["domainid"] = cls.domain.id cls.testData["zoneid"] = cls.zone.id cls.testData["virtual_machine"]["zoneid"] = cls.zone.id cls.testData["virtual_machine"]["template"] = cls.template.id cls._cleanup = [] try: cls.service_offering = ServiceOffering.create( cls.api_client, cls.testData["service_offering"] ) cls._cleanup.append(cls.service_offering) cls.isolated_network_offering = CreateEnabledNetworkOffering(cls.api_client, cls.testData["isolated_network_offering"]) cls._cleanup.append(cls.isolated_network_offering) cls.isolated_persistent_network_offering = CreateEnabledNetworkOffering(cls.api_client, cls.testData["nw_off_isolated_persistent"]) cls._cleanup.append(cls.isolated_persistent_network_offering) cls.isolated_network_offering_RVR = CreateEnabledNetworkOffering(cls.api_client, cls.testData["nw_off_isolated_RVR"]) cls._cleanup.append(cls.isolated_network_offering_RVR) except Exception as e: cls.tearDownClass() raise unittest.SkipTest("Failure in setUpClass: %s" % e) return @classmethod def tearDownClass(cls): try: # Cleanup resources used cleanup_resources(cls.api_client, cls._cleanup) except Exception as e: raise Exception("Warning: Exception during cleanup : %s" % e) return def setUp(self): self.apiclient = self.testClient.getApiClient() self.dbclient = self.testClient.getDbConnection() self.cleanup = [] try: self.account = Account.create(self.apiclient, self.testData["account"], domainid=self.domain.id) self.cleanup.append(self.account) except Exception as e: self.skipTest("Failed to create account: %s" % e) return def tearDown(self): try: # Clean up, terminate the resources created cleanup_resources(self.apiclient, self.cleanup) except Exception as e: raise Exception("Warning: Exception during cleanup : %s" % e) return @attr(tags=["advanced"]) def test_vm_create_after_reservation(self): """ Test creating VM in network after IP reservation # steps # 1. Create vm in isolated network (LB through VR or Netscaler) with ip in guestvmcidr # 2. Update guestvmcidr # 3. Create another VM # validation # 1. Guest vm cidr should be successfully updated with correct value # 2. Existing guest vm ip should not be changed after reservation # 3. Newly created VM should get ip in guestvmcidr""" networkOffering = self.isolated_network_offering subnet = "10.1."+str(random.randrange(1,254)) gateway = subnet +".1" resultSet = createIsolatedNetwork(self, networkOffering.id, gateway=gateway) if resultSet[0] == FAIL: self.fail("Failed to create isolated network") else: isolated_network = resultSet[1] guest_vm_cidr = subnet +".0/29" try: virtual_machine_1 = createVirtualMachine(self, network_id=isolated_network.id, ip_address = subnet+".3") except Exception as e: self.fail("VM creation failed: %s" % e) isolated_network.update(self.apiclient, guestvmcidr=guest_vm_cidr) matchNetworkGuestVmCIDR(self, isolated_network.id, guest_vm_cidr) vms = VirtualMachine.list(self.apiclient, id=virtual_machine_1.id) self.assertEqual(validateList(vms)[0], PASS, "vm list validation failed") self.assertEqual(vms[0].nic[0].ipaddress, virtual_machine_1.ipaddress, "VM IP should not change after reservation") try: virtual_machine_2 = createVirtualMachine(self, network_id=isolated_network.id) if netaddr.IPAddress(virtual_machine_2.ipaddress) not in netaddr.IPNetwork(guest_vm_cidr): self.fail("Newly created VM doesn't get IP from reserverd CIDR") except Exception as e: self.fail("VM creation failed, cannot validate the condition: %s" % e) return @attr(tags=["advanced"]) def test_vm_create_outside_cidr_after_reservation(self): """ Test create VM outside the range of reserved IPs # steps # 1. update guestvmcidr of persistent isolated network (LB through VR or # Netscaler # 2. create another VM with ip outside guestvmcidr """ # validation # 1. guest vm cidr should be successfully updated with correct value # 2 newly created VM should not be created and result in exception networkOffering = self.isolated_persistent_network_offering subnet = "10.1."+str(random.randrange(1,254)) gateway = subnet +".1" resultSet = createIsolatedNetwork(self, networkOffering.id, gateway=gateway) if resultSet[0] == FAIL: self.fail("Failed to create isolated network") else: isolated_network = resultSet[1] guest_vm_cidr = subnet+".0/29" isolated_network.update(self.apiclient, guestvmcidr=guest_vm_cidr) matchNetworkGuestVmCIDR(self, isolated_network.id, guest_vm_cidr) try: createVirtualMachine(self, network_id=self.isolated_network.id, ip_address=subnet+".9") self.fail("vm should not be created ") except Exception as e: self.debug("exception as IP is outside of guestvmcidr %s" % e) return @attr(tags=["advanced"]) def test_update_cidr_multiple_vms_not_all_inclusive(self): """ Test reserve IP range such that one of the VM is not included # steps # 1. Create two vms in isolated network # 2. Update guestvmcidr of network such that only one of the ipaddress of vms # is in the given range # validation # 1. Network updation with this new range should fail""" subnet = "10.1."+str(random.randrange(1,254)) gateway = subnet +".1" resultSet = createIsolatedNetwork(self, self.isolated_network_offering.id, gateway=gateway) if resultSet[0] == FAIL: self.fail("Failed to create isolated network") else: isolated_network = resultSet[1] guest_vm_cidr = subnet+".0/29" try: createVirtualMachine(self, network_id=isolated_network.id, ip_address=subnet+".3") except Exception as e: self.fail("VM creation failed: %s" % e) try: createVirtualMachine(self, network_id=isolated_network.id, ip_address=subnet+".9") except Exception as e: self.fail("VM creation failed: %s" % e) with self.assertRaises(Exception): isolated_network.update(self.apiclient, guestvmcidr=guest_vm_cidr) return @attr(tags=["advanced"]) def test_update_cidr_single_vm_not_inclusive(self): """ Test reserving IP range in network such that existing VM is outside the range # steps # 1. Create vm in isolated network # 2. Update guestvmcidr of network such that ip address of vm # is outside the given range # # validation # 1. Network updation with this new range should fail""" subnet = "10.1."+str(random.randrange(1,254)) gateway = subnet +".1" resultSet = createIsolatedNetwork(self, self.isolated_network_offering.id, gateway=gateway) if resultSet[0] == FAIL: self.fail("Failed to create isolated network") else: isolated_network = resultSet[1] guest_vm_cidr = subnet+".0/29" try: createVirtualMachine(self, network_id=isolated_network.id, ip_address=subnet+".9") except Exception as e: self.fail("VM creation failed: %s" % e) with self.assertRaises(Exception): isolated_network.update(self.apiclient, guestvmcidr=guest_vm_cidr) return @data(NAT_RULE, STATIC_NAT_RULE) @attr(tags=["advanced"]) def test_nat_rules(self, value): """ Test NAT rules working with IP reservation # steps # 1. Create vm in persistent isolated network with ip in guestvmcidr # 2. Create NAT/static NAT rule for this VM # 3. Update guestvmcidr # 4. Create another VM and create network rules for this vm too # # validation # 1. Guest vm cidr should be successfully updated with correct value # 2. Existing guest vm ip should not be changed after reservation # 3. Newly created VM should get ip in guestvmcidr # 4. The network rules should be working""" subnet = "10.1."+str(random.randrange(1,254)) gateway = subnet +".1" resultSet = createIsolatedNetwork(self, self.isolated_network_offering.id, gateway=gateway) if resultSet[0] == FAIL: self.fail("Failed to create isolated network") else: isolated_network = resultSet[1] guest_vm_cidr = subnet+".0/29" try: virtual_machine_1 = createVirtualMachine(self, network_id=isolated_network.id, ip_address=subnet+".3") except Exception as e: self.fail("VM creation failed: %s" % e) result = createNetworkRulesForVM(self.apiclient, virtual_machine_1,value, self.account, self.testData) if result[0] == FAIL: self.fail("Failed to create network rules for VM: %s" % result[1]) else: ipaddress_1 = result[1] virtual_machine_1.get_ssh_client(ipaddress=ipaddress_1.ipaddress.ipaddress) isolated_network.update(self.apiclient, guestvmcidr=guest_vm_cidr) matchNetworkGuestVmCIDR(self, isolated_network.id, guest_vm_cidr) vms = VirtualMachine.list(self.apiclient, id=virtual_machine_1.id) self.assertEqual(validateList(vms)[0], PASS, "vm list validation failed") self.assertEqual(vms[0].nic[0].ipaddress, virtual_machine_1.ipaddress, "VM IP should not change after reservation") try: virtual_machine_2 = createVirtualMachine(self, network_id=isolated_network.id) if netaddr.IPAddress(virtual_machine_2.ipaddress) not in netaddr.IPNetwork(guest_vm_cidr): self.fail("Newly created VM doesn't get IP from reserverd CIDR") except Exception as e: self.fail("VM creation failed, cannot validate the condition: %s" % e) result = createNetworkRulesForVM(self.apiclient, virtual_machine_2, value, self.account, self.testData) if result[0] == FAIL: self.fail("Failed to create network rules for VM: %s" % result[1]) else: ipaddress_2 = result[1] virtual_machine_2.get_ssh_client(ipaddress=ipaddress_2.ipaddress.ipaddress) return @unittest.skip("Skip - WIP") @attr(tags=["advanced"]) def test_RVR_network(self): """ Test IP reservation in network with RVR # steps # 1. create vm in isolated network with RVR and ip in guestvmcidr # 2. update guestvmcidr # 3. List routers and stop the master router, wait till backup router comes up # 4. create another VM # # validation # 1. Guest vm cidr should be successfully updated with correct value # 2. Existing guest vm ip should not be changed after reservation # 3. Newly created VM should get ip in guestvmcidr # 4. Verify that the network has two routers associated with it # 5. Backup router should come up when master router is stopped""" subnet = "10.1."+str(random.randrange(1,254)) gateway = subnet +".1" resultSet = createIsolatedNetwork(self, self.isolated_network_offering_RVR.id, gateway=gateway) if resultSet[0] == FAIL: self.fail("Failed to create isolated network") else: isolated_network_RVR= resultSet[1] guest_vm_cidr = subnet+".0/29" try: virtual_machine_1 = createVirtualMachine(self, network_id=isolated_network_RVR.id, ip_address=subnet+".3") except Exception as e: self.fail("VM creation failed: %s" % e) isolated_network_RVR.update(self.apiclient, guestvmcidr=guest_vm_cidr) matchNetworkGuestVmCIDR(self, isolated_network_RVR.id, guest_vm_cidr) vms = VirtualMachine.list(self.apiclient, id=virtual_machine_1.id) self.assertEqual(validateList(vms)[0], PASS, "vm list validation failed") self.assertEqual(vms[0].nic[0].ipaddress, virtual_machine_1.ipaddress, "VM IP should not change after reservation") self.debug("Listing routers for network: %s" % isolated_network_RVR.name) routers = Router.list(self.apiclient, networkid=isolated_network_RVR.id, listall=True) self.assertEqual(validateList(routers)[0], PASS, "Routers list validation failed") self.assertEqual(len(routers), 2, "Length of the list router should be 2 (Backup & master)") if routers[0].redundantstate == MASTER: master_router = routers[0] backup_router = routers[1] else: master_router = routers[1] backup_router = routers[0] self.debug("Stopping router ID: %s" % master_router.id) try: Router.stop(self.apiclient, id=master_router.id) except Exception as e: self.fail("Failed to stop master router due to error %s" % e) # wait for VR to update state wait_for_cleanup(self.apiclient, ["router.check.interval"]) result = verifyRouterState(master_router.id, [UNKNOWN,FAULT]) if result[0] == FAIL: self.fail(result[1]) result = verifyRouterState(backup_router.id, [MASTER]) if result[0] == FAIL: self.fail(result[1]) try: virtual_machine_2 = createVirtualMachine(self, network_id=isolated_network_RVR.id) if netaddr.IPAddress(virtual_machine_2.ipaddress) not in netaddr.IPNetwork(guest_vm_cidr): self.fail("Newly created VM doesn't get IP from reserverd CIDR") except Exception as e: self.fail("VM creation failed, cannot validate the condition: %s" % e) return @attr(tags=["advanced"]) def test_ip_reservation_in_multiple_networks_same_account(self): """ Test IP reservation in multiple networks created in same account # steps # 1. Create two isolated networks with user defined cidr in same account # Test below conditions for both the networks in the account # 2. Create vm in persistent isolated network with ip in guestvmcidr # 3. Update guestvmcidr # 4. Create another VM # # validation # 1. Guest vm cidr should be successfully updated with correct value # 2. Existing guest vm ip should not be changed after reservation # 3. Newly created VM should get ip in guestvmcidr""" account_1 = Account.create(self.apiclient, self.testData["account"], domainid=self.domain.id) self.cleanup.append(account_1) random_subnet = str(random.randrange(1,254)) gateway = "10.1." + random_subnet +".1" isolated_network_1 = Network.create(self.apiclient, self.testData["isolated_network"], networkofferingid=self.isolated_network_offering.id,accountid=account_1.name, domainid=self.domain.id,zoneid=self.zone.id, gateway=gateway, netmask='255.255.255.0') guest_vm_cidr = "10.1."+random_subnet+".0/29" try: virtual_machine_1 = VirtualMachine.create(self.apiclient, self.testData["virtual_machine"], networkids=isolated_network_1.id, serviceofferingid=self.service_offering.id, accountid=account_1.name, domainid=self.domain.id, ipaddress="10.1."+random_subnet+".3") except Exception as e: self.fail("VM creation failed: %s" % e) isolated_network_1.update(self.apiclient, guestvmcidr=guest_vm_cidr) matchNetworkGuestVmCIDR(self, isolated_network_1.id, guest_vm_cidr) vms = VirtualMachine.list(self.apiclient, id=virtual_machine_1.id) self.assertEqual(validateList(vms)[0], PASS, "vm list validation failed") self.assertEqual(vms[0].nic[0].ipaddress, virtual_machine_1.ipaddress, "VM IP should not change after reservation") try: virtual_machine_2 = VirtualMachine.create(self.apiclient, self.testData["virtual_machine"], networkids=isolated_network_1.id, serviceofferingid=self.service_offering.id, accountid=account_1.name, domainid=self.domain.id) if netaddr.IPAddress(virtual_machine_2.ipaddress) not in netaddr.IPNetwork(guest_vm_cidr): self.fail("Newly created VM doesn't get IP from reserverd CIDR") except Exception as e: self.fail("VM creation failed, cannot validate the condition: %s" % e) random_subnet = str(random.randrange(1,254)) gateway = "10.1." + random_subnet +".1" isolated_network_2 = Network.create(self.apiclient, self.testData["isolated_network"], networkofferingid=self.isolated_network_offering.id,accountid=account_1.name, domainid=self.domain.id,zoneid=self.zone.id, gateway=gateway, netmask='255.255.255.0') guest_vm_cidr = "10.1."+random_subnet+".0/29" try: virtual_machine_3 = VirtualMachine.create(self.apiclient, self.testData["virtual_machine"], networkids=isolated_network_2.id, serviceofferingid=self.service_offering.id, accountid=account_1.name, domainid=self.domain.id, ipaddress="10.1."+random_subnet+".3") except Exception as e: self.fail("VM creation failed: %s" % e) isolated_network_2.update(self.apiclient, guestvmcidr=guest_vm_cidr) matchNetworkGuestVmCIDR(self, isolated_network_2.id, guest_vm_cidr) vms = VirtualMachine.list(self.apiclient, id=virtual_machine_3.id) self.assertEqual(validateList(vms)[0], PASS, "vm list validation failed") self.assertEqual(vms[0].nic[0].ipaddress, virtual_machine_3.ipaddress, "VM IP should not change after reservation") try: virtual_machine_4 = VirtualMachine.create(self.apiclient, self.testData["virtual_machine"], networkids=isolated_network_2.id, serviceofferingid=self.service_offering.id, accountid=account_1.name, domainid=self.domain.id) if netaddr.IPAddress(virtual_machine_4.ipaddress) not in netaddr.IPNetwork(guest_vm_cidr): self.fail("Newly created VM doesn't get IP from reserverd CIDR") except Exception as e: self.fail("VM creation failed, cannot validate the condition: %s" % e) return @ddt class TestRestartNetwork(cloudstackTestCase): """Test Restart Network """ @classmethod def setUpClass(cls): cls.testClient = super(TestRestartNetwork, cls).getClsTestClient() cls.api_client = cls.testClient.getApiClient() # Fill services from the external config file cls.testData = cls.testClient.getParsedTestDataConfig() # Get Zone, Domain and templates cls.domain = get_domain(cls.api_client) cls.zone = get_zone(cls.api_client, cls.testClient.getZoneForTests()) cls.template = get_template( cls.api_client, cls.zone.id, cls.testData["ostype"] ) if cls.template == FAILED: assert False, "get_template() failed to return template with description %s" % cls.testData["ostype"] cls.testData["domainid"] = cls.domain.id cls.testData["zoneid"] = cls.zone.id cls.testData["virtual_machine"]["zoneid"] = cls.zone.id cls.testData["virtual_machine"]["template"] = cls.template.id cls._cleanup = [] try: cls.service_offering = ServiceOffering.create( cls.api_client, cls.testData["service_offering"] ) cls._cleanup.append(cls.service_offering) cls.isolated_network_offering = CreateEnabledNetworkOffering(cls.api_client, cls.testData["isolated_network_offering"]) cls._cleanup.append(cls.isolated_network_offering) cls.isolated_persistent_network_offering = CreateEnabledNetworkOffering(cls.api_client, cls.testData["nw_off_isolated_persistent"]) cls._cleanup.append(cls.isolated_persistent_network_offering) except Exception as e: cls.tearDownClass() raise unittest.SkipTest("Failure in setUpClass: %s" % e) return @classmethod def tearDownClass(cls): try: # Cleanup resources used cleanup_resources(cls.api_client, cls._cleanup) except Exception as e: raise Exception("Warning: Exception during cleanup : %s" % e) return def setUp(self): self.apiclient = self.testClient.getApiClient() self.dbclient = self.testClient.getDbConnection() self.cleanup = [] try: self.account = Account.create(self.apiclient, self.testData["account"], domainid=self.domain.id) self.cleanup.append(self.account) except Exception as e: self.skipTest("Failed to create account: %s" % e) return def tearDown(self): try: # Clean up, terminate the resources created cleanup_resources(self.apiclient, self.cleanup) except Exception as e: raise Exception("Warning: Exception during cleanup : %s" % e) return @data(True, False) @attr(tags=["advanced"]) def test_restart_network_with_cleanup(self, value): """ Test IP reservation rules with network restart operation # steps # 1. Create vm in isolated network with ip in guestvmcidr # 2. Update guestvmcidr # 3. Restart network with cleanup True/False # 4. Deploy another VM in the network # # validation # 1. Guest vm cidr should be successfully updated with correct value # 2. Existing guest vm ip should not be changed after reservation # 3. Network should be restarted successfully with and without cleanup # 4. Newly created VM should get ip in guestvmcidr""" subnet = "10.1."+str(random.randrange(1,254)) gateway = subnet +".1" resultSet = createIsolatedNetwork(self, self.isolated_network_offering.id, gateway=gateway) if resultSet[0] == FAIL: self.fail("Failed to create isolated network") else: isolated_network= resultSet[1] guest_vm_cidr = subnet+".0/29" try: virtual_machine_1 = createVirtualMachine(self, network_id=isolated_network.id, ip_address=subnet+".3") except Exception as e: self.fail("VM creation failed: %s" % e) isolated_network.update(self.apiclient, guestvmcidr=guest_vm_cidr) matchNetworkGuestVmCIDR(self, isolated_network.id, guest_vm_cidr) vms = VirtualMachine.list(self.apiclient, id=virtual_machine_1.id) self.assertEqual(validateList(vms)[0], PASS, "vm list validation failed") self.assertEqual(vms[0].nic[0].ipaddress, virtual_machine_1.ipaddress, "VM IP should not change after reservation") #Restart Network isolated_network.restart(self.apiclient, cleanup=value) try: virtual_machine_2 = createVirtualMachine(self, network_id=isolated_network.id) if netaddr.IPAddress(virtual_machine_2.ipaddress) not in netaddr.IPNetwork(guest_vm_cidr): self.fail("Newly created VM doesn't get IP from reserverd CIDR") except Exception as e: self.fail("VM creation failed, cannot validate the condition: %s" % e) return @ddt class TestUpdateIPReservation(cloudstackTestCase): """Test Updating IP reservation multiple times """ @classmethod def setUpClass(cls): cls.testClient = super(TestUpdateIPReservation, cls).getClsTestClient() cls.api_client = cls.testClient.getApiClient() # Fill services from the external config file cls.testData = cls.testClient.getParsedTestDataConfig() # Get Zone, Domain and templates cls.domain = get_domain(cls.api_client) cls.zone = get_zone(cls.api_client, cls.testClient.getZoneForTests()) cls.template = get_template( cls.api_client, cls.zone.id, cls.testData["ostype"] ) if cls.template == FAILED: assert False, "get_template() failed to return template with description %s" % cls.testData["ostype"] cls.testData["domainid"] = cls.domain.id cls.testData["zoneid"] = cls.zone.id cls.testData["virtual_machine"]["zoneid"] = cls.zone.id cls.testData["virtual_machine"]["template"] = cls.template.id cls._cleanup = [] try: cls.service_offering = ServiceOffering.create( cls.api_client, cls.testData["service_offering"] ) cls._cleanup.append(cls.service_offering) cls.isolated_network_offering = CreateEnabledNetworkOffering(cls.api_client, cls.testData["isolated_network_offering"]) cls._cleanup.append(cls.isolated_network_offering) cls.isolated_persistent_network_offering = CreateEnabledNetworkOffering(cls.api_client, cls.testData["nw_off_isolated_persistent"]) cls._cleanup.append(cls.isolated_persistent_network_offering) except Exception as e: cls.tearDownClass() raise unittest.SkipTest("Failure in setUpClass: %s" % e) return @classmethod def tearDownClass(cls): try: # Cleanup resources used cleanup_resources(cls.api_client, cls._cleanup) except Exception as e: raise Exception("Warning: Exception during cleanup : %s" % e) return def setUp(self): self.apiclient = self.testClient.getApiClient() self.dbclient = self.testClient.getDbConnection() self.cleanup = [] try: self.account = Account.create(self.apiclient, self.testData["account"], domainid=self.domain.id) self.cleanup.append(self.account) except Exception as e: self.skipTest("Failed to create account: %s" % e) return def tearDown(self): try: # Clean up, terminate the resources created cleanup_resources(self.apiclient, self.cleanup) except Exception as e: raise Exception("Warning: Exception during cleanup : %s" % e) return @data("existingVmInclusive", "existingVmExclusive") @attr(tags=["advanced"]) def test_update_network_guestvmcidr(self, value): """ Test updating guest vm cidr of the network after VMs are already deployed in previous guest VM cidr # steps # 1. Create isolated network with user defined cidr # 2. Deploy VM in the network # 3. Try to update the guestvmcidr of the network with VM ip in the guestvmcidr and # deploy another VM # 4. Try to update the guestvmcidr of the network with VM ip outside the guestvmcidr # # validation # 1. When vm IP is in the guestvmcidr, updation should be successful and # new VM should get IP from this range # 2. When VM IP is outside the guestvmcidr, updation should be unsuccessful""" random_subnet = str(random.randrange(1,254)) gateway = "10.1." + random_subnet +".1" resultSet = createIsolatedNetwork(self, self.isolated_network_offering.id, gateway=gateway) if resultSet[0] == FAIL: self.fail("Failed to create isolated network") else: isolated_network= resultSet[1] guest_vm_cidr = "10.1."+random_subnet+".0/29" try: virtual_machine_1 = createVirtualMachine(self, network_id=isolated_network.id, ip_address=u"10.1."+random_subnet+".3") except Exception as e: self.fail("VM creation failed: %s" % e) isolated_network.update(self.apiclient, guestvmcidr=guest_vm_cidr) matchNetworkGuestVmCIDR(self, isolated_network.id, guest_vm_cidr) vms = VirtualMachine.list(self.apiclient, id=virtual_machine_1.id) self.assertEqual(validateList(vms)[0], PASS, "vm list validation failed") self.assertEqual(vms[0].nic[0].ipaddress, virtual_machine_1.ipaddress, "VM IP should not change after reservation") try: virtual_machine_2 = createVirtualMachine(self, network_id=isolated_network.id) if netaddr.IPAddress(virtual_machine_2.ipaddress) not in netaddr.IPNetwork(guest_vm_cidr): self.fail("Newly created VM doesn't get IP from reserverd CIDR") except Exception as e: self.fail("VM creation failed, cannot validate the condition: %s" % e) # Update guest vm cidr of network again if value == "existingVmExclusive": guest_vm_cidr = "10.1."+random_subnet+".10/29" try: isolated_network.update(self.apiclient, guestvmcidr=guest_vm_cidr) self.fail("Network updation should fail") except Exception as e: self.debug("Failed to update guest VM cidr of network: %s" % e) elif value == "existingVmInclusive": guest_vm_cidr = "10.1."+random_subnet+".0/28" try: isolated_network.update(self.apiclient, guestvmcidr=guest_vm_cidr) except Exception as e: self.fail("Failed to update guest VM cidr of network: %s" % e) matchNetworkGuestVmCIDR(self, isolated_network.id, guest_vm_cidr) try: virtual_machine_3 = createVirtualMachine(self, network_id=isolated_network.id) if netaddr.IPAddress(virtual_machine_3.ipaddress) not in netaddr.IPNetwork(guest_vm_cidr): self.fail("Newly created VM doesn't get IP from reserverd CIDR") except Exception as e: self.fail("VM creation failed, cannot validate the condition: %s" % e) return @ddt class TestRouterOperations(cloudstackTestCase): """Test Router operations of network with IP reservation """ @classmethod def setUpClass(cls): cls.testClient = super(TestRouterOperations, cls).getClsTestClient() cls.api_client = cls.testClient.getApiClient() # Fill services from the external config file cls.testData = cls.testClient.getParsedTestDataConfig() # Get Zone, Domain and templates cls.domain = get_domain(cls.api_client) cls.zone = get_zone(cls.api_client, cls.testClient.getZoneForTests()) cls.template = get_template( cls.api_client, cls.zone.id, cls.testData["ostype"] ) if cls.template == FAILED: assert False, "get_template() failed to return template with description %s" % cls.testData["ostype"] cls.testData["domainid"] = cls.domain.id cls.testData["zoneid"] = cls.zone.id cls.testData["virtual_machine"]["zoneid"] = cls.zone.id cls.testData["virtual_machine"]["template"] = cls.template.id cls._cleanup = [] try: cls.service_offering = ServiceOffering.create( cls.api_client, cls.testData["service_offering"] ) cls._cleanup.append(cls.service_offering) cls.isolated_network_offering = CreateEnabledNetworkOffering(cls.api_client, cls.testData["isolated_network_offering"]) cls._cleanup.append(cls.isolated_network_offering) cls.isolated_persistent_network_offering = CreateEnabledNetworkOffering(cls.api_client, cls.testData["nw_off_isolated_persistent"]) cls._cleanup.append(cls.isolated_persistent_network_offering) except Exception as e: cls.tearDownClass() raise unittest.SkipTest("Failure in setUpClass: %s" % e) return @classmethod def tearDownClass(cls): try: # Cleanup resources used cleanup_resources(cls.api_client, cls._cleanup) except Exception as e: raise Exception("Warning: Exception during cleanup : %s" % e) return def setUp(self): self.apiclient = self.testClient.getApiClient() self.dbclient = self.testClient.getDbConnection() self.cleanup = [] try: self.account = Account.create(self.apiclient, self.testData["account"], domainid=self.domain.id) self.cleanup.append(self.account) except Exception as e: self.skipTest("Failed to create account: %s" % e) return def tearDown(self): try: # Clean up, terminate the resources created cleanup_resources(self.apiclient, self.cleanup) except Exception as e: raise Exception("Warning: Exception during cleanup : %s" % e) return @attr(tags=["advanced"]) def test_reservation_after_router_restart(self): """ Test IP reservation working before and after router is restarted # steps # 1. Update guestvmcidr of persistent isolated network # 2. Reboot router # # validation # 1. Guest vm cidr should be successfully updated with correct value # 2. Network cidr should remain same after router restart""" subnet = "10.1."+str(random.randrange(1,254)) gateway = subnet +".1" resultSet = createIsolatedNetwork(self, self.isolated_persistent_network_offering.id, gateway=gateway) if resultSet[0] == FAIL: self.fail("Failed to create isolated network") else: isolated_network= resultSet[1] guest_vm_cidr = subnet+".0/29" isolated_network.update(self.apiclient, guestvmcidr=guest_vm_cidr) matchNetworkGuestVmCIDR(self, isolated_network.id, guest_vm_cidr) routers = Router.list(self.apiclient, networkid=isolated_network.id, listall=True) self.assertEqual(validateList(routers)[0], PASS, "routers list validation failed") if not routers: self.fail("Router list should not be empty") Router.reboot(self.apiclient, routers[0].id) networks = Network.list(self.apiclient, id=isolated_network.id) self.assertEqual(validateList(networks)[0], PASS, "networks list validation failed") self.assertEqual(networks[0].cidr, guest_vm_cidr, "guestvmcidr should match after router reboot") return @attr(tags=["advanced"]) def test_destroy_recreate_router(self): """ Test IP reservation working after destroying and recreating router # steps # 1. Create isolated network and deploy VM in it and update network with # guestvmcidr # 2. List the router associated with network and destroy the router # 3. Restart the network # 3. Deploy another VM in the network # # validation # 1. Guest vm cidr should be successfully updated with correct value # 2. existing guest vm ip should not be changed after reservation # 3. Router should be destroyed and recreated when network is restarted # 4. New VM should be deployed in the guestvmcidr""" subnet = "10.1."+str(random.randrange(1,254)) gateway = subnet +".1" resultSet = createIsolatedNetwork(self, self.isolated_network_offering.id, gateway=gateway) if resultSet[0] == FAIL: self.fail("Failed to create isolated network") else: isolated_network= resultSet[1] guest_vm_cidr = subnet+".0/29" try: virtual_machine_1 = createVirtualMachine(self, network_id=isolated_network.id, ip_address=subnet+".3") except Exception as e: self.fail("VM creation failed: %s" % e) isolated_network.update(self.apiclient, guestvmcidr=guest_vm_cidr) matchNetworkGuestVmCIDR(self, isolated_network.id, guest_vm_cidr) vms = VirtualMachine.list(self.apiclient, id=virtual_machine_1.id) self.assertEqual(validateList(vms)[0], PASS, "vm list validation failed") self.assertEqual(vms[0].nic[0].ipaddress, virtual_machine_1.ipaddress, "VM IP should not change after reservation") # List router and destroy it routers = Router.list(self.apiclient, networkid=isolated_network.id, listall=True) self.assertEqual(validateList(routers)[0], PASS, "Routers list validation failed") # Destroy Router Router.destroy(self.apiclient, id=routers[0].id) #Restart Network isolated_network.restart(self.apiclient) try: virtual_machine_2 = createVirtualMachine(self, network_id=isolated_network.id) if netaddr.IPAddress(virtual_machine_2.ipaddress) not in netaddr.IPNetwork(guest_vm_cidr): self.fail("Newly created VM doesn't get IP from reserverd CIDR") except Exception as e: self.fail("VM creation failed, cannot validate the condition: %s" % e) return @ddt class TestFailureScnarios(cloudstackTestCase): """Test failure scenarios related to IP reservation in network """ @classmethod def setUpClass(cls): cls.testClient = super(TestFailureScnarios, cls).getClsTestClient() cls.api_client = cls.testClient.getApiClient() # Fill services from the external config file cls.testData = cls.testClient.getParsedTestDataConfig() # Get Zone, Domain and templates cls.domain = get_domain(cls.api_client) cls.zone = get_zone(cls.api_client, cls.testClient.getZoneForTests()) cls.template = get_template( cls.api_client, cls.zone.id, cls.testData["ostype"] ) if cls.template == FAILED: assert False, "get_template() failed to return template with description %s" % cls.testData["ostype"] cls.testData["domainid"] = cls.domain.id cls.testData["zoneid"] = cls.zone.id cls.testData["virtual_machine"]["zoneid"] = cls.zone.id cls.testData["virtual_machine"]["template"] = cls.template.id cls._cleanup = [] try: cls.service_offering = ServiceOffering.create( cls.api_client, cls.testData["service_offering"] ) cls._cleanup.append(cls.service_offering) cls.isolated_network_offering = CreateEnabledNetworkOffering(cls.api_client, cls.testData["isolated_network_offering"]) cls._cleanup.append(cls.isolated_network_offering) cls.isolated_persistent_network_offering = CreateEnabledNetworkOffering(cls.api_client, cls.testData["nw_off_isolated_persistent"]) cls._cleanup.append(cls.isolated_persistent_network_offering) cls.testData["shared_network_offering"]["specifyVlan"] = "True" cls.testData["shared_network_offering"]["specifyIpRanges"] = "True" #Create Network Offering cls.shared_network_offering = NetworkOffering.create(cls.api_client, cls.testData["shared_network_offering"], conservemode=False) cls._cleanup.append(cls.shared_network_offering) #Update network offering state from disabled to enabled. NetworkOffering.update(cls.shared_network_offering,cls.api_client,state="enabled") except Exception as e: cls.tearDownClass() raise unittest.SkipTest("Failure in setUpClass: %s" % e) return @classmethod def tearDownClass(cls): try: # Cleanup resources used cleanup_resources(cls.api_client, cls._cleanup) except Exception as e: raise Exception("Warning: Exception during cleanup : %s" % e) return def setUp(self): self.apiclient = self.testClient.getApiClient() self.dbclient = self.testClient.getDbConnection() self.cleanup = [] try: self.account = Account.create(self.apiclient, self.testData["account"], domainid=self.domain.id) self.cleanup.append(self.account) except Exception as e: self.skipTest("Failed to create account: %s" % e) return def tearDown(self): try: # Clean up, terminate the resources created cleanup_resources(self.apiclient, self.cleanup) except Exception as e: raise Exception("Warning: Exception during cleanup : %s" % e) return @attr(tags=["advanced"], required_hardware="false") def test_network_not_implemented(self): # steps # 1. update guestvmcidr of isolated network (non persistent) # # validation # should throw exception as network is not in implemented state as no vm is created networkOffering = self.isolated_network_offering resultSet = createIsolatedNetwork(self, networkOffering.id) if resultSet[0] == FAIL: self.fail("Failed to create isolated network") else: isolated_network = resultSet[1] with self.assertRaises(Exception): isolated_network.update(self.apiclient, guestvmcidr="10.1.1.0/26") return @attr(tags=["advanced"], required_hardware="false") def test_vm_create_after_reservation(self): # steps # 1. create vm in persistent isolated network with ip in guestvmcidr # 2. update guestvmcidr # 3. create another VM # # validation # 1. guest vm cidr should be successfully updated with correct value # 2. existing guest vm ip should not be changed after reservation # 3. newly created VM should get ip in guestvmcidr networkOffering = self.isolated_persistent_network_offering subnet = "10.1."+str(random.randrange(1,254)) gateway = subnet + ".1" isolated_persistent_network = None resultSet = createIsolatedNetwork(self, networkOffering.id, gateway=gateway) if resultSet[0] == FAIL: self.fail("Failed to create isolated network") else: isolated_persistent_network = resultSet[1] guest_vm_cidr = subnet +".0/29" virtual_machine_1 = None try: virtual_machine_1 = VirtualMachine.create(self.apiclient, self.testData["virtual_machine"], networkids=isolated_persistent_network.id, serviceofferingid=self.service_offering.id, accountid=self.account.name, domainid=self.domain.id, ipaddress=subnet+".3" ) except Exception as e: self.fail("VM creation fails in network: %s" % e) update_response = Network.update(isolated_persistent_network, self.apiclient, id=isolated_persistent_network.id, guestvmcidr=guest_vm_cidr) self.assertEqual(guest_vm_cidr, update_response.cidr, "cidr in response is not as expected") vm_list = VirtualMachine.list(self.apiclient, id=virtual_machine_1.id) self.assertEqual(isinstance(vm_list, list), True, "VM list response in not a valid list") self.assertEqual(vm_list[0].nic[0].ipaddress, virtual_machine_1.ipaddress, "VM IP should not change after reservation") try: virtual_machine_2 = VirtualMachine.create(self.apiclient, self.testData["virtual_machine"], networkids=isolated_persistent_network.id, serviceofferingid=self.service_offering.id, accountid=self.account.name, domainid=self.domain.id ) if netaddr.IPAddress(virtual_machine_2.ipaddress) not in netaddr.IPNetwork(guest_vm_cidr): self.fail("Newly created VM doesn't get IP from reserverd CIDR") except Exception as e: self.skipTest("VM creation fails, cannot validate the condition: %s" % e) return @attr(tags=["advanced"], required_hardware="false") def test_reservation_after_router_restart(self): # steps # 1. update guestvmcidr of persistent isolated network # 2. reboot router # # validation # 1. guest vm cidr should be successfully updated with correct value # 2. network cidr should remain same after router restart networkOffering = self.isolated_persistent_network_offering subnet = "10.1."+str(random.randrange(1,254)) gateway = subnet + ".1" isolated_persistent_network = None resultSet = createIsolatedNetwork(self, networkOffering.id, gateway=gateway) if resultSet[0] == FAIL: self.fail("Failed to create isolated network") else: isolated_persistent_network = resultSet[1] response = verifyNetworkState(self.apiclient, isolated_persistent_network.id,\ "implemented") exceptionOccured = response[0] isNetworkInDesiredState = response[1] exceptionMessage = response[2] if (exceptionOccured or (not isNetworkInDesiredState)): self.fail(exceptionMessage) guest_vm_cidr = subnet +".0/29" update_response = Network.update(isolated_persistent_network, self.apiclient, id=isolated_persistent_network.id, guestvmcidr=guest_vm_cidr) self.assertEqual(guest_vm_cidr, update_response.cidr, "cidr in response is not as expected") routers = Router.list(self.apiclient, networkid=isolated_persistent_network.id, listall=True) self.assertEqual( isinstance(routers, list), True, "list router should return valid response" ) if not routers: self.skipTest("Router list should not be empty, skipping test") Router.reboot(self.apiclient, routers[0].id) networks = Network.list(self.apiclient, id=isolated_persistent_network.id) self.assertEqual( isinstance(networks, list), True, "list Networks should return valid response" ) self.assertEqual(networks[0].cidr, guest_vm_cidr, "guestvmcidr should match after router reboot") return @attr(tags=["advanced"], required_hardware="false") def test_vm_create_outside_cidr_after_reservation(self): # steps # 1. update guestvmcidr of persistent isolated network # 2. create another VM with ip outside guestvmcidr # # validation # 1. guest vm cidr should be successfully updated with correct value # 2 newly created VM should not be created and result in exception networkOffering = self.isolated_persistent_network_offering subnet = "10.1."+str(random.randrange(1,254)) gateway = subnet + ".1" isolated_persistent_network = None resultSet = createIsolatedNetwork(self, networkOffering.id, gateway=gateway) if resultSet[0] == FAIL: self.fail("Failed to create isolated network") else: isolated_persistent_network = resultSet[1] guest_vm_cidr = subnet +".0/29" update_response = Network.update(isolated_persistent_network, self.apiclient, id=isolated_persistent_network.id, guestvmcidr=guest_vm_cidr) self.assertEqual(guest_vm_cidr, update_response.cidr, "cidr in response is not as expected") with self.assertRaises(Exception): VirtualMachine.create(self.apiclient, self.testData["virtual_machine"], networkids=isolated_persistent_network.id, serviceofferingid=self.service_offering.id, accountid=self.account.name, domainid=self.domain.id, ipaddress="10.1.1.9" ) return

47.061125

147

0.603457

3400817c44441247fba7a19b3e2cbe7f7e6feee7

2,887

py

Python

utils/link_tester.py

ArneBinder/transformers

ddaafd78fb9c98d4f7b5009fb1998deff4c3d6f1

[ "Apache-2.0" ]

309

2020-02-07T23:09:27.000Z

2022-03-31T08:01:53.000Z

utils/link_tester.py

ArneBinder/transformers

ddaafd78fb9c98d4f7b5009fb1998deff4c3d6f1

[ "Apache-2.0" ]

93

2020-02-22T05:56:28.000Z

2022-03-27T08:43:38.000Z

utils/link_tester.py

ArneBinder/transformers

ddaafd78fb9c98d4f7b5009fb1998deff4c3d6f1

[ "Apache-2.0" ]

148

2020-02-14T22:16:11.000Z

2022-03-22T17:08:04.000Z

# Copyright 2020 The HuggingFace Team. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Link tester. This little utility reads all the python files in the repository, scans for links pointing to S3 and tests the links one by one. Raises an error at the end of the scan if at least one link was reported broken. """ import os import re import sys import requests REGEXP_FIND_S3_LINKS = r"""([\"'])(https:\/\/s3)(.*)?\1""" S3_BUCKET_PREFIX = "https://s3.amazonaws.com/models.huggingface.co/bert" def list_python_files_in_repository(): """List all python files in the repository. This function assumes that the script is executed in the root folder. """ source_code_files = [] for path, subdirs, files in os.walk("."): if "templates" in path: continue for name in files: if ".py" in name and ".pyc" not in name: path_to_files = os.path.join(path, name) source_code_files.append(path_to_files) return source_code_files def find_all_links(file_paths): links = [] for path in file_paths: links += scan_code_for_links(path) return [link for link in links if link != S3_BUCKET_PREFIX] def scan_code_for_links(source): """Scans the file to find links using a regular expression. Returns a list of links. """ with open(source, "r") as content: content = content.read() raw_links = re.findall(REGEXP_FIND_S3_LINKS, content) links = [prefix + suffix for _, prefix, suffix in raw_links] return links def check_all_links(links): """Check that the provided links are valid. Links are considered valid if a HEAD request to the server returns a 200 status code. """ broken_links = [] for link in links: head = requests.head(link) if head.status_code != 200: broken_links.append(link) return broken_links if __name__ == "__main__": file_paths = list_python_files_in_repository() links = find_all_links(file_paths) broken_links = check_all_links(links) print("Looking for broken links to pre-trained models/configs/tokenizers...") if broken_links: print("The following links did not respond:") for link in broken_links: print("- {}".format(link)) sys.exit(1) print("All links are ok.")

29.762887

81

0.682716

74c454427b95e0d6f3dcfd6bbcd9a083a9cdd537

2,228

py

Python

vendor/src/html5lib-python/html5lib/tests/test_encoding.py

lgp171188/fjord

1cb4aa3c3e0932c586cdd2c4ee3b6b9974a6976a

[ "BSD-3-Clause" ]

16

2015-02-06T14:35:57.000Z

2021-07-10T11:14:00.000Z

vendor/src/html5lib-python/html5lib/tests/test_encoding.py

lgp171188/fjord

1cb4aa3c3e0932c586cdd2c4ee3b6b9974a6976a

[ "BSD-3-Clause" ]

310

2015-01-07T14:39:35.000Z

2016-05-02T17:41:30.000Z

vendor/src/html5lib-python/html5lib/tests/test_encoding.py

lgp171188/fjord

1cb4aa3c3e0932c586cdd2c4ee3b6b9974a6976a

[ "BSD-3-Clause" ]

22

2015-01-15T13:46:03.000Z

2020-07-24T10:08:51.000Z

from __future__ import absolute_import, division, unicode_literals import os import unittest try: unittest.TestCase.assertEqual except AttributeError: unittest.TestCase.assertEqual = unittest.TestCase.assertEquals from .support import get_data_files, TestData, test_dir, errorMessage from html5lib import HTMLParser, inputstream class Html5EncodingTestCase(unittest.TestCase): def test_codec_name_a(self): self.assertEqual(inputstream.codecName('utf-8'), 'utf-8') def test_codec_name_b(self): self.assertEqual(inputstream.codecName('utf8'), 'utf-8') def test_codec_name_c(self): self.assertEqual(inputstream.codecName(' utf8 '), 'utf-8') def test_codec_name_d(self): self.assertEqual(inputstream.codecName('ISO_8859--1'), 'windows-1252') def runParserEncodingTest(data, encoding): p = HTMLParser() assert p.documentEncoding is None p.parse(data, useChardet=False) encoding = encoding.lower().decode('ascii') assert encoding == p.documentEncoding, errorMessage(data, encoding, p.documentEncoding) def runPreScanEncodingTest(data, encoding): stream = inputstream.HTMLBinaryInputStream(data, chardet=False) encoding = encoding.lower().decode('ascii') # Very crude way to ignore irrelevant tests if len(data) > stream.numBytesMeta: return assert encoding == stream.charEncoding[0], errorMessage(data, encoding, stream.charEncoding[0]) def test_encoding(): for filename in get_data_files('encoding'): tests = TestData(filename, b'data', encoding=None) for idx, test in enumerate(tests): yield (runParserEncodingTest, test[b'data'], test[b'encoding']) yield (runPreScanEncodingTest, test[b'data'], test[b'encoding']) try: try: import charade # flake8: noqa except ImportError: import chardet # flake8: noqa except ImportError: print('charade/chardet not found, skipping chardet tests') else: def test_chardet(): with open(os.path.join(test_dir, 'encoding' , 'chardet', 'test_big5.txt'), 'rb') as fp: encoding = inputstream.HTMLInputStream(fp.read()).charEncoding assert encoding[0].lower() == 'big5'

32.764706

99

0.70781

c6fdacb231fa9d7c5485d00d3022b374d423bb1a

1,620

py

Python

train_ppo.py

zhuyawen/sonic-on-ray

418d8917aff3265f50ca37d8aed0a244af5a5fa8

[ "Apache-2.0" ]

47

2018-04-05T20:24:39.000Z

2021-10-30T06:53:46.000Z

train_ppo.py

zhuyawen/sonic-on-ray

418d8917aff3265f50ca37d8aed0a244af5a5fa8

[ "Apache-2.0" ]

2

2018-10-30T20:38:05.000Z

2019-07-15T18:44:01.000Z

train_ppo.py

LaudateCorpus1/sonic-on-ray

418d8917aff3265f50ca37d8aed0a244af5a5fa8

[ "Apache-2.0" ]

14

2018-04-19T20:05:05.000Z

2021-09-19T06:48:17.000Z

from __future__ import absolute_import from __future__ import division from __future__ import print_function import sonic_on_ray import ray from ray.rllib import ppo from ray.tune.registry import register_env env_name = 'sonic_env' # Note that the hyperparameters have been tuned for sonic, which can be used # run by replacing the below function with: # # register_env(env_name, lambda config: sonic_on_ray.make( # game='SonicTheHedgehog-Genesis', # state='GreenHillZone.Act1')) # # However, to try Sonic, you have to obtain the ROM yourself (see then # instructions at https://github.com/openai/retro/blob/master/README.md). register_env(env_name, lambda config: sonic_on_ray.make(game='Airstriker-Genesis', state='Level1')) ray.init() config = ppo.DEFAULT_CONFIG.copy() config.update({ 'timesteps_per_batch': 40000, 'min_steps_per_task': 100, 'num_workers': 32, 'gamma': 0.99, 'lambda': 0.95, 'clip_param': 0.1, 'num_sgd_iter': 30, 'sgd_batchsize': 4096, 'sgd_stepsize': 5e-5, 'use_gae': True, 'horizon': 4000, 'devices': ['/gpu:0', '/gpu:1', '/gpu:2', '/gpu:3', '/gpu:4', '/gpu:5', '/gpu:6', 'gpu:7'], 'tf_session_args': { 'gpu_options': {'allow_growth': True} } }) alg = ppo.PPOAgent(config=config, env=env_name) for i in range(1000): result = alg.train() print('result = {}'.format(result)) if i % 10 == 0: checkpoint = alg.save() print('checkpoint saved at', checkpoint)

28.421053

76

0.621605

7824199b84dc568c0155e61b9775180406dec779

28,388

py

Python

parsl/executors/high_throughput/process_worker_pool.py

tuhz/parsl

8a36d0ae8f6d935441a378c4cd4e85b308a36caa

[ "Apache-2.0" ]

null

parsl/executors/high_throughput/process_worker_pool.py

tuhz/parsl

8a36d0ae8f6d935441a378c4cd4e85b308a36caa

[ "Apache-2.0" ]

null

parsl/executors/high_throughput/process_worker_pool.py

tuhz/parsl

8a36d0ae8f6d935441a378c4cd4e85b308a36caa

[ "Apache-2.0" ]

null

#!/usr/bin/env python3 import argparse import logging import os import sys import platform # import random import threading import pickle import time import datetime import queue import uuid import zmq import math import json import psutil import multiprocessing from parsl.version import VERSION as PARSL_VERSION from parsl.app.errors import RemoteExceptionWrapper from parsl.executors.high_throughput.errors import WorkerLost from parsl.executors.high_throughput.probe import probe_addresses if platform.system() == 'Darwin': from parsl.executors.high_throughput.mac_safe_queue import MacSafeQueue as mpQueue else: from multiprocessing import Queue as mpQueue from parsl.serialize import unpack_apply_message, serialize RESULT_TAG = 10 TASK_REQUEST_TAG = 11 HEARTBEAT_CODE = (2 ** 32) - 1 class Manager(object): """ Manager manages task execution by the workers | 0mq | Manager | Worker Processes | | | | <-----Request N task-----+--Count task reqs | Request task<--+ Interchange | -------------------------+->Receive task batch| | | | | Distribute tasks--+----> Get(block) & | | | | Execute task | | | | | | | <------------------------+--Return results----+---- Post result | | | | | | | | | +----------+ | | IPC-Qeueues """ def __init__(self, addresses="127.0.0.1", address_probe_timeout=30, task_port="50097", result_port="50098", cores_per_worker=1, mem_per_worker=None, max_workers=float('inf'), prefetch_capacity=0, uid=None, block_id=None, heartbeat_threshold=120, heartbeat_period=30, poll_period=10): """ Parameters ---------- addresses : str comma separated list of addresses for the interchange address_probe_timeout : int Timeout in seconds for the address probe to detect viable addresses to the interchange. Default : 30s worker_url : str Worker url on which workers will attempt to connect back uid : str string unique identifier block_id : str Block identifier that maps managers to the provider blocks they belong to. cores_per_worker : float cores to be assigned to each worker. Oversubscription is possible by setting cores_per_worker < 1.0. Default=1 mem_per_worker : float GB of memory required per worker. If this option is specified, the node manager will check the available memory at startup and limit the number of workers such that the there's sufficient memory for each worker. If set to None, memory on node is not considered in the determination of workers to be launched on node by the manager. Default: None max_workers : int caps the maximum number of workers that can be launched. default: infinity prefetch_capacity : int Number of tasks that could be prefetched over available worker capacity. When there are a few tasks (<100) or when tasks are long running, this option should be set to 0 for better load balancing. Default is 0. heartbeat_threshold : int Seconds since the last message from the interchange after which the interchange is assumed to be un-available, and the manager initiates shutdown. Default:120s Number of seconds since the last message from the interchange after which the worker assumes that the interchange is lost and the manager shuts down. Default:120 heartbeat_period : int Number of seconds after which a heartbeat message is sent to the interchange poll_period : int Timeout period used by the manager in milliseconds. Default: 10ms """ logger.info("Manager started") try: ix_address = probe_addresses(addresses.split(','), task_port, timeout=address_probe_timeout) if not ix_address: raise Exception("No viable address found") else: logger.info("Connection to Interchange successful on {}".format(ix_address)) task_q_url = "tcp://{}:{}".format(ix_address, task_port) result_q_url = "tcp://{}:{}".format(ix_address, result_port) logger.info("Task url : {}".format(task_q_url)) logger.info("Result url : {}".format(result_q_url)) except Exception: logger.exception("Caught exception while trying to determine viable address to interchange") print("Failed to find a viable address to connect to interchange. Exiting") exit(5) self.context = zmq.Context() self.task_incoming = self.context.socket(zmq.DEALER) self.task_incoming.setsockopt(zmq.IDENTITY, uid.encode('utf-8')) # Linger is set to 0, so that the manager can exit even when there might be # messages in the pipe self.task_incoming.setsockopt(zmq.LINGER, 0) self.task_incoming.connect(task_q_url) self.result_outgoing = self.context.socket(zmq.DEALER) self.result_outgoing.setsockopt(zmq.IDENTITY, uid.encode('utf-8')) self.result_outgoing.setsockopt(zmq.LINGER, 0) self.result_outgoing.connect(result_q_url) logger.info("Manager connected") self.uid = uid self.block_id = block_id if os.environ.get('PARSL_CORES'): cores_on_node = int(os.environ['PARSL_CORES']) else: cores_on_node = multiprocessing.cpu_count() if os.environ.get('PARSL_MEMORY_GB'): available_mem_on_node = float(os.environ['PARSL_MEMORY_GB']) else: available_mem_on_node = round(psutil.virtual_memory().available / (2**30), 1) self.max_workers = max_workers self.prefetch_capacity = prefetch_capacity mem_slots = max_workers # Avoid a divide by 0 error. if mem_per_worker and mem_per_worker > 0: mem_slots = math.floor(available_mem_on_node / mem_per_worker) self.worker_count = min(max_workers, mem_slots, math.floor(cores_on_node / cores_per_worker)) logger.info("Manager will spawn {} workers".format(self.worker_count)) self.pending_task_queue = mpQueue() self.pending_result_queue = mpQueue() self.ready_worker_queue = mpQueue() self.max_queue_size = self.prefetch_capacity + self.worker_count self.tasks_per_round = 1 self.heartbeat_period = heartbeat_period self.heartbeat_threshold = heartbeat_threshold self.poll_period = poll_period def create_reg_message(self): """ Creates a registration message to identify the worker to the interchange """ msg = {'parsl_v': PARSL_VERSION, 'python_v': "{}.{}.{}".format(sys.version_info.major, sys.version_info.minor, sys.version_info.micro), 'worker_count': self.worker_count, 'block_id': self.block_id, 'prefetch_capacity': self.prefetch_capacity, 'max_capacity': self.worker_count + self.prefetch_capacity, 'os': platform.system(), 'hostname': platform.node(), 'dir': os.getcwd(), 'cpu_count': psutil.cpu_count(logical=False), 'total_memory': psutil.virtual_memory().total, 'reg_time': datetime.datetime.now().strftime("%Y-%m-%d %H:%M:%S"), } b_msg = json.dumps(msg).encode('utf-8') return b_msg def heartbeat(self): """ Send heartbeat to the incoming task queue """ heartbeat = (HEARTBEAT_CODE).to_bytes(4, "little") r = self.task_incoming.send(heartbeat) logger.debug("Return from heartbeat: {}".format(r)) def pull_tasks(self, kill_event): """ Pull tasks from the incoming tasks 0mq pipe onto the internal pending task queue Parameters: ----------- kill_event : threading.Event Event to let the thread know when it is time to die. """ logger.info("[TASK PULL THREAD] starting") poller = zmq.Poller() poller.register(self.task_incoming, zmq.POLLIN) # Send a registration message msg = self.create_reg_message() logger.debug("Sending registration message: {}".format(msg)) self.task_incoming.send(msg) last_beat = time.time() last_interchange_contact = time.time() task_recv_counter = 0 poll_timer = self.poll_period while not kill_event.is_set(): ready_worker_count = self.ready_worker_queue.qsize() pending_task_count = self.pending_task_queue.qsize() logger.debug("[TASK_PULL_THREAD] ready workers:{}, pending tasks:{}".format(ready_worker_count, pending_task_count)) if time.time() > last_beat + self.heartbeat_period: self.heartbeat() last_beat = time.time() if pending_task_count < self.max_queue_size and ready_worker_count > 0: logger.debug("[TASK_PULL_THREAD] Requesting tasks: {}".format(ready_worker_count)) msg = ((ready_worker_count).to_bytes(4, "little")) self.task_incoming.send(msg) socks = dict(poller.poll(timeout=poll_timer)) if self.task_incoming in socks and socks[self.task_incoming] == zmq.POLLIN: poll_timer = 0 _, pkl_msg = self.task_incoming.recv_multipart() tasks = pickle.loads(pkl_msg) last_interchange_contact = time.time() if tasks == 'STOP': logger.critical("[TASK_PULL_THREAD] Received stop request") kill_event.set() break elif tasks == HEARTBEAT_CODE: logger.debug("Got heartbeat from interchange") else: task_recv_counter += len(tasks) logger.debug("[TASK_PULL_THREAD] Got tasks: {} of {}".format([t['task_id'] for t in tasks], task_recv_counter)) for task in tasks: self.pending_task_queue.put(task) # logger.debug("[TASK_PULL_THREAD] Ready tasks: {}".format( # [i['task_id'] for i in self.pending_task_queue])) else: logger.debug("[TASK_PULL_THREAD] No incoming tasks") # Limit poll duration to heartbeat_period # heartbeat_period is in s vs poll_timer in ms if not poll_timer: poll_timer = self.poll_period poll_timer = min(self.heartbeat_period * 1000, poll_timer * 2) # Only check if no messages were received. if time.time() > last_interchange_contact + self.heartbeat_threshold: logger.critical("[TASK_PULL_THREAD] Missing contact with interchange beyond heartbeat_threshold") kill_event.set() logger.critical("[TASK_PULL_THREAD] Exiting") break def push_results(self, kill_event): """ Listens on the pending_result_queue and sends out results via 0mq Parameters: ----------- kill_event : threading.Event Event to let the thread know when it is time to die. """ logger.debug("[RESULT_PUSH_THREAD] Starting thread") push_poll_period = max(10, self.poll_period) / 1000 # push_poll_period must be atleast 10 ms logger.debug("[RESULT_PUSH_THREAD] push poll period: {}".format(push_poll_period)) last_beat = time.time() items = [] while not kill_event.is_set(): try: r = self.pending_result_queue.get(block=True, timeout=push_poll_period) items.append(r) except queue.Empty: pass except Exception as e: logger.exception("[RESULT_PUSH_THREAD] Got an exception: {}".format(e)) # If we have reached poll_period duration or timer has expired, we send results if len(items) >= self.max_queue_size or time.time() > last_beat + push_poll_period: last_beat = time.time() if items: self.result_outgoing.send_multipart(items) items = [] logger.critical("[RESULT_PUSH_THREAD] Exiting") def worker_watchdog(self, kill_event): """ Listens on the pending_result_queue and sends out results via 0mq Parameters: ----------- kill_event : threading.Event Event to let the thread know when it is time to die. """ logger.debug("[WORKER_WATCHDOG_THREAD] Starting thread") while not kill_event.is_set(): for worker_id, p in self.procs.items(): if not p.is_alive(): logger.info("[WORKER_WATCHDOG_THREAD] Worker {} has died".format(worker_id)) try: task = self._tasks_in_progress.pop(worker_id) logger.info("[WORKER_WATCHDOG_THREAD] Worker {} was busy when it died".format(worker_id)) try: raise WorkerLost(worker_id, platform.node()) except Exception: logger.info("[WORKER_WATCHDOG_THREAD] Putting exception for task {} in the pending result queue".format(task['task_id'])) result_package = {'task_id': task['task_id'], 'exception': serialize(RemoteExceptionWrapper(*sys.exc_info()))} pkl_package = pickle.dumps(result_package) self.pending_result_queue.put(pkl_package) except KeyError: logger.info("[WORKER_WATCHDOG_THREAD] Worker {} was not busy when it died".format(worker_id)) p = multiprocessing.Process(target=worker, args=(worker_id, self.uid, self.worker_count, self.pending_task_queue, self.pending_result_queue, self.ready_worker_queue, self._tasks_in_progress ), name="HTEX-Worker-{}".format(worker_id)) self.procs[worker_id] = p logger.info("[WORKER_WATCHDOG_THREAD] Worker {} has been restarted".format(worker_id)) time.sleep(self.poll_period) logger.critical("[WORKER_WATCHDOG_THREAD] Exiting") def start(self): """ Start the worker processes. TODO: Move task receiving to a thread """ start = time.time() self._kill_event = threading.Event() self._tasks_in_progress = multiprocessing.Manager().dict() self.procs = {} for worker_id in range(self.worker_count): p = multiprocessing.Process(target=worker, args=(worker_id, self.uid, self.worker_count, self.pending_task_queue, self.pending_result_queue, self.ready_worker_queue, self._tasks_in_progress ), name="HTEX-Worker-{}".format(worker_id)) p.start() self.procs[worker_id] = p logger.debug("Manager synced with workers") self._task_puller_thread = threading.Thread(target=self.pull_tasks, args=(self._kill_event,), name="Task-Puller") self._result_pusher_thread = threading.Thread(target=self.push_results, args=(self._kill_event,), name="Result-Pusher") self._worker_watchdog_thread = threading.Thread(target=self.worker_watchdog, args=(self._kill_event,), name="worker-watchdog") self._task_puller_thread.start() self._result_pusher_thread.start() self._worker_watchdog_thread.start() logger.info("Loop start") # TODO : Add mechanism in this loop to stop the worker pool # This might need a multiprocessing event to signal back. self._kill_event.wait() logger.critical("[MAIN] Received kill event, terminating worker processes") self._task_puller_thread.join() self._result_pusher_thread.join() self._worker_watchdog_thread.join() for proc_id in self.procs: self.procs[proc_id].terminate() logger.critical("Terminating worker {}:{}".format(self.procs[proc_id], self.procs[proc_id].is_alive())) self.procs[proc_id].join() logger.debug("Worker:{} joined successfully".format(self.procs[proc_id])) self.task_incoming.close() self.result_outgoing.close() self.context.term() delta = time.time() - start logger.info("process_worker_pool ran for {} seconds".format(delta)) return def execute_task(bufs): """Deserialize the buffer and execute the task. Returns the result or throws exception. """ user_ns = locals() user_ns.update({'__builtins__': __builtins__}) f, args, kwargs = unpack_apply_message(bufs, user_ns, copy=False) # We might need to look into callability of the function from itself # since we change it's name in the new namespace prefix = "parsl_" fname = prefix + "f" argname = prefix + "args" kwargname = prefix + "kwargs" resultname = prefix + "result" user_ns.update({fname: f, argname: args, kwargname: kwargs, resultname: resultname}) code = "{0} = {1}(*{2}, **{3})".format(resultname, fname, argname, kwargname) try: # logger.debug("[RUNNER] Executing: {0}".format(code)) exec(code, user_ns, user_ns) except Exception as e: logger.warning("Caught exception; will raise it: {}".format(e), exc_info=True) raise e else: # logger.debug("[RUNNER] Result: {0}".format(user_ns.get(resultname))) return user_ns.get(resultname) def worker(worker_id, pool_id, pool_size, task_queue, result_queue, worker_queue, tasks_in_progress): """ Put request token into queue Get task from task_queue Pop request from queue Put result into result_queue """ start_file_logger('{}/block-{}/{}/worker_{}.log'.format(args.logdir, args.block_id, pool_id, worker_id), worker_id, name="worker_log", level=logging.DEBUG if args.debug else logging.INFO) # Store worker ID as an environment variable os.environ['PARSL_WORKER_RANK'] = str(worker_id) os.environ['PARSL_WORKER_COUNT'] = str(pool_size) os.environ['PARSL_WORKER_POOL_ID'] = str(pool_id) # Sync worker with master logger.info('Worker {} started'.format(worker_id)) if args.debug: logger.debug("Debug logging enabled") while True: worker_queue.put(worker_id) # The worker will receive {'task_id':<tid>, 'buffer':<buf>} req = task_queue.get() tasks_in_progress[worker_id] = req tid = req['task_id'] logger.info("Received task {}".format(tid)) try: worker_queue.get() except queue.Empty: logger.warning("Worker ID: {} failed to remove itself from ready_worker_queue".format(worker_id)) pass try: result = execute_task(req['buffer']) serialized_result = serialize(result, buffer_threshold=1e6) except Exception as e: logger.info('Caught an exception: {}'.format(e)) result_package = {'task_id': tid, 'exception': serialize(RemoteExceptionWrapper(*sys.exc_info()))} else: result_package = {'task_id': tid, 'result': serialized_result} # logger.debug("Result: {}".format(result)) logger.info("Completed task {}".format(tid)) try: pkl_package = pickle.dumps(result_package) except Exception: logger.exception("Caught exception while trying to pickle the result package") pkl_package = pickle.dumps({'task_id': tid, 'exception': serialize(RemoteExceptionWrapper(*sys.exc_info())) }) result_queue.put(pkl_package) tasks_in_progress.pop(worker_id) def start_file_logger(filename, rank, name='parsl', level=logging.DEBUG, format_string=None): """Add a stream log handler. Args: - filename (string): Name of the file to write logs to - name (string): Logger name - level (logging.LEVEL): Set the logging level. - format_string (string): Set the format string Returns: - None """ if format_string is None: format_string = "%(asctime)s.%(msecs)03d %(name)s:%(lineno)d Rank:{0} [%(levelname)s] %(message)s".format(rank) global logger logger = logging.getLogger(name) logger.setLevel(logging.DEBUG) handler = logging.FileHandler(filename) handler.setLevel(level) formatter = logging.Formatter(format_string, datefmt='%Y-%m-%d %H:%M:%S') handler.setFormatter(formatter) logger.addHandler(handler) if __name__ == "__main__": parser = argparse.ArgumentParser() parser.add_argument("-d", "--debug", action='store_true', help="Count of apps to launch") parser.add_argument("-a", "--addresses", default='', help="Comma separated list of addresses at which the interchange could be reached") parser.add_argument("-l", "--logdir", default="process_worker_pool_logs", help="Process worker pool log directory") parser.add_argument("-u", "--uid", default=str(uuid.uuid4()).split('-')[-1], help="Unique identifier string for Manager") parser.add_argument("-b", "--block_id", default=None, help="Block identifier for Manager") parser.add_argument("-c", "--cores_per_worker", default="1.0", help="Number of cores assigned to each worker process. Default=1.0") parser.add_argument("-m", "--mem_per_worker", default=0, help="GB of memory assigned to each worker process. Default=0, no assignment") parser.add_argument("-t", "--task_port", required=True, help="REQUIRED: Task port for receiving tasks from the interchange") parser.add_argument("--max_workers", default=float('inf'), help="Caps the maximum workers that can be launched, default:infinity") parser.add_argument("-p", "--prefetch_capacity", default=0, help="Number of tasks that can be prefetched to the manager. Default is 0.") parser.add_argument("--hb_period", default=30, help="Heartbeat period in seconds. Uses manager default unless set") parser.add_argument("--hb_threshold", default=120, help="Heartbeat threshold in seconds. Uses manager default unless set") parser.add_argument("--address_probe_timeout", default=30, help="Timeout to probe for viable address to interchange. Default: 30s") parser.add_argument("--poll", default=10, help="Poll period used in milliseconds") parser.add_argument("-r", "--result_port", required=True, help="REQUIRED: Result port for posting results to the interchange") args = parser.parse_args() os.makedirs(os.path.join(args.logdir, "block-{}".format(args.block_id), args.uid), exist_ok=True) try: start_file_logger('{}/block-{}/{}/manager.log'.format(args.logdir, args.block_id, args.uid), 0, level=logging.DEBUG if args.debug is True else logging.INFO) logger.info("Python version: {}".format(sys.version)) logger.info("Debug logging: {}".format(args.debug)) logger.info("Log dir: {}".format(args.logdir)) logger.info("Manager ID: {}".format(args.uid)) logger.info("Block ID: {}".format(args.block_id)) logger.info("cores_per_worker: {}".format(args.cores_per_worker)) logger.info("mem_per_worker: {}".format(args.mem_per_worker)) logger.info("task_port: {}".format(args.task_port)) logger.info("result_port: {}".format(args.result_port)) logger.info("addresses: {}".format(args.addresses)) logger.info("max_workers: {}".format(args.max_workers)) logger.info("poll_period: {}".format(args.poll)) logger.info("address_probe_timeout: {}".format(args.address_probe_timeout)) logger.info("Prefetch capacity: {}".format(args.prefetch_capacity)) logger.info("Heartbeat threshold: {}".format(args.hb_threshold)) logger.info("Heartbeat period: {}".format(args.hb_period)) manager = Manager(task_port=args.task_port, result_port=args.result_port, addresses=args.addresses, address_probe_timeout=int(args.address_probe_timeout), uid=args.uid, block_id=args.block_id, cores_per_worker=float(args.cores_per_worker), mem_per_worker=None if args.mem_per_worker == 'None' else float(args.mem_per_worker), max_workers=args.max_workers if args.max_workers == float('inf') else int(args.max_workers), prefetch_capacity=int(args.prefetch_capacity), heartbeat_threshold=int(args.hb_threshold), heartbeat_period=int(args.hb_period), poll_period=int(args.poll)) manager.start() except Exception as e: logger.critical("process_worker_pool exiting from an exception") logger.exception("Caught error: {}".format(e)) raise else: logger.info("process_worker_pool exiting") print("PROCESS_WORKER_POOL exiting")

44.080745

149

0.565979

49330c7c9e97c1a810a54ac6cb73b674defe0efd

280

py

Python

src/apps/blog/forms.py

Pewpewarrows/MyModernLife

5348792b0aedc2bae6c91d688e61391b0656e136

[ "X11" ]

null

src/apps/blog/forms.py

Pewpewarrows/MyModernLife

5348792b0aedc2bae6c91d688e61391b0656e136

[ "X11" ]

null

src/apps/blog/forms.py

Pewpewarrows/MyModernLife

5348792b0aedc2bae6c91d688e61391b0656e136

[ "X11" ]

null

from django.forms import ModelForm from models import Blog, Post class BlogForm(ModelForm): class Meta: model = Blog fields = ('title',) class PostForm(ModelForm): class Meta: model = Post fields = ('title', 'markup', 'content', 'tags')

20

55

0.617857

500cb572e5e26a0c84338f1618bc53a03db2e8ef

1,551

py

Python

tests/integration_tests/feature_flag_tests.py

cevheri/superset

34542db3b615ff556281f80410f322f41f5a97a6

[ "Apache-2.0" ]

19

2018-09-02T10:52:23.000Z

2022-03-24T09:43:48.000Z

tests/integration_tests/feature_flag_tests.py

cevheri/superset

34542db3b615ff556281f80410f322f41f5a97a6

[ "Apache-2.0" ]

62

2020-05-06T22:51:53.000Z

2022-03-28T20:49:17.000Z

tests/integration_tests/feature_flag_tests.py

cevheri/superset

34542db3b615ff556281f80410f322f41f5a97a6

[ "Apache-2.0" ]

15

2019-04-29T05:38:31.000Z

2022-02-12T10:47:54.000Z

# Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. from unittest.mock import patch from superset import is_feature_enabled from tests.integration_tests.base_tests import SupersetTestCase class TestFeatureFlag(SupersetTestCase): @patch.dict( "superset.extensions.feature_flag_manager._feature_flags", {"FOO": True}, clear=True, ) def test_existing_feature_flags(self): self.assertTrue(is_feature_enabled("FOO")) @patch.dict( "superset.extensions.feature_flag_manager._feature_flags", {}, clear=True ) def test_nonexistent_feature_flags(self): self.assertFalse(is_feature_enabled("FOO")) def test_feature_flags(self): self.assertEqual(is_feature_enabled("foo"), "bar") self.assertEqual(is_feature_enabled("super"), "set")

37.829268

81

0.746615

8d6a2340769e867303e71495d14a1b9df247b032

680

py

Python

setup.py

rolandio/python-elgato-streamdeck

72805ca1475f6b2638344b287dda55386095f30c

[ "MIT" ]

517

2018-01-06T18:27:40.000Z

2022-03-30T23:06:46.000Z

setup.py

rolandio/python-elgato-streamdeck

72805ca1475f6b2638344b287dda55386095f30c

[ "MIT" ]

87

2018-01-06T13:10:41.000Z

2022-03-19T02:47:23.000Z

setup.py

rolandio/python-elgato-streamdeck

72805ca1475f6b2638344b287dda55386095f30c

[ "MIT" ]

97

2018-01-06T12:00:09.000Z

2022-03-19T01:39:32.000Z

import setuptools with open("VERSION", 'r') as f: version = f.read().strip() with open("README.md", 'r') as f: long_description = f.read() setuptools.setup( name='streamdeck', version=version, description='Library to control Elgato StreamDeck devices.', author='Dean Camera', author_email='dean@fourwalledcubicle.com', url='https://github.com/abcminiuser/python-elgato-streamdeck', package_dir={'': 'src'}, packages=setuptools.find_packages(where='src'), install_requires=[], license="MIT", long_description=long_description, long_description_content_type="text/markdown", include_package_data=True, python_requires='>=3.8', )

27.2

65

0.707353

be9d6b540c576ed8cd7fb0130f2abbe52bd60f50

922

py

Python

scraper/storage_spiders/onlinefridayvn.py

chongiadung/choinho

d2a216fe7a5064d73cdee3e928a7beef7f511fd1

[ "MIT" ]

null

scraper/storage_spiders/onlinefridayvn.py

chongiadung/choinho

d2a216fe7a5064d73cdee3e928a7beef7f511fd1

[ "MIT" ]

10

2020-02-11T23:34:28.000Z

2022-03-11T23:16:12.000Z

scraper/storage_spiders/onlinefridayvn.py

chongiadung/choinho

d2a216fe7a5064d73cdee3e928a7beef7f511fd1

[ "MIT" ]

3

2018-08-05T14:54:25.000Z

2021-06-07T01:49:59.000Z

# Auto generated by generator.py. Delete this line if you make modification. from scrapy.spiders import Rule from scrapy.linkextractors import LinkExtractor XPATH = { 'name' : "//div[@class='title_sp_detail width_common']", 'price' : "//div[@class='block_item_detial']/div[@class='w70 price_at color_price_at']", 'category' : "//div[@id='breakcumb']//div[@class='cate_sales_name']/a", 'description' : "", 'images' : "//div[@class='center_thumb']/img/@src", 'canonical' : "", 'base_url' : "", 'brand' : "" } name = 'onlinefriday.vn' allowed_domains = ['onlinefriday.vn'] start_urls = ['http://onlinefriday.vn/'] tracking_url = '' sitemap_urls = [''] sitemap_rules = [('', 'parse_item')] sitemap_follow = [] rules = [ Rule(LinkExtractor(allow=['/san-pham/']), 'parse_item'), Rule(LinkExtractor(allow=['/nganh-hang/']), 'parse'), #Rule(LinkExtractor(), 'parse_item_and_links'), ]

34.148148

92

0.652928

7d5ca92e2aae0323480b3c8dd5b6afb5d48ec663

7,971

py

Python

grr/server/grr_response_server/server_logging.py

certxlm/grr

c2a442a27f656fb18dfa3bce098847e5c5b849d7

[ "Apache-2.0" ]

1

2019-08-28T23:48:20.000Z

grr/server/grr_response_server/server_logging.py

AjitNair2/grr

2a2ea891b3927775872904cdd402a18e7bb3d143

[ "Apache-2.0" ]

2

2022-01-15T03:18:12.000Z

2022-02-13T22:02:43.000Z

grr/server/grr_response_server/server_logging.py

acidburn0zzz/grr

44e1a5b1630e8101610faaaebe15b19b5ad30cb1

[ "Apache-2.0" ]

null

#!/usr/bin/env python """Functions for server logging.""" from __future__ import absolute_import from __future__ import division from __future__ import unicode_literals import logging from logging import handlers import os import socket import time from absl import flags from grr_response_core import config from grr_response_server import data_store from grr_response_server.rdfvalues import objects as rdf_objects try: # pylint: disable=g-import-not-at-top from grr_response_server.local import log as local_log # pylint: enable=g-import-not-at-top except ImportError: local_log = None # Global Application Logger. LOGGER = None flags.DEFINE_bool( "verbose", default=False, help="Turn on verbose logging.", allow_override=True) class GrrApplicationLogger(object): """The GRR application logger. These records are used for machine readable authentication logging of security critical events. """ def GetNewEventId(self, event_time=None): """Return a unique Event ID string.""" if event_time is None: event_time = int(time.time() * 1e6) return "%s:%s:%s" % (event_time, socket.gethostname(), os.getpid()) def LogHttpAdminUIAccess(self, request, response): """Log an http based api call. Args: request: A WSGI request object. response: A WSGI response object. """ # TODO(user): generate event_id elsewhere and use it for all the log # messages that have to do with handling corresponding request. event_id = self.GetNewEventId() api_method = response.headers.get("X-API-Method", "unknown") api_reason = response.headers.get("X-GRR-Reason", "none") log_msg = "%s API call [%s] by %s (reason: %s): %s [%d]" % ( event_id, api_method, request.user, api_reason, request.full_path, response.status_code) logging.info(log_msg) if response.headers.get("X-No-Log") != "True": entry = rdf_objects.APIAuditEntry.FromHttpRequestResponse( request, response) data_store.REL_DB.WriteAPIAuditEntry(entry) def LogHttpFrontendAccess(self, request, source=None, message_count=None): """Write a log entry for a Frontend or UI Request. Args: request: A HttpRequest protobuf. source: Client id of the client initiating the request. Optional. message_count: Number of messages received from the client. Optional. """ # TODO(user): generate event_id elsewhere and use it for all the log # messages that have to do with handling corresponding request. event_id = self.GetNewEventId() log_msg = "%s-%s [%s]: %s %s %s %s (%d)" % ( event_id, request.source_ip, source or "<unknown>", request.method, request.url, request.user_agent, request.user, message_count or 0) logging.info(log_msg) class PreLoggingMemoryHandler(handlers.BufferingHandler): """Handler used before logging subsystem is initialized.""" def shouldFlush(self, record): return len(self.buffer) >= self.capacity def flush(self): """Flush the buffer. This is called when the buffer is really full, we just just drop one oldest message. """ self.buffer = self.buffer[-self.capacity:] class RobustSysLogHandler(handlers.SysLogHandler): """A handler which does not raise if it fails to connect.""" def __init__(self, *args, **kwargs): self.formatter = None try: super(RobustSysLogHandler, self).__init__(*args, **kwargs) except socket.error: pass def handleError(self, record): """Just ignore socket errors - the syslog server might come back.""" BASE_LOG_LEVELS = { "FileHandler": logging.ERROR, "NTEventLogHandler": logging.CRITICAL, "StreamHandler": logging.ERROR, "RobustSysLogHandler": logging.CRITICAL, } VERBOSE_LOG_LEVELS = { "FileHandler": logging.DEBUG, "NTEventLogHandler": logging.INFO, "StreamHandler": logging.DEBUG, "RobustSysLogHandler": logging.INFO, } def SetLogLevels(): logger = logging.getLogger() if config.CONFIG["Logging.verbose"] or flags.FLAGS.verbose: logging.root.setLevel(logging.DEBUG) levels = VERBOSE_LOG_LEVELS else: levels = BASE_LOG_LEVELS for handler in logger.handlers: handler.setLevel(levels[handler.__class__.__name__]) LOG_FORMAT = ("%(levelname)s:%(asctime)s %(process)d " "%(processName)s %(thread)d %(threadName)s " "%(module)s:%(lineno)s] %(message)s") def GetLogHandlers(): formatter = logging.Formatter(LOG_FORMAT) engines = config.CONFIG["Logging.engines"] logging.debug("Will use logging engines %s", engines) for engine in engines: try: if engine == "stderr": handler = logging.StreamHandler() handler.setFormatter(formatter) yield handler elif engine == "event_log": handler = handlers.NTEventLogHandler("GRR") handler.setFormatter(formatter) yield handler elif engine == "syslog": # Allow the specification of UDP sockets. socket_name = config.CONFIG["Logging.syslog_path"] if ":" in socket_name: addr, port = socket_name.split(":", 1) handler = RobustSysLogHandler((addr, int(port))) else: handler = RobustSysLogHandler(socket_name) handler.setFormatter(formatter) yield handler elif engine == "file": # Create a logfile if needed. path = config.CONFIG["Logging.filename"] logging.info("Writing log file to %s", path) if not os.path.isdir(os.path.dirname(path)): os.makedirs(os.path.dirname(path)) handler = logging.FileHandler(path, mode="a", encoding="utf-8") handler.setFormatter(formatter) yield handler else: logging.error("Unknown logging engine %s", engine) except Exception: # pylint:disable=broad-except # Failure to log should not be fatal. logging.exception("Unable to create logger %s", engine) def LogInit(): """Configure the logging subsystem.""" logging.debug("Initializing Logging subsystem.") # The root logger. logger = logging.getLogger() memory_handlers = [ m for m in logger.handlers if m.__class__.__name__ == "PreLoggingMemoryHandler" ] # Clear all handers. logger.handlers = list(GetLogHandlers()) SetLogLevels() # Now flush the old messages into the log files. for handler in memory_handlers: for record in handler.buffer: logger.handle(record) def AppLogInit(): """Initialize the Application Log. This log is what will be used whenever someone does a log.LOGGER call. These are used for more detailed application or event logs. Returns: GrrApplicationLogger object """ logging.debug("Initializing Application Logger.") return GrrApplicationLogger() def ServerLoggingStartupInit(): """Initialize the server logging configuration.""" global LOGGER if local_log: logging.debug("Using local LogInit from %s", local_log) local_log.LogInit() logging.debug("Using local AppLogInit from %s", local_log) LOGGER = local_log.AppLogInit() else: LogInit() LOGGER = AppLogInit() def SetTestVerbosity(): if local_log: local_log.SetTestVerbosity() return # Test logging. This is only to stderr, adjust the levels according to flags if flags.FLAGS.verbose: logging.root.setLevel(logging.DEBUG) else: logging.root.setLevel(logging.WARN) # There is a catch 22 here: We need to start logging right away but we will only # configure the logging system once the config is read. Therefore we set up a # memory logger now and then when the log destination is configured we replay # the logs into that. This ensures we do not lose any log messages during early # program start up. root_logger = logging.root memory_logger = PreLoggingMemoryHandler(1000) root_logger.addHandler(memory_logger) memory_logger.setLevel(logging.DEBUG) logging.debug("Starting GRR Prelogging buffer.")

29.522222

80

0.69803

f2b5e779e0653889e47e400105c4e61627428874

17,883

py

Python

IEEExtreme2017/elementary.py

Victoralin10/ACMSolutions

6d6e50da87b2bc455e953629737215b74b10269c

[ "MIT" ]

null

IEEExtreme2017/elementary.py

Victoralin10/ACMSolutions

6d6e50da87b2bc455e953629737215b74b10269c

[ "MIT" ]

null

IEEExtreme2017/elementary.py

Victoralin10/ACMSolutions

6d6e50da87b2bc455e953629737215b74b10269c

[ "MIT" ]

null

M = {} M["a"] = "0" M["aa"] = "0" M["aaa"] = "0" M["ab"] = "0" M["aba"] = "0" M["abc"] = "0" M["abinombca"] = "0" M["able"] = "0" M["about"] = "0" M["account"] = "0" M["activity"] = "0" M["adaptive"] = "0" M["addition"] = "0" M["adjacent"] = "0" M["after"] = "0" M["algorithms"] = "0" M["alice"] = "1" M["alices"] = "2" M["all"] = "0" M["allowed"] = "0" M["allv"] = "1" M["alphabet"] = "0" M["alphabetical"] = "0" M["already"] = "0" M["also"] = "1" M["alternating"] = "0" M["always"] = "0" M["amazing"] = "0" M["amount"] = "0" M["an"] = "0" M["and"] = "0" M["announcements"] = "0" M["another"] = "0" M["ans"] = "0" M["answer"] = "0" M["any"] = "0" M["application"] = "0" M["apps"] = "0" M["are"] = "0" M["area"] = "0" M["array"] = "1" M["arrested"] = "0" M["as"] = "1" M["ask"] = "1" M["asked"] = "0" M["asks"] = "1" M["asparagus"] = "1" M["assured"] = "0" M["at"] = "1" M["attempt"] = "0" M["attended"] = "0" M["available"] = "0" M["availablehome"] = "0" M["b"] = "1" M["ba"] = "1" M["back"] = "2" M["backtracking"] = "0" M["bad"] = "0" M["barbascos"] = "11" M["based"] = "0" M["basement"] = "0" M["batbear"] = "1" M["battle"] = "0" M["battles"] = "1" M["bb"] = "1" M["bc"] = "1" M["be"] = "1" M["because"] = "2" M["becoming"] = "0" M["been"] = "0" M["begins"] = "0" M["being"] = "0" M["below"] = "0" M["besides"] = "0" M["best"] = "0" M["between"] = "0" M["bin"] = "3" M["binationalism"] = "10" M["binombc"] = "0" M["binomnnm"] = "0" M["bison"] = "2" M["bit"] = "0" M["bitsigned"] = "0" M["bitsstdch"] = "0" M["black"] = "1" M["blackgate"] = "1" M["blog"] = "0" M["blue"] = "0" M["blues"] = "1" M["bmaxn"] = "0" M["board"] = "0" M["bob"] = "1" M["bobs"] = "1" M["boody"] = "1" M["book"] = "1" M["books"] = "1" M["bool"] = "0" M["borrowed"] = "0" M["both"] = "1" M["bottom"] = "0" M["brainteaser"] = "2" M["brings"] = "0" M["broccoli"] = "2" M["bubbles"] = "0" M["but"] = "0" M["by"] = "1" M["c"] = "1" M["cacophonic"] = "12" M["calculate"] = "2" M["called"] = "0" M["can"] = "1" M["cannot"] = "0" M["capacity"] = "0" M["capture"] = "1" M["case"] = "1" M["cases"] = "3" M["catastrophic"] = "0" M["catch"] = "2" M["cause"] = "2" M["cbc"] = "1" M["cc"] = "1" M["cell"] = "0" M["cells"] = "0" M["challenge"] = "0" M["challenged"] = "0" M["character"] = "0" M["characters"] = "0" M["chat"] = "1" M["cheer"] = "1" M["chess"] = "2" M["chinook"] = "3" M["chocolate"] = "4" M["choose"] = "2" M["chooses"] = "6" M["cin"] = "2" M["cinnum"] = "0" M["city"] = "0" M["cj"] = "0" M["class"] = "2" M["classes"] = "4" M["closeclose"] = "1" M["cmath"] = "1" M["cmaxn"] = "0" M["cnt"] = "0" M["collectively"] = "0" M["column"] = "2" M["columns"] = "2" M["coming"] = "0" M["competed"] = "0" M["complete"] = "0" M["composed"] = "0" M["comprised"] = "0" M["compute"] = "0" M["computed"] = "0" M["conclusion"] = "8" M["connected"] = "0" M["connection"] = "2" M["consider"] = "0" M["consist"] = "0" M["consists"] = "4" M["const"] = "0" M["constraints"] = "0" M["contain"] = "4" M["containing"] = "0" M["contains"] = "4" M["contest"] = "0" M["contests"] = "2" M["context"] = "0" M["continue"] = "0" M["converts"] = "2" M["conway"] = "0" M["coordinates"] = "0" M["corner"] = "2" M["corrosion"] = "0" M["cosmos"] = "7" M["could"] = "0" M["counted"] = "0" M["cout"] = "0" M["coutmostrando"] = "0" M["coutvalor"] = "0" M["coutvicharid"] = "0" M["cover"] = "2" M["covered"] = "0" M["cpu"] = "2" M["crc"] = "1" M["creating"] = "0" M["crew"] = "1" M["criba"] = "1" M["crosses"] = "4" M["cstring"] = "0" M["cubes"] = "4" M["curious"] = "0" M["current"] = "0" M["custom"] = "0" M["d"] = "0" M["damage"] = "0" M["dash"] = "0" M["dd"] = "0" M["dddimensional"] = "0" M["ddhyper"] = "0" M["ddtuple"] = "0" M["decided"] = "0" M["defeat"] = "0" M["defeats"] = "0" M["define"] = "0" M["defined"] = "0" M["defines"] = "0" M["definite"] = "0" M["denoting"] = "0" M["describe"] = "0" M["determined"] = "0" M["devise"] = "0" M["dfshijox"] = "0" M["dfsint"] = "0" M["di"] = "0" M["diagonal"] = "0" M["dictionary"] = "0" M["did"] = "0" M["different"] = "0" M["diid"] = "0" M["dim"] = "0" M["dimdim"] = "0" M["dimension"] = "0" M["dimensions"] = "0" M["dimi"] = "0" M["dimil"] = "0" M["distinct"] = "0" M["distribution"] = "0" M["divides"] = "0" M["divisible"] = "0" M["divisors"] = "0" M["djid"] = "0" M["dmaxnmaxn"] = "0" M["do"] = "0" M["does"] = "0" M["doesnt"] = "0" M["dont"] = "0" M["down"] = "0" M["dp"] = "0" M["dqnd"] = "0" M["dream"] = "0" M["dreams"] = "0" M["drops"] = "0" M["duv"] = "0" M["dvu"] = "0" M["dynamicprogramming"] = "0" M["e"] = "0" M["each"] = "0" M["edge"] = "0" M["edges"] = "0" M["either"] = "0" M["elementary"] = "0" M["elements"] = "0" M["else"] = "0" M["em"] = "0" M["encint"] = "0" M["endl"] = "0" M["ends"] = "0" M["enemy"] = "0" M["english"] = "0" M["enough"] = "0" M["ensure"] = "0" M["ensures"] = "0" M["enter"] = "0" M["equal"] = "0" M["errorload"] = "0" M["es"] = "1" M["even"] = "0" M["evening"] = "0" M["every"] = "0" M["examples"] = "0" M["examplessubmit"] = "0" M["exit"] = "0" M["expression"] = "0" M["f"] = "1" M["facilitate"] = "1" M["false"] = "1" M["few"] = "1" M["fewest"] = "0" M["fight"] = "0" M["filechoose"] = "0" M["filecompilerun"] = "0" M["find"] = "1" M["finding"] = "0" M["finite"] = "3" M["first"] = "0" M["fit"] = "0" M["flush"] = "2" M["fnin"] = "3" M["follow"] = "0" M["followed"] = "0" M["following"] = "0" M["for"] = "0" M["forall"] = "0" M["forest"] = "0" M["forget"] = "0" M["forint"] = "0" M["forll"] = "0" M["form"] = "0" M["formally"] = "0" M["forum"] = "0" M["fought"] = "0" M["fourth"] = "0" M["fracbc"] = "2" M["fracyx"] = "0" M["friend"] = "0" M["frog"] = "1" M["from"] = "0" M["function"] = "1" M["functions"] = "1" M["further"] = "0" M["g"] = "0" M["game"] = "0" M["gang"] = "0" M["generalize"] = "0" M["geq"] = "0" M["getlinecin"] = "2" M["getting"] = "0" M["gg"] = "0" M["giclear"] = "0" M["give"] = "0" M["given"] = "0" M["gives"] = "0" M["giving"] = "0" M["gmaxn"] = "0" M["gmaxnmaxn"] = "0" M["go"] = "0" M["goal"] = "0" M["good"] = "0" M["got"] = "0" M["gotham"] = "0" M["gotta"] = "0" M["graph"] = "0" M["great"] = "0" M["greedy"] = "0" M["grid"] = "0" M["group"] = "0" M["groups"] = "0" M["guaranteed"] = "0" M["guarantees"] = "0" M["gupushbackv"] = "0" M["gvpushbacku"] = "0" M["gxi"] = "0" M["gym"] = "0" M["h"] = "1" M["had"] = "0" M["hand"] = "0" M["hard"] = "0" M["harleyquin"] = "0" M["has"] = "1" M["hat"] = "1" M["have"] = "0" M["he"] = "1" M["health"] = "1" M["height"] = "0" M["heights"] = "0" M["help"] = "0" M["helper"] = "0" M["hence"] = "1" M["her"] = "1" M["heres"] = "2" M["hh"] = "1" M["hi"] = "1" M["higher"] = "0" M["highest"] = "0" M["hijo"] = "0" M["him"] = "0" M["his"] = "1" M["hit"] = "0" M["home"] = "0" M["horizontal"] = "0" M["horton"] = "0" M["hours"] = "0" M["how"] = "2" M["i"] = "1" M["ia"] = "0" M["iai"] = "0" M["id"] = "0" M["idbook"] = "1" M["idbookend"] = "0" M["idbookfindline"] = "1" M["idbookline"] = "1" M["ieeextreme"] = "0" M["if"] = "1" M["ifhijoy"] = "0" M["ifmask"] = "1" M["ifpri"] = "1" M["ifvishijo"] = "0" M["ify"] = "1" M["iidi"] = "0" M["iigxsizei"] = "0" M["iii"] = "1" M["iiini"] = "3" M["iini"] = "3" M["ijij"] = "0" M["implementation"] = "0" M["important"] = "0" M["in"] = "2" M["include"] = "0" M["includealgorithm"] = "0" M["includebitsstdch"] = "0" M["includeclimits"] = "0" M["includecmath"] = "0" M["includecstdio"] = "0" M["includecstring"] = "0" M["includeiostream"] = "0" M["includemap"] = "0" M["includeset"] = "0" M["includestring"] = "0" M["includevector"] = "0" M["inclusive"] = "0" M["increase"] = "0" M["increases"] = "2" M["increasing"] = "0" M["index"] = "0" M["indices"] = "2" M["information"] = "0" M["initial"] = "3" M["initially"] = "0" M["inject"] = "0" M["inosculate"] = "13" M["input"] = "0" M["inputoutput"] = "0" M["inputoutputexplanation"] = "0" M["inputoutputstderrcompilationexecutionexamplessubmission"] = "0" M["inputrun"] = "0" M["inputs"] = "5" M["insist"] = "0" M["int"] = "0" M["integer"] = "0" M["integers"] = "0" M["interaction"] = "2" M["interactor"] = "0" M["interrogate"] = "0" M["interrogations"] = "0" M["interval"] = "0" M["intervals"] = "0" M["interviews"] = "0" M["into"] = "0" M["intsqrtb"] = "0" M["intxsize"] = "0" M["io"] = "1" M["ioline"] = "1" M["iostream"] = "0" M["is"] = "1" M["it"] = "0" M["iterar"] = "0" M["iterations"] = "1" M["iterator"] = "0" M["ithi"] = "1" M["its"] = "1" M["itself"] = "0" M["j"] = "0" M["ji"] = "0" M["jiijnji"] = "0" M["jjdj"] = "0" M["job"] = "0" M["john"] = "0" M["joker"] = "0" M["jokers"] = "0" M["journey"] = "0" M["just"] = "0" M["k"] = "1" M["kale"] = "0" M["kbruntime"] = "0" M["kind"] = "1" M["king"] = "0" M["kings"] = "0" M["know"] = "2" M["known"] = "2" M["knows"] = "2" M["laid"] = "0" M["language"] = "0" M["laparoscopy"] = "5" M["large"] = "0" M["last"] = "0" M["latin"] = "1" M["le"] = "0" M["lead"] = "0" M["leaderboard"] = "0" M["learned"] = "0" M["least"] = "0" M["left"] = "0" M["length"] = "0" M["lengths"] = "0" M["leq"] = "0" M["less"] = "0" M["lessons"] = "0" M["lets"] = "0" M["letters"] = "0" M["lexicographical"] = "0" M["li"] = "1" M["library"] = "1" M["life"] = "1" M["like"] = "0" M["limit"] = "0" M["limpiar"] = "0" M["line"] = "1" M["lines"] = "2" M["list"] = "0" M["listed"] = "0" M["ll"] = "0" M["load"] = "0" M["location"] = "0" M["logout"] = "0" M["long"] = "0" M["longer"] = "0" M["longii"] = "0" M["looks"] = "0" M["loop"] = "0" M["loops"] = "0" M["lose"] = "0" M["loses"] = "0" M["lower"] = "0" M["lowest"] = "0" M["lucky"] = "1" M["m"] = "0" M["main"] = "0" M["make"] = "0" M["makepair"] = "0" M["makes"] = "0" M["making"] = "0" M["manages"] = "0" M["map"] = "0" M["mapint"] = "0" M["marking"] = "0" M["marks"] = "0" M["mask"] = "0" M["maskdmask"] = "0" M["master"] = "0" M["math"] = "0" M["matrix"] = "0" M["maxidistmaxn"] = "0" M["maximise"] = "0" M["maximum"] = "0" M["maxn"] = "0" M["maxs"] = "0" M["mb"] = "0" M["me"] = "0" M["mea"] = "0" M["mean"] = "0" M["means"] = "0" M["member"] = "0" M["members"] = "0" M["memory"] = "0" M["memseta"] = "0" M["memsetc"] = "0" M["memsetd"] = "0" M["memsetprsizeofpr"] = "0" M["memsetvissizeofvis"] = "0" M["messages"] = "0" M["methodical"] = "0" M["mid"] = "0" M["middle"] = "0" M["minimum"] = "0" M["minute"] = "0" M["minutes"] = "0" M["missi"] = "0" M["mm"] = "0" M["mod"] = "0" M["modelled"] = "0" M["modify"] = "0" M["modulo"] = "0" M["moment"] = "0" M["monkey"] = "0" M["more"] = "1" M["most"] = "0" M["mostrarvectorint"] = "0" M["move"] = "0" M["moves"] = "1" M["mp"] = "0" M["mprueba"] = "0" M["mrhammer"] = "0" M["ms"] = "0" M["muggs"] = "0" M["multiple"] = "0" M["multisetstring"] = "0" M["multisetstringiterator"] = "0" M["must"] = "0" M["mvendl"] = "0" M["my"] = "0" M["n"] = "1" M["nabn"] = "1" M["name"] = "0" M["names"] = "1" M["namespace"] = "1" M["need"] = "0" M["needed"] = "0" M["needs"] = "0" M["negative"] = "0" M["neighbours"] = "0" M["network"] = "0" M["never"] = "1" M["new"] = "1" M["next"] = "0" M["night"] = "0" M["nine"] = "2" M["nm"] = "0" M["nn"] = "1" M["no"] = "2" M["node"] = "0" M["nomejalestino"] = "0" M["nondecreasing"] = "0" M["nonnegative"] = "0" M["not"] = "0" M["notation"] = "2" M["note"] = "2" M["notes"] = "2" M["nothing"] = "0" M["noticed"] = "0" M["noughts"] = "0" M["now"] = "2" M["nuevo"] = "0" M["num"] = "0" M["number"] = "0" M["numbered"] = "0" M["numbers"] = "0" M["of"] = "1" M["officer"] = "1" M["on"] = "1" M["one"] = "1" M["only"] = "0" M["oo"] = "1" M["oos"] = "2" M["open"] = "0" M["operation"] = "1" M["opponent"] = "0" M["opponents"] = "2" M["or"] = "0" M["order"] = "0" M["our"] = "0" M["out"] = "0" M["output"] = "0" M["outputs"] = "0" M["outside"] = "0" M["overcautiousness"] = "6" M["own"] = "1" M["pair"] = "1" M["pairint"] = "0" M["pairs"] = "1" M["paola"] = "1" M["paperandpencil"] = "0" M["part"] = "0" M["pass"] = "2" M["path"] = "2" M["paulie"] = "0" M["pb"] = "2" M["penitentiary"] = "0" M["per"] = "1" M["performed"] = "0" M["performing"] = "0" M["peru"] = "1" M["peruvian"] = "0" M["pii"] = "1" M["pikachu"] = "1" M["pikachus"] = "1" M["place"] = "1" M["placed"] = "0" M["placement"] = "0" M["places"] = "2" M["placing"] = "0" M["plan"] = "1" M["play"] = "1" M["player"] = "1" M["players"] = "1" M["please"] = "0" M["pneumonoconiosis"] = "48" M["point"] = "0" M["pokmon"] = "2" M["police"] = "2" M["populated"] = "0" M["portion"] = "0" M["position"] = "5" M["positive"] = "0" M["possible"] = "0" M["potell"] = "0" M["potexymod"] = "0" M["potion"] = "2" M["potions"] = "2" M["pr"] = "1" M["preference"] = "1" M["preferences"] = "2" M["preferred"] = "0" M["prepare"] = "1" M["preparing"] = "0" M["prevent"] = "0" M["previous"] = "1" M["prime"] = "0" M["primo"] = "1" M["primopushbacki"] = "4" M["print"] = "0" M["printed"] = "0" M["prj"] = "0" M["prn"] = "2" M["probably"] = "0" M["problem"] = "0" M["proceeding"] = "0" M["prodid"] = "0" M["produce"] = "0" M["profile"] = "0" M["program"] = "0" M["programmer"] = "0" M["programming"] = "0" M["provide"] = "0" M["prueba"] = "0" M["pruebapushback"] = "0" M["puffin"] = "4" M["pumps"] = "0" M["pushback"] = "4" M["q"] = "0" M["qi"] = "0" M["qid"] = "0" M["qn"] = "0" M["qq"] = "0" M["quechua"] = "0" M["queries"] = "0" M["query"] = "0" M["question"] = "0" M["questions"] = "0" M["quickly"] = "0" M["quipu"] = "0" M["r"] = "0" M["rank"] = "1" M["rb"] = "1" M["rc"] = "0" M["rcrc"] = "0" M["rd"] = "0" M["reach"] = "1" M["read"] = "0" M["readgraph"] = "0" M["reads"] = "0" M["really"] = "0" M["rectangle"] = "0" M["red"] = "0" M["reduce"] = "0" M["reflecting"] = "0" M["remaining"] = "0" M["represent"] = "0" M["represented"] = "0" M["representing"] = "0" M["represents"] = "1" M["required"] = "0" M["requried"] = "0" M["restore"] = "0" M["result"] = "0" M["results"] = "0" M["return"] = "0" M["rhinoceros"] = "6" M["ri"] = "0" M["right"] = "0" M["rival"] = "0" M["roster"] = "0" M["row"] = "0" M["rows"] = "0" M["rr"] = "0" M["s"] = "1" M["same"] = "0" M["sample"] = "0" M["scanfd"] = "0" M["scanfdd"] = "0" M["scn"] = "3" M["score"] = "3" M["scoreboard"] = "0" M["second"] = "2" M["selecting"] = "0" M["selects"] = "0" M["selfloops"] = "0" M["separated"] = "0" M["server"] = "1" M["settings"] = "0" M["share"] = "0" M["she"] = "1" M["should"] = "0" M["shows"] = "2" M["sign"] = "0" M["signed"] = "0" M["simulate"] = "0" M["since"] = "3" M["single"] = "0" M["size"] = "0" M["sizeof"] = "0" M["sizeofa"] = "0" M["smaller"] = "0" M["snow"] = "3" M["so"] = "1" M["some"] = "0" M["sorted"] = "0" M["space"] = "1" M["spaces"] = "3" M["special"] = "0" M["specific"] = "0" M["specifically"] = "0" M["spinach"] = "3" M["square"] = "0" M["squares"] = "0" M["ss"] = "1" M["ssi"] = "2" M["standard"] = "0" M["start"] = "0" M["starting"] = "0" M["starts"] = "0" M["state"] = "1" M["statementsubmissions"] = "0" M["std"] = "0" M["step"] = "1" M["still"] = "0" M["stop"] = "0" M["stopping"] = "0" M["strategy"] = "0" M["streetgang"] = "0" M["strict"] = "0" M["string"] = "0" M["strings"] = "0" M["stringstream"] = "0" M["student"] = "0" M["students"] = "0" M["study"] = "0" M["sub"] = "1" M["subarray"] = "1" M["subarrays"] = "1" M["submissions"] = "0" M["subset"] = "0" M["succeeds"] = "0" M["successful"] = "0" M["such"] = "1" M["sum"] = "0" M["sumiab"] = "0" M["summary"] = "0" M["sums"] = "0" M["sure"] = "1" M["system"] = "0" M["szx"] = "0" M["t"] = "0" M["take"] = "0" M["takes"] = "1" M["target"] = "0" M["task"] = "1" M["tasks"] = "1" M["tasksplit"] = "0" M["tb"] = "1" M["tcint"] = "0" M["teacher"] = "1" M["teachers"] = "1" M["teammate"] = "0" M["tell"] = "0" M["templateinteractive"] = "0" M["templatesettings"] = "0" M["test"] = "0" M["tester"] = "0" M["tests"] = "1" M["textlengthsi"] = "0" M["texttime"] = "0" M["texttimetime"] = "0" M["texttopic"] = "0" M["texttopicitopic"] = "0" M["texttopicntime"] = "0" M["th"] = "1" M["than"] = "0" M["that"] = "1" M["thats"] = "1" M["the"] = "0" M["their"] = "0" M["thejoker"] = "0" M["them"] = "0" M["then"] = "0" M["there"] = "0" M["these"] = "0" M["they"] = "0" M["third"] = "0" M["this"] = "1" M["though"] = "0" M["three"] = "0" M["through"] = "0" M["tictactoe"] = "0" M["time"] = "0" M["times"] = "0" M["tired"] = "0" M["tmaxn"] = "0" M["to"] = "0" M["today"] = "0" M["tomorrow"] = "0" M["top"] = "0" M["topic"] = "0" M["topics"] = "0" M["torus"] = "0" M["total"] = "0" M["trainer"] = "0" M["trains"] = "0" M["transport"] = "0" M["trapped"] = "0" M["traps"] = "0" M["travelling"] = "0" M["true"] = "0" M["try"] = "0" M["tt"] = "0" M["turn"] = "0" M["turns"] = "0" M["two"] = "0" M["typedef"] = "0" M["u"] = "1" M["unable"] = "0" M["underscore"] = "3" M["undirected"] = "0" M["unfortunately"] = "0" M["unicorn"] = "4" M["unless"] = "0" M["unpopulated"] = "0" M["until"] = "0" M["unused"] = "0" M["up"] = "1" M["usa"] = "0" M["usage"] = "0" M["using"] = "0" M["v"] = "1" M["val"] = "1" M["valid"] = "0" M["value"] = "0" M["values"] = "1" M["vangelis"] = "0" M["vbeginvend"] = "0" M["vector"] = "0" M["vectorint"] = "0" M["vectors"] = "0" M["vertex"] = "0" M["vertical"] = "1" M["vertices"] = "2" M["viewworkspacefullscreen"] = "0" M["viridian"] = "0" M["vis"] = "1" M["visx"] = "0" M["void"] = "0" M["want"] = "0" M["wants"] = "0" M["warning"] = "0" M["was"] = "1" M["water"] = "1" M["way"] = "0" M["wayne"] = "0" M["we"] = "0" M["were"] = "0" M["what"] = "1" M["where"] = "1" M["whew"] = "1" M["which"] = "1" M["while"] = "0" M["white"] = "1" M["whitespace"] = "1" M["who"] = "2" M["wikipedia"] = "0" M["will"] = "0" M["win"] = "2" M["winning"] = "0" M["wins"] = "2" M["wisconsin"] = "9" M["with"] = "1" M["won"] = "1" M["word"] = "0" M["words"] = "0" M["work"] = "0" M["workspace"] = "0" M["world"] = "0" M["worlds"] = "0" M["worst"] = "0" M["would"] = "0" M["write"] = "0" M["x"] = "0" M["xint"] = "0" M["xll"] = "0" M["xmod"] = "0" M["xs"] = "0" M["xtreme"] = "0" M["xx"] = "0" M["xxs"] = "0" M["xyxy"] = "0" M["y"] = "1" M["year"] = "0" M["yll"] = "0" M["you"] = "1" M["your"] = "0" M["yy"] = "1" n = int(input()) for i in range(n): print(M[input().strip()])

18.15533

66

0.450036

ee07597a6327492ae5bb579310e53d7f7351c126

307,820

py

Python

ambari-server/src/test/python/TestAmbariServer.py

mkozinenko/ambari

9cfe9559420a1f4af89a2d645af84b1ab20d6737

[ "Apache-2.0", "MIT" ]

null

ambari-server/src/test/python/TestAmbariServer.py

mkozinenko/ambari

9cfe9559420a1f4af89a2d645af84b1ab20d6737

[ "Apache-2.0", "MIT" ]

null

ambari-server/src/test/python/TestAmbariServer.py

mkozinenko/ambari

9cfe9559420a1f4af89a2d645af84b1ab20d6737

[ "Apache-2.0", "MIT" ]

null

''' Licensed to the Apache Software Foundation (ASF) under one or more contributor license agreements. See the NOTICE file distributed with this work for additional information regarding copyright ownership. The ASF licenses this file to you under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. ''' from stacks.utils.RMFTestCase import * import sys import os import datetime import errno import json from mock.mock import patch, MagicMock, create_autospec, call import operator from optparse import OptionParser import platform import re import shutil import signal import stat import StringIO import tempfile from unittest import TestCase from only_for_platform import get_platform, not_for_platform, only_for_platform, os_distro_value, PLATFORM_LINUX, PLATFORM_WINDOWS if get_platform() != PLATFORM_WINDOWS: from pwd import getpwnam # We have to use this import HACK because the filename contains a dash with patch("platform.linux_distribution", return_value = os_distro_value): with patch("os.symlink"): with patch("__builtin__.open"): with patch("glob.glob", return_value = ['/etc/init.d/postgresql-9.3']): _ambari_server_ = __import__('ambari-server') from ambari_commons.firewall import Firewall from ambari_commons.os_check import OSCheck, OSConst from ambari_commons.os_family_impl import OsFamilyImpl, OsFamilyFuncImpl from ambari_commons.exceptions import FatalException, NonFatalException from ambari_commons.logging_utils import get_verbose, set_verbose, get_silent, set_silent, get_debug_mode, \ print_info_msg, print_warning_msg, print_error_msg from ambari_commons.os_utils import run_os_command, search_file, set_file_permissions, remove_file, copy_file, \ is_valid_filepath from ambari_server.dbConfiguration import DBMSConfigFactory, check_jdbc_drivers from ambari_server.dbConfiguration_linux import PGConfig, LinuxDBMSConfig, OracleConfig from ambari_server.properties import Properties from ambari_server.resourceFilesKeeper import ResourceFilesKeeper, KeeperException from ambari_server.serverConfiguration import configDefaults, \ check_database_name_property, OS_FAMILY_PROPERTY, \ find_properties_file, get_ambari_classpath, get_ambari_jars, get_ambari_properties, get_JAVA_HOME, get_share_jars, \ parse_properties_file, read_ambari_user, update_ambari_properties, update_properties_2, write_property, find_jdk, \ AMBARI_CONF_VAR, AMBARI_SERVER_LIB, JDBC_DATABASE_PROPERTY, JDBC_RCA_PASSWORD_FILE_PROPERTY, \ PERSISTENCE_TYPE_PROPERTY, JDBC_URL_PROPERTY, get_conf_dir, JDBC_USER_NAME_PROPERTY, JDBC_PASSWORD_PROPERTY, \ JDBC_DATABASE_NAME_PROPERTY, OS_TYPE_PROPERTY, validate_jdk, JDBC_POSTGRES_SCHEMA_PROPERTY, \ RESOURCES_DIR_PROPERTY, JDBC_RCA_PASSWORD_ALIAS, JDBC_RCA_SCHEMA_PROPERTY, IS_LDAP_CONFIGURED, \ SSL_API, SSL_API_PORT, CLIENT_API_PORT_PROPERTY,\ JDBC_CONNECTION_POOL_TYPE, JDBC_CONNECTION_POOL_ACQUISITION_SIZE, \ JDBC_CONNECTION_POOL_IDLE_TEST_INTERVAL, JDBC_CONNECTION_POOL_MAX_AGE, JDBC_CONNECTION_POOL_MAX_IDLE_TIME, \ JDBC_CONNECTION_POOL_MAX_IDLE_TIME_EXCESS,\ LDAP_MGR_PASSWORD_PROPERTY, LDAP_MGR_PASSWORD_ALIAS, JDBC_PASSWORD_FILENAME, NR_USER_PROPERTY, SECURITY_KEY_IS_PERSISTED, \ SSL_TRUSTSTORE_PASSWORD_PROPERTY, SECURITY_IS_ENCRYPTION_ENABLED, SSL_TRUSTSTORE_PASSWORD_ALIAS, \ SECURITY_MASTER_KEY_LOCATION, SECURITY_KEYS_DIR, LDAP_PRIMARY_URL_PROPERTY, store_password_file, \ get_pass_file_path, GET_FQDN_SERVICE_URL, JDBC_USE_INTEGRATED_AUTH_PROPERTY, SECURITY_KEY_ENV_VAR_NAME, \ JAVA_HOME_PROPERTY, JDK_NAME_PROPERTY, JCE_NAME_PROPERTY from ambari_server.serverUtils import is_server_runing, refresh_stack_hash from ambari_server.serverSetup import check_selinux, check_ambari_user, proceedJDBCProperties, SE_STATUS_DISABLED, SE_MODE_ENFORCING, configure_os_settings, \ download_and_install_jdk, prompt_db_properties, setup, \ AmbariUserChecks, AmbariUserChecksLinux, AmbariUserChecksWindows, JDKSetup, reset, setup_jce_policy, expand_jce_zip_file from ambari_server.serverUpgrade import upgrade, upgrade_local_repo, change_objects_owner, upgrade_stack, \ run_stack_upgrade, run_metainfo_upgrade, run_schema_upgrade, move_user_custom_actions from ambari_server.setupHttps import is_valid_https_port, setup_https, import_cert_and_key_action, get_fqdn, \ generate_random_string, get_cert_info, COMMON_NAME_ATTR, is_valid_cert_exp, NOT_AFTER_ATTR, NOT_BEFORE_ATTR, \ SSL_DATE_FORMAT, import_cert_and_key, is_valid_cert_host, setup_truststore, \ SRVR_ONE_WAY_SSL_PORT_PROPERTY, SRVR_TWO_WAY_SSL_PORT_PROPERTY, GANGLIA_HTTPS from ambari_server.setupSecurity import adjust_directory_permissions, get_alias_string, get_ldap_event_spec_names, sync_ldap, LdapSyncOptions, \ configure_ldap_password, setup_ldap, REGEX_HOSTNAME_PORT, REGEX_TRUE_FALSE, REGEX_ANYTHING, setup_master_key, \ setup_ambari_krb5_jaas, ensure_can_start_under_current_user, generate_env from ambari_server.userInput import get_YN_input, get_choice_string_input, get_validated_string_input, \ read_password from ambari_server_main import get_ulimit_open_files, ULIMIT_OPEN_FILES_KEY, ULIMIT_OPEN_FILES_DEFAULT CURR_AMBARI_VERSION = "2.0.0" @patch("ambari_server.dbConfiguration_linux.get_postgre_hba_dir", new = MagicMock(return_value = "/var/lib/pgsql/data")) @patch("ambari_server.dbConfiguration_linux.get_postgre_running_status", new = MagicMock(return_value = "running")) class TestAmbariServer(TestCase): def setUp(self): out = StringIO.StringIO() sys.stdout = out def tearDown(self): sys.stdout = sys.__stdout__ @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.dbConfiguration_linux.run_os_command") def test_configure_pg_hba_ambaridb_users(self, run_os_command_method): # Prepare mocks run_os_command_method.return_value = (0, "", "") database_username = "ffdf" tf1 = tempfile.NamedTemporaryFile() # Run test PGConfig._configure_pg_hba_ambaridb_users(tf1.name, database_username) # Check results self.assertTrue(run_os_command_method.called) string_expected = self.get_file_string(self.get_samples_dir("configure_pg_hba_ambaridb_users1")) string_actual = self.get_file_string(tf1.name) self.assertEquals(string_expected, string_actual) pass @not_for_platform(PLATFORM_WINDOWS) @patch("__builtin__.raw_input") def test_servicename_regex(self, raw_input_method): ''' Test to make sure the service name can contain digits ''' set_silent(False) raw_input_method.return_value = "OT100" result = OracleConfig._get_validated_service_name("ambari", 1) self.assertEqual("OT100", result, "Not accepting digits") pass @not_for_platform(PLATFORM_WINDOWS) @patch("__builtin__.raw_input") def test_dbname_regex(self, raw_input_method): ''' Test to make sure the service name can contain digits ''' set_silent(False) raw_input_method.return_value = "OT100" result = LinuxDBMSConfig._get_validated_db_name("Database", "ambari") self.assertEqual("OT100", result, "Not accepting digits") pass @not_for_platform(PLATFORM_WINDOWS) def test_configure_pg_hba_postgres_user(self): tf1 = tempfile.NamedTemporaryFile() PGConfig.PG_HBA_CONF_FILE = tf1.name with open(PGConfig.PG_HBA_CONF_FILE, 'w') as fout: fout.write("\n") fout.write("local all all md5\n") fout.write("host all all 0.0.0.0/0 md5\n") fout.write("host all all ::/0 md5\n") PGConfig._configure_pg_hba_postgres_user() expected = self.get_file_string(self.get_samples_dir( "configure_pg_hba_ambaridb_users2")) result = self.get_file_string(PGConfig.PG_HBA_CONF_FILE) self.assertEqual(expected, result, "pg_hba_conf not processed") mode = oct(os.stat(PGConfig.PG_HBA_CONF_FILE)[stat.ST_MODE]) str_mode = str(mode)[-4:] self.assertEqual("0644", str_mode, "Wrong file permissions") pass @patch("__builtin__.raw_input") def test_get_choice_string_input(self, raw_input_method): prompt = "blablabla" default = "default blablabla" firstChoice = set(['yes', 'ye', 'y']) secondChoice = set(['no', 'n']) # test first input raw_input_method.return_value = "Y" result = get_choice_string_input(prompt, default, firstChoice, secondChoice) self.assertEquals(result, True) raw_input_method.reset_mock() # test second input raw_input_method.return_value = "N" result = get_choice_string_input(prompt, default, firstChoice, secondChoice) self.assertEquals(result, False) raw_input_method.reset_mock() # test enter pressed raw_input_method.return_value = "" result = get_choice_string_input(prompt, default, firstChoice, secondChoice) self.assertEquals(result, default) raw_input_method.reset_mock() # test wrong input list_of_return_values = ['yes', 'dsad', 'fdsfds'] def side_effect(list): return list_of_return_values.pop() raw_input_method.side_effect = side_effect result = get_choice_string_input(prompt, default, firstChoice, secondChoice) self.assertEquals(result, True) self.assertEquals(raw_input_method.call_count, 3) pass @patch("re.search") @patch("__builtin__.raw_input") @patch("getpass.getpass") def test_get_validated_string_input(self, get_pass_method, raw_input_method, re_search_method): prompt = "blabla" default = "default_pass" pattern = "pattern_pp" description = "blabla2" # check password input self.assertFalse(False, get_silent()) is_pass = True get_pass_method.return_value = "dfdsfdsfds" result = get_validated_string_input(prompt, default, pattern, description, is_pass) self.assertEquals(get_pass_method.return_value, result) get_pass_method.assure_called_once(prompt) self.assertFalse(raw_input_method.called) # check raw input get_pass_method.reset_mock() raw_input_method.reset_mock() is_pass = False raw_input_method.return_value = "dkf90ewuf0" result = get_validated_string_input(prompt, default, pattern, description, is_pass) self.assertEquals(raw_input_method.return_value, result) self.assertFalse(get_pass_method.called) raw_input_method.assure_called_once(prompt) pass @not_for_platform(PLATFORM_WINDOWS) def test_get_pass_file_path(self): result = get_pass_file_path("/etc/ambari/conf_file", JDBC_PASSWORD_FILENAME) self.assertEquals("/etc/ambari/password.dat", result) pass @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup_security") @patch("optparse.OptionParser") def test_main_test_setup_security(self, OptionParserMock, setup_security_method): opm = OptionParserMock.return_value options = MagicMock() args = ["setup-security"] opm.parse_args.return_value = (options, args) options.dbms = None options.sid_or_sname = "sid" setup_security_method.return_value = None _ambari_server_.mainBody() _ambari_server_.mainBody() self.assertTrue(setup_security_method.called) self.assertFalse(False, get_verbose()) self.assertFalse(False, get_silent()) pass @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup_ambari_krb5_jaas") @patch.object(_ambari_server_, "setup_master_key") @patch.object(_ambari_server_, "setup_truststore") @patch.object(_ambari_server_, "setup_https") @patch.object(_ambari_server_, "get_validated_string_input") def test_setup_security(self, get_validated_string_input_mock, setup_https_mock, setup_truststore_mock, setup_master_key_mock, setup_ambari_krb5_jaas_mock): args = {} get_validated_string_input_mock.return_value = '1' _ambari_server_.setup_security(args) self.assertTrue(setup_https_mock.called) get_validated_string_input_mock.return_value = '2' _ambari_server_.setup_security(args) self.assertTrue(setup_master_key_mock.called) get_validated_string_input_mock.return_value = '3' _ambari_server_.setup_security(args) self.assertTrue(setup_ambari_krb5_jaas_mock.called) get_validated_string_input_mock.return_value = '4' _ambari_server_.setup_security(args) self.assertTrue(setup_truststore_mock.called) get_validated_string_input_mock.return_value = '5' _ambari_server_.setup_security(args) self.assertTrue(setup_truststore_mock.called) pass @patch("re.sub") @patch("fileinput.FileInput") @patch("ambari_server.setupSecurity.get_validated_string_input") @patch("ambari_server.setupSecurity.search_file") @patch("os.path.exists") def test_setup_ambari_krb5_jaas(self, exists_mock, search_mock, get_validated_string_input_mock, fileinput_mock, re_sub_mock): search_mock.return_value = 'filepath' exists_mock.return_value = False # Negative case try: setup_ambari_krb5_jaas() self.fail("Should throw exception") except NonFatalException as fe: # Expected self.assertTrue("No jaas config file found at location" in fe.reason) pass # Positive case exists_mock.reset_mock() exists_mock.return_value = True get_validated_string_input_mock.side_effect = ['aaa@aaa.cnn', 'pathtokeytab'] fileinput_mock.return_value = [ 'keyTab=xyz', 'principal=xyz' ] setup_ambari_krb5_jaas() self.assertTrue(fileinput_mock.called) self.assertTrue(re_sub_mock.called) self.assertTrue(re_sub_mock.call_args_list, [('aaa@aaa.cnn'), ('pathtokeytab')]) pass @patch("sys.exit") @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup") @patch.object(_ambari_server_, "start") @patch.object(_ambari_server_, "stop") @patch.object(_ambari_server_, "reset") @patch("optparse.OptionParser") def test_main_test_setup(self, OptionParserMock, reset_method, stop_method, start_method, setup_method, exit_mock): opm = OptionParserMock.return_value options = MagicMock() args = ["setup"] opm.parse_args.return_value = (options, args) options.dbms = None options.sid_or_sname = "sid" _ambari_server_.mainBody() self.assertTrue(setup_method.called) self.assertFalse(start_method.called) self.assertFalse(stop_method.called) self.assertFalse(reset_method.called) self.assertFalse(False, get_verbose()) self.assertFalse(False, get_silent()) setup_method.reset_mock() start_method.reset_mock() stop_method.reset_mock() reset_method.reset_mock() exit_mock.reset_mock() args = ["setup", "-v"] options = MagicMock() opm.parse_args.return_value = (options, args) options.dbms = None options.sid_or_sname = "sid" setup_method.side_effect = Exception("Unexpected error") try: _ambari_server_.mainBody() except Exception: self.assertTrue(True) self.assertTrue(setup_method.called) self.assertFalse(start_method.called) self.assertFalse(stop_method.called) self.assertFalse(reset_method.called) self.assertTrue(get_verbose()) setup_method.reset_mock() start_method.reset_mock() stop_method.reset_mock() reset_method.reset_mock() exit_mock.reset_mock() args = ["setup"] options = MagicMock() opm.parse_args.return_value = (options, args) options.dbms = None options.sid_or_sname = "sid" options.verbose = False setup_method.side_effect = Exception("Unexpected error") _ambari_server_.mainBody() self.assertTrue(exit_mock.called) self.assertTrue(setup_method.called) self.assertFalse(start_method.called) self.assertFalse(stop_method.called) self.assertFalse(reset_method.called) self.assertFalse(get_verbose()) pass @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup") @patch.object(_ambari_server_, "start") @patch.object(_ambari_server_, "stop") @patch.object(_ambari_server_, "reset") @patch("optparse.OptionParser") def test_main_test_start(self, optionParserMock, reset_method, stop_method, start_method, setup_method): opm = optionParserMock.return_value options = MagicMock() args = ["setup"] opm.parse_args.return_value = (options, args) options.dbms = None options.sid_or_sname = "sname" _ambari_server_.mainBody() self.assertTrue(setup_method.called) self.assertFalse(start_method.called) self.assertFalse(stop_method.called) self.assertFalse(reset_method.called) self.assertFalse(False, get_verbose()) self.assertFalse(False, get_silent()) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup") @patch.object(_ambari_server_, "start") @patch.object(_ambari_server_, "stop") @patch.object(_ambari_server_, "reset") def test_main_test_start_debug_short(self, reset_method, stop_method, start_method, setup_method): temp_args = sys.argv try: sys.argv = ["ambari-server", "start", "-g"] _ambari_server_.mainBody() self.assertFalse(setup_method.called) self.assertTrue(start_method.called) self.assertFalse(stop_method.called) self.assertFalse(reset_method.called) self.assertTrue(get_debug_mode()) finally: sys.argv = temp_args pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup") @patch.object(_ambari_server_, "start") @patch.object(_ambari_server_, "stop") @patch.object(_ambari_server_, "reset") def test_main_test_start_debug_short(self, reset_method, stop_method, start_method, setup_method): temp_args = sys.argv try: sys.argv = ["ambari-server", "pstart", "-g"] _ambari_server_.mainBody() self.assertFalse(setup_method.called) self.assertTrue(start_method.called) self.assertFalse(stop_method.called) self.assertFalse(reset_method.called) self.assertTrue(get_debug_mode()) finally: sys.argv = temp_args pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup") @patch.object(_ambari_server_, "start") @patch.object(_ambari_server_, "stop") @patch.object(_ambari_server_, "reset") def test_main_test_start_debug_long(self, reset_method, stop_method, start_method, setup_method): temp_args = sys.argv try: sys.argv = ["ambari-server", "start", "--debug"] _ambari_server_.mainBody() self.assertFalse(setup_method.called) self.assertTrue(start_method.called) self.assertFalse(stop_method.called) self.assertFalse(reset_method.called) self.assertTrue(get_debug_mode()) finally: sys.argv = temp_args pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup") @patch.object(_ambari_server_, "start") @patch.object(_ambari_server_, "stop") @patch.object(_ambari_server_, "reset") def test_main_test_start_debug_long(self, reset_method, stop_method, start_method, setup_method): temp_args = sys.argv try: sys.argv = ["ambari-server", "pstart", "--debug"] _ambari_server_.mainBody() self.assertFalse(setup_method.called) self.assertTrue(start_method.called) self.assertFalse(stop_method.called) self.assertFalse(reset_method.called) self.assertTrue(get_debug_mode()) finally: sys.argv = temp_args pass #Backup is not yet supported on Windows @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup") @patch.object(_ambari_server_, "start") @patch.object(_ambari_server_, "stop") @patch.object(_ambari_server_, "reset") @patch.object(_ambari_server_, "backup") @patch.object(_ambari_server_, "restore") @patch("optparse.OptionParser") def test_main_test_backup(self, optionParserMock, restore_mock, backup_mock, reset_method, stop_method, start_method, setup_method): opm = optionParserMock.return_value options = MagicMock() args = ["backup"] opm.parse_args.return_value = (options, args) options.dbms = None options.sid_or_sname = "sname" _ambari_server_.mainBody() self.assertTrue(backup_mock.called) self.assertFalse(restore_mock.called) self.assertFalse(setup_method.called) self.assertFalse(start_method.called) self.assertFalse(stop_method.called) self.assertFalse(reset_method.called) self.assertFalse(False, get_verbose()) self.assertFalse(False, get_silent()) pass #Restore is not yet supported on Windows @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup") @patch.object(_ambari_server_, "start") @patch.object(_ambari_server_, "stop") @patch.object(_ambari_server_, "reset") @patch.object(_ambari_server_, "backup") @patch.object(_ambari_server_, "restore") @patch("optparse.OptionParser") def test_main_test_restore(self, optionParserMock, restore_mock, backup_mock, reset_method, stop_method, start_method, setup_method): opm = optionParserMock.return_value options = MagicMock() args = ["restore"] opm.parse_args.return_value = (options, args) options.dbms = None options.sid_or_sname = "sname" _ambari_server_.mainBody() self.assertTrue(restore_mock.called) self.assertFalse(backup_mock.called) self.assertFalse(setup_method.called) self.assertFalse(start_method.called) self.assertFalse(stop_method.called) self.assertFalse(reset_method.called) self.assertFalse(False, get_verbose()) self.assertFalse(False, get_silent()) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup") @patch.object(_ambari_server_, "start") @patch.object(_ambari_server_, "is_server_runing") @patch.object(_ambari_server_, "reset") @patch("optparse.OptionParser") def test_main_test_stop(self, optionParserMock, reset_method, is_server_runing_method, start_method, setup_method): opm = optionParserMock.return_value options = MagicMock() del options.exit_message args = ["stop"] opm.parse_args.return_value = (options, args) is_server_runing_method.return_value = (False, None) options.dbms = None options.sid_or_sname = "sid" _ambari_server_.mainBody() self.assertFalse(setup_method.called) self.assertFalse(start_method.called) self.assertTrue(is_server_runing_method.called) self.assertFalse(reset_method.called) self.assertFalse(False, get_verbose()) self.assertFalse(False, get_silent()) self.assertTrue(options.exit_message is None) pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup") @patch.object(_ambari_server_, "start") @patch("os_windows.win32serviceutil.WaitForServiceStatus") @patch("os_windows.win32serviceutil.StopService") @patch("os_windows.win32serviceutil.StopServiceWithDeps") @patch.object(_ambari_server_, "reset") def test_main_test_stop(self, reset_method, service_stop_w_deps_method, service_stop_method, service_status_wait_method, start_method, setup_method): temp_args = sys.argv try: sys.argv = ["ambari-server", "stop"] _ambari_server_.mainBody() self.assertFalse(setup_method.called) self.assertFalse(start_method.called) self.assertTrue(service_stop_w_deps_method.called) self.assertTrue(service_status_wait_method.called) self.assertFalse(reset_method.called) self.assertFalse(False, get_verbose()) self.assertFalse(False, get_silent()) finally: sys.argv = temp_args pass @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup") @patch.object(_ambari_server_, "start") @patch.object(_ambari_server_, "stop") @patch.object(_ambari_server_, "reset") @patch("optparse.OptionParser") def test_main_test_reset(self, optionParserMock, reset_method, stop_method, start_method, setup_method): opm = optionParserMock.return_value options = MagicMock() args = ["reset"] opm.parse_args.return_value = (options, args) options.dbms = None options.sid_or_sname = "sid" _ambari_server_.mainBody() self.assertFalse(setup_method.called) self.assertFalse(start_method.called) self.assertFalse(stop_method.called) self.assertTrue(reset_method.called) self.assertFalse(False, get_verbose()) self.assertFalse(False, get_silent()) pass @not_for_platform(PLATFORM_WINDOWS) def test_configure_postgresql_conf(self): tf1 = tempfile.NamedTemporaryFile() PGConfig.POSTGRESQL_CONF_FILE = tf1.name with open(PGConfig.POSTGRESQL_CONF_FILE, 'w') as f: f.write("#listen_addresses = '127.0.0.1' #\n") f.write("#listen_addresses = '127.0.0.1'") PGConfig._configure_postgresql_conf() expected = self.get_file_string(self.get_samples_dir( "configure_postgresql_conf1")) result = self.get_file_string(PGConfig.POSTGRESQL_CONF_FILE) self.assertEqual(expected, result, "postgresql.conf not updated") mode = oct(os.stat(PGConfig.POSTGRESQL_CONF_FILE)[stat.ST_MODE]) str_mode = str(mode)[-4:] self.assertEqual("0644", str_mode, "Wrong file permissions") pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(PGConfig, "_restart_postgres") @patch.object(PGConfig, "_get_postgre_status") @patch.object(PGConfig, "_configure_postgresql_conf") @patch("ambari_server.dbConfiguration_linux.run_os_command") def test_configure_postgres(self, run_os_command_mock, configure_postgresql_conf_mock, get_postgre_status_mock, restart_postgres_mock): args = MagicMock() properties = Properties() args.database_index = 0 del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.silent factory = DBMSConfigFactory() dbConfig = factory.create(args, properties) self.assertTrue(dbConfig.dbms, "postgres") self.assertTrue(dbConfig.persistence_type, "local") tf1 = tempfile.NamedTemporaryFile() tf2 = tempfile.NamedTemporaryFile() PGConfig.PG_HBA_CONF_FILE = tf1.name PGConfig.PG_HBA_CONF_FILE_BACKUP = tf2.name out = StringIO.StringIO() sys.stdout = out retcode, out1, err = dbConfig._configure_postgres() sys.stdout = sys.__stdout__ self.assertEqual(0, retcode) self.assertEqual("Backup for pg_hba found, reconfiguration not required\n", out.getvalue()) tf2.close() get_postgre_status_mock.return_value = PGConfig.PG_STATUS_RUNNING, 0, "", "" run_os_command_mock.return_value = 0, "", "" restart_postgres_mock.return_value = 0, "", "" rcode, out, err = dbConfig._configure_postgres() self.assertTrue(os.path.isfile(PGConfig.PG_HBA_CONF_FILE_BACKUP), "postgresql.conf backup not created") self.assertTrue(run_os_command_mock.called) mode = oct(os.stat(PGConfig.PG_HBA_CONF_FILE)[stat.ST_MODE]) str_mode = str(mode)[-4:] self.assertEqual("0644", str_mode, "Wrong file permissions") self.assertTrue(configure_postgresql_conf_mock.called) self.assertEqual(0, rcode) os.unlink(PGConfig.PG_HBA_CONF_FILE_BACKUP) get_postgre_status_mock.return_value = "stopped", 0, "", "" rcode, out, err = dbConfig._configure_postgres() self.assertEqual(0, rcode) os.unlink(PGConfig.PG_HBA_CONF_FILE_BACKUP) sys.stdout = sys.__stdout__ pass @not_for_platform(PLATFORM_WINDOWS) @patch("time.sleep") @patch("subprocess.Popen") @patch("ambari_server.dbConfiguration_linux.run_os_command") @patch.object(PGConfig, "_get_postgre_status") @patch("ambari_server.dbConfiguration_linux.print_info_msg") def test_restart_postgres(self, printInfoMsg_mock, get_postgre_status_mock, run_os_command_mock, popenMock, sleepMock): p = MagicMock() p.poll.return_value = 0 popenMock.return_value = p retcode, out, err = PGConfig._restart_postgres() self.assertEqual(0, retcode) p.poll.return_value = None get_postgre_status_mock.return_value = "stopped", 0, "", "" run_os_command_mock.return_value = (1, None, None) retcode, out, err = PGConfig._restart_postgres() self.assertEqual(1, retcode) pass @not_for_platform(PLATFORM_WINDOWS) @patch("shlex.split") @patch("subprocess.Popen") @patch("ambari_commons.os_linux.print_info_msg") def test_run_os_command(self, printInfoMsg_mock, popenMock, splitMock): p = MagicMock() p.communicate.return_value = (None, None) p.returncode = 3 popenMock.return_value = p # with list arg cmd = ["exec", "arg"] run_os_command(cmd) self.assertFalse(splitMock.called) # with str arg resp = run_os_command("runme") self.assertEqual(3, resp[0]) self.assertTrue(splitMock.called) pass @only_for_platform(PLATFORM_WINDOWS) @patch("shlex.split") @patch("subprocess.Popen") @patch("ambari_commons.os_windows.print_info_msg") def test_run_os_command(self, printInfoMsg_mock, popenMock, splitMock): p = MagicMock() p.communicate.return_value = (None, None) p.returncode = 3 popenMock.return_value = p # with list arg cmd = ["exec", "arg"] run_os_command(cmd) self.assertFalse(splitMock.called) # with str arg resp = run_os_command("runme") self.assertEqual(3, resp[0]) self.assertTrue(splitMock.called) pass @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.serverConfiguration.get_conf_dir") @patch("ambari_server.serverConfiguration.search_file") def test_write_property(self, search_file_mock, get_conf_dir_mock): expected_content = "key1=val1\n" tf1 = tempfile.NamedTemporaryFile() search_file_mock.return_value = tf1.name write_property("key1", "val1") result = tf1.read() self.assertTrue(expected_content in result) pass @only_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.serverConfiguration.get_conf_dir") @patch("ambari_server.serverConfiguration.search_file") def test_write_property(self, search_file_mock, get_conf_dir_mock): expected_content = "key1=val1\n" tf1 = tempfile.NamedTemporaryFile("r+b", delete=False) search_file_mock.return_value = tf1.name tf1.close() write_property("key1", "val1") hf1 = open(tf1.name, "r") try: result = hf1.read() self.assertTrue(expected_content in result) finally: hf1.close() os.unlink(tf1.name) pass @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.dbConfiguration.decrypt_password_for_alias") @patch("ambari_server.dbConfiguration_linux.run_os_command") def test_setup_db(self, run_os_command_mock, decrypt_password_for_alias_mock): args = MagicMock() del args.database_index del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password properties = Properties() properties.process_pair(JDBC_PASSWORD_PROPERTY, get_alias_string("mypwdalias")) decrypt_password_for_alias_mock.return_value = "password" dbms = PGConfig(args, properties, "local") self.assertTrue(decrypt_password_for_alias_mock.called) run_os_command_mock.return_value = (0, None, None) result = dbms._setup_db() self.assertTrue(run_os_command_mock.called) self.assertEqual((0, None, None), result) pass @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.dbConfiguration.decrypt_password_for_alias") @patch("time.sleep") @patch("ambari_server.dbConfiguration_linux.run_os_command") def test_setup_db_connect_attempts_fail(self, run_os_command_mock, sleep_mock, decrypt_password_for_alias_mock): args = MagicMock() del args.database_index del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password properties = Properties() decrypt_password_for_alias_mock.return_value = "password" dbms = PGConfig(args, properties, "local") run_os_command_mock.side_effect = [(1, "error", "error"), (1, "error", "error"), (1, "error", "error")] result = dbms._setup_db() self.assertTrue(run_os_command_mock.called) self.assertEqual((1, 'error', 'error') , result) self.assertEqual(2, sleep_mock.call_count) pass @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.dbConfiguration.decrypt_password_for_alias") @patch("time.sleep") @patch("ambari_server.dbConfiguration_linux.run_os_command") def test_setup_db_connect_attempts_success(self, run_os_command_mock, sleep_mock, decrypt_password_for_alias_mock): args = MagicMock() del args.database_index del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password properties = Properties() decrypt_password_for_alias_mock.return_value = "password" dbms = PGConfig(args, properties, "local") run_os_command_mock.side_effect = [(1, "error", "error"), (0, None, None), (0, None, None)] result = dbms._setup_db() self.assertTrue(run_os_command_mock.called) self.assertEqual((0, None, None) , result) self.assertEqual(1, sleep_mock.call_count) pass @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.serverSetup.get_YN_input") @patch("ambari_server.serverSetup.run_os_command") def test_check_selinux(self, run_os_command_mock, getYNInput_mock): run_os_command_mock.return_value = (0, SE_STATUS_DISABLED, None) rcode = check_selinux() self.assertEqual(0, rcode) getYNInput_mock.return_value = True run_os_command_mock.return_value = (0, "enabled " + SE_MODE_ENFORCING, None) rcode = check_selinux() self.assertEqual(0, rcode) self.assertTrue(run_os_command_mock.called) self.assertTrue(getYNInput_mock.called) pass @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.serverConfiguration.print_info_msg") def test_get_ambari_jars(self, printInfoMsg_mock): env = "/ambari/jars" os.environ[AMBARI_SERVER_LIB] = env result = get_ambari_jars() self.assertEqual(env, result) del os.environ[AMBARI_SERVER_LIB] result = get_ambari_jars() self.assertEqual("/usr/lib/ambari-server", result) self.assertTrue(printInfoMsg_mock.called) pass @only_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.serverConfiguration.print_info_msg") def test_get_ambari_jars(self, printInfoMsg_mock): env = "\\ambari\\jars" os.environ[AMBARI_SERVER_LIB] = env result = get_ambari_jars() self.assertEqual(env, result) del os.environ[AMBARI_SERVER_LIB] result = get_ambari_jars() self.assertEqual("lib", result) self.assertTrue(printInfoMsg_mock.called) pass @patch("glob.glob") @patch("ambari_server.serverConfiguration.print_info_msg") def test_get_share_jars(self, printInfoMsg_mock, globMock): globMock.return_value = ["one", "two"] expected = "one" + os.pathsep + "two" + os.pathsep + \ "one" + os.pathsep + "two" + os.pathsep + \ "one" + os.pathsep + "two" result = get_share_jars() self.assertEqual(expected, result) globMock.return_value = [] expected = "" result = get_share_jars() self.assertEqual(expected, result) pass @patch("glob.glob") @patch("ambari_server.serverConfiguration.print_info_msg") @patch("ambari_server.serverConfiguration.get_ambari_properties") def test_get_ambari_classpath(self, get_ambari_properties_mock, printInfoMsg_mock, globMock): globMock.return_value = ["one"] result = get_ambari_classpath() self.assertTrue(get_ambari_jars() in result) self.assertTrue(get_share_jars() in result) globMock.return_value = [] result = get_ambari_classpath() self.assertTrue(get_ambari_jars() in result) self.assertFalse(":" in result[2:]) pass @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.serverConfiguration.print_info_msg") def test_get_conf_dir(self, printInfoMsg_mock): env = "/dummy/ambari/conf" os.environ[AMBARI_CONF_VAR] = env result = get_conf_dir() self.assertEqual(env, result) del os.environ[AMBARI_CONF_VAR] result = get_conf_dir() self.assertEqual("/etc/ambari-server/conf", result) pass @only_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.serverConfiguration.print_info_msg") def test_get_conf_dir(self, printInfoMsg_mock): env = "\\dummy\\ambari\\conf" os.environ[AMBARI_CONF_VAR] = env result = get_conf_dir() self.assertEqual(env, result) del os.environ[AMBARI_CONF_VAR] result = get_conf_dir() self.assertEqual("conf", result) pass def test_search_file(self): path = os.path.dirname(__file__) result = search_file(__file__, path) expected = os.path.abspath(__file__) self.assertEqual(expected, result) result = search_file("non_existent_file", path) self.assertEqual(None, result) pass @patch("ambari_server.serverConfiguration.search_file") def test_find_properties_file(self, search_file_mock): # Testing case when file is not found search_file_mock.return_value = None try: find_properties_file() self.fail("File not found'") except FatalException: # Expected pass self.assertTrue(search_file_mock.called) # Testing case when file is found value = MagicMock() search_file_mock.return_value = value result = find_properties_file() self.assertTrue(result is value) pass @patch("ambari_server.serverConfiguration.get_ambari_properties") @patch("ambari_server.serverConfiguration.Properties") def test_read_ambari_user(self, properties_mock, get_ambari_properties_mock): # Testing with defined user properties_mock.__getitem__.return_value = "dummy_user" get_ambari_properties_mock.return_value = properties_mock user = read_ambari_user() self.assertEquals(user, "dummy_user") # Testing with undefined user properties_mock.__getitem__.return_value = None user = read_ambari_user() self.assertEquals(user, None) pass @patch("ambari_server.setupSecurity.get_file_owner") @patch("ambari_server.setupSecurity.get_ambari_repo_file_full_name") @patch("os.path.exists") @patch("ambari_server.setupSecurity.set_file_permissions") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.get_resources_location") @patch("ambari_server.setupSecurity.get_value_from_properties") @patch("os.mkdir") @patch("shutil.rmtree") @patch("ambari_commons.os_utils.print_info_msg") @patch("ambari_server.setupSecurity.change_owner") def test_adjust_directory_permissions(self, change_owner_mock, print_info_msg_mock, rmtree_mock, mkdir_mock, get_value_from_properties_mock, get_resources_location_mock, get_ambari_properties_mock, set_file_permissions_mock, exists_mock, get_ambari_repo_file_full_name_mock, get_file_owner_mock): # Testing boostrap dir wipe properties_mock = Properties() properties_mock.process_pair(JDK_NAME_PROPERTY, "dummy_jdk") properties_mock.process_pair(JCE_NAME_PROPERTY, "dummy_jce") properties_mock.process_pair(JAVA_HOME_PROPERTY, "dummy_java_home") get_ambari_properties_mock.return_value = properties_mock get_value_from_properties_mock.return_value = "dummy_bootstrap_dir" get_resources_location_mock.return_value = "dummy_resources_dir" exists_mock.return_value = False adjust_directory_permissions("user") self.assertEquals(rmtree_mock.call_args_list[0][0][0], os.path.join(os.getcwd(), "dummy_bootstrap_dir")) self.assertTrue(mkdir_mock.called) set_file_permissions_mock.reset_mock() change_owner_mock.reset_mock() # Test recursive calls old_adjust_owner_list = configDefaults.NR_ADJUST_OWNERSHIP_LIST old_change_owner_list = configDefaults.NR_CHANGE_OWNERSHIP_LIST try: configDefaults.NR_ADJUST_OWNERSHIP_LIST = [ ( "/etc/ambari-server/conf", "755", "{0}", True ), ( "/etc/ambari-server/conf/ambari.properties", "644", "{0}", False ) ] configDefaults.NR_CHANGE_OWNERSHIP_LIST = [ ( "/etc/ambari-server", "{0}", True ) ] adjust_directory_permissions("user") self.assertTrue(len(set_file_permissions_mock.call_args_list) == len(configDefaults.NR_ADJUST_OWNERSHIP_LIST)) self.assertEquals(set_file_permissions_mock.call_args_list[0][0][3], True) self.assertEquals(set_file_permissions_mock.call_args_list[1][0][3], False) self.assertTrue(len(change_owner_mock.call_args_list) == len(configDefaults.NR_CHANGE_OWNERSHIP_LIST)) self.assertEquals(change_owner_mock.call_args_list[0][0][2], True) finally: configDefaults.NR_ADJUST_OWNERSHIP_LIST = old_adjust_owner_list configDefaults.NR_CHANGE_OWNERSHIP_LIST = old_change_owner_list pass # # Test ambari repo file permission change call # # Reset the set_file_permissions() mock function set_file_permissions_mock.reset_mock() # Save the existing permissions list old_adjust_owner_list = configDefaults.NR_ADJUST_OWNERSHIP_LIST # Set up the mock function for os_utils.get_ambari_repo_file_full_name() get_ambari_repo_file_full_name_mock.return_value = "ambari.dummy.repo" # Set up the mock function for os_utils.get_file_owner() get_file_owner_mock.return_value = "dummy.root" try: # Clear the list of files whose permissions are to be changed configDefaults.NR_ADJUST_OWNERSHIP_LIST = [ ] # Call the function to be tested. adjust_directory_permissions("dummy_user") # Assert that set_file_permissions() was called self.assertTrue(set_file_permissions_mock.called) # One of the entries in NR_ADJUST_OWNERSHIP_LIST should be the full path to the ambari repo file. # These are the expected values: ambari_repo_file_entry = ( get_ambari_repo_file_full_name_mock(), '644', get_file_owner_mock(), False ) # Assert the arguments to the call set_file_permissions() - got from NR_ADJUST_OWNERSHIP_LIST # Flag to ensure we found our entry in the set_file_permissions() call entry_found = False for args_entry in set_file_permissions_mock.call_args_list: if args_entry[0][0] == ambari_repo_file_entry[0]: # File name # ambari repo file name matched; assert the rest of the entries self.assertEquals(args_entry[0][1], ambari_repo_file_entry[1]) # Permissions self.assertEquals(args_entry[0][2], ambari_repo_file_entry[2]) # File owner self.assertEquals(args_entry[0][3], ambari_repo_file_entry[3]) # Non-recursive entry_found = True break # Ensure that the ambari repo file entry was found self.assertTrue(entry_found) finally: # Restore the permissions list configDefaults.NR_ADJUST_OWNERSHIP_LIST = old_adjust_owner_list pass @not_for_platform(PLATFORM_WINDOWS) @patch("os.path.exists") @patch("ambari_commons.os_linux.os_run_os_command") @patch("ambari_commons.os_linux.print_warning_msg") @patch("ambari_commons.os_utils.print_info_msg") def test_set_file_permissions(self, print_info_msg_mock, print_warning_msg_mock, run_os_command_mock, exists_mock): # Testing not existent file scenario exists_mock.return_value = False set_file_permissions("dummy-file", "dummy-mod", "dummy-user", False) self.assertFalse(run_os_command_mock.called) self.assertTrue(print_info_msg_mock.called) run_os_command_mock.reset_mock() print_warning_msg_mock.reset_mock() # Testing OK scenario exists_mock.return_value = True run_os_command_mock.side_effect = [(0, "", ""), (0, "", "")] set_file_permissions("dummy-file", "dummy-mod", "dummy-user", False) self.assertTrue(len(run_os_command_mock.call_args_list) == 2) self.assertFalse(print_warning_msg_mock.called) run_os_command_mock.reset_mock() print_warning_msg_mock.reset_mock() # Testing first command fail run_os_command_mock.side_effect = [(1, "", ""), (0, "", "")] set_file_permissions("dummy-file", "dummy-mod", "dummy-user", False) self.assertTrue(len(run_os_command_mock.call_args_list) == 2) self.assertTrue(print_warning_msg_mock.called) run_os_command_mock.reset_mock() print_warning_msg_mock.reset_mock() # Testing second command fail run_os_command_mock.side_effect = [(0, "", ""), (1, "", "")] set_file_permissions("dummy-file", "dummy-mod", "dummy-user", False) self.assertTrue(len(run_os_command_mock.call_args_list) == 2) self.assertTrue(print_warning_msg_mock.called) run_os_command_mock.reset_mock() print_warning_msg_mock.reset_mock() # Testing recursive operation exists_mock.return_value = True run_os_command_mock.side_effect = [(0, "", ""), (0, "", "")] set_file_permissions("dummy-file", "dummy-mod", "dummy-user", True) self.assertTrue(len(run_os_command_mock.call_args_list) == 2) self.assertTrue("-R" in run_os_command_mock.call_args_list[0][0][0]) self.assertTrue("-R" in run_os_command_mock.call_args_list[1][0][0]) self.assertFalse(print_warning_msg_mock.called) run_os_command_mock.reset_mock() print_warning_msg_mock.reset_mock() # Testing non-recursive operation exists_mock.return_value = True run_os_command_mock.side_effect = [(0, "", ""), (0, "", "")] set_file_permissions("dummy-file", "dummy-mod", "dummy-user", False) self.assertTrue(len(run_os_command_mock.call_args_list) == 2) self.assertFalse("-R" in run_os_command_mock.call_args_list[0][0][0]) self.assertFalse("-R" in run_os_command_mock.call_args_list[1][0][0]) self.assertFalse(print_warning_msg_mock.called) run_os_command_mock.reset_mock() print_warning_msg_mock.reset_mock() pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.serverSetup.get_validated_string_input") @patch("ambari_server.serverSetup.print_info_msg") @patch("ambari_server.serverSetup.print_warning_msg") @patch("ambari_server.serverSetup.run_os_command") def test_create_custom_user(self, run_os_command_mock, print_warning_msg_mock, print_info_msg_mock, get_validated_string_input_mock): options = MagicMock() user = "dummy-user" get_validated_string_input_mock.return_value = user userChecks = AmbariUserChecks(options) # Testing scenario: absent user run_os_command_mock.side_effect = [(0, "", "")] result = userChecks._create_custom_user() self.assertFalse(print_warning_msg_mock.called) self.assertEquals(result, 0) self.assertEquals(userChecks.user, user) print_info_msg_mock.reset_mock() print_warning_msg_mock.reset_mock() run_os_command_mock.reset_mock() # Testing scenario: existing user run_os_command_mock.side_effect = [(9, "", "")] result = userChecks._create_custom_user() self.assertTrue("User dummy-user already exists" in str(print_info_msg_mock.call_args_list[1][0])) self.assertEquals(result, 0) self.assertEquals(userChecks.user, user) print_info_msg_mock.reset_mock() print_warning_msg_mock.reset_mock() run_os_command_mock.reset_mock() # Testing scenario: os command fail run_os_command_mock.side_effect = [(1, "", "")] result = userChecks._create_custom_user() self.assertTrue(print_warning_msg_mock.called) self.assertEquals(result, 1) pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("win32security.LsaAddAccountRights") @patch("win32security.LookupAccountName") @patch("win32net.NetUserAdd") @patch("win32net.NetUserGetInfo") @patch("win32security.LsaOpenPolicy") @patch("win32net.NetGetDCName") @patch("ambari_server.serverSetup.get_validated_string_input") @patch("ambari_server.serverSetup.print_info_msg") @patch("ambari_server.serverSetup.print_warning_msg") def test_create_custom_user(self, print_warning_msg_mock, print_info_msg_mock, get_validated_string_input_mock, net_get_dc_name_mock, lsa_open_policy_mock, net_user_get_info_mock, net_user_add_mock, lookup_account_name_mock, lsa_add_account_rights_mock): def _reset_mocks(): get_validated_string_input_mock.reset_mock() print_info_msg_mock.reset_mock() print_warning_msg_mock.reset_mock() net_get_dc_name_mock.reset_mock() net_user_get_info_mock.reset_mock() net_user_add_mock.reset_mock() lookup_account_name_mock.reset_mock() lsa_add_account_rights_mock.reset_mock() pass options = MagicMock() user = "dummy-user" get_validated_string_input_mock.return_value = user userChecks = AmbariUserChecks(options) # Testing scenario: absent user def user_not_found(*args, **keywargs): import pywintypes raise pywintypes.error(2221) net_user_get_info_mock.side_effect = user_not_found result = userChecks._create_custom_user() self.assertTrue(print_warning_msg_mock.called) self.assertTrue(net_user_add_mock.called) self.assertEqual(str(net_user_add_mock.call_args_list[0][0]), str((None, 1, {'comment': 'Ambari user', 'password': 'dummy-user', 'flags': 513, 'name': 'dummy-user', 'priv': 1}))) self.assertEquals(result, 0) self.assertEquals(userChecks.user, ".\\" + user) _reset_mocks() # Testing scenario: existing user net_user_get_info_mock.side_effect = None net_user_get_info_mock.return_value = { "name":"dummy_user" } #lookup_account_name_mock #lsa_add_account_rights_mock result = userChecks._create_custom_user() self.assertTrue("User dummy-user already exists" in print_info_msg_mock.call_args_list[0][0][0]) self.assertEquals(result, 0) self.assertEquals(userChecks.user, ".\\" + user) self.assertFalse(net_user_add_mock.called) _reset_mocks() # Testing scenario: new domain user get_validated_string_input_mock.side_effect = ["dummy_domain\\dummy_user", "newpassword"] net_get_dc_name_mock.return_value = "dummy_dc" net_user_get_info_mock.side_effect = user_not_found result = userChecks._create_custom_user() self.assertTrue(net_get_dc_name_mock.called) self.assertEqual(str(net_get_dc_name_mock.call_args_list[0][0]), str((None, "dummy_domain"))) self.assertTrue(net_user_add_mock.called) self.assertEqual(str(net_user_add_mock.call_args_list[0][0]), str(('dummy_dc', 1, {'comment': 'Ambari user', 'password': 'newpassword', 'flags': 513, 'name': 'dummy_user', 'priv': 1}))) self.assertEquals(result, 0) self.assertEquals(userChecks.user, "dummy_domain\\dummy_user") _reset_mocks() # Testing scenario: existing domain user get_validated_string_input_mock.side_effect = ["dummy_domain\\dummy_user", "newpassword"] net_user_get_info_mock.side_effect = None net_user_get_info_mock.return_value = { "name":"dummy_domain\\dummy_user" } result = userChecks._create_custom_user() self.assertTrue("User dummy_domain\\dummy_user already exists" in print_info_msg_mock.call_args_list[0][0][0]) self.assertTrue(net_get_dc_name_mock.called) self.assertEqual(str(net_get_dc_name_mock.call_args_list[0][0]), str((None, "dummy_domain"))) self.assertFalse(net_user_add_mock.called) self.assertEquals(result, 0) self.assertEquals(userChecks.user, "dummy_domain\\dummy_user") pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.serverSetup.read_ambari_user") @patch("ambari_server.serverSetup.get_YN_input") @patch("ambari_server.serverSetup.get_validated_string_input") @patch("ambari_server.serverSetup.adjust_directory_permissions") @patch("ambari_server.serverSetup.run_os_command") @patch("ambari_server.serverSetup.print_error_msg") @patch("ambari_server.serverSetup.print_warning_msg") @patch("ambari_server.serverSetup.print_info_msg") def test_check_ambari_user(self, print_info_msg_mock, print_warning_msg_mock, print_error_msg_mock, run_os_command_mock, adjust_directory_permissions_mock, get_validated_string_input_mock, get_YN_input_mock, read_ambari_user_mock): def _reset_mocks(): get_YN_input_mock.reset_mock() get_validated_string_input_mock.reset_mock() run_os_command_mock.reset_mock() adjust_directory_permissions_mock.reset_mock() pass options = MagicMock() run_os_command_mock.return_value = (0, "", "") # Scenario: user is already defined, user does not want to reconfigure it read_ambari_user_mock.return_value = "dummy-user" get_YN_input_mock.return_value = False result = check_ambari_user(options) self.assertTrue(get_YN_input_mock.called) self.assertFalse(get_validated_string_input_mock.called) self.assertFalse(run_os_command_mock.called) self.assertTrue(adjust_directory_permissions_mock.called) self.assertEqual(result[0], 0) _reset_mocks() # Scenario: user is already defined, but user wants to reconfigure it read_ambari_user_mock.return_value = "dummy-user" get_validated_string_input_mock.return_value = "new-dummy-user" get_YN_input_mock.return_value = True result = check_ambari_user(options) self.assertTrue(get_YN_input_mock.called) self.assertTrue(result[2] == "new-dummy-user") self.assertTrue(get_validated_string_input_mock.called) self.assertTrue(adjust_directory_permissions_mock.called) self.assertEqual(result[0], 0) _reset_mocks() # Negative scenario: user is already defined, but user wants # to reconfigure it, user creation failed read_ambari_user_mock.return_value = "dummy-user" run_os_command_mock.return_value = (1, "", "") get_YN_input_mock.return_value = True result = check_ambari_user(options) self.assertTrue(get_YN_input_mock.called) self.assertTrue(get_validated_string_input_mock.called) self.assertTrue(run_os_command_mock.called) self.assertFalse(adjust_directory_permissions_mock.called) self.assertEqual(result[0], 1) _reset_mocks() # Scenario: user is not defined (setup process) read_ambari_user_mock.return_value = None get_YN_input_mock.return_value = True get_validated_string_input_mock.return_value = "dummy-user" run_os_command_mock.return_value = (0, "", "") result = check_ambari_user(options) self.assertTrue(get_YN_input_mock.called) self.assertTrue(get_validated_string_input_mock.called) self.assertTrue(run_os_command_mock.called) self.assertTrue(result[2] == "dummy-user") self.assertTrue(adjust_directory_permissions_mock.called) self.assertEqual(result[0], 0) _reset_mocks() # Scenario: user is not defined (setup process), user creation failed read_ambari_user_mock.return_value = None get_YN_input_mock.return_value = True run_os_command_mock.return_value = (1, "", "") result = check_ambari_user(options) self.assertTrue(get_YN_input_mock.called) self.assertTrue(get_validated_string_input_mock.called) self.assertTrue(run_os_command_mock.called) self.assertFalse(adjust_directory_permissions_mock.called) self.assertEqual(result[0], 1) _reset_mocks() # negative scenario: user is not defined (setup process), user creation failed read_ambari_user_mock.return_value = None get_YN_input_mock.return_value = True run_os_command_mock.return_value = (1, "", "") result = check_ambari_user(options) self.assertTrue(get_YN_input_mock.called) self.assertTrue(get_validated_string_input_mock.called) self.assertTrue(run_os_command_mock.called) self.assertFalse(adjust_directory_permissions_mock.called) self.assertEqual(result[0], 1) _reset_mocks() # Scenario: user is not defined and left to be root read_ambari_user_mock.return_value = None get_YN_input_mock.return_value = False result = check_ambari_user(options) self.assertTrue(get_YN_input_mock.called) self.assertFalse(get_validated_string_input_mock.called) self.assertFalse(run_os_command_mock.called) self.assertTrue(result[2] == "root") self.assertTrue(adjust_directory_permissions_mock.called) self.assertEqual(result[0], 0) pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_commons.os_windows.UserHelper.add_user_privilege") @patch("ambari_commons.os_windows.UserHelper.create_user") @patch("ambari_commons.os_windows.UserHelper.find_user") @patch("ambari_server.serverSetup.read_ambari_user") @patch("ambari_server.serverSetup.get_YN_input") @patch("ambari_server.serverSetup.get_validated_string_input") @patch("ambari_server.serverSetup.adjust_directory_permissions") @patch("ambari_server.serverSetup.run_os_command") @patch("ambari_server.serverSetup.print_error_msg") @patch("ambari_server.serverSetup.print_warning_msg") @patch("ambari_server.serverSetup.print_info_msg") def test_check_ambari_user(self, print_info_msg_mock, print_warning_msg_mock, print_error_msg_mock, run_os_command_mock, adjust_directory_permissions_mock, get_validated_string_input_mock, get_YN_input_mock, read_ambari_user_mock, find_user_mock, create_user_mock, add_user_privilege_mock): def _reset_mocks(): get_YN_input_mock.reset_mock() get_validated_string_input_mock.reset_mock() find_user_mock.reset_mock() create_user_mock.reset_mock() adjust_directory_permissions_mock.reset_mock() pass options = MagicMock() options.svc_user = None options.svc_password = None run_os_command_mock.return_value = (0, "", "") # Scenario: user is already defined, user does not want to reconfigure it read_ambari_user_mock.return_value = "dummy-user" get_YN_input_mock.return_value = False result = check_ambari_user(options) self.assertTrue(get_YN_input_mock.called) self.assertFalse(get_validated_string_input_mock.called) self.assertFalse(find_user_mock.called) self.assertFalse(create_user_mock.called) self.assertTrue(adjust_directory_permissions_mock.called) self.assertEqual(result[0], 0) _reset_mocks() # Scenario: user is already defined, but user wants to reconfigure it read_ambari_user_mock.return_value = "dummy-user" get_validated_string_input_mock.side_effect = ["new-dummy-user", "new_password"] get_YN_input_mock.return_value = True find_user_mock.return_value = False create_user_mock.return_value = (0, "User created") add_user_privilege_mock.return_value = (0, "Privilege added") result = check_ambari_user(options) self.assertTrue(get_YN_input_mock.called) self.assertEqual(result[2], ".\\new-dummy-user") self.assertTrue(get_validated_string_input_mock.called) self.assertTrue(adjust_directory_permissions_mock.called) self.assertTrue(find_user_mock.called) self.assertTrue(create_user_mock.called) self.assertTrue(add_user_privilege_mock.called) self.assertEqual(result[0], 0) _reset_mocks() # Negative scenario: user is already defined, but user wants # to reconfigure it, user creation failed read_ambari_user_mock.return_value = "dummy-user" get_validated_string_input_mock.side_effect = ["new-dummy-user", "new_password"] find_user_mock.return_value = False create_user_mock.return_value = (-1, "Failed") get_YN_input_mock.return_value = True result = check_ambari_user(options) self.assertTrue(get_YN_input_mock.called) self.assertTrue(get_validated_string_input_mock.called) self.assertTrue(create_user_mock.called) self.assertFalse(adjust_directory_permissions_mock.called) self.assertEqual(result[0], -1) _reset_mocks() # Scenario: user is not defined (setup process) read_ambari_user_mock.return_value = None get_YN_input_mock.return_value = True get_validated_string_input_mock.side_effect = ["dummy-user", "new_password"] create_user_mock.return_value = (0, "User created") result = check_ambari_user(options) self.assertTrue(get_YN_input_mock.called) self.assertTrue(get_validated_string_input_mock.called) self.assertTrue(create_user_mock.called) self.assertTrue(result[2] == ".\\dummy-user") self.assertTrue(adjust_directory_permissions_mock.called) self.assertEqual(result[0], 0) _reset_mocks() # Scenario: user is not defined, use system account (setup process) read_ambari_user_mock.return_value = None get_YN_input_mock.return_value = True get_validated_string_input_mock.side_effect = ["NT AUTHORITY\\SYSTEM"] create_user_mock.return_value = (0, "User created") result = check_ambari_user(options) self.assertTrue(get_YN_input_mock.called) self.assertTrue(get_validated_string_input_mock.called) self.assertEqual(get_validated_string_input_mock.call_count, 1) self.assertFalse(find_user_mock.called) self.assertFalse(create_user_mock.called) self.assertTrue(result[2] == "NT AUTHORITY\\SYSTEM") self.assertTrue(adjust_directory_permissions_mock.called) self.assertEqual(result[0], 0) _reset_mocks() # Scenario: user is not defined (setup process), user creation failed read_ambari_user_mock.return_value = None get_YN_input_mock.return_value = True get_validated_string_input_mock.side_effect = ["new-dummy-user", "new_password"] find_user_mock.return_value = False create_user_mock.return_value = (-1, "Failed") result = check_ambari_user(options) self.assertTrue(get_YN_input_mock.called) self.assertTrue(get_validated_string_input_mock.called) self.assertTrue(create_user_mock.called) self.assertFalse(adjust_directory_permissions_mock.called) self.assertEqual(result[0], -1) _reset_mocks() # Scenario: user is not defined and left to be the default read_ambari_user_mock.return_value = None get_YN_input_mock.return_value = False result = check_ambari_user(options) self.assertTrue(get_YN_input_mock.called) self.assertFalse(get_validated_string_input_mock.called) self.assertFalse(run_os_command_mock.called) self.assertTrue(result[2] == "NT AUTHORITY\\SYSTEM") self.assertTrue(adjust_directory_permissions_mock.called) self.assertEqual(result[0], 0) pass @patch("ambari_server.serverConfiguration.search_file") @patch("__builtin__.open") @patch("ambari_server.serverConfiguration.read_ambari_user") @patch("ambari_server.serverConfiguration.set_file_permissions") def test_store_password_file(self, set_file_permissions_mock, read_ambari_user_mock, open_mock, search_file_mock): search_file_mock.return_value = "/etc/ambari-server/conf/ambari.properties" open_mock.return_value = MagicMock() store_password_file("password", "passfile") self.assertTrue(set_file_permissions_mock.called) pass @patch("subprocess.Popen") @patch.object(OSCheck, "get_os_family") @patch.object(OSCheck, "get_os_type") @patch.object(OSCheck, "get_os_major_version") def test_check_firewall_is_running(self, get_os_major_version_mock, get_os_type_mock, get_os_family_mock, popen_mock): get_os_major_version_mock.return_value = 18 get_os_type_mock.return_value = OSConst.OS_FEDORA get_os_family_mock.return_value = OSConst.REDHAT_FAMILY firewall_obj = Firewall().getFirewallObject() p = MagicMock() p.communicate.return_value = ("active", "err") p.returncode = 0 popen_mock.return_value = p self.assertEqual("Fedora18FirewallChecks", firewall_obj.__class__.__name__) self.assertTrue(firewall_obj.check_firewall()) p.communicate.return_value = ("", "err") p.returncode = 3 self.assertFalse(firewall_obj.check_firewall()) self.assertEqual("err", firewall_obj.stderrdata) get_os_type_mock.return_value = OSConst.OS_UBUNTU get_os_family_mock.return_value = OSConst.UBUNTU_FAMILY firewall_obj = Firewall().getFirewallObject() p.communicate.return_value = ("Status: active", "err") p.returncode = 0 self.assertEqual("UbuntuFirewallChecks", firewall_obj.__class__.__name__) self.assertTrue(firewall_obj.check_firewall()) p.communicate.return_value = ("Status: inactive", "err") p.returncode = 0 self.assertFalse(firewall_obj.check_firewall()) self.assertEqual("err", firewall_obj.stderrdata) get_os_type_mock.return_value = "" get_os_family_mock.return_value = OSConst.SUSE_FAMILY firewall_obj = Firewall().getFirewallObject() p.communicate.return_value = ("### iptables", "err") p.returncode = 0 self.assertEqual("SuseFirewallChecks", firewall_obj.__class__.__name__) self.assertTrue(firewall_obj.check_firewall()) p.communicate.return_value = ("SuSEfirewall2 not active", "err") p.returncode = 0 self.assertFalse(firewall_obj.check_firewall()) self.assertEqual("err", firewall_obj.stderrdata) get_os_type_mock.return_value = "" get_os_family_mock.return_value = OSConst.REDHAT_FAMILY firewall_obj = Firewall().getFirewallObject() p.communicate.return_value = ("Table: filter", "err") p.returncode = 0 self.assertEqual("FirewallChecks", firewall_obj.__class__.__name__) self.assertTrue(firewall_obj.check_firewall()) p.communicate.return_value = ("", "err") p.returncode = 3 self.assertFalse(firewall_obj.check_firewall()) self.assertEqual("err", firewall_obj.stderrdata) pass @patch("ambari_server.setupHttps.get_validated_filepath_input") @patch("ambari_server.setupHttps.get_validated_string_input") @patch("ambari_server.setupHttps.run_os_command") @patch("ambari_server.setupHttps.get_truststore_type") @patch("__builtin__.open") @patch("ambari_server.setupHttps.find_properties_file") @patch("ambari_server.setupHttps.run_component_https_cmd") @patch("ambari_server.setupHttps.get_delete_cert_command") @patch("ambari_server.setupHttps.get_truststore_password") @patch("ambari_server.setupHttps.get_truststore_path") @patch("ambari_server.setupHttps.get_YN_input") @patch("ambari_server.setupHttps.get_ambari_properties") @patch("ambari_server.setupHttps.find_jdk") def test_setup_truststore(self, find_jdk_mock, get_ambari_properties_mock, get_YN_input_mock, get_truststore_path_mock, get_truststore_password_mock, get_delete_cert_command_mock, run_component_https_cmd_mock, find_properties_file_mock, open_mock, get_truststore_type_mock, run_os_command_mock, get_validated_string_input_mock, get_validated_filepath_input_mock): out = StringIO.StringIO() sys.stdout = out component = "component" command = "command" property = "use_ssl" alias = "alias" #Silent mode set_silent(True) setup_truststore() self.assertEqual('setup-security is not enabled in silent mode.\n', out.getvalue()) sys.stdout = sys.__stdout__ #Verbouse mode and jdk_path is None set_silent(False) p = get_ambari_properties_mock.return_value # Dont disable ssl get_YN_input_mock.side_effect = [False] get_validated_string_input_mock.return_value = "alias" setup_truststore() self.assertTrue(get_YN_input_mock.called) p.get_property.reset_mock() get_YN_input_mock.reset_mock() # Cant find jdk find_jdk_mock.return_value = None try: setup_truststore() self.fail("Should throw exception") except FatalException as fe: # Expected self.assertTrue('No JDK found, please run the "ambari-server setup" command to install a' + ' JDK automatically or install any JDK manually to ' in fe.reason) pass #Verbouse mode and jdk_path is not None (use_https = true) find_jdk_mock.return_value = "/jdk_path" p.get_property.side_effect = ["true"] get_YN_input_mock.side_effect = [True,True] get_truststore_path_mock.return_value = "/truststore_path" get_truststore_password_mock.return_value = "/truststore_password" get_delete_cert_command_mock.return_value = "rm -f" setup_truststore(True) self.assertTrue(get_truststore_path_mock.called) self.assertTrue(get_truststore_password_mock.called) self.assertTrue(get_delete_cert_command_mock.called) self.assertTrue(find_properties_file_mock.called) self.assertTrue(open_mock.called) self.assertTrue(p.store.called) self.assertTrue(run_component_https_cmd_mock.called) p.process_pair.reset_mock() get_truststore_path_mock.reset_mock() get_truststore_password_mock.reset_mock() get_delete_cert_command_mock.reset_mock() find_properties_file_mock.reset_mock() open_mock.reset_mock() p.store.reset_mock() #Verbouse mode and jdk_path is not None (use_https = false) and import cert p.get_property.side_effect = ["false"] get_YN_input_mock.side_effect = [True,True] setup_truststore(True) self.assertTrue(get_truststore_type_mock.called) self.assertTrue(get_truststore_path_mock.called) self.assertTrue(get_truststore_password_mock.called) self.assertTrue(get_delete_cert_command_mock.called) self.assertTrue(find_properties_file_mock.called) self.assertTrue(open_mock.called) self.assertTrue(p.store.called) self.assertTrue(run_component_https_cmd_mock.called) self.assertTrue(run_os_command_mock.called) self.assertTrue(get_validated_filepath_input_mock.called) p.process_pair.reset_mock() get_truststore_type_mock.reset_mock() get_truststore_path_mock.reset_mock() get_truststore_password_mock.reset_mock() get_delete_cert_command_mock.reset_mock() find_properties_file_mock.reset_mock() open_mock.reset_mock() p.store.reset_mock() run_os_command_mock.reset_mock() get_validated_filepath_input_mock.reset_mock() pass @patch("ambari_server.setupHttps.adjust_directory_permissions") @patch("ambari_server.setupHttps.read_ambari_user") @patch("ambari_server.setupHttps.get_validated_string_input") @patch("ambari_server.setupHttps.find_properties_file") @patch("ambari_server.setupHttps.get_ambari_properties") @patch("ambari_server.setupHttps.import_cert_and_key_action") @patch("ambari_server.setupHttps.get_YN_input") @patch("__builtin__.open") @patch("ambari_server.setupHttps.is_root") @patch("ambari_server.setupHttps.is_valid_cert_host") @patch("ambari_server.setupHttps.is_valid_cert_exp") def test_setup_https(self, is_valid_cert_exp_mock, is_valid_cert_host_mock, \ is_root_mock, open_Mock, get_YN_input_mock, \ import_cert_and_key_action_mock, get_ambari_properties_mock, \ find_properties_file_mock, \ get_validated_string_input_mock, read_ambari_user_method, \ adjust_directory_permissions_mock): is_valid_cert_exp_mock.return_value = True is_valid_cert_host_mock.return_value = True args = MagicMock() open_Mock.return_value = file p = get_ambari_properties_mock.return_value # Testing call under non-root is_root_mock.return_value = False try: setup_https(args) self.fail("Should throw exception") except FatalException as fe: # Expected self.assertTrue("root-level" in fe.reason) pass # Testing call under root is_root_mock.return_value = True read_ambari_user_method.return_value = "user" #Case #1: if client ssl is on and user didnt choose #disable ssl option and choose import certs and keys p.get_property.side_effect = ["key_dir", "5555", "6666", "true"] get_YN_input_mock.side_effect = [False, True] get_validated_string_input_mock.side_effect = ["4444"] get_property_expected = "[call('security.server.keys_dir'),\n" + \ " call('client.api.ssl.port'),\n" + \ " call('client.api.ssl.port'),\n call('api.ssl')]" process_pair_expected = "[call('client.api.ssl.port', '4444')]" set_silent(False) setup_https(args) self.assertTrue(p.process_pair.called) self.assertTrue(p.get_property.call_count == 4) self.assertEqual(str(p.get_property.call_args_list), get_property_expected) self.assertEqual(str(p.process_pair.call_args_list), process_pair_expected) self.assertTrue(p.store.called) self.assertTrue(import_cert_and_key_action_mock.called) p.process_pair.reset_mock() p.get_property.reset_mock() p.store.reset_mock() import_cert_and_key_action_mock.reset_mock() #Case #2: if client ssl is on and user choose to disable ssl option p.get_property.side_effect = ["key_dir", "", "true"] get_YN_input_mock.side_effect = [True] get_validated_string_input_mock.side_effect = ["4444"] get_property_expected = "[call('security.server.keys_dir'),\n" + \ " call('client.api.ssl.port'),\n call('api.ssl')]" process_pair_expected = "[call('api.ssl', 'false')]" setup_https(args) self.assertTrue(p.process_pair.called) self.assertTrue(p.get_property.call_count == 3) self.assertEqual(str(p.get_property.call_args_list), get_property_expected) self.assertEqual(str(p.process_pair.call_args_list), process_pair_expected) self.assertTrue(p.store.called) self.assertFalse(import_cert_and_key_action_mock.called) p.process_pair.reset_mock() p.get_property.reset_mock() p.store.reset_mock() import_cert_and_key_action_mock.reset_mock() #Case #3: if client ssl is off and user choose option #to import cert and keys p.get_property.side_effect = ["key_dir", "", None] get_YN_input_mock.side_effect = [True, True] get_validated_string_input_mock.side_effect = ["4444"] get_property_expected = "[call('security.server.keys_dir'),\n" + \ " call('client.api.ssl.port'),\n call('api.ssl')]" process_pair_expected = "[call('client.api.ssl.port', '4444')]" setup_https(args) self.assertTrue(p.process_pair.called) self.assertTrue(p.get_property.call_count == 3) self.assertEqual(str(p.get_property.call_args_list), get_property_expected) self.assertEqual(str(p.process_pair.call_args_list), process_pair_expected) self.assertTrue(p.store.called) self.assertTrue(import_cert_and_key_action_mock.called) p.process_pair.reset_mock() p.get_property.reset_mock() p.store.reset_mock() import_cert_and_key_action_mock.reset_mock() #Case #4: if client ssl is off and #user did not choose option to import cert and keys p.get_property.side_effect = ["key_dir", "", None] get_YN_input_mock.side_effect = [False] get_validated_string_input_mock.side_effect = ["4444"] get_property_expected = "[call('security.server.keys_dir'),\n" + \ " call('client.api.ssl.port'),\n call('api.ssl')]" process_pair_expected = "[]" setup_https(args) self.assertFalse(p.process_pair.called) self.assertTrue(p.get_property.call_count == 3) self.assertEqual(str(p.get_property.call_args_list), get_property_expected) self.assertEqual(str(p.process_pair.call_args_list), process_pair_expected) self.assertFalse(p.store.called) self.assertFalse(import_cert_and_key_action_mock.called) p.process_pair.reset_mock() p.get_property.reset_mock() p.store.reset_mock() import_cert_and_key_action_mock.reset_mock() #Case #5: if cert must be imported but didnt imported p.get_property.side_effect = ["key_dir", "", "false"] get_YN_input_mock.side_effect = [True] import_cert_and_key_action_mock.side_effect = [False] get_validated_string_input_mock.side_effect = ["4444"] get_property_expected = "[call('security.server.keys_dir'),\n" + \ " call('client.api.ssl.port'),\n call('api.ssl')]" process_pair_expected = "[call('client.api.ssl.port', '4444')]" self.assertFalse(setup_https(args)) self.assertTrue(p.process_pair.called) self.assertTrue(p.get_property.call_count == 3) self.assertEqual(str(p.get_property.call_args_list), get_property_expected) self.assertEqual(str(p.process_pair.call_args_list), process_pair_expected) self.assertFalse(p.store.called) self.assertTrue(import_cert_and_key_action_mock.called) p.process_pair.reset_mock() p.get_property.reset_mock() p.store.reset_mock() import_cert_and_key_action_mock.reset_mock() #Case #6: if silent mode is enabled set_silent(True) try: setup_https(args) self.fail("Should throw exception") except NonFatalException as fe: self.assertTrue("setup-https is not enabled in silent mode" in fe.reason) p.process_pair.reset_mock() p.get_property.reset_mock() p.store.reset_mock() import_cert_and_key_action_mock.reset_mock() #Case #7: read property throw exception set_silent(False) find_properties_file_mock.return_value = "propertyFile" p.get_property.side_effect = KeyError("Failed to read property") try: setup_https(args) self.fail("Should throw exception") except FatalException as fe: self.assertTrue("Failed to read property" in fe.reason) pass @patch("ambari_server.setupHttps.import_cert_and_key") def test_import_cert_and_key_action(self, import_cert_and_key_mock): import_cert_and_key_mock.return_value = True properties = MagicMock() properties.get_property.side_effect = ["key_dir", "5555", "6666", "true"] properties.process_pair = MagicMock() expect_process_pair = "[call('client.api.ssl.cert_name', 'https.crt'),\n" + \ " call('client.api.ssl.key_name', 'https.key'),\n" + \ " call('api.ssl', 'true')]" import_cert_and_key_action("key_dir", properties) self.assertEqual(str(properties.process_pair.call_args_list), \ expect_process_pair) pass @patch("ambari_server.setupHttps.remove_file") @patch("ambari_server.setupHttps.copy_file") @patch("ambari_server.setupHttps.read_ambari_user") @patch("ambari_server.setupHttps.set_file_permissions") @patch("ambari_server.setupHttps.import_file_to_keystore") @patch("__builtin__.open") @patch("ambari_server.setupHttps.run_os_command") @patch("os.path.join") @patch("os.path.isfile") @patch("__builtin__.raw_input") @patch("ambari_server.setupHttps.get_validated_string_input") @patch("ambari_server.setupHttps.is_valid_cert_host") @patch("ambari_server.setupHttps.is_valid_cert_exp") def test_import_cert_and_key(self, is_valid_cert_exp_mock, \ is_valid_cert_host_mock, \ get_validated_string_input_mock, \ raw_input_mock, \ os_path_isfile_mock, \ os_path_join_mock, run_os_command_mock, \ open_mock, import_file_to_keystore_mock, \ set_file_permissions_mock, read_ambari_user_mock, copy_file_mock, \ remove_file_mock): is_valid_cert_exp_mock.return_value = True is_valid_cert_host_mock.return_value = True os_path_isfile_mock.return_value = True get_validated_string_input_mock.return_value = "password" raw_input_mock.side_effect = \ ["cert_file_path", "key_file_path"] os_path_join_mock.side_effect = ["keystore_file_path", "keystore_file_path_tmp", \ "pass_file_path", "pass_file_path_tmp", \ "passin_file_path", "password_file_path", \ "keystore_cert_file_path", \ "keystore_cert_key_file_path", ] run_os_command_mock.return_value = (0, "", "") om = open_mock.return_value expect_import_file_to_keystore = "[call('keystore_file_path_tmp'," + \ " 'keystore_file_path'),\n" + \ " call('pass_file_path_tmp'," + \ " 'pass_file_path'),\n" + \ " call('cert_file_path'," + \ " 'keystore_cert_file_path'),\n" + \ " call('key_file_path'," + \ " 'keystore_cert_key_file_path')]" import_cert_and_key("key_dir") self.assertTrue(raw_input_mock.call_count == 2) self.assertTrue(get_validated_string_input_mock.called) self.assertEqual(os_path_join_mock.call_count, 8) self.assertTrue(set_file_permissions_mock.call_count == 1) self.assertEqual(str(import_file_to_keystore_mock.call_args_list), \ expect_import_file_to_keystore) pass @patch("ambari_server.setupHttps.remove_file") @patch("ambari_server.setupHttps.copy_file") @patch("ambari_server.setupHttps.generate_random_string") @patch("ambari_server.setupHttps.read_ambari_user") @patch("ambari_server.setupHttps.set_file_permissions") @patch("ambari_server.setupHttps.import_file_to_keystore") @patch("__builtin__.open") @patch("ambari_server.setupHttps.run_os_command") @patch("os.path.join") @patch("ambari_server.setupHttps.get_validated_filepath_input") @patch("ambari_server.setupHttps.get_validated_string_input") @patch("ambari_server.setupHttps.is_valid_cert_host") @patch("ambari_server.setupHttps.is_valid_cert_exp") def test_import_cert_and_key_with_empty_password(self, \ is_valid_cert_exp_mock, is_valid_cert_host_mock, get_validated_string_input_mock, get_validated_filepath_input_mock, \ os_path_join_mock, run_os_command_mock, open_mock, \ import_file_to_keystore_mock, set_file_permissions_mock, read_ambari_user_mock, generate_random_string_mock, copy_file_mock, \ remove_file_mock): is_valid_cert_exp_mock.return_value = True is_valid_cert_host_mock.return_value = True get_validated_string_input_mock.return_value = "" get_validated_filepath_input_mock.side_effect = \ ["cert_file_path", "key_file_path"] os_path_join_mock.side_effect = ["keystore_file_path", "keystore_file_path_tmp", \ "pass_file_path", "pass_file_path_tmp", \ "passin_file_path", "password_file_path", \ "keystore_cert_file_path", \ "keystore_cert_key_file_path", ] run_os_command_mock.return_value = (0, "", "") expect_import_file_to_keystore = "[call('keystore_file_path_tmp'," + \ " 'keystore_file_path'),\n" + \ " call('pass_file_path_tmp'," + \ " 'pass_file_path'),\n" + \ " call('cert_file_path'," + \ " 'keystore_cert_file_path'),\n" + \ " call('key_file_path.secured'," + \ " 'keystore_cert_key_file_path')]" import_cert_and_key("key_dir") self.assertEquals(get_validated_filepath_input_mock.call_count, 2) self.assertTrue(get_validated_string_input_mock.called) self.assertEquals(os_path_join_mock.call_count, 8) self.assertEquals(set_file_permissions_mock.call_count, 1) self.assertEqual(str(import_file_to_keystore_mock.call_args_list), \ expect_import_file_to_keystore) self.assertTrue(generate_random_string_mock.called) pass @patch("__builtin__.open") @patch("ambari_server.setupHttps.copy_file") @patch("ambari_server.setupHttps.is_root") @patch("ambari_server.setupHttps.read_ambari_user") @patch("ambari_server.setupHttps.set_file_permissions") @patch("ambari_server.setupHttps.import_file_to_keystore") @patch("ambari_server.setupHttps.run_os_command") @patch("os.path.join") @patch("ambari_server.setupHttps.get_validated_filepath_input") @patch("ambari_server.setupHttps.get_validated_string_input") def test_import_cert_and_key_with_incorrect_password(self, get_validated_string_input_mock, \ get_validated_filepath_input_mock, \ os_path_join_mock, \ run_os_command_mock, \ import_file_to_keystore_mock, \ set_file_permissions_mock, \ read_ambari_user_mock, \ is_root_mock, \ copy_file_mock, \ open_mock): get_validated_string_input_mock.return_value = "incorrect_password" get_validated_filepath_input_mock.return_value = 'filename' open_mock.return_value = MagicMock() os_path_join_mock.return_value = '' is_root_mock.return_value = True #provided password doesn't match, openssl command returns an error run_os_command_mock.return_value = (1, "", "Some error message") self.assertFalse(import_cert_and_key_action(*["key_dir", None])) self.assertFalse(import_cert_and_key("key_dir")) pass def test_is_valid_cert_exp(self): #No data in certInfo certInfo = {} is_valid = is_valid_cert_exp(certInfo) self.assertFalse(is_valid) #Issued in future issuedOn = (datetime.datetime.now() + datetime.timedelta(hours=1000)).strftime(SSL_DATE_FORMAT) expiresOn = (datetime.datetime.now() + datetime.timedelta(hours=2000)).strftime(SSL_DATE_FORMAT) certInfo = {NOT_BEFORE_ATTR: issuedOn, NOT_AFTER_ATTR: expiresOn} is_valid = is_valid_cert_exp(certInfo) self.assertFalse(is_valid) #Was expired issuedOn = (datetime.datetime.now() - datetime.timedelta(hours=2000)).strftime(SSL_DATE_FORMAT) expiresOn = (datetime.datetime.now() - datetime.timedelta(hours=1000)).strftime(SSL_DATE_FORMAT) certInfo = {NOT_BEFORE_ATTR: issuedOn, NOT_AFTER_ATTR: expiresOn} is_valid = is_valid_cert_exp(certInfo) self.assertFalse(is_valid) #Valid issuedOn = (datetime.datetime.now() - datetime.timedelta(hours=2000)).strftime(SSL_DATE_FORMAT) expiresOn = (datetime.datetime.now() + datetime.timedelta(hours=1000)).strftime(SSL_DATE_FORMAT) certInfo = {NOT_BEFORE_ATTR: issuedOn, NOT_AFTER_ATTR: expiresOn} is_valid = is_valid_cert_exp(certInfo) self.assertTrue(is_valid) pass @patch("ambari_server.setupHttps.get_fqdn") def test_is_valid_cert_host(self, get_fqdn_mock): #No data in certInfo certInfo = {} is_valid = is_valid_cert_host(certInfo) self.assertFalse(is_valid) #Failed to get FQDN get_fqdn_mock.return_value = None is_valid = is_valid_cert_host(certInfo) self.assertFalse(is_valid) #FQDN and Common name in certificated don't correspond get_fqdn_mock.return_value = 'host1' certInfo = {COMMON_NAME_ATTR: 'host2'} is_valid = is_valid_cert_host(certInfo) self.assertFalse(is_valid) #FQDN and Common name in certificated correspond get_fqdn_mock.return_value = 'host1' certInfo = {COMMON_NAME_ATTR: 'host1'} is_valid = is_valid_cert_host(certInfo) self.assertTrue(is_valid) pass @patch("ambari_server.setupHttps.get_ambari_properties") def test_is_valid_https_port(self, get_ambari_properties_mock): #No ambari.properties get_ambari_properties_mock.return_value = -1 is_valid = is_valid_https_port(1111) self.assertEqual(is_valid, False) #User entered port used by one way auth portOneWay = "1111" portTwoWay = "2222" validPort = "3333" get_ambari_properties_mock.return_value = {SRVR_ONE_WAY_SSL_PORT_PROPERTY: portOneWay, SRVR_TWO_WAY_SSL_PORT_PROPERTY: portTwoWay} is_valid = is_valid_https_port(portOneWay) self.assertEqual(is_valid, False) #User entered port used by two way auth is_valid = is_valid_https_port(portTwoWay) self.assertEqual(is_valid, False) #User entered valid port get_ambari_properties_mock.return_value = {SRVR_ONE_WAY_SSL_PORT_PROPERTY: portOneWay, SRVR_TWO_WAY_SSL_PORT_PROPERTY: portTwoWay} is_valid = is_valid_https_port(validPort) self.assertEqual(is_valid, True) pass @patch("socket.getfqdn") @patch("urllib2.urlopen") @patch("ambari_server.setupHttps.get_ambari_properties") def test_get_fqdn(self, get_ambari_properties_mock, url_open_mock, getfqdn_mock): #No ambari.properties get_ambari_properties_mock.return_value = -1 fqdn = get_fqdn() self.assertEqual(fqdn, None) #Check mbari_server.GET_FQDN_SERVICE_URL property name (AMBARI-2612) #property name should be server.fqdn.service.url self.assertEqual(GET_FQDN_SERVICE_URL, "server.fqdn.service.url") #Read FQDN from service p = MagicMock() p[GET_FQDN_SERVICE_URL] = 'someurl' get_ambari_properties_mock.return_value = p u = MagicMock() host = 'host1.domain.com' u.read.return_value = host url_open_mock.return_value = u fqdn = get_fqdn() self.assertEqual(fqdn, host) #Failed to read FQDN from service, getting from socket u.reset_mock() u.side_effect = Exception("Failed to read FQDN from service") getfqdn_mock.return_value = host fqdn = get_fqdn() self.assertEqual(fqdn, host) pass def test_get_ulimit_open_files(self): # 1 - No ambari.properties p = Properties() open_files = get_ulimit_open_files(p) self.assertEqual(open_files, ULIMIT_OPEN_FILES_DEFAULT) # 2 - With ambari.properties - ok prop_value = 65000 p.process_pair(ULIMIT_OPEN_FILES_KEY, str(prop_value)) open_files = get_ulimit_open_files(p) self.assertEqual(open_files, 65000) # 2 - With ambari.properties - default tf1 = tempfile.NamedTemporaryFile() prop_value = 0 p.process_pair(ULIMIT_OPEN_FILES_KEY, str(prop_value)) open_files = get_ulimit_open_files(p) self.assertEqual(open_files, ULIMIT_OPEN_FILES_DEFAULT) pass @patch("ambari_server.setupHttps.run_os_command") def test_get_cert_info(self, run_os_command_mock): # Error running openssl command path = 'path/to/certificate' run_os_command_mock.return_value = -1, None, None cert_info = get_cert_info(path) self.assertEqual(cert_info, None) #Empty result of openssl command run_os_command_mock.return_value = 0, None, None cert_info = get_cert_info(path) self.assertEqual(cert_info, None) #Positive scenario notAfter = 'Jul 3 14:12:57 2014 GMT' notBefore = 'Jul 3 14:12:57 2013 GMT' attr1_key = 'A' attr1_value = 'foo' attr2_key = 'B' attr2_value = 'bar' attr3_key = 'CN' attr3_value = 'host.domain.com' subject_pattern = '/{attr1_key}={attr1_value}/{attr2_key}={attr2_value}/{attr3_key}={attr3_value}' subject = subject_pattern.format(attr1_key=attr1_key, attr1_value=attr1_value, attr2_key=attr2_key, attr2_value=attr2_value, attr3_key=attr3_key, attr3_value=attr3_value) out_pattern = \ "notAfter={notAfter}" + os.linesep + \ "notBefore={notBefore}" + os.linesep + \ "subject={subject}" + os.linesep + \ "-----BEGIN CERTIFICATE-----" + os.linesep + \ "MIIFHjCCAwYCCQDpHKOBI+Lt0zANBgkqhkiG9w0BAQUFADBRMQswCQYDVQQGEwJV" + os.linesep + \ "..." + os.linesep + \ "5lqd8XxOGSYoMOf+70BLN2sB" + os.linesep + \ "-----END CERTIFICATE-----" + os.linesep + \ "" out = out_pattern.format(notAfter=notAfter, notBefore=notBefore, subject=subject) run_os_command_mock.return_value = 0, out, None cert_info = get_cert_info(path) self.assertEqual(cert_info['notAfter'], notAfter) self.assertEqual(cert_info['notBefore'], notBefore) self.assertEqual(cert_info['subject'], subject) self.assertEqual(cert_info[attr1_key], attr1_value) self.assertEqual(cert_info[attr2_key], attr2_value) self.assertEqual(cert_info[attr3_key], attr3_value) pass @patch("__builtin__.raw_input") def test_get_validated_string_input(self, raw_input_mock): prompt = 'prompt' default_value = 'default' description = 'desc' validator = MagicMock() validator.return_value = True inputed_value1 = 'val1' inputed_value2 = 'val2' raw_input_mock.return_value = inputed_value1 input = get_validated_string_input(prompt, default_value, None, description, False, False, validator) self.assertTrue(validator.called) self.assertEqual(inputed_value1, input) validator.side_effect = [False, True] raw_input_mock.side_effect = [inputed_value1, inputed_value2] input = get_validated_string_input(prompt, default_value, None, description, False, False, validator) self.assertEqual(inputed_value2, input) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.serverUtils.run_os_command") @patch("__builtin__.open") @patch("os.path.exists") def test_is_server_runing(self, os_path_exists_mock, open_mock, \ run_os_command_mock): os_path_exists_mock.return_value = True f = open_mock.return_value f.readline.return_value = "111" run_os_command_mock.return_value = 0, "", "" status, pid = is_server_runing() self.assertTrue(status) self.assertEqual(111, pid) os_path_exists_mock.return_value = False status, pid = is_server_runing() self.assertFalse(status) pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("os_windows.win32serviceutil.QueryServiceStatus") def test_is_server_runing(self, query_service_status_mock): query_service_status_mock.return_value = ("", 4) status, desc = is_server_runing() self.assertTrue(status) self.assertEqual("", desc) query_service_status_mock.return_value = ("", 1) status, desc = is_server_runing() self.assertFalse(status) self.assertEqual("stopped", desc) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.serverUtils.run_os_command") @patch("__builtin__.open") @patch("os.path.exists") def test_is_server_runing_bad_file(self, os_path_exists_mock, open_mock, \ run_os_command_mock): os_path_exists_mock.return_value = True f = open_mock.return_value f.readline.return_value = "" # empty file content run_os_command_mock.return_value = 0, "", "" self.assertRaises(NonFatalException, is_server_runing) open_mock.side_effect = IOError('[Errno 13] Permission denied: /var/run/ambari-server/ambari-server.pid') self.assertRaises(FatalException, is_server_runing) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("os.path.exists") @patch("os.makedirs") @patch("os.chdir") @patch("ambari_server.serverSetup.run_os_command") def test_install_jdk(self, run_os_command_mock, os_chdir_mock, os_makedirs_mock, os_path_exists_mock): run_os_command_mock.return_value = 1, "", "" os_path_exists_mock.return_value = False failed = False try: jdkSetup = JDKSetup() jdkSetup._install_jdk(MagicMock(), MagicMock()) self.fail("Exception was not rised!") except FatalException: failed = True self.assertTrue(failed) pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("os.path.exists") @patch("os.makedirs") @patch("os.chdir") @patch("ambari_server.serverSetup.run_os_command") def test_install_jdk(self, run_os_command_mock, os_chdir_mock, os_makedirs_mock, os_path_exists_mock): jdk_cfg = MagicMock() jdk_cfg.inst_dir = "java_home_dir" run_os_command_mock.return_value = 1, "", "" os_path_exists_mock.return_value = False failed = False try: jdkSetup = JDKSetup() jdkSetup._install_jdk("jdk.exe", jdk_cfg) self.fail("Exception was not rised!") except FatalException: failed = True self.assertTrue(failed) pass @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.serverSetup.read_ambari_user") @patch("os.stat") @patch("os.path.isfile") @patch("os.path.exists") @patch("os.chdir") @patch("os.makedirs") @patch("ambari_server.serverSetup.JDKSetupLinux.adjust_jce_permissions") @patch("ambari_server.serverSetup.expand_jce_zip_file") @patch("ambari_server.serverSetup.force_download_file") @patch("ambari_server.serverSetup.get_YN_input") @patch("ambari_server.serverSetup.run_os_command") @patch("ambari_server.serverSetup.update_properties") @patch("ambari_server.serverSetup.get_validated_string_input") @patch("ambari_server.serverSetup.print_info_msg") @patch("ambari_server.serverSetup.validate_jdk") @patch("ambari_server.serverSetup.get_JAVA_HOME") @patch("ambari_server.serverSetup.get_resources_location") @patch("ambari_server.serverSetup.get_ambari_properties") @patch("shutil.copyfile") @patch("sys.exit") def test_download_jdk(self, exit_mock, copyfile_mock, get_ambari_properties_mock, get_resources_location_mock, get_JAVA_HOME_mock, \ validate_jdk_mock, print_info_msg_mock, get_validated_string_input_mock, update_properties_mock, \ run_os_command_mock, get_YN_input_mock, force_download_file_mock, expand_jce_zip_file_mock, adjust_jce_permissions_mock, os_makedirs_mock, os_chdir_mock, path_existsMock, path_isfileMock, statMock, read_ambari_user_mock): @OsFamilyFuncImpl(OSConst.WINSRV_FAMILY) def _init_test_jdk_mocks(): jdk1_url = "http://somewhere/myjdk.exe" res_location = "resources" p = Properties() p.process_pair("java.releases", "jdk1") p.process_pair("jdk1.desc", "JDK name") p.process_pair("jdk1.url", "http://somewhere/myjdk.exe") p.process_pair("jdk1.dest-file", "myjdk.exe") p.process_pair("jdk1.jcpol-url", "http://somewhere/some-jcpol.zip") p.process_pair("jdk1.jcpol-file", "some-jcpol.zip") p.process_pair("jdk1.home", "C:\\jdk1") p.process_pair("jdk1.re", "(jdk.*)/jre") pem_side_effect1 = [False, True, False] return p, jdk1_url, res_location, pem_side_effect1 @OsFamilyFuncImpl(OsFamilyImpl.DEFAULT) def _init_test_jdk_mocks(): jdk1_url = "http://somewhere/somewhere.tar.gz" res_location = MagicMock() p = Properties() p.process_pair("java.releases", "jdk1") p.process_pair("jdk1.desc", "JDK name") p.process_pair("jdk1.url", jdk1_url) p.process_pair("jdk1.dest-file", "somewhere.tar.gz") p.process_pair("jdk1.jcpol-url", "http://somewhere/some-jcpol.tar.gz") p.process_pair("jdk1.jcpol-file", "some-jcpol.tar.gz") p.process_pair("jdk1.home", "/jdk1") p.process_pair("jdk1.re", "(jdk.*)/jre") pem_side_effect1 = [True, False, True, False] return p, jdk1_url, res_location, pem_side_effect1 args = MagicMock() args.java_home = "somewhere" args.silent = False p, jdk1_url, res_location, pem_side_effect1 = _init_test_jdk_mocks() validate_jdk_mock.return_value = False path_existsMock.return_value = False get_resources_location_mock.return_value = res_location get_JAVA_HOME_mock.return_value = False read_ambari_user_mock.return_value = "ambari" get_ambari_properties_mock.return_value = p # Test case: ambari.properties not found try: download_and_install_jdk(args) self.fail("Should throw exception because of not found ambari.properties") except FatalException: # Expected self.assertTrue(get_ambari_properties_mock.called) pass # Test case: JDK already exists args.java_home = None args.jdk_location = None get_JAVA_HOME_mock.return_value = "some_jdk" validate_jdk_mock.return_value = True get_YN_input_mock.return_value = False path_existsMock.return_value = False run_os_command_mock.return_value = 0, "", "" rcode = download_and_install_jdk(args) self.assertEqual(0, rcode) # Test case: java home setup args.java_home = "somewhere" validate_jdk_mock.return_value = True path_existsMock.return_value = False get_JAVA_HOME_mock.return_value = None rcode = download_and_install_jdk(args) self.assertEqual(0, rcode) self.assertTrue(update_properties_mock.called) # Test case: JDK file does not exist, property not defined validate_jdk_mock.return_value = False path_existsMock.return_value = False get_ambari_properties_mock.return_value = p p.removeProp("jdk1.url") try: download_and_install_jdk(args) self.fail("Should throw exception") except FatalException: # Expected pass # Test case: JDK file does not exist, HTTP response does not # contain Content-Length p.process_pair("jdk1.url", jdk1_url) validate_jdk_mock.return_value = False path_existsMock.return_value = False get_YN_input_mock.return_value = True get_validated_string_input_mock.return_value = "1" run_os_command_mock.return_value = (0, "Wrong out", None) try: download_and_install_jdk(args) self.fail("Should throw exception") except FatalException: # Expected pass # Successful JDK download args.java_home = None validate_jdk_mock.return_value = False path_existsMock.reset_mock() path_existsMock.side_effect = [False, False, False] path_isfileMock.return_value = False args.jdk_location = None run_os_command_mock.return_value = (0, "Creating jdk1/jre", None) statResult = MagicMock() statResult.st_size = 32000 statMock.return_value = statResult try: rcode = download_and_install_jdk(args) except Exception, e: raise self.assertEqual(0, rcode) # Test case: not accept the license" get_YN_input_mock.return_value = False path_existsMock.reset_mock() path_existsMock.side_effect = [False, False, True, False, True, False] download_and_install_jdk(args) self.assertTrue(exit_mock.called) # Test case: jdk is already installed, ensure that JCE check is skipped if -j option is not supplied. args.jdk_location = None get_JAVA_HOME_mock.return_value = "some_jdk" validate_jdk_mock.return_value = True get_YN_input_mock.return_value = False path_existsMock.reset_mock() path_existsMock.side_effect = pem_side_effect1 force_download_file_mock.reset_mock() with patch("ambari_server.serverSetup.JDKSetup._download_jce_policy") as download_jce_policy_mock: rcode = download_and_install_jdk(args) self.assertFalse(download_jce_policy_mock.called) self.assertFalse(force_download_file_mock.called) # Test case: Update JAVA_HOME location using command: ambari-server setup -j %NEW_LOCATION% update_properties_mock.reset_mock() args.java_home = "somewhere" validate_jdk_mock.return_value = True path_existsMock.reset_mock() path_existsMock.side_effect = pem_side_effect1 get_JAVA_HOME_mock.return_value = "some_jdk" path_isfileMock.return_value = True download_and_install_jdk(args) self.assertTrue(update_properties_mock.call_count == 1) # Test case: Negative test case JAVA_HOME location should not be updated if -j option is supplied and # jce_policy file already exists in resources dir. #write_property_mock.reset_mock() #args.java_home = "somewhere" #path_existsMock.side_effect = None #path_existsMock.return_value = True #get_JAVA_HOME_mock.return_value = "some_jdk" #try: # download_and_install_jdk(args) # self.fail("Should throw exception") #except FatalException as fe: # Expected # self.assertFalse(write_property_mock.called) # Test case: Setup ambari-server first time, Custom JDK selected, JDK exists args.java_home = None args.jdk_location = None validate_jdk_mock.return_value = False update_properties_mock.reset_mock() path_existsMock.reset_mock() path_existsMock.side_effect = [True, True, True, True] get_validated_string_input_mock.return_value = "2" get_JAVA_HOME_mock.return_value = None rcode = download_and_install_jdk(args) self.assertEqual(0, rcode) self.assertTrue(update_properties_mock.called) # Test case: Setup ambari-server first time, Custom JDK selected, JDK not exists update_properties_mock.reset_mock() validate_jdk_mock.return_value = False path_existsMock.reset_mock() path_existsMock.side_effect = pem_side_effect1 get_validated_string_input_mock.return_value = "2" get_JAVA_HOME_mock.return_value = None try: download_and_install_jdk(args) self.fail("Should throw exception") except FatalException as fe: # Expected pass # Test when custom java home exists but java binary file doesn't exist args.java_home = None validate_jdk_mock.return_value = False path_isfileMock.return_value = False update_properties_mock.reset_mock() path_existsMock.reset_mock() path_existsMock.side_effect = pem_side_effect1 get_validated_string_input_mock.return_value = "2" get_JAVA_HOME_mock.return_value = None flag = False try: download_and_install_jdk(args) self.fail("Should throw exception") except FatalException as fe: # Expected flag = True pass self.assertTrue(flag) #Test case: Setup ambari-server with java home passed. Path to java home doesn't exist args.java_home = "somewhere" validate_jdk_mock.return_value = False path_existsMock.reset_mock() path_existsMock.side_effect = pem_side_effect1 try: download_and_install_jdk(args) self.fail("Should throw exception") except FatalException as fe: self.assertTrue("Path to java home somewhere or java binary file does not exists" in fe.reason) pass pass @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.dbConfiguration_linux.run_os_command") def test_get_postgre_status(self, run_os_command_mock): run_os_command_mock.return_value = (1, "running", None) pg_status, retcode, out, err = PGConfig._get_postgre_status() self.assertEqual("running", pg_status) run_os_command_mock.return_value = (1, "wrong", None) pg_status, retcode, out, err = PGConfig._get_postgre_status() self.assertEqual(None, pg_status) pass @not_for_platform(PLATFORM_WINDOWS) @patch("time.sleep") @patch("subprocess.Popen") @patch("ambari_server.dbConfiguration_linux.run_os_command") @patch.object(PGConfig, "_get_postgre_status") def test_check_postgre_up(self, get_postgre_status_mock, run_os_command_mock, popen_mock, sleep_mock): from ambari_server import serverConfiguration p = MagicMock() p.communicate.return_value = (None, None) p.returncode = 0 popen_mock.return_value = p get_postgre_status_mock.return_value = "running", 0, "", "" serverConfiguration.OS_TYPE = OSConst.OS_REDHAT p.poll.return_value = 0 run_os_command_mock.return_value = (0, None, None) pg_status, retcode, out, err = PGConfig._check_postgre_up() self.assertEqual(0, retcode) serverConfiguration.OS_TYPE = OSConst.OS_SUSE run_os_command_mock.return_value = (0, None, None) p.poll.return_value = 0 get_postgre_status_mock.return_value = "stopped", 0, "", "" pg_status, retcode, out, err = PGConfig._check_postgre_up() self.assertEqual(0, retcode) pass @patch("platform.linux_distribution") @patch("platform.system") @patch("ambari_commons.logging_utils.print_info_msg") @patch("ambari_commons.logging_utils.print_error_msg") @patch("ambari_server.serverSetup.get_ambari_properties") @patch("ambari_server.serverSetup.write_property") @patch("ambari_server.serverConfiguration.get_conf_dir") def test_configure_os_settings(self, get_conf_dir_mock, write_property_mock, get_ambari_properties_mock, print_error_msg_mock, print_info_msg_mock, systemMock, distMock): get_ambari_properties_mock.return_value = -1 rcode = configure_os_settings() self.assertEqual(-1, rcode) p = MagicMock() p[OS_TYPE_PROPERTY] = 'somevalue' get_ambari_properties_mock.return_value = p rcode = configure_os_settings() self.assertEqual(0, rcode) p.__getitem__.return_value = "" rcode = configure_os_settings() self.assertEqual(0, rcode) self.assertTrue(write_property_mock.called) self.assertEqual(2, write_property_mock.call_count) self.assertEquals(write_property_mock.call_args_list[0][0][0], "server.os_family") self.assertEquals(write_property_mock.call_args_list[1][0][0], "server.os_type") pass @patch("__builtin__.open") @patch("ambari_server.serverConfiguration.Properties") @patch("ambari_server.serverConfiguration.search_file") @patch("ambari_server.serverConfiguration.get_conf_dir") def test_get_JAVA_HOME(self, get_conf_dir_mock, search_file_mock, Properties_mock, openMock): openMock.side_effect = Exception("exception") result = get_JAVA_HOME() self.assertEqual(None, result) expected = os.path.dirname(__file__) p = MagicMock() p.__getitem__.return_value = expected openMock.side_effect = None Properties_mock.return_value = p result = get_JAVA_HOME() self.assertEqual(expected, result) pass @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) def test_prompt_db_properties_default(self): args = MagicMock() args.must_set_database_options = False del args.database_index del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.persistence_type prompt_db_properties(args) self.assertEqual(args.database_index, 0) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(LinuxDBMSConfig, "_setup_remote_server") @patch("ambari_server.dbConfiguration_linux.print_info_msg") @patch("ambari_server.dbConfiguration_linux.read_password") @patch("ambari_server.dbConfiguration_linux.get_validated_string_input") @patch("ambari_server.dbConfiguration.get_validated_string_input") @patch("ambari_server.serverSetup.get_YN_input") def test_prompt_db_properties_oracle_sname(self, gyni_mock, gvsi_mock, gvsi_2_mock, rp_mock, print_info_msg_mock, srs_mock): gyni_mock.return_value = True list_of_return_values = ["ambari-server", "ambari", "1", "1521", "localhost", "2"] def side_effect(*args, **kwargs): return list_of_return_values.pop() gvsi_mock.side_effect = side_effect gvsi_2_mock.side_effect = side_effect rp_mock.return_value = "password" args = MagicMock() args.must_set_database_options = True del args.database_index del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.persistence_type del args.sid_or_sname del args.jdbc_url set_silent(False) prompt_db_properties(args) self.assertEqual(args.database_index, 1) props = Properties() factory = DBMSConfigFactory() dbmsConfig = factory.create(args, props) self.assertEqual(dbmsConfig.dbms, "oracle") self.assertEqual(dbmsConfig.database_port, "1521") self.assertEqual(dbmsConfig.database_host, "localhost") self.assertEqual(dbmsConfig.database_name, "ambari") self.assertEqual(dbmsConfig.database_username, "ambari") self.assertEqual(dbmsConfig.database_password, "bigdata") self.assertEqual(dbmsConfig.sid_or_sname, "sid") dbmsConfig.configure_database(props) self.assertEqual(dbmsConfig.database_username, "ambari-server") self.assertEqual(dbmsConfig.sid_or_sname, "sname") pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(LinuxDBMSConfig, "_setup_remote_server") @patch("ambari_server.dbConfiguration_linux.print_info_msg") @patch("ambari_server.dbConfiguration_linux.read_password") @patch("ambari_server.dbConfiguration_linux.get_validated_string_input") @patch("ambari_server.dbConfiguration.get_validated_string_input") @patch("ambari_server.serverSetup.get_YN_input") def test_prompt_db_properties_oracle_sid(self, gyni_mock, gvsi_mock, gvsi_2_mock, rp_mock, print_info_msg_mock, srs_mock): gyni_mock.return_value = True list_of_return_values = ["ambari-server", "ambari", "2", "1521", "localhost", "2"] def side_effect(*args, **kwargs): return list_of_return_values.pop() gvsi_mock.side_effect = side_effect gvsi_2_mock.side_effect = side_effect rp_mock.return_value = "password" args = MagicMock() args.must_set_database_options = True del args.database_index del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.persistence_type del args.sid_or_sname del args.jdbc_url set_silent(False) prompt_db_properties(args) self.assertEqual(args.database_index, 1) props = Properties() factory = DBMSConfigFactory() dbmsConfig = factory.create(args, props) self.assertEqual(dbmsConfig.dbms, "oracle") self.assertEqual(dbmsConfig.database_port, "1521") self.assertEqual(dbmsConfig.database_host, "localhost") self.assertEqual(dbmsConfig.database_name, "ambari") self.assertEqual(dbmsConfig.database_username, "ambari") self.assertEqual(dbmsConfig.database_password, "bigdata") dbmsConfig.configure_database(props) self.assertEqual(dbmsConfig.database_username, "ambari-server") self.assertEqual(dbmsConfig.database_password, "password") self.assertEqual(dbmsConfig.sid_or_sname, "sid") pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(PGConfig, "_setup_local_server") @patch("ambari_server.dbConfiguration_linux.print_info_msg") @patch("ambari_server.dbConfiguration_linux.read_password") @patch("ambari_server.dbConfiguration_linux.get_validated_string_input") @patch("ambari_server.dbConfiguration.get_validated_string_input") @patch("ambari_server.serverSetup.get_YN_input") def test_prompt_db_properties_postgre_adv(self, gyni_mock, gvsi_mock, gvsi_2_mock, rp_mock, print_info_msg_mock, sls_mock): gyni_mock.return_value = True list_of_return_values = ["ambari-server", "ambari", "ambari", "1"] def side_effect(*args, **kwargs): return list_of_return_values.pop() gvsi_mock.side_effect = side_effect gvsi_2_mock.side_effect = side_effect rp_mock.return_value = "password" args = MagicMock() args.must_set_database_options = True del args.database_index del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.persistence_type set_silent(False) prompt_db_properties(args) self.assertEqual(args.database_index, 0) props = Properties() factory = DBMSConfigFactory() dbmsConfig = factory.create(args, props) self.assertEqual(dbmsConfig.dbms, "postgres") self.assertEqual(dbmsConfig.database_port, "5432") self.assertEqual(dbmsConfig.database_host, "localhost") self.assertEqual(dbmsConfig.database_name, "ambari") self.assertEqual(dbmsConfig.database_username, "ambari") self.assertEqual(dbmsConfig.database_password, "bigdata") dbmsConfig.configure_database(props) self.assertEqual(dbmsConfig.database_username, "ambari-server") self.assertEqual(dbmsConfig.database_password, "password") self.assertEqual(dbmsConfig.sid_or_sname, "sid") pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.dbConfiguration_linux.store_password_file") @patch("ambari_server.dbConfiguration_linux.read_password") @patch("ambari_server.dbConfiguration_linux.get_validated_string_input") @patch("ambari_server.dbConfiguration_linux.get_YN_input") def test_prompt_db_properties_for_each_database_type(self, gyni_mock, gvsi_mock, rp_mock, spf_mock): """ :return: Validates that installation for each database type correctly stores the database type, database name, and optionally the postgres schema name. """ from ambari_server import serverConfiguration gyni_mock.return_value = True rp_mock.return_value = "password" spf_mock.return_value = "encrypted password" # Values to use while installing several database types hostname = "localhost" db_name = "db_ambari" postgres_schema = "sc_ambari" port = "1234" oracle_service = "1" oracle_service_name = "ambari" user_name = "ambari" # Input values postgres_embedded_values = [db_name, postgres_schema, hostname] oracle_values = [hostname, port, oracle_service, oracle_service_name, user_name] mysql_values = [hostname, port, db_name, user_name] postgres_external_values = [hostname, port, db_name, postgres_schema, user_name] mssql_values = [hostname, port, db_name, user_name] list_of_return_values = postgres_embedded_values + oracle_values + mysql_values + postgres_external_values + mssql_values list_of_return_values = list_of_return_values[::-1] # Reverse the list since the input will be popped def side_effect(*args, **kwargs): return list_of_return_values.pop() gvsi_mock.side_effect = side_effect if AMBARI_CONF_VAR in os.environ: del os.environ[AMBARI_CONF_VAR] tempdir = tempfile.gettempdir() os.environ[AMBARI_CONF_VAR] = tempdir prop_file = os.path.join(tempdir, "ambari.properties") for i in range(0, 5): # Use the expected path of the ambari.properties file to delete it if it exists, and then create a new one # during each use case. if os.path.exists(prop_file): os.remove(prop_file) with open(prop_file, "w") as f: f.write("server.jdbc.database_name=oldDBName") f.close() serverConfiguration.AMBARI_PROPERTIES_FILE = prop_file args = MagicMock() properties = Properties() args.database_index = i args.silent = False del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.sid_or_sname del args.jdbc_url factory = DBMSConfigFactory() dbConfig = factory.create(args, properties) dbConfig._prompt_db_properties() if dbConfig._is_local_database(): dbConfig._setup_local_server(properties) else: dbConfig._setup_remote_server(properties) if i == 0: # Postgres Embedded self.assertEqual(properties[JDBC_DATABASE_PROPERTY], "postgres") self.assertEqual(properties[JDBC_DATABASE_NAME_PROPERTY], db_name) self.assertEqual(properties[JDBC_POSTGRES_SCHEMA_PROPERTY], postgres_schema) self.assertEqual(properties[PERSISTENCE_TYPE_PROPERTY], "local") elif i == 1: # Oracle self.assertEqual(properties[JDBC_DATABASE_PROPERTY], "oracle") self.assertFalse(JDBC_POSTGRES_SCHEMA_PROPERTY in properties.propertyNames()) self.assertEqual(properties[PERSISTENCE_TYPE_PROPERTY], "remote") elif i == 2: # MySQL self.assertEqual(properties[JDBC_DATABASE_PROPERTY], "mysql") self.assertFalse(JDBC_POSTGRES_SCHEMA_PROPERTY in properties.propertyNames()) self.assertEqual(properties[PERSISTENCE_TYPE_PROPERTY], "remote") elif i == 3: # Postgres External self.assertEqual(properties[JDBC_DATABASE_PROPERTY], "postgres") self.assertEqual(properties[JDBC_DATABASE_NAME_PROPERTY], db_name) self.assertEqual(properties[JDBC_POSTGRES_SCHEMA_PROPERTY], postgres_schema) self.assertEqual(properties[PERSISTENCE_TYPE_PROPERTY], "remote") elif i == 4: # MSSQL self.assertEqual(properties[JDBC_DATABASE_PROPERTY], "mssql") self.assertFalse(JDBC_POSTGRES_SCHEMA_PROPERTY in properties.propertyNames()) self.assertEqual(properties[PERSISTENCE_TYPE_PROPERTY], "remote") pass @patch.object(os.path, "exists") @patch.object(os.path, "isfile") def test_validate_jdk(self, isfile_mock, exists_mock): exists_mock.side_effect = [False] result = validate_jdk("path") self.assertFalse(result) exists_mock.side_effect = [True, False] result = validate_jdk("path") self.assertFalse(result) exists_mock.side_effect = [True, True] isfile_mock.return_value = False result = validate_jdk("path") self.assertFalse(result) exists_mock.side_effect = [True, True] isfile_mock.return_value = True result = validate_jdk("path") self.assertTrue(result) pass @patch("glob.glob") @patch("ambari_server.serverConfiguration.get_JAVA_HOME") @patch("ambari_server.serverConfiguration.validate_jdk") def test_find_jdk(self, validate_jdk_mock, get_JAVA_HOME_mock, globMock): get_JAVA_HOME_mock.return_value = "somewhere" validate_jdk_mock.return_value = True result = find_jdk() self.assertEqual("somewhere", result) get_JAVA_HOME_mock.return_value = None globMock.return_value = [] result = find_jdk() self.assertEqual(None, result) globMock.return_value = ["one", "two"] result = find_jdk() self.assertNotEqual(None, result) globMock.return_value = ["one", "two"] validate_jdk_mock.side_effect = [False, True] result = find_jdk() self.assertEqual(result, "one") pass @patch("os.path.exists") @patch("zipfile.ZipFile") @patch("os.path.split") @patch("os.listdir") @patch("ambari_server.serverSetup.copy_files") @patch("shutil.rmtree") def test_unpack_jce_policy(self, rmtree_mock, copy_files_mock, os_listdir_mock, os_path_split_mock, zipfile_mock, exists_mock): # Testing the case when the zip file doesn't contains any folder exists_mock.return_value = True zipfile = MagicMock() zipfile_mock.return_value = zipfile zip_members = ["US_export_policy.jar", "local_policy.jar", "README.txt"] zipfile.namelist.return_value = zip_members os_path_split_mock.return_value = [""] expand_jce_zip_file("", "") self.assertTrue(exists_mock.called) self.assertTrue(zipfile_mock.called) self.assertTrue(os_path_split_mock.called) # Testing the case when the zip file contains a folder unziped_jce_path = "jce" os_path_split_mock.return_value = unziped_jce_path expand_jce_zip_file("", "") self.assertTrue(exists_mock.called) self.assertTrue(zipfile_mock.called) self.assertTrue(os_listdir_mock.called) self.assertTrue(copy_files_mock.called) self.assertTrue(rmtree_mock.called) # Testing when the jdk_security_path or jce_zip_path doesn't exist exists_mock.return_value = False try: expand_jce_zip_file("", "") except FatalException: self.assertTrue(True) exists_mock.return_value = True # Testing when zipfile fail with an error zipfile_mock.side_effect = FatalException(1,"Extract error") try: expand_jce_zip_file("", "") except FatalException: self.assertTrue(True) @patch("os.path.exists") @patch("shutil.copy") @patch("os.path.split") @patch("ambari_server.serverSetup.update_properties") @patch.object(JDKSetup, "unpack_jce_policy") @patch("ambari_server.serverSetup.get_ambari_properties") @patch("ambari_commons.os_utils.search_file") @patch("__builtin__.open") def test_setup_jce_policy(self, open_mock, search_file_mock, get_ambari_properties_mock, unpack_jce_policy_mock, update_properties_mock, path_split_mock, shutil_copy_mock, exists_mock): exists_mock.return_value = True properties = Properties() properties.process_pair(JAVA_HOME_PROPERTY, "/java_home") unpack_jce_policy_mock.return_value = 0 get_ambari_properties_mock.return_value = properties conf_file = 'etc/ambari-server/conf/ambari.properties' search_file_mock.return_value = conf_file path_split_mock.return_value = ["/path/to", "JCEPolicy.zip"] args = ['setup-jce', '/path/to/JCEPolicy.zip'] setup_jce_policy(args) shutil_copy_mock.assert_called_with(args[1], configDefaults.SERVER_RESOURCES_DIR) self.assertTrue(unpack_jce_policy_mock.called) self.assertTrue(get_ambari_properties_mock.called) self.assertTrue(update_properties_mock.called) # Testing that if the source and the destination is the same will not try to copy the file path_split_mock.return_value = [configDefaults.SERVER_RESOURCES_DIR, "JCEPolicy.zip"] shutil_copy_mock.reset_mock() setup_jce_policy(args) self.assertFalse(shutil_copy_mock.called) self.assertTrue(unpack_jce_policy_mock.called) self.assertTrue(get_ambari_properties_mock.called) self.assertTrue(update_properties_mock.called) path_split_mock.return_value = ["/path/to", "JCEPolicy.zip"] # Testing with bad path exists_mock.return_value = False try: setup_jce_policy(args) except FatalException: self.assertTrue(True) exists_mock.return_value = True # Testing with an error produced by shutil.copy shutil_copy_mock.reset_mock() shutil_copy_mock.side_effect = FatalException(1, "Error trying to copy the file.") try: setup_jce_policy(args) except FatalException: self.assertTrue(True) # Testing with an error produced by Properties.store function update_properties_mock.side_effect = Exception("Invalid file.") try: setup_jce_policy(args) except Exception: self.assertTrue(True) update_properties_mock.reset_mock() # Testing with an error produced by unpack_jce_policy unpack_jce_policy_mock.side_effect = FatalException(1, "Can not install JCE policy") try: setup_jce_policy(args) except FatalException: self.assertTrue(True) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_commons.firewall.run_os_command") @patch("os.path.exists") @patch("os.path.isfile") @patch("ambari_commons.os_utils.remove_file") @patch("ambari_server.dbConfiguration_linux.LinuxDBMSConfig.ensure_jdbc_driver_installed") @patch("ambari_server.dbConfiguration_linux.get_YN_input") @patch("ambari_server.serverSetup.update_properties") @patch("ambari_server.dbConfiguration_linux.get_ambari_properties") @patch("ambari_server.dbConfiguration_linux.store_password_file") @patch("ambari_server.dbConfiguration_linux.run_os_command") @patch("ambari_server.dbConfiguration_linux.PGConfig._configure_postgres") @patch("ambari_server.dbConfiguration_linux.PGConfig._check_postgre_up") @patch("ambari_server.dbConfiguration_linux.PGConfig._is_jdbc_user_changed") @patch("ambari_server.serverSetup.verify_setup_allowed") @patch("ambari_server.dbConfiguration_linux.read_password") @patch("ambari_server.dbConfiguration_linux.get_validated_string_input") @patch("ambari_server.dbConfiguration.get_validated_string_input") @patch("ambari_server.serverSetup.get_YN_input") @patch("ambari_server.serverSetup.get_ambari_properties") @patch("ambari_server.serverSetup.configure_os_settings") @patch("ambari_server.serverSetup.download_and_install_jdk") @patch("ambari_server.serverSetup.check_ambari_user") @patch("ambari_server.serverSetup.check_jdbc_drivers") @patch("ambari_server.serverSetup.disable_security_enhancements") @patch("ambari_server.serverSetup.is_root") @patch("ambari_server.serverSetup.proceedJDBCProperties") @patch("ambari_server.serverSetup.extract_views") @patch("ambari_server.serverSetup.adjust_directory_permissions") @patch("ambari_server.serverSetup.service_setup") @patch("ambari_server.serverSetup.read_ambari_user") @patch("ambari_server.serverSetup.expand_jce_zip_file") def test_setup(self, expand_jce_zip_file_mock, read_ambari_user_mock, service_setup_mock, adjust_dirs_mock, extract_views_mock, proceedJDBCProperties_mock, is_root_mock, disable_security_enhancements_mock, check_jdbc_drivers_mock, check_ambari_user_mock, download_jdk_mock, configure_os_settings_mock, get_ambari_properties_mock, get_YN_input_mock, gvsi_mock, gvsi_1_mock, read_password_mock, verify_setup_allowed_method, is_jdbc_user_changed_mock, check_postgre_up_mock, configure_postgres_mock, run_os_command_1_mock, store_password_file_mock, get_ambari_properties_1_mock, update_properties_mock, get_YN_input_1_mock, ensure_jdbc_driver_installed_mock, remove_file_mock, isfile_mock, exists_mock, run_os_command_mock): hostname = "localhost" db_name = "db_ambari" postgres_schema = "sc_ambari" port = "1234" oracle_service = "1" oracle_service_name = "ambari" user_name = "ambari" args = MagicMock() del args.dbms del args.database_index del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password args.silent = False failed = False properties = Properties() get_YN_input_mock.return_value = False isfile_mock.return_value = False verify_setup_allowed_method.return_value = 0 exists_mock.return_value = False remove_file_mock.return_value = 0 run_os_command_mock.return_value = 3,"","" extract_views_mock.return_value = 0 read_ambari_user_mock.return_value = "ambari" read_password_mock.return_value = "bigdata2" get_ambari_properties_mock.return_value = properties get_ambari_properties_1_mock.return_value = properties store_password_file_mock.return_value = "encrypted_bigdata2" ensure_jdbc_driver_installed_mock.return_value = True check_postgre_up_mock.return_value = (PGConfig.PG_STATUS_RUNNING, 0, "", "") configure_postgres_mock.return_value = (0, "", "") run_os_command_1_mock.return_value = (0, "", "") expand_jce_zip_file_mock.return_value = 0 def reset_mocks(): is_jdbc_user_changed_mock.reset_mock() is_root_mock.reset_mock() disable_security_enhancements_mock.reset_mock() check_jdbc_drivers_mock.reset_mock() check_ambari_user_mock.reset_mock() run_os_command_mock.reset_mock() configure_os_settings_mock.reset_mock() run_os_command_1_mock.reset_mock() get_YN_input_1_mock.reset_mock() update_properties_mock.reset_mock() args = MagicMock() del args.dbms del args.database_index del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.persistence_type del args.sid_or_sname del args.jdbc_url args.jdbc_driver= None args.jdbc_db = None args.silent = False return args # Testing call under non-root is_root_mock.return_value = False try: setup(args) self.fail("Should throw exception") except FatalException as fe: # Expected self.assertTrue("root-level" in fe.reason) pass args = reset_mocks() # Testing calls under root # remote case is_root_mock.return_value = True disable_security_enhancements_mock.return_value = (0, "") check_ambari_user_mock.return_value = (0, False, 'user', None) check_jdbc_drivers_mock.return_value = 0 download_jdk_mock.return_value = 0 configure_os_settings_mock.return_value = 0 result = setup(args) self.assertEqual(None, result) self.assertTrue(check_ambari_user_mock.called) self.assertEqual(1, run_os_command_mock.call_count) #Local case args = reset_mocks() # Input values db_selection_values = ["1"] postgres_values = [db_name, postgres_schema, hostname] postgres_values = postgres_values[::-1] # Reverse the list since the input will be popped def side_effect(*args, **kwargs): return db_selection_values.pop() gvsi_mock.side_effect = side_effect def side_effect_1(*args, **kwargs): return postgres_values.pop() gvsi_1_mock.side_effect = side_effect_1 get_YN_input_mock.return_value = True # is_local_database_mock.return_value = True is_jdbc_user_changed_mock.return_value = False try: result = setup(args) except FatalException: self.fail("Setup should be successful") self.assertEqual(None, result) self.assertTrue(is_jdbc_user_changed_mock.called) self.assertTrue(update_properties_mock.called) self.assertTrue(run_os_command_1_mock.called) self.assertFalse(remove_file_mock.called) self.assertTrue("Ambari-DDL-Postgres-EMBEDDED-CREATE.sql" in run_os_command_1_mock.call_args[0][0][3]) #if DB user name was changed args = reset_mocks() # is_local_database_mock.return_value = True is_jdbc_user_changed_mock.return_value = True db_selection_values = ["1"] postgres_values = [db_name, postgres_schema, hostname] postgres_values = postgres_values[::-1] # Reverse the list since the input will be popped try: result = setup(args) except FatalException: self.fail("Setup should be successful") self.assertEqual(None, result) self.assertTrue(is_jdbc_user_changed_mock.called) self.assertTrue(update_properties_mock.called) self.assertTrue(run_os_command_1_mock.called) self.assertFalse(remove_file_mock.called) #negative case args = reset_mocks() # Use remote database get_YN_input_1_mock.return_value = False db_selection_values = ["4"] postgres_values = [hostname, port, db_name, postgres_schema, user_name] postgres_values = postgres_values[::-1] # Reverse the list since the input will be popped try: result = setup(args) self.fail("Should throw exception") except NonFatalException as fe: self.assertTrue("Remote database setup aborted." in fe.reason) self.assertFalse(run_os_command_1_mock.called) # test not run setup if ambari-server setup executed with jdbc properties args = reset_mocks() # is_server_runing_mock.return_value = (False, 1) args.jdbc_driver= "path/to/driver" args.jdbc_db = "test_db_name" setup(args) self.assertTrue(proceedJDBCProperties_mock.called) self.assertFalse(disable_security_enhancements_mock.called) self.assertFalse(check_ambari_user_mock.called) pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_commons.firewall.run_os_command") @patch("os.path.exists") @patch("os.path.isfile") @patch("ambari_commons.os_utils.remove_file") @patch("ambari_server.dbConfiguration_windows.MSSQLConfig.ensure_jdbc_driver_installed") @patch("ambari_server.serverSetup.update_properties") @patch("ambari_server.dbConfiguration_windows.store_password_file") @patch("ambari_server.dbConfiguration_windows.run_os_command") @patch("ambari_server.serverSetup.verify_setup_allowed") @patch("ambari_server.dbConfiguration_windows.get_validated_string_input") @patch("ambari_server.dbConfiguration.get_validated_string_input") @patch("ambari_server.serverSetup.get_YN_input") @patch("ambari_server.serverSetup.get_ambari_properties") @patch("ambari_server.serverSetup.configure_os_settings") @patch("ambari_server.serverSetup.download_and_install_jdk") @patch("ambari_server.serverSetup.check_firewall") @patch("ambari_server.serverSetup.check_ambari_user") @patch("ambari_server.serverSetup.check_jdbc_drivers") @patch("ambari_server.serverSetup.disable_security_enhancements") @patch("ambari_server.serverSetup.is_root") @patch("ambari_server.serverSetup.proceedJDBCProperties") @patch("ambari_server.serverSetup.extract_views") @patch("ambari_server.serverSetup.adjust_directory_permissions") @patch("ambari_server.serverSetup.service_setup") @patch("ambari_server.serverSetup.read_ambari_user") @patch("ambari_server.serverSetup.expand_jce_zip_file") def test_setup(self, expand_jce_zip_file_mock, read_ambari_user_mock, service_setup_mock, adjust_dirs_mock, extract_views_mock, proceedJDBCProperties_mock, is_root_mock, disable_security_enhancements_mock, check_jdbc_drivers_mock, check_ambari_user_mock, check_firewall_mock, download_jdk_mock, configure_os_settings_mock, get_ambari_properties_mock, get_YN_input_mock, gvsi_mock, gvsi_1_mock, verify_setup_allowed_method, run_os_command_1_mock, store_password_file_mock, update_properties_mock, ensure_jdbc_driver_installed_mock, remove_file_mock, isfile_mock, exists_mock, run_os_command_mock): hostname = "localhost" db_name = "db_ambari" port = "1433" user_name = "ambari" password = "bigdata2" failed = False properties = Properties() get_YN_input_mock.return_value = False isfile_mock.return_value = False verify_setup_allowed_method.return_value = 0 exists_mock.return_value = False remove_file_mock.return_value = 0 run_os_command_mock.return_value = 3,"","" extract_views_mock.return_value = 0 read_ambari_user_mock.return_value = "ambari" #read_password_mock.return_value = "bigdata2" get_ambari_properties_mock.return_value = properties store_password_file_mock.return_value = "encrypted_bigdata2" ensure_jdbc_driver_installed_mock.return_value = True run_os_command_1_mock.return_value = (0, "", "") expand_jce_zip_file_mock.return_value = 0 def reset_mocks(): is_root_mock.reset_mock() disable_security_enhancements_mock.reset_mock() check_jdbc_drivers_mock.reset_mock() check_ambari_user_mock.reset_mock() run_os_command_mock.reset_mock() configure_os_settings_mock.reset_mock() run_os_command_1_mock.reset_mock() update_properties_mock.reset_mock() args = MagicMock() del args.dbms del args.database_index del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.default_database_host del args.persistence_type del args.init_db_script_file del args.cleanup_db_script_file del args.sid_or_sname del args.jdbc_url args.jdbc_driver= None args.jdbc_db = None args.silent = False args.must_set_database_options = True return args args = reset_mocks() # Testing call under non-root is_root_mock.return_value = False try: setup(args) self.fail("Should throw exception") except FatalException as fe: # Expected self.assertTrue("administrator-level" in fe.reason) pass args = reset_mocks() # Testing calls under root is_root_mock.return_value = True disable_security_enhancements_mock.return_value = (0, "") check_ambari_user_mock.return_value = (0, False, 'user', None) check_jdbc_drivers_mock.return_value = 0 download_jdk_mock.return_value = 0 configure_os_settings_mock.return_value = 0 result = setup(args) self.assertEqual(None, result) self.assertTrue(check_ambari_user_mock.called) self.assertEqual(2, run_os_command_1_mock.call_count) #negative case args = reset_mocks() # Use Windows authentication get_YN_input_mock.return_value = True gvsi_1_mock.side_effect = [hostname, "1"] try: result = setup(args) except Exception: self.fail("Shouldn't throw exception") self.assertTrue(run_os_command_1_mock.called) # Use SQL Server authentication get_YN_input_mock.return_value = True gvsi_1_mock.side_effect = [hostname, "2", user_name, password] try: result = setup(args) except Exception: self.fail("Shouldn't throw exception") self.assertTrue(run_os_command_1_mock.called) # test not run setup if ambari-server setup executed with jdbc properties args = reset_mocks() args.jdbc_driver= "path/to/driver" args.jdbc_db = "test_db_name" setup(args) self.assertTrue(proceedJDBCProperties_mock.called) self.assertFalse(disable_security_enhancements_mock.called) self.assertFalse(check_ambari_user_mock.called) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(OracleConfig, "_get_remote_script_line") @patch("ambari_server.serverSetup.is_server_runing") @patch("ambari_server.dbConfiguration_linux.get_YN_input") @patch("ambari_server.serverSetup.get_YN_input") @patch.object(PGConfig, "_setup_db") @patch("ambari_server.dbConfiguration_linux.print_warning_msg") @patch("ambari_server.dbConfiguration_linux.print_info_msg") @patch("ambari_server.dbConfiguration_linux.run_os_command") @patch("ambari_server.dbConfiguration.decrypt_password_for_alias") @patch("ambari_server.serverSetup.get_ambari_properties") @patch("ambari_server.serverSetup.is_root") def test_reset(self, is_root_mock, get_ambari_properties_mock, decrypt_password_for_alias_mock, run_os_command_mock, print_info_msg_mock, print_warning_msg_mock, setup_db_mock, get_YN_input_mock, get_YN_input_2_mock, is_server_running_mock, get_remote_script_line_mock): def reset_mocks(): args = MagicMock() del args.dbms del args.database_index del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.persistence_type del args.init_script_file del args.drop_script_file del args.sid_or_sname del args.jdbc_url return args properties = Properties() get_ambari_properties_mock.return_value = properties args = reset_mocks() args.persistence_type = "local" get_YN_input_mock.return_value = False decrypt_password_for_alias_mock.return_value = "password" is_server_running_mock.return_value = (False, 0) setup_db_mock.side_effect = [(0,None, None),(0,None, "ERROR: database 'ambari' is being accessed by other users"), (0, None, "ERROR: user 'mapred' already exist")] # Testing call under non-root is_root_mock.return_value = False try: reset(args) self.fail("Should throw exception") except FatalException as fe: # Expected self.assertTrue("root-level" in fe.reason) pass # Testing calls under root is_root_mock.return_value = True try: reset(args) self.fail("Should throw exception") except FatalException as fe: # Expected self.assertFalse("root-level" in fe.reason) pass get_YN_input_mock.return_value = True get_YN_input_2_mock.return_value = True run_os_command_mock.return_value = (1, None, None) try: reset(args) self.fail("Should throw exception") except FatalException: # Expected pass run_os_command_mock.return_value = (0, None, None) reset(args) self.assertTrue(setup_db_mock.called) # Database errors cases is_server_running_mock.side_effect = [(True, 123), (False, 0), (False, 0), (False, 0), (False, 0)] try: reset(args) self.fail("Should throw exception") except FatalException: # Expected pass try: reset(args) self.fail("Should throw exception") except NonFatalException: # Expected pass args = reset_mocks() args.dbms = "postgres" #get_remote_script_line_mock.return_value = None try: #remote db case reset(args) self.fail("Should throw exception") except NonFatalException: # Expected pass args = reset_mocks() args.dbms = "oracle" print_warning_msg_mock.reset_mock() get_remote_script_line_mock.reset_mock() get_remote_script_line_mock.side_effect = ["drop", "create"] try: #remote db case (not Postgres) rcode = reset(args) self.fail("Should throw exception") except NonFatalException: # Expected self.assertTrue(get_remote_script_line_mock.called) self.assertTrue(print_warning_msg_mock.called) pass pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.serverSetup.is_server_runing") @patch("ambari_server.serverSetup.get_YN_input") @patch("ambari_server.dbConfiguration_windows.print_warning_msg") @patch("ambari_server.dbConfiguration_windows.print_info_msg") @patch("ambari_server.dbConfiguration_windows.run_os_command") @patch("ambari_server.dbConfiguration.decrypt_password_for_alias") @patch("ambari_server.serverSetup.get_ambari_properties") @patch("ambari_server.serverSetup.is_root") def test_reset(self, is_root_mock, get_ambari_properties_mock, decrypt_password_for_alias_mock, run_os_command_mock, print_info_msg_mock, print_warning_msg_mock, get_YN_input_mock, is_server_running_mock): def reset_mocks(): args = MagicMock() del args.dbms del args.database_index del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.default_database_host del args.persistence_type del args.init_db_script_file del args.cleanup_db_script_file del args.sid_or_sname del args.jdbc_url return args properties = Properties() get_ambari_properties_mock.return_value = properties args = reset_mocks() args.persistence_type = "local" get_YN_input_mock.return_value = False decrypt_password_for_alias_mock.return_value = "password" is_server_running_mock.return_value = (False, 0) # Testing call under non-root is_root_mock.return_value = False try: reset(args) self.fail("Should throw exception") except FatalException as fe: # Expected self.assertTrue("administrator-level" in fe.reason) pass # Testing calls under root is_root_mock.return_value = True try: reset(args) self.fail("Should throw exception") except FatalException as fe: # Expected self.assertFalse("administrator-level" in fe.reason) pass get_YN_input_mock.return_value = True run_os_command_mock.return_value = (1, None, None) try: reset(args) self.fail("Should throw exception") except FatalException: # Expected pass run_os_command_mock.reset_mock() run_os_command_mock.return_value = (0, None, None) reset(args) self.assertTrue(run_os_command_mock.called) self.assertEqual(run_os_command_mock.call_count, 2) # Database errors cases is_server_running_mock.side_effect = [(True, 123), (False, 0)] try: reset(args) self.fail("Should throw exception") except FatalException: # Expected pass try: reset(args) except NonFatalException: self.fail("Shouldn't throw exception") pass pass @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.serverSetup.get_YN_input") @patch("__builtin__.raw_input") @patch("ambari_server.serverSetup.is_root") def test_reset_default(self, is_root_mock, raw_input_mock, get_YN_inputMock): is_root_mock.return_value=True get_YN_inputMock.return_value = False raw_input_mock.return_value="" args = MagicMock() try: reset(args) self.fail("Should throw exception") except FatalException as fe: # Expected self.assertTrue(fe.code == 1) pass pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(PGConfig, "_setup_db") @patch("ambari_server.dbConfiguration_linux.print_info_msg") @patch("ambari_server.dbConfiguration_linux.run_os_command") #@patch("ambari_server.serverSetup.parse_properties_file") @patch("ambari_server.serverSetup.is_root") #@patch("ambari_server.serverSetup.check_database_name_property") @patch("ambari_server.serverSetup.is_server_runing") def test_silent_reset(self, is_server_runing_mock, #check_database_name_property_mock, is_root_mock, #parse_properties_file_mock, run_os_command_mock, print_info_msg_mock, setup_db_mock): is_root_mock.return_value = True args = MagicMock() del args.dbms del args.database_index del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.persistence_type set_silent(True) self.assertTrue(get_silent()) setup_db_mock.return_value = (0, None, None) run_os_command_mock.return_value = (0, None, None) is_server_runing_mock.return_value = (False, 0) def signal_handler(signum, frame): self.fail("Timed out!") signal.signal(signal.SIGALRM, signal_handler) try: signal.alarm(5) rcode = reset(args) signal.alarm(0) self.assertEqual(None, rcode) self.assertTrue(setup_db_mock.called) finally: signal.signal(signal.SIGALRM, signal.SIG_IGN) pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.dbConfiguration_windows.MSSQLConfig._execute_db_script") @patch("ambari_server.serverSetup.get_ambari_properties") @patch("ambari_server.serverSetup.is_root") @patch("ambari_server.serverSetup.is_server_runing") def test_silent_reset(self, is_server_runing_mock, is_root_mock, get_ambari_properties_mock, execute_db_script_mock): is_root_mock.return_value = True args = MagicMock() del args.dbms del args.database_index del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.default_database_host del args.persistence_type del args.init_db_script_file del args.cleanup_db_script_file set_silent(True) self.assertTrue(get_silent()) properties = Properties() get_ambari_properties_mock.return_value = properties is_server_runing_mock.return_value = (False, 0) rcode = reset(args) self.assertEqual(None, rcode) self.assertEqual(execute_db_script_mock.call_count, 2) @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("sys.stdout.flush") @patch("sys.stdout.write") @patch("ambari_server_main.looking_for_pid") @patch("ambari_server_main.wait_for_pid") @patch("ambari_server_main.save_main_pid_ex") @patch("ambari_server_main.check_exitcode") @patch("os.makedirs") @patch("ambari_server_main.locate_file") @patch.object(_ambari_server_, "is_server_runing") @patch("os.chown") @patch("ambari_server.setupSecurity.get_master_key_location") @patch("ambari_server.setupSecurity.save_master_key") @patch("ambari_server_main.get_is_persisted") @patch("ambari_server_main.get_is_secure") @patch('os.chmod', autospec=True) @patch("ambari_server.serverConfiguration.write_property") @patch("ambari_server.serverConfiguration.get_validated_string_input") @patch("os.environ") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.serverSetup.get_ambari_properties") @patch("ambari_server.serverConfiguration.get_ambari_properties") @patch("ambari_server_main.get_ambari_properties") @patch("os.path.exists") @patch("__builtin__.open") @patch("subprocess.Popen") @patch("ambari_server.serverConfiguration.search_file") @patch("ambari_server_main.check_database_name_property") @patch("ambari_server_main.find_jdk") @patch("ambari_server_main.print_warning_msg") @patch("ambari_server_main.print_info_msg") @patch.object(PGConfig, "_check_postgre_up") @patch("ambari_server_main.read_ambari_user") @patch("ambari_server.setupSecurity.is_root") @patch("ambari_server.dbConfiguration_linux.is_root") @patch("ambari_server_main.is_root") @patch.object(LinuxDBMSConfig, "_find_jdbc_driver") @patch("getpass.getuser") @patch("os.chdir") @patch.object(ResourceFilesKeeper, "perform_housekeeping") def test_start(self, perform_housekeeping_mock, chdir_mock, getuser_mock, find_jdbc_driver_mock, is_root_mock, is_root_2_mock, is_root_3_mock, read_ambari_user_mock, check_postgre_up_mock, print_info_msg_mock, print_warning_msg_mock, find_jdk_mock, check_database_name_property_mock, search_file_mock, popenMock, openMock, pexistsMock, get_ambari_properties_mock, get_ambari_properties_2_mock, get_ambari_properties_3_mock, get_ambari_properties_4_mock, os_environ_mock, get_validated_string_input_method, write_property_method, os_chmod_method, get_is_secure_mock, get_is_persisted_mock, save_master_key_method, get_master_key_location_method, os_chown_mock, is_server_running_mock, locate_file_mock, os_makedirs_mock, check_exitcode_mock, save_main_pid_ex_mock, wait_for_pid_mock, looking_for_pid_mock, stdout_write_mock, stdout_flush_mock): def reset_mocks(): pexistsMock.reset_mock() args = MagicMock() del args.dbms del args.database_index del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.persistence_type del args.sid_or_sname del args.jdbc_url del args.debug del args.suspend_start return args args = reset_mocks() locate_file_mock.side_effect = lambda *args: '/bin/su' if args[0] == 'su' else '/bin/sh' f = MagicMock() f.readline.return_value = '42' openMock.return_value = f looking_for_pid_mock.return_value = [{ "pid": "777", "exe": "/test", "cmd": "test arg" }] wait_for_pid_mock.return_value = 1 check_exitcode_mock.return_value = 0 p = Properties() p.process_pair(SECURITY_IS_ENCRYPTION_ENABLED, 'False') get_ambari_properties_4_mock.return_value = \ get_ambari_properties_3_mock.return_value = get_ambari_properties_2_mock.return_value = \ get_ambari_properties_mock.return_value = p get_is_secure_mock.return_value = False get_is_persisted_mock.return_value = (False, None) search_file_mock.return_value = None is_server_running_mock.return_value = (True, 123) os_chown_mock.return_value = None # Checking "server is running" pexistsMock.return_value = True if get_platform() != PLATFORM_WINDOWS: with patch("pwd.getpwnam") as getpwnam_mock: pw = MagicMock() pw.setattr('pw_uid', 0) pw.setattr('pw_gid', 0) getpwnam_mock.return_value = pw try: _ambari_server_.start(args) self.fail("Should fail with 'Server is running'") except FatalException as e: # Expected self.assertTrue('Ambari Server is already running.' in e.reason) args = reset_mocks() is_server_running_mock.return_value = (False, 0) pexistsMock.return_value = False # Checking situation when ambari user is not set up read_ambari_user_mock.return_value = None try: _ambari_server_.start(args) self.fail("Should fail with 'Can not detect a system user for Ambari'") except FatalException as e: # Expected self.assertTrue('Unable to detect a system user for Ambari Server.' in e.reason) # Checking start from non-root when current user is not the same as a # custom user args = reset_mocks() read_ambari_user_mock.return_value = "dummy-user" getuser_mock.return_value = "non_custom_user" is_root_3_mock.return_value = \ is_root_2_mock.return_value = \ is_root_mock.return_value = False try: _ambari_server_.start(args) self.fail("Should fail with 'Can not start ambari-server as user...'") except FatalException as e: # Expected self.assertTrue('Unable to start Ambari Server as user' in e.reason) #self.assertFalse(parse_properties_file_mock.called) # Checking "jdk not found" args = reset_mocks() is_root_3_mock.return_value = \ is_root_2_mock.return_value = \ is_root_mock.return_value = True find_jdk_mock.return_value = None try: _ambari_server_.start(args) self.fail("Should fail with 'No JDK found'") except FatalException as e: # Expected self.assertTrue('No JDK found' in e.reason) args = reset_mocks() find_jdk_mock.return_value = "somewhere" ## Testing workflow under root is_root_3_mock.return_value = \ is_root_2_mock.return_value = \ is_root_mock.return_value = True # Remote DB p.process_pair(JDBC_DATABASE_PROPERTY, 'oracle') p.process_pair(PERSISTENCE_TYPE_PROPERTY, 'remote') # Case when jdbc driver is not used find_jdbc_driver_mock.return_value = -1 try: _ambari_server_.start(args) self.fail("Should fail with exception") except FatalException as e: self.assertTrue('Before starting Ambari Server' in e.reason) args = reset_mocks() # Remote DB p.process_pair(JDBC_DATABASE_PROPERTY, 'oracle') p.process_pair(PERSISTENCE_TYPE_PROPERTY, 'remote') find_jdbc_driver_mock.reset_mock() find_jdbc_driver_mock.return_value = -1 try: _ambari_server_.start(args) except FatalException as e: # Ignored pass args = reset_mocks() # Remote DB p.process_pair(JDBC_DATABASE_PROPERTY, 'oracle') p.process_pair(PERSISTENCE_TYPE_PROPERTY, 'remote') find_jdbc_driver_mock.reset_mock() find_jdbc_driver_mock.return_value = 0 # Test exception handling on resource files housekeeping perform_housekeeping_mock.reset_mock() perform_housekeeping_mock.side_effect = KeeperException("some_reason") pexistsMock.return_value = True try: _ambari_server_.start(args) self.fail("Should fail with exception") except FatalException as e: self.assertTrue('some_reason' in e.reason) self.assertTrue(perform_housekeeping_mock.called) perform_housekeeping_mock.side_effect = lambda *v, **kv : None perform_housekeeping_mock.reset_mock() self.assertFalse('Unable to start PostgreSQL server' in e.reason) self.assertFalse(check_postgre_up_mock.called) args = reset_mocks() # Local DB p.process_pair(JDBC_DATABASE_PROPERTY, 'postgres') p.process_pair(PERSISTENCE_TYPE_PROPERTY, 'local') check_postgre_up_mock.reset_mock() # case: postgres failed to start check_postgre_up_mock.return_value = None, 1, "Unable to start PostgreSQL serv", "error" try: _ambari_server_.start(args) self.fail("Should fail with 'Unable to start PostgreSQL server'") except FatalException as e: # Expected self.assertTrue('Unable to start PostgreSQL server' in e.reason) self.assertTrue(check_postgre_up_mock.called) args = reset_mocks() # Local DB p.process_pair(JDBC_DATABASE_PROPERTY, 'postgres') p.process_pair(PERSISTENCE_TYPE_PROPERTY, 'local') check_postgre_up_mock.return_value = "running", 0, "success", "" # Case: custom user is "root" read_ambari_user_mock.return_value = "root" # Java failed to start proc = MagicMock() proc.pid = -186 popenMock.return_value = proc try: _ambari_server_.start(args) except FatalException as e: # Expected self.assertTrue(popenMock.called) self.assertTrue('Ambari Server java process died' in e.reason) self.assertTrue(perform_housekeeping_mock.called) args = reset_mocks() # Java OK proc.pid = 186 popenMock.reset_mock() _ambari_server_.start(args) self.assertTrue(popenMock.called) popen_arg = popenMock.call_args[0][0] self.assertTrue(popen_arg[0] == "/bin/sh") self.assertTrue(perform_housekeeping_mock.called) args = reset_mocks() # Local DB p.process_pair(JDBC_DATABASE_PROPERTY, 'postgres') p.process_pair(PERSISTENCE_TYPE_PROPERTY, 'local') perform_housekeeping_mock.reset_mock() popenMock.reset_mock() # Case: custom user is not "root" read_ambari_user_mock.return_value = "not-root-user" _ambari_server_.start(args) self.assertTrue(chdir_mock.called) self.assertTrue(popenMock.called) popen_arg = popenMock.call_args_list[0][0][0] self.assertTrue("; /bin/su" in popen_arg[2]) self.assertTrue(perform_housekeeping_mock.called) args = reset_mocks() # Local DB p.process_pair(JDBC_DATABASE_PROPERTY, 'postgres') p.process_pair(PERSISTENCE_TYPE_PROPERTY, 'local') check_postgre_up_mock.reset_mock() popenMock.reset_mock() ## Testing workflow under non-root is_root_3_mock.return_value = \ is_root_2_mock.return_value = \ is_root_mock.return_value = False read_ambari_user_mock.return_value = "not-root-user" getuser_mock.return_value = read_ambari_user_mock.return_value _ambari_server_.start(args) self.assertFalse(check_postgre_up_mock.called) args = reset_mocks() # Remote DB p.process_pair(JDBC_DATABASE_PROPERTY, 'postgres') p.process_pair(PERSISTENCE_TYPE_PROPERTY, 'remote') _ambari_server_.start(args) self.assertFalse(check_postgre_up_mock.called) args = reset_mocks() # Remote DB p.process_pair(JDBC_DATABASE_PROPERTY, 'postgres') p.process_pair(PERSISTENCE_TYPE_PROPERTY, 'remote') # Checking call _ambari_server_.start(args) self.assertTrue(popenMock.called) popen_arg = popenMock.call_args[0][0] self.assertTrue(popen_arg[0] == "/bin/sh") args = reset_mocks() # Remote DB p.process_pair(JDBC_DATABASE_PROPERTY, 'postgres') p.process_pair(PERSISTENCE_TYPE_PROPERTY, 'remote') # Test start under wrong user read_ambari_user_mock.return_value = "not-root-user" getuser_mock.return_value = "non_custom_user" try: _ambari_server_.start(args) self.fail("Can not start ambari-server as user non_custom_user.") except FatalException as e: # Expected self.assertTrue('Unable to start Ambari Server as user' in e.reason) args = reset_mocks() # Check environ master key is set popenMock.reset_mock() os_environ_mock.copy.return_value = {"a": "b", SECURITY_KEY_ENV_VAR_NAME: "masterkey"} p.process_pair(JDBC_DATABASE_PROPERTY, 'postgres') p.process_pair(PERSISTENCE_TYPE_PROPERTY, 'local') read_ambari_user_mock.return_value = "root" is_root_3_mock.return_value = \ is_root_2_mock.return_value = \ is_root_mock.return_value = True _ambari_server_.start(args) self.assertFalse(get_validated_string_input_method.called) self.assertFalse(save_master_key_method.called) popen_arg = popenMock.call_args[1]['env'] self.assertEquals(os_environ_mock.copy.return_value, popen_arg) args = reset_mocks() # Check environ master key is not set popenMock.reset_mock() os_environ_mock.reset_mock() p.process_pair(SECURITY_IS_ENCRYPTION_ENABLED, 'True') os_environ_mock.copy.return_value = {"a": "b"} p.process_pair(JDBC_DATABASE_PROPERTY, 'postgres') p.process_pair(PERSISTENCE_TYPE_PROPERTY, 'local') read_ambari_user_mock.return_value = "root" is_root_3_mock.return_value = \ is_root_2_mock.return_value = \ is_root_mock.return_value = True get_validated_string_input_method.return_value = "masterkey" os_chmod_method.return_value = None get_is_secure_mock.return_value = True _ambari_server_.start(args) self.assertTrue(get_validated_string_input_method.called) self.assertTrue(save_master_key_method.called) popen_arg = popenMock.call_args[1]['env'] self.assertEquals(os_environ_mock.copy.return_value, popen_arg) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "is_server_runing") @patch("os.remove") @patch("os.killpg") @patch("os.getpgid") @patch.object(_ambari_server_, "print_info_msg") def test_stop(self, print_info_msg_mock, gpidMock, removeMock, killMock, isServerRuningMock): isServerRuningMock.return_value = (True, 123) _ambari_server_.stop(None) self.assertTrue(killMock.called) self.assertTrue(removeMock.called) pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("win32serviceutil.StopServiceWithDeps") @patch("win32serviceutil.StopService") @patch("win32serviceutil.WaitForServiceStatus") def test_stop(self, WaitForServiceStatusMock, StopServiceMock, StopServiceWithDepsMock): _ambari_server_.stop() self.assertTrue(StopServiceWithDepsMock.called) self.assertFalse(StopServiceMock.called) self.assertTrue(WaitForServiceStatusMock.called) pass @patch.object(_ambari_server_, "BackupRestore_main") def test_backup(self, bkrestore_mock): args = ["", "/some/path/file.zip"] _ambari_server_.backup(args) self.assertTrue(bkrestore_mock.called) pass @patch.object(_ambari_server_, "BackupRestore_main") def test_backup_no_path(self, bkrestore_mock): args = [""] _ambari_server_.backup(args) self.assertTrue(bkrestore_mock.called) pass @patch.object(_ambari_server_, "BackupRestore_main") def test_restore(self, bkrestore_mock): args = ["", "/some/path/file.zip"] _ambari_server_.restore(args) self.assertTrue(bkrestore_mock.called) pass @patch.object(_ambari_server_, "BackupRestore_main") def test_restore_no_path(self, bkrestore_mock): args = [""] _ambari_server_.restore(args) self.assertTrue(bkrestore_mock.called) pass @patch("ambari_server.serverUpgrade.is_root") @patch("ambari_server.serverUpgrade.check_database_name_property") @patch("ambari_server.serverUpgrade.run_stack_upgrade") def test_upgrade_stack(self, run_stack_upgrade_mock, check_database_name_property_mock, is_root_mock): # Testing call under non-root is_root_mock.return_value = False args = ['', 'HDP-2.0'] try: upgrade_stack(args) self.fail("Should throw exception") except FatalException as fe: # Expected self.assertTrue("root-level" in fe.reason) pass # Testing calls under root is_root_mock.return_value = True run_stack_upgrade_mock.return_value = 0 upgrade_stack(args) self.assertTrue(run_stack_upgrade_mock.called) run_stack_upgrade_mock.assert_called_with("HDP", "2.0", None, None) pass @patch("ambari_server.serverUpgrade.get_ambari_properties") @patch("os.listdir") @patch("os.path.isfile") @patch("shutil.move") def test_move_user_custom_actions(self, shutil_move_mock, os_path_isfile_mock, os_listdir_mock, get_ambari_properties_mock): properties = Properties() properties.process_pair(RESOURCES_DIR_PROPERTY, 'some/test/fake/resources/dir/path') get_ambari_properties_mock.return_value = properties os_listdir_mock.return_value = ['sometestdir', 'sometestfile.md', 'sometestfile.py', 'sometestfile2.java', 'sometestfile2.py', 'sometestdir2.py'] os_path_isfile_mock.side_effect = [False, True, True, True, True, False] move_user_custom_actions() custom_actions_scripts_dir = os.path.join('some/test/fake/resources/dir/path', 'custom_actions', 'scripts') shutil_move_mock.assert_has_calls([call(os.path.join('some/test/fake/resources/dir/path', 'custom_actions', 'sometestfile.py'), custom_actions_scripts_dir), call(os.path.join('some/test/fake/resources/dir/path', 'custom_actions', 'sometestfile2.py'), custom_actions_scripts_dir)]) self.assertEqual(shutil_move_mock.call_count, 2) pass @patch("ambari_server.serverConfiguration.get_conf_dir") @patch("ambari_server.serverConfiguration.get_ambari_classpath") @patch("ambari_server.serverUpgrade.run_os_command") @patch("ambari_server.serverUpgrade.get_java_exe_path") def test_run_stack_upgrade(self, java_exe_path_mock, run_os_command_mock, get_ambari_classpath_mock, get_conf_dir_mock): java_exe_path_mock.return_value = "/usr/lib/java/bin/java" run_os_command_mock.return_value = (0, None, None) get_ambari_classpath_mock.return_value = 'test:path12' get_conf_dir_mock.return_value = '/etc/conf' stackIdMap = {'HDP' : '2.0', 'repo_url' : 'http://test.com'} run_stack_upgrade('HDP', '2.0', 'http://test.com', None) self.assertTrue(java_exe_path_mock.called) self.assertTrue(get_ambari_classpath_mock.called) self.assertTrue(get_conf_dir_mock.called) self.assertTrue(run_os_command_mock.called) run_os_command_mock.assert_called_with('/usr/lib/java/bin/java -cp /etc/conf' + os.pathsep + 'test:path12 ' 'org.apache.ambari.server.upgrade.StackUpgradeHelper ' 'updateStackId ' + "'" + json.dumps(stackIdMap) + "'" + ' > ' + os.sep + 'var' + os.sep + 'log' + os.sep + 'ambari-server' + os.sep + 'ambari-server.out 2>&1') pass @patch("ambari_server.serverConfiguration.get_conf_dir") @patch("ambari_server.serverConfiguration.get_ambari_classpath") @patch("ambari_server.serverUpgrade.run_os_command") @patch("ambari_server.serverUpgrade.get_java_exe_path") def test_run_stack_upgrade_with_url_os(self, java_exe_path_mock, run_os_command_mock, get_ambari_classpath_mock, get_conf_dir_mock): java_exe_path_mock.return_value = "/usr/lib/java/bin/java" run_os_command_mock.return_value = (0, None, None) get_ambari_classpath_mock.return_value = 'test:path12' get_conf_dir_mock.return_value = '/etc/conf' stackIdMap = {'HDP' : '2.0', 'repo_url': 'http://test.com', 'repo_url_os': 'centos5,centos6'} run_stack_upgrade('HDP', '2.0', 'http://test.com', 'centos5,centos6') self.assertTrue(java_exe_path_mock.called) self.assertTrue(get_ambari_classpath_mock.called) self.assertTrue(get_conf_dir_mock.called) self.assertTrue(run_os_command_mock.called) run_os_command_mock.assert_called_with('/usr/lib/java/bin/java -cp /etc/conf' + os.pathsep + 'test:path12 ' 'org.apache.ambari.server.upgrade.StackUpgradeHelper ' 'updateStackId ' + "'" + json.dumps(stackIdMap) + "'" + ' > ' + os.sep + 'var' + os.sep + 'log' + os.sep + 'ambari-server' + os.sep + 'ambari-server.out 2>&1') pass @patch("ambari_server.serverUpgrade.ensure_can_start_under_current_user") @patch("ambari_server.serverUpgrade.generate_env") @patch("ambari_server.serverUpgrade.read_ambari_user") @patch("ambari_server.serverConfiguration.get_conf_dir") @patch("ambari_server.serverConfiguration.get_ambari_classpath") @patch("ambari_server.serverUpgrade.run_os_command") @patch("ambari_server.serverUpgrade.get_java_exe_path") def test_run_schema_upgrade(self, java_exe_path_mock, run_os_command_mock, get_ambari_classpath_mock, get_conf_dir_mock, read_ambari_user_mock, generate_env_mock, ensure_can_start_under_current_user_mock): java_exe_path_mock.return_value = "/usr/lib/java/bin/java" run_os_command_mock.return_value = (0, None, None) get_ambari_classpath_mock.return_value = 'test' + os.pathsep + 'path12' get_conf_dir_mock.return_value = '/etc/conf' command = '/usr/lib/java/bin/java -cp /etc/conf' + os.pathsep + 'test' + os.pathsep + 'path12 ' \ 'org.apache.ambari.server.upgrade.SchemaUpgradeHelper ' \ '> ' + os.sep + 'var' + os.sep + 'log' + os.sep + 'ambari-server' + os.sep + 'ambari-server.out 2>&1' environ = {} generate_env_mock.return_value = environ ensure_can_start_under_current_user_mock.return_value = "root" read_ambari_user_mock.return_value = "ambari" run_schema_upgrade() self.assertTrue(java_exe_path_mock.called) self.assertTrue(ensure_can_start_under_current_user_mock.called) self.assertTrue(generate_env_mock.called) self.assertTrue(read_ambari_user_mock.called) self.assertTrue(get_ambari_classpath_mock.called) self.assertTrue(get_conf_dir_mock.called) self.assertTrue(run_os_command_mock.called) run_os_command_mock.assert_called_with(command, env=environ) pass @patch("ambari_server.serverConfiguration.get_conf_dir") @patch("ambari_server.serverConfiguration.get_ambari_classpath") @patch("ambari_server.serverUpgrade.run_os_command") @patch("ambari_server.serverUpgrade.get_java_exe_path") def test_run_metainfo_upgrade(self, java_exe_path_mock, run_os_command_mock, get_ambari_classpath_mock, get_conf_dir_mock): java_exe_path_mock.return_value = "/usr/lib/java/bin/java" run_os_command_mock.return_value = (0, None, None) get_ambari_classpath_mock.return_value = 'test' + os.pathsep + 'path12' get_conf_dir_mock.return_value = '/etc/conf' json_map = {'a': 'http://newurl'} run_metainfo_upgrade(json_map) self.assertTrue(java_exe_path_mock.called) self.assertTrue(get_ambari_classpath_mock.called) self.assertTrue(get_conf_dir_mock.called) self.assertTrue(run_os_command_mock.called) run_os_command_mock.assert_called_with('/usr/lib/java/bin/java ' '-cp /etc/conf' + os.pathsep + 'test' + os.pathsep + 'path12 ' 'org.apache.ambari.server.upgrade.StackUpgradeHelper updateMetaInfo ' + "'" + json.dumps(json_map) + "'" + ' > ' + os.sep + 'var' + os.sep + 'log' + os.sep + 'ambari-server' + os.sep + 'ambari-server.out 2>&1') pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("os.path.isfile") @patch("ambari_server.serverSetup.get_ambari_properties") @patch("os.path.exists") @patch("os.path.lexists") @patch("os.remove") @patch("os.symlink") @patch("shutil.copy") def test_proceedJDBCProperties(self, copy_mock, os_symlink_mock, os_remove_mock, lexists_mock, exists_mock, get_ambari_properties_mock, isfile_mock): args = MagicMock() # test incorrect path to jdbc-driver isfile_mock.return_value = False args.jdbc_driver = "test jdbc" fail = False try: proceedJDBCProperties(args) except FatalException as e: self.assertEquals("File test jdbc does not exist!", e.reason) fail = True self.assertTrue(fail) # test incorrect jdbc-db isfile_mock.return_value = True args.jdbc_db = "incorrect db" fail = False try: proceedJDBCProperties(args) except FatalException as e: self.assertEquals("Unsupported database name incorrect db. Please see help for more information.", e.reason) fail = True self.assertTrue(fail) # test getAmbariProperties failed args.jdbc_db = "mysql" get_ambari_properties_mock.return_value = -1 fail = False try: proceedJDBCProperties(args) except FatalException as e: self.assertEquals("Error getting ambari properties", e.reason) fail = True self.assertTrue(fail) # test getAmbariProperties failed args.jdbc_db = "mssql" get_ambari_properties_mock.return_value = -1 fail = False try: proceedJDBCProperties(args) except FatalException as e: self.assertEquals("Error getting ambari properties", e.reason) fail = True self.assertTrue(fail) # test get resource dir param failed args.jdbc_db = "oracle" p = MagicMock() get_ambari_properties_mock.return_value = p p.__getitem__.side_effect = KeyError("test exception") exists_mock.return_value = False fail = False try: proceedJDBCProperties(args) except FatalException as e: fail = True self.assertTrue(fail) # test copy jdbc failed and symlink exists lexists_mock.return_value = True args.jdbc_db = "postgres" get_ambari_properties_mock.return_value = MagicMock() isfile_mock.side_effect = [True, False] exists_mock.return_value = True fail = False def side_effect(): raise Exception(-1, "Failed to copy!") copy_mock.side_effect = side_effect try: proceedJDBCProperties(args) except FatalException as e: fail = True self.assertTrue(fail) self.assertTrue(os_remove_mock.called) # test success symlink creation get_ambari_properties_mock.reset_mock() os_remove_mock.reset_mock() p = MagicMock() get_ambari_properties_mock.return_value = p p.__getitem__.side_effect = None p.__getitem__.return_value = "somewhere" copy_mock.reset_mock() copy_mock.side_effect = None isfile_mock.side_effect = [True, False] proceedJDBCProperties(args) self.assertTrue(os_remove_mock.called) self.assertTrue(os_symlink_mock.called) self.assertTrue(copy_mock.called) self.assertEquals(os_symlink_mock.call_args_list[0][0][0], os.path.join("somewhere","test jdbc")) self.assertEquals(os_symlink_mock.call_args_list[0][0][1], os.path.join("somewhere","postgres-jdbc-driver.jar")) pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("os.path.isfile") @patch("ambari_server.serverSetup.get_ambari_properties") @patch("os.path.exists") @patch("os.path.lexists") @patch("os.remove") @patch("os.symlink") @patch("shutil.copy") def test_proceedJDBCProperties(self, copy_mock, os_symlink_mock, os_remove_mock, lexists_mock, exists_mock, get_ambari_properties_mock, isfile_mock): args = MagicMock() # test incorrect path to jdbc-driver isfile_mock.return_value = False args.jdbc_driver = "test jdbc" fail = False try: proceedJDBCProperties(args) except FatalException as e: self.assertEquals("File test jdbc does not exist!", e.reason) fail = True self.assertTrue(fail) # test incorrect jdbc-db isfile_mock.return_value = True args.jdbc_db = "incorrect db" fail = False try: proceedJDBCProperties(args) except FatalException as e: self.assertEquals("Unsupported database name incorrect db. Please see help for more information.", e.reason) fail = True self.assertTrue(fail) # test getAmbariProperties succeeded args.jdbc_db = "mssql" get_ambari_properties_mock.return_value = -1 fail = False try: proceedJDBCProperties(args) except FatalException as e: self.assertEquals("Error getting ambari properties", e.reason) fail = True self.assertFalse(fail) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("__builtin__.open") @patch("os.path.isfile") @patch("os.path.lexists") @patch("os.path.exists") @patch("os.remove") @patch("os.symlink") @patch.object(Properties, "store") @patch("ambari_server.serverUpgrade.adjust_directory_permissions") @patch("ambari_server.serverUpgrade.print_warning_msg") @patch("ambari_server.serverUpgrade.read_ambari_user") @patch("ambari_server.serverUpgrade.run_schema_upgrade") @patch("ambari_server.dbConfiguration_linux.run_os_command") @patch("ambari_server.serverConfiguration.find_properties_file") @patch("ambari_server.serverUpgrade.update_ambari_properties") @patch("ambari_server.serverUpgrade.is_root") @patch("ambari_server.serverConfiguration.write_property") @patch("ambari_server.serverConfiguration.get_ambari_version") @patch("ambari_server.dbConfiguration.get_ambari_properties") @patch("ambari_server.serverConfiguration.get_ambari_properties") @patch("ambari_server.serverUpgrade.get_ambari_properties") @patch("ambari_server.serverUpgrade.upgrade_local_repo") @patch("ambari_server.serverUpgrade.move_user_custom_actions") @patch("ambari_server.serverUpgrade.update_krb_jaas_login_properties") def test_upgrade_from_161(self, update_krb_jaas_login_properties_mock, move_user_custom_actions_mock, upgrade_local_repo_mock, get_ambari_properties_mock, get_ambari_properties_2_mock, get_ambari_properties_3_mock, get_ambari_version_mock, write_property_mock, is_root_mock, update_ambari_properties_mock, find_properties_file_mock, run_os_command_mock, run_schema_upgrade_mock, read_ambari_user_mock, print_warning_msg_mock, adjust_directory_permissions_mock, properties_store_mock, os_symlink_mock, os_remove_mock, exists_mock, lexists_mock, isfile_mock, open_mock): def reset_mocks(): run_os_command_mock.reset_mock() write_property_mock.reset_mock() isfile_mock.reset_mock() lexists_mock.reeset_mock() os_symlink_mock.reset_mock() lexists_mock.return_value = False args = MagicMock() del args.dbms del args.database_index del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.database_windows_auth del args.default_database_host del args.init_db_script_file del args.cleanup_db_script_file del args.must_set_database_options del args.sid_or_sname del args.jdbc_url args.jdbc_driver= None args.jdbc_db = None args.silent = False return args args = reset_mocks() args.dbms = "postgres" is_root_mock.return_value = True update_ambari_properties_mock.return_value = 0 get_ambari_version_mock.return_value = "1.7.0" move_user_custom_actions_mock.return_value = None update_krb_jaas_login_properties_mock.return_value = -2 # Local Postgres # In Ambari 1.6.1 for an embedded postgres database, the "server.jdbc.database" property stored the DB name, # and the DB type was assumed to be "postgres" if the "server.persistence.type" property was "local" properties = Properties() properties.process_pair(PERSISTENCE_TYPE_PROPERTY, "local") properties.process_pair(JDBC_DATABASE_PROPERTY, "ambari") properties.process_pair(RESOURCES_DIR_PROPERTY, "/tmp") get_ambari_properties_mock.return_value = properties properties2 = Properties() properties2.process_pair(PERSISTENCE_TYPE_PROPERTY, "local") properties2.process_pair(JDBC_DATABASE_NAME_PROPERTY, "ambari") properties2.process_pair(JDBC_DATABASE_PROPERTY, "postgres") get_ambari_properties_3_mock.side_effect = get_ambari_properties_2_mock.side_effect = [properties, properties2, properties2] run_schema_upgrade_mock.return_value = 0 read_ambari_user_mock.return_value = "custom_user" run_os_command_mock.return_value = (0, "", "") isfile_mock.return_value = False try: upgrade(args) except FatalException as fe: self.fail("Did not expect failure: " + str(fe)) else: self.assertTrue(write_property_mock.called) self.assertEquals(write_property_mock.call_args_list[0][0][0], JDBC_DATABASE_NAME_PROPERTY) self.assertEquals(write_property_mock.call_args_list[0][0][1], "ambari") self.assertEquals(write_property_mock.call_args_list[1][0][0], JDBC_DATABASE_PROPERTY) self.assertEquals(write_property_mock.call_args_list[1][0][1], "postgres") self.assertTrue(run_os_command_mock.called) self.assertFalse(move_user_custom_actions_mock.called) args = reset_mocks() # External Postgres # In Ambari 1.6.1 for an external postgres database, the "server.jdbc.database" property stored the # DB type ("postgres"), and the "server.jdbc.schema" property stored the DB name. properties = Properties() properties.process_pair(PERSISTENCE_TYPE_PROPERTY, "remote") properties.process_pair(JDBC_DATABASE_PROPERTY, "postgres") properties.process_pair(JDBC_RCA_SCHEMA_PROPERTY, "ambari") properties.process_pair(JDBC_URL_PROPERTY, "jdbc:postgresql://c6410.ambari.apache.org:5432/ambari") properties2 = Properties() properties2.process_pair(PERSISTENCE_TYPE_PROPERTY, "remote") properties2.process_pair(JDBC_DATABASE_NAME_PROPERTY, "ambari") properties2.process_pair(JDBC_DATABASE_PROPERTY, "postgres") properties2.process_pair(JDBC_RCA_SCHEMA_PROPERTY, "ambari") properties2.process_pair(JDBC_URL_PROPERTY, "jdbc:postgresql://c6410.ambari.apache.org:5432/ambari") get_ambari_properties_mock.return_value = properties get_ambari_properties_3_mock.side_effect = get_ambari_properties_2_mock.side_effect = [properties, properties2, properties2] exists_mock.return_value = True try: upgrade(args) except FatalException as fe: self.fail("Did not expect failure: " + str(fe)) else: self.assertTrue(write_property_mock.called) self.assertFalse(run_os_command_mock.called) self.assertFalse(move_user_custom_actions_mock.called) args = reset_mocks() # External Postgres missing DB type, so it should be set based on the JDBC URL. properties = Properties() properties.process_pair(PERSISTENCE_TYPE_PROPERTY, "remote") properties.process_pair(JDBC_RCA_SCHEMA_PROPERTY, "ambari") properties.process_pair(JDBC_URL_PROPERTY, "jdbc:postgresql://c6410.ambari.apache.org:5432/ambari") get_ambari_properties_mock.return_value = properties get_ambari_properties_3_mock.side_effect = get_ambari_properties_2_mock.side_effect = [properties, properties2, properties2] try: upgrade(args) except FatalException as fe: self.fail("Did not expect failure: " + str(fe)) else: self.assertTrue(write_property_mock.call_count == 2) self.assertFalse(move_user_custom_actions_mock.called) args = reset_mocks() # External MySQL # In Ambari 1.6.1 for an external MySQL database, the "server.jdbc.database" property stored the DB type ("mysql"), # And the "server.jdbc.schema" property stored the DB name. properties = Properties() properties.process_pair(PERSISTENCE_TYPE_PROPERTY, "remote") properties.process_pair(JDBC_DATABASE_PROPERTY, "mysql") properties.process_pair(JDBC_RCA_SCHEMA_PROPERTY, "ambari") properties.process_pair(JDBC_URL_PROPERTY, "jdbc:mysql://c6409.ambari.apache.org:3306/ambari") properties2 = Properties() properties2.process_pair(PERSISTENCE_TYPE_PROPERTY, "remote") properties2.process_pair(JDBC_DATABASE_PROPERTY, "mysql") properties2.process_pair(JDBC_DATABASE_NAME_PROPERTY, "ambari") properties2.process_pair(JDBC_RCA_SCHEMA_PROPERTY, "ambari") properties2.process_pair(JDBC_URL_PROPERTY, "jdbc:mysql://c6409.ambari.apache.org:3306/ambari") get_ambari_properties_mock.return_value = properties get_ambari_properties_3_mock.side_effect = get_ambari_properties_2_mock.side_effect = [properties, properties2, properties2] isfile_mock.side_effect = [False, True, False] try: upgrade(args) except FatalException as fe: self.fail("Did not expect failure: " + str(fe)) else: self.assertTrue(write_property_mock.called) self.assertFalse(move_user_custom_actions_mock.called) self.assertTrue(os_symlink_mock.called) self.assertTrue(os_symlink_mock.call_args_list[0][0][0] == "/var/lib/ambari-server/resources/mysql-connector-java.jar") self.assertTrue(os_symlink_mock.call_args_list[0][0][1] == "/var/lib/ambari-server/resources/mysql-jdbc-driver.jar") args = reset_mocks() # External MySQL missing DB type, so it should be set based on the JDBC URL. properties = Properties() properties.process_pair(PERSISTENCE_TYPE_PROPERTY, "remote") properties.process_pair(JDBC_RCA_SCHEMA_PROPERTY, "ambari") properties.process_pair(JDBC_URL_PROPERTY, "jdbc:mysql://c6409.ambari.apache.org:3306/ambari") get_ambari_properties_mock.return_value = properties get_ambari_properties_3_mock.side_effect = get_ambari_properties_2_mock.side_effect = [properties, properties2, properties2] isfile_mock.side_effect = None try: upgrade(args) except FatalException as fe: self.fail("Did not expect failure: " + str(fe)) else: self.assertTrue(write_property_mock.call_count == 2) self.assertFalse(move_user_custom_actions_mock.called) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("__builtin__.open") @patch("os.path.isfile") @patch("os.path.exists") @patch("os.path.lexists") @patch("os.remove") @patch("os.symlink") @patch.object(Properties, "store") @patch.object(PGConfig, "_change_db_files_owner") @patch("ambari_server.serverConfiguration.find_properties_file") @patch("ambari_server.serverUpgrade.adjust_directory_permissions") @patch("ambari_server.serverUpgrade.print_warning_msg") @patch("ambari_server.serverUpgrade.read_ambari_user") @patch("ambari_server.serverUpgrade.run_schema_upgrade") @patch("ambari_server.serverUpgrade.update_ambari_properties") @patch("ambari_server.serverUpgrade.parse_properties_file") @patch("ambari_server.serverUpgrade.get_ambari_version") @patch("ambari_server.serverConfiguration.get_ambari_version") @patch("ambari_server.serverUpgrade.is_root") @patch("ambari_server.dbConfiguration.get_ambari_properties") @patch("ambari_server.serverConfiguration.get_ambari_properties") @patch("ambari_server.serverUpgrade.get_ambari_properties") @patch("ambari_server.serverUpgrade.upgrade_local_repo") @patch("ambari_server.serverUpgrade.move_user_custom_actions") @patch("ambari_server.serverUpgrade.update_krb_jaas_login_properties") def test_upgrade(self, update_krb_jaas_login_properties_mock, move_user_custom_actions, upgrade_local_repo_mock, get_ambari_properties_mock, get_ambari_properties_2_mock, get_ambari_properties_3_mock, is_root_mock, get_ambari_version_mock, get_ambari_version_2_mock, parse_properties_file_mock, update_ambari_properties_mock, run_schema_upgrade_mock, read_ambari_user_mock, print_warning_msg_mock, adjust_directory_permissions_mock, find_properties_file_mock, change_db_files_owner_mock, properties_store_mock, os_symlink_mock, os_remove_mock, lexists_mock, exists_mock, isfile_mock, open_mock): def reset_mocks(): isfile_mock.reset_mock() args = MagicMock() del args.database_index del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.persistence_type del args.sid_or_sname del args.jdbc_url args.must_set_database_options = True return args args = reset_mocks() properties = Properties() get_ambari_properties_3_mock.return_value = get_ambari_properties_2_mock.return_value = \ get_ambari_properties_mock.return_value = properties update_ambari_properties_mock.return_value = 0 run_schema_upgrade_mock.return_value = 0 isfile_mock.return_value = False get_ambari_version_2_mock.return_value = get_ambari_version_mock.return_value = CURR_AMBARI_VERSION move_user_custom_actions.return_value = None update_krb_jaas_login_properties_mock.return_value = -2 # Testing call under non-root is_root_mock.return_value = False try: upgrade(args) self.fail("Should throw exception") except FatalException as fe: # Expected self.assertTrue("root-level" in fe.reason) pass args = reset_mocks() # Testing calls under root is_root_mock.return_value = True # Testing with undefined custom user read_ambari_user_mock.return_value = None run_schema_upgrade_mock.return_value = 0 change_db_files_owner_mock.return_value = 0 exists_mock.return_value = True upgrade(args) self.assertTrue(print_warning_msg_mock.called) warning_args = print_warning_msg_mock.call_args[0][0] self.assertTrue("custom ambari user" in warning_args) self.assertTrue(upgrade_local_repo_mock.called) self.assertTrue(move_user_custom_actions.called) args = reset_mocks() # Testing with defined custom user read_ambari_user_mock.return_value = "ambari-custom-user" upgrade(args) self.assertTrue(adjust_directory_permissions_mock.called) args = reset_mocks() run_schema_upgrade_mock.return_value = 0 parse_properties_file_mock.called = False move_user_custom_actions.called = False retcode = upgrade(args) self.assertTrue(get_ambari_properties_mock.called) self.assertTrue(get_ambari_properties_2_mock.called) self.assertNotEqual(-1, retcode) self.assertTrue(parse_properties_file_mock.called) self.assertTrue(run_schema_upgrade_mock.called) self.assertTrue(move_user_custom_actions.called) # Assert that move_user_custom_actions is called on upgrade to Ambari == 2.0.0 get_ambari_version_2_mock.return_value = get_ambari_version_mock.return_value = '2.0.0' move_user_custom_actions.called = False upgrade(args) self.assertTrue(move_user_custom_actions.called) # Assert that move_user_custom_actions is not called on upgrade to Ambari < 2.0.0 get_ambari_version_2_mock.return_value = get_ambari_version_mock.return_value = '1.6.0' move_user_custom_actions.called = False upgrade(args) self.assertFalse(move_user_custom_actions.called) get_ambari_version_2_mock.return_value = get_ambari_version_mock.return_value = CURR_AMBARI_VERSION # test getAmbariProperties failed args = reset_mocks() get_ambari_properties_3_mock.return_value = get_ambari_properties_2_mock.return_value = \ get_ambari_properties_mock.return_value = -1 fail = False try: upgrade(args) except FatalException as e: self.assertEquals("Error getting ambari properties", e.reason) fail = True self.assertTrue(fail) # test get resource dir param failed args = reset_mocks() p = MagicMock() get_ambari_properties_mock.reset_mock() get_ambari_properties_2_mock.reset_mock() get_ambari_properties_3_mock.reset_mock() get_ambari_properties_3_mock.return_value = get_ambari_properties_2_mock.return_value = \ get_ambari_properties_mock.return_value = p p.__getitem__.side_effect = ["something", "something", "something", "something", KeyError("test exception")] exists_mock.return_value = False fail = False try: upgrade(args) except FatalException as e: fail = True self.assertTrue(fail) # test if some drivers are available in resources, and symlink available too args = reset_mocks() props = Properties() props.process_pair(JDBC_DATABASE_NAME_PROPERTY, "something") props.process_pair(RESOURCES_DIR_PROPERTY, "resources") get_ambari_properties_3_mock.return_value = get_ambari_properties_2_mock.return_value = \ get_ambari_properties_mock.return_value = props exists_mock.return_value = True lexists_mock.return_value = True isfile_mock.side_effect = [True, False, False] upgrade(args) self.assertTrue(os_remove_mock.called) self.assertEquals(os_remove_mock.call_count, 1) self.assertEquals(os_remove_mock.call_args[0][0], os.path.join("resources", "oracle-jdbc-driver.jar")) self.assertEquals(os_symlink_mock.call_count, 1) self.assertEquals(os_symlink_mock.call_args[0][0], os.path.join("resources", "ojdbc6.jar")) self.assertEquals(os_symlink_mock.call_args[0][1], os.path.join("resources", "oracle-jdbc-driver.jar")) pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("__builtin__.open") @patch("os.path.isfile") @patch("os.path.exists") @patch("os.path.lexists") @patch("os.remove") @patch("os.symlink") @patch.object(Properties, "store") @patch("ambari_server.serverConfiguration.find_properties_file") @patch("ambari_server.serverUpgrade.adjust_directory_permissions") @patch("ambari_server.serverUpgrade.print_warning_msg") @patch("ambari_server.serverUpgrade.read_ambari_user") @patch("ambari_server.serverUpgrade.run_schema_upgrade") @patch("ambari_server.serverUpgrade.update_ambari_properties") @patch("ambari_server.serverUpgrade.parse_properties_file") @patch("ambari_server.serverUpgrade.get_ambari_version") @patch("ambari_server.serverConfiguration.get_ambari_version") @patch("ambari_server.serverUpgrade.is_root") @patch("ambari_server.dbConfiguration.get_ambari_properties") @patch("ambari_server.serverConfiguration.get_ambari_properties") @patch("ambari_server.serverUpgrade.get_ambari_properties") @patch("ambari_server.serverUpgrade.upgrade_local_repo") @patch("ambari_server.serverUpgrade.move_user_custom_actions") @patch("ambari_server.serverUpgrade.update_krb_jaas_login_properties") def test_upgrade(self, update_krb_jaas_login_properties_mock, move_user_custom_actions, upgrade_local_repo_mock, get_ambari_properties_mock, get_ambari_properties_2_mock, get_ambari_properties_3_mock, is_root_mock, get_ambari_version_mock, get_ambari_version_2_mock, parse_properties_file_mock, update_ambari_properties_mock, run_schema_upgrade_mock, read_ambari_user_mock, print_warning_msg_mock, adjust_directory_permissions_mock, find_properties_file_mock, properties_store_mock, os_symlink_mock, os_remove_mock, lexists_mock, exists_mock, isfile_mock, open_mock): def reset_mocks(): isfile_mock.reset_mock() args = MagicMock() del args.dbms del args.database_index del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.default_database_host del args.persistence_type del args.init_db_script_file del args.cleanup_db_script_file del args.sid_or_sname del args.jdbc_url args.must_set_database_options = True return args args = reset_mocks() properties = Properties() get_ambari_properties_3_mock.return_value = get_ambari_properties_2_mock.return_value = \ get_ambari_properties_mock.return_value = properties update_ambari_properties_mock.return_value = 0 run_schema_upgrade_mock.return_value = 0 isfile_mock.return_value = False get_ambari_version_2_mock.return_value = get_ambari_version_mock.return_value = CURR_AMBARI_VERSION move_user_custom_actions.return_value = None update_krb_jaas_login_properties_mock.return_value = -2 # Testing call under non-root is_root_mock.return_value = False try: upgrade(args) self.fail("Should throw exception") except FatalException as fe: # Expected self.assertTrue("administrator-level" in fe.reason) pass args = reset_mocks() # Testing calls under root is_root_mock.return_value = True # Testing with undefined custom user read_ambari_user_mock.return_value = None run_schema_upgrade_mock.return_value = 0 exists_mock.return_value = True upgrade(args) self.assertTrue(print_warning_msg_mock.called) warning_args = print_warning_msg_mock.call_args[0][0] self.assertTrue("custom ambari user" in warning_args) self.assertTrue(upgrade_local_repo_mock.called) self.assertTrue(move_user_custom_actions.called) args = reset_mocks() # Testing with defined custom user read_ambari_user_mock.return_value = "ambari-custom-user" upgrade(args) self.assertTrue(adjust_directory_permissions_mock.called) args = reset_mocks() run_schema_upgrade_mock.return_value = 0 parse_properties_file_mock.called = False move_user_custom_actions.called = False retcode = upgrade(args) self.assertTrue(get_ambari_properties_mock.called) self.assertTrue(get_ambari_properties_2_mock.called) self.assertNotEqual(-1, retcode) self.assertTrue(parse_properties_file_mock.called) self.assertTrue(run_schema_upgrade_mock.called) self.assertTrue(move_user_custom_actions.called) # Assert that move_user_custom_actions is called on upgrade to Ambari == 2.0.0 get_ambari_version_2_mock.return_value = get_ambari_version_mock.return_value = '2.0.0' move_user_custom_actions.called = False upgrade(args) self.assertTrue(move_user_custom_actions.called) # Assert that move_user_custom_actions is not called on upgrade to Ambari < 2.0.0 get_ambari_version_2_mock.return_value = get_ambari_version_mock.return_value = '1.6.0' move_user_custom_actions.called = False upgrade(args) self.assertFalse(move_user_custom_actions.called) get_ambari_version_2_mock.return_value = get_ambari_version_mock.return_value = CURR_AMBARI_VERSION # test getAmbariProperties failed args = reset_mocks() get_ambari_properties_3_mock.return_value = get_ambari_properties_2_mock.return_value = \ get_ambari_properties_mock.return_value = -1 fail = False try: upgrade(args) except FatalException as e: self.assertEquals("Error getting ambari properties", e.reason) fail = True self.assertTrue(fail) # test get resource dir param failed args = reset_mocks() p = MagicMock() get_ambari_properties_mock.reset_mock() get_ambari_properties_2_mock.reset_mock() get_ambari_properties_3_mock.reset_mock() get_ambari_properties_3_mock.return_value = get_ambari_properties_2_mock.return_value = \ get_ambari_properties_mock.return_value = p p.__getitem__.side_effect = ["something", "something", "something", "something", KeyError("test exception")] exists_mock.return_value = False fail = False try: upgrade(args) except FatalException as e: fail = True self.assertTrue(fail) # test if some drivers are available in resources, and symlink available too args = reset_mocks() props = Properties() props.process_pair(JDBC_DATABASE_NAME_PROPERTY, "something") props.process_pair(RESOURCES_DIR_PROPERTY, "resources") get_ambari_properties_3_mock.return_value = get_ambari_properties_2_mock.return_value = \ get_ambari_properties_mock.return_value = props exists_mock.return_value = True lexists_mock.return_value = True isfile_mock.side_effect = [True, False, False] pass def test_print_info_msg(self): out = StringIO.StringIO() sys.stdout = out set_verbose(True) print_info_msg("msg") self.assertNotEqual("", out.getvalue()) sys.stdout = sys.__stdout__ pass def test_print_error_msg(self): out = StringIO.StringIO() sys.stdout = out set_verbose(True) print_error_msg("msg") self.assertNotEqual("", out.getvalue()) sys.stdout = sys.__stdout__ pass def test_print_warning_msg(self): out = StringIO.StringIO() sys.stdout = out set_verbose(True) print_warning_msg("msg") self.assertNotEqual("", out.getvalue()) sys.stdout = sys.__stdout__ pass @patch("ambari_server.userInput.get_choice_string_input") def test_get_YN_input(self, get_choice_string_input_mock): get_YN_input("prompt", "default") self.assertTrue(get_choice_string_input_mock.called) self.assertEqual(4, len(get_choice_string_input_mock.call_args_list[0][0])) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup") def test_main_db_options(self, setup_mock): base_args = ["ambari-server.py", "setup"] db_args = ["--database", "postgres", "--databasehost", "somehost.net", "--databaseport", "12345", "--databasename", "ambari", "--databaseusername", "ambari", "--databasepassword", "bigdata"] #test no args failed = False sys.argv = list(base_args) try: _ambari_server_.mainBody() except SystemExit: failed = True pass self.assertFalse(failed) self.assertTrue(setup_mock.called) self.assertTrue(setup_mock.call_args_list[0][0][0].must_set_database_options) setup_mock.reset_mock() # test embedded option failed = False sys.argv = list(base_args) sys.argv.extend(db_args[-10:]) sys.argv.extend(["--database", "embedded"]) try: _ambari_server_.mainBody() except SystemExit: failed = True pass self.assertFalse(failed) self.assertTrue(setup_mock.called) setup_mock.reset_mock() #test full args sys.argv = list(base_args) sys.argv.extend(db_args) try: _ambari_server_.mainBody() except SystemExit: failed = True pass self.assertFalse(failed) self.assertTrue(setup_mock.called) self.assertFalse(setup_mock.call_args_list[0][0][0].must_set_database_options) setup_mock.reset_mock() #test not full args sys.argv = list(base_args) sys.argv.extend(["--database", "postgres"]) try: _ambari_server_.mainBody() except SystemExit: failed = True pass self.assertFalse(setup_mock.called) self.assertTrue(failed) setup_mock.reset_mock() #test wrong database failed = False sys.argv = list(base_args) sys.argv.extend(["--database", "unknown"]) sys.argv.extend(db_args[2:]) try: _ambari_server_.mainBody() except SystemExit: failed = True pass self.assertTrue(failed) self.assertFalse(setup_mock.called) setup_mock.reset_mock() #test wrong port check failed = False sys.argv = list(base_args) sys.argv.extend(["--databaseport", "unknown"]) sys.argv.extend(db_args[:4]) sys.argv.extend(db_args[6:]) try: _ambari_server_.mainBody() except SystemExit: failed = True pass self.assertTrue(failed) self.assertFalse(setup_mock.called) pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(_ambari_server_, "setup") def test_main_db_options(self, setup_mock): base_args = ["ambari-server.py", "setup"] db_args = ["--databasehost", "somehost.net", "--databaseport", "12345", "--databasename", "ambari", "--databaseusername", "ambari", "--databasepassword", "bigdata"] #test no args failed = False sys.argv = list(base_args) try: _ambari_server_.mainBody() except SystemExit: failed = True pass self.assertFalse(failed) self.assertTrue(setup_mock.called) self.assertTrue(setup_mock.call_args_list[0][0][0].must_set_database_options) setup_mock.reset_mock() #test full args sys.argv = list(base_args) sys.argv.extend(db_args) try: _ambari_server_.mainBody() except SystemExit: failed = True pass self.assertFalse(failed) self.assertTrue(setup_mock.called) self.assertFalse(setup_mock.call_args_list[0][0][0].must_set_database_options) setup_mock.reset_mock() #test not full args sys.argv = list(base_args) sys.argv.extend(["--databasehost", "somehost.net"]) try: _ambari_server_.mainBody() except SystemExit: failed = True pass self.assertFalse(setup_mock.called) self.assertTrue(failed) setup_mock.reset_mock() #test wrong port check failed = False sys.argv = list(base_args) sys.argv.extend(["--databaseport", "unknown"]) sys.argv.extend(db_args[:2]) sys.argv.extend(db_args[6:]) try: _ambari_server_.mainBody() except SystemExit: failed = True pass self.assertTrue(failed) self.assertFalse(setup_mock.called) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.serverSetup.get_YN_input") @patch("ambari_server.dbConfiguration.get_validated_string_input") @patch("ambari_server.dbConfiguration_linux.print_info_msg") def test_prompt_db_properties(self, print_info_msg_mock, get_validated_string_input_mock, get_YN_input_mock): def reset_mocks(): get_validated_string_input_mock.reset_mock() get_YN_input_mock.reset_mock() args = MagicMock() del args.database_index del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.persistence_type return args args = reset_mocks() set_silent(False) #test not prompt args.must_set_database_options = False prompt_db_properties(args) self.assertFalse(get_validated_string_input_mock.called) self.assertFalse(get_YN_input_mock.called) args = reset_mocks() #test prompt args.must_set_database_options = True get_YN_input_mock.return_value = False prompt_db_properties(args) self.assertTrue(get_YN_input_mock.called) self.assertFalse(get_validated_string_input_mock.called) args = reset_mocks() #test prompt advanced args.must_set_database_options = True get_YN_input_mock.return_value = True get_validated_string_input_mock.return_value = "4" prompt_db_properties(args) self.assertTrue(get_YN_input_mock.called) self.assertTrue(get_validated_string_input_mock.called) self.assertEquals(args.database_index, 3) pass @patch("ambari_server.serverConfiguration.get_conf_dir") def test_update_ambari_properties(self, get_conf_dir_mock): from ambari_server import serverConfiguration # need to modify constants inside the module properties = ["server.jdbc.user.name=ambari-server\n", "server.jdbc.user.passwd=/etc/ambari-server/conf/password.dat\n", "java.home=/usr/jdk64/jdk1.6.0_31\n", "server.jdbc.database_name=ambari\n", "ambari-server.user=ambari\n", "agent.fqdn.service.url=URL\n"] NEW_PROPERTY = 'some_new_property=some_value\n' CHANGED_VALUE_PROPERTY = 'server.jdbc.database_name=should_not_overwrite_value\n' get_conf_dir_mock.return_value = '/etc/ambari-server/conf' (tf1, fn1) = tempfile.mkstemp() (tf2, fn2) = tempfile.mkstemp() configDefaults.AMBARI_PROPERTIES_BACKUP_FILE = fn1 os.close(tf1) serverConfiguration.AMBARI_PROPERTIES_FILE = fn2 os.close(tf2) with open(serverConfiguration.AMBARI_PROPERTIES_FILE, "w") as f: f.write(NEW_PROPERTY) f.write(CHANGED_VALUE_PROPERTY) f.close() with open(configDefaults.AMBARI_PROPERTIES_BACKUP_FILE, 'w') as f: for line in properties: f.write(line) f.close() #Call tested method update_ambari_properties() timestamp = datetime.datetime.now() #RPMSAVE_FILE wasn't found self.assertFalse(os.path.exists(configDefaults.AMBARI_PROPERTIES_BACKUP_FILE)) #Renamed RPMSAVE_FILE exists self.assertTrue(os.path.exists(configDefaults.AMBARI_PROPERTIES_BACKUP_FILE + '.' + timestamp.strftime('%Y%m%d%H%M%S'))) with open(serverConfiguration.AMBARI_PROPERTIES_FILE, 'r') as f: ambari_properties_content = f.readlines() for line in properties: if (line == "agent.fqdn.service.url=URL\n"): if (not GET_FQDN_SERVICE_URL + "=URL\n" in ambari_properties_content) and ( line in ambari_properties_content): self.fail() else: if not line in ambari_properties_content: self.fail() if not NEW_PROPERTY in ambari_properties_content: self.fail() if CHANGED_VALUE_PROPERTY in ambari_properties_content: self.fail() # Command should not fail if *.rpmsave file is missing result = update_ambari_properties() self.assertEquals(result, 0) os.unlink(fn2) #if ambari.properties file is absent then "ambari-server upgrade" should # fail (tf, fn) = tempfile.mkstemp() configDefaults.AMBARI_PROPERTIES_BACKUP_FILE = fn result = update_ambari_properties() self.assertNotEquals(result, 0) pass @patch("ambari_server.properties.Properties.__init__") @patch("ambari_server.serverConfiguration.search_file") def test_update_ambari_properties_negative_case(self, search_file_mock, properties_mock): search_file_mock.return_value = None #Call tested method self.assertEquals(0, update_ambari_properties()) self.assertFalse(properties_mock.called) search_file_mock.return_value = False #Call tested method self.assertEquals(0, update_ambari_properties()) self.assertFalse(properties_mock.called) search_file_mock.return_value = '' #Call tested method self.assertEquals(0, update_ambari_properties()) self.assertFalse(properties_mock.called) pass @patch("ambari_server.serverConfiguration.get_conf_dir") def test_update_ambari_properties_without_some_properties(self, get_conf_dir_mock): ''' Checks: update_ambari_properties call should add ambari-server.user property if it's absent ''' from ambari_server import serverConfiguration # need to modify constants inside the module properties = ["server.jdbc.user.name=ambari-server\n", "server.jdbc.user.passwd=/etc/ambari-server/conf/password.dat\n", "java.home=/usr/jdk64/jdk1.6.0_31\n", "server.os_type=redhat6\n"] get_conf_dir_mock.return_value = '/etc/ambari-server/conf' (tf1, fn1) = tempfile.mkstemp() os.close(tf1) (tf2, fn2) = tempfile.mkstemp() os.close(tf2) serverConfiguration.AMBARI_PROPERTIES_RPMSAVE_FILE = fn1 serverConfiguration.AMBARI_PROPERTIES_FILE = fn2 with open(serverConfiguration.AMBARI_PROPERTIES_RPMSAVE_FILE, 'w') as f: for line in properties: f.write(line) #Call tested method update_ambari_properties() ambari_properties = Properties() ambari_properties.load(open(fn2)) self.assertTrue(NR_USER_PROPERTY in ambari_properties.keys()) value = ambari_properties[NR_USER_PROPERTY] self.assertEqual(value, "root") self.assertTrue(OS_FAMILY_PROPERTY in ambari_properties.keys()) os.unlink(fn2) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_commons.firewall.run_os_command") @patch("ambari_server.serverSetup.verify_setup_allowed") @patch("sys.exit") @patch("ambari_server.serverSetup.get_YN_input") @patch("ambari_server.dbConfiguration.get_validated_string_input") @patch("ambari_server.dbConfiguration_linux.get_YN_input") @patch("ambari_server.dbConfiguration_linux.get_validated_string_input") @patch("ambari_server.dbConfiguration_linux.PGConfig._store_remote_properties") @patch("ambari_server.dbConfiguration_linux.LinuxDBMSConfig.ensure_jdbc_driver_installed") @patch("ambari_server.dbConfiguration_linux.read_password") @patch("ambari_server.serverSetup.check_jdbc_drivers") @patch("ambari_server.serverSetup.is_root") @patch("ambari_server.serverSetup.check_ambari_user") @patch("ambari_server.serverSetup.download_and_install_jdk") @patch("ambari_server.serverSetup.configure_os_settings") @patch('__builtin__.raw_input') @patch("ambari_server.serverSetup.disable_security_enhancements") @patch("ambari_server.serverSetup.expand_jce_zip_file") def test_setup_remote_db_wo_client(self, expand_jce_zip_file_mock, check_selinux_mock, raw_input, configure_os_settings_mock, download_jdk_mock, check_ambari_user_mock, is_root_mock, check_jdbc_drivers_mock, read_password_mock, ensure_jdbc_driver_installed_mock, store_remote_properties_mock, get_validated_string_input_0_mock, get_YN_input_0_mock, get_validated_string_input_mock, get_YN_input, exit_mock, verify_setup_allowed_method, run_os_command_mock): args = MagicMock() args.jdbc_driver = None args.jdbc_db = None args.silent = False del args.dbms del args.database_index del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.persistence_type raw_input.return_value = "" is_root_mock.return_value = True check_selinux_mock.return_value = (0, "") run_os_command_mock.return_value = 3,"","" store_remote_properties_mock.return_value = 0 get_YN_input.return_value = True get_validated_string_input_mock.side_effect = ["4"] get_validated_string_input_0_mock.side_effect = ["localhost", "5432", "ambari", "ambari", "admin"] get_YN_input_0_mock.return_value = False read_password_mock.return_value = "encrypted_bigdata" ensure_jdbc_driver_installed_mock.return_value = True check_jdbc_drivers_mock.return_value = 0 check_ambari_user_mock.return_value = (0, False, 'user', None) download_jdk_mock.return_value = 0 configure_os_settings_mock.return_value = 0 verify_setup_allowed_method.return_value = 0 expand_jce_zip_file_mock.return_value = 0 try: setup(args) self.fail("Should throw exception") except NonFatalException as fe: # Expected self.assertTrue("Remote database setup aborted." in fe.reason) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_commons.firewall.run_os_command") @patch("sys.exit") @patch("ambari_server.userInput.get_YN_input") @patch("ambari_commons.os_utils.is_root") @patch("ambari_server.dbConfiguration_linux.store_password_file") @patch("__builtin__.raw_input") def test_store_remote_properties(self, raw_input_mock, store_password_file_mock, is_root_mock, get_YN_input, exit_mock, run_os_command_mock ): raw_input_mock.return_value = "" is_root_mock.return_value = True get_YN_input.return_value = False run_os_command_mock.return_value = 3,"","" store_password_file_mock.return_value = "encrypted_bigdata" import optparse args = optparse.Values() args.dbms = "oracle" args.database_host = "localhost" args.database_port = "1234" args.database_name = "ambari" args.postgres_schema = "ambari" args.sid_or_sname = "foo" args.database_username = "foo" args.database_password = "foo" properties0 = Properties() properties = Properties() factory = DBMSConfigFactory() dbConfig = factory.create(args, properties0) dbConfig._store_remote_properties(properties) found = False for n in properties.propertyNames(): if not found and n.startswith("server.jdbc.properties"): found = True self.assertTrue(found) # verify that some properties exist self.assertEquals("internal", properties.get_property(JDBC_CONNECTION_POOL_TYPE)) # now try with MySQL instead of Oracle to verify that the properties are different args.dbms = "mysql" args.database_index = 2 properties0 = Properties() properties = Properties() factory = DBMSConfigFactory() dbConfig = factory.create(args, properties0) dbConfig._store_remote_properties(properties) # verify MySQL properties self.assertEquals("c3p0", properties.get_property(JDBC_CONNECTION_POOL_TYPE)) @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.serverConfiguration.find_properties_file") def test_get_ambari_properties(self, find_properties_file_mock): find_properties_file_mock.return_value = None rcode = get_ambari_properties() self.assertEqual(rcode, -1) tf1 = tempfile.NamedTemporaryFile() find_properties_file_mock.return_value = tf1.name prop_name = 'name' prop_value = 'val' with open(tf1.name, 'w') as fout: fout.write(prop_name + '=' + prop_value) fout.close() properties = get_ambari_properties() self.assertEqual(properties[prop_name], prop_value) pass @only_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.serverConfiguration.find_properties_file") def test_get_ambari_properties(self, find_properties_file): find_properties_file.return_value = None rcode = get_ambari_properties() self.assertEqual(rcode, -1) tf1 = tempfile.NamedTemporaryFile(delete=False) find_properties_file.return_value = tf1.name tf1.close() prop_name = 'name' prop_value = 'val' with open(tf1.name, 'w') as fout: fout.write(prop_name + '=' + prop_value) properties = get_ambari_properties() self.assertEqual(properties[prop_name], prop_value) self.assertEqual(properties.fileName, os.path.abspath(tf1.name)) sys.stdout = sys.__stdout__ pass @patch("os.path.exists") @patch("os.remove") @patch("ambari_commons.os_utils.print_warning_msg") def test_remove_file(self, printWarningMsgMock, removeMock, pathExistsMock): def side_effect(): raise Exception(-1, "Failed to delete!") removeMock.side_effect = side_effect pathExistsMock.return_value = 1 res = remove_file("/someNonExsistantDir/filename") self.assertEquals(res, 1) removeMock.side_effect = None res = remove_file("/someExsistantDir/filename") self.assertEquals(res, 0) @patch("shutil.copyfile") def test_copy_file(self, shutilCopyfileMock): def side_effect(): raise Exception(-1, "Failed to copy!") shutilCopyfileMock.side_effect = side_effect try: copy_file("/tmp/psswd", "/someNonExsistantDir/filename") self.fail("Exception on file not copied has not been thrown!") except FatalException: # Expected pass self.assertTrue(shutilCopyfileMock.called) shutilCopyfileMock.side_effect = None try: copy_file("/tmp/psswd", "/root/psswd") except FatalException: self.fail("Exception on file copied should not be thrown!") self.assertTrue(shutilCopyfileMock.called) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.dbConfiguration_linux.get_ambari_properties") @patch("ambari_server.dbConfiguration_linux.print_error_msg") @patch("ambari_server.dbConfiguration.print_error_msg") @patch("ambari_server.dbConfiguration_linux.print_warning_msg") @patch("__builtin__.raw_input") @patch("glob.glob") @patch("os.path.isdir") @patch("os.path.lexists") @patch("os.remove") @patch("os.symlink") @patch("shutil.copy") def test_ensure_jdbc_drivers_installed(self, shutil_copy_mock, os_symlink_mock, os_remove_mock, lexists_mock, isdir_mock, glob_mock, raw_input_mock, print_warning_msg, print_error_msg_mock, print_error_msg_2_mock, get_ambari_properties_mock): out = StringIO.StringIO() sys.stdout = out def reset_mocks(): get_ambari_properties_mock.reset_mock() shutil_copy_mock.reset_mock() print_error_msg_mock.reset_mock() print_warning_msg.reset_mock() raw_input_mock.reset_mock() args = MagicMock() del args.database_index del args.persistence_type del args.silent del args.sid_or_sname del args.jdbc_url args.dbms = "oracle" return args # Check positive scenario drivers_list = [os.path.join(os.sep,'usr','share','java','ojdbc6.jar')] resources_dir = os.sep + 'tmp' props = Properties() props.process_pair(RESOURCES_DIR_PROPERTY, resources_dir) get_ambari_properties_mock.return_value = props factory = DBMSConfigFactory() args = reset_mocks() glob_mock.return_value = drivers_list isdir_mock.return_value = True lexists_mock.return_value = True dbms = factory.create(args, props) rcode = dbms.ensure_jdbc_driver_installed(props) self.assertEquals(os_symlink_mock.call_count, 1) self.assertEquals(os_symlink_mock.call_args_list[0][0][0], os.path.join(os.sep,'tmp','ojdbc6.jar')) self.assertEquals(os_symlink_mock.call_args_list[0][0][1], os.path.join(os.sep,'tmp','oracle-jdbc-driver.jar')) self.assertTrue(rcode) self.assertEquals(shutil_copy_mock.call_count, 1) self.assertEquals(shutil_copy_mock.call_args_list[0][0][0], drivers_list[0]) self.assertEquals(shutil_copy_mock.call_args_list[0][0][1], resources_dir) # Check negative scenarios # Silent option, no drivers set_silent(True) args = reset_mocks() glob_mock.return_value = [] failed = False try: dbms = factory.create(args, props) rcode = dbms.ensure_jdbc_driver_installed(props) except FatalException: failed = True self.assertTrue(print_error_msg_mock.called) self.assertTrue(failed) # Non-Silent option, no drivers set_silent(False) args = reset_mocks() glob_mock.return_value = [] failed = False try: dbms = factory.create(args, props) rcode = dbms.ensure_jdbc_driver_installed(props) except FatalException: failed = True self.assertTrue(failed) self.assertTrue(print_error_msg_mock.called) # Non-Silent option, no drivers at first ask, present drivers after that args = reset_mocks() glob_mock.side_effect = [[], drivers_list] dbms = factory.create(args, props) rcode = dbms.ensure_jdbc_driver_installed(props) self.assertTrue(rcode) self.assertEquals(shutil_copy_mock.call_count, 1) self.assertEquals(shutil_copy_mock.call_args_list[0][0][0], drivers_list[0]) self.assertEquals(shutil_copy_mock.call_args_list[0][0][1], resources_dir) # Non-Silent option, no drivers at first ask, no drivers after that args = reset_mocks() glob_mock.side_effect = [[], []] failed = False try: dbms = factory.create(args, props) rcode = dbms.ensure_jdbc_driver_installed(props) except FatalException: failed = True self.assertTrue(failed) self.assertTrue(print_error_msg_mock.called) # Failed to copy_files args = reset_mocks() glob_mock.side_effect = [drivers_list] try: dbms = factory.create(args, props) rcode = dbms.ensure_jdbc_driver_installed(props) except FatalException: failed = True self.assertTrue(failed) sys.stdout = sys.__stdout__ pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.dbConfiguration.get_ambari_properties") @patch("os.path.isdir") @patch("os.path.isfile") @patch("os.path.lexists") @patch("os.remove") @patch("os.symlink") def test_check_jdbc_drivers(self, os_symlink_mock, os_remove_mock, lexists_mock, isfile_mock, isdir_mock, get_ambari_properties_mock): args = MagicMock() # Check positive scenario drivers_list = [os.path.join(os.sep,'usr','share','java','ojdbc6.jar')] resources_dir = os.sep + 'tmp' props = Properties() props.process_pair(RESOURCES_DIR_PROPERTY, resources_dir) get_ambari_properties_mock.return_value = props isdir_mock.return_value = True isfile_mock.side_effect = [True, False, False] del args.database_index del args.persistence_type del args.silent del args.sid_or_sname del args.jdbc_url lexists_mock.return_value = True check_jdbc_drivers(args) self.assertEquals(os_symlink_mock.call_count, 1) self.assertEquals(os_symlink_mock.call_args_list[0][0][0], os.path.join(os.sep,'tmp','ojdbc6.jar')) self.assertEquals(os_symlink_mock.call_args_list[0][0][1], os.path.join(os.sep,'tmp','oracle-jdbc-driver.jar')) # Check negative scenarios # No drivers deployed get_ambari_properties_mock.reset_mock() os_symlink_mock.reset_mock() isfile_mock.side_effect = [False, False, False] check_jdbc_drivers(args) self.assertFalse(os_symlink_mock.called) pass @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.serverConfiguration.find_properties_file") def test_get_ambari_properties(self, find_properties_file_mock): find_properties_file_mock.return_value = None rcode = get_ambari_properties() self.assertEqual(rcode, -1) tf1 = tempfile.NamedTemporaryFile() find_properties_file_mock.return_value = tf1.name prop_name = 'name' prop_value = 'val' with open(tf1.name, 'w') as fout: fout.write(prop_name + '=' + prop_value) fout.close() properties = get_ambari_properties() self.assertEqual(properties[prop_name], prop_value) self.assertEqual(properties.fileName, os.path.abspath(tf1.name)) sys.stdout = sys.__stdout__ pass @only_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.serverConfiguration.find_properties_file") def test_get_ambari_properties(self, find_properties_file_mock): find_properties_file_mock.return_value = None rcode = get_ambari_properties() self.assertEqual(rcode, -1) tf1 = tempfile.NamedTemporaryFile(delete=False) find_properties_file_mock.return_value = tf1.name prop_name = 'name' prop_value = 'val' tf1.close() with open(tf1.name, 'w') as fout: fout.write(prop_name + '=' + prop_value) fout.close() properties = get_ambari_properties() self.assertEqual(properties[prop_name], prop_value) self.assertEqual(properties.fileName, os.path.abspath(tf1.name)) sys.stdout = sys.__stdout__ pass @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.serverConfiguration.check_database_name_property") @patch("ambari_server.serverConfiguration.find_properties_file") def test_parse_properties_file(self, find_properties_file_mock, check_database_name_property_mock): check_database_name_property_mock.return_value = 1 tf1 = tempfile.NamedTemporaryFile(mode='r') find_properties_file_mock.return_value = tf1.name args = MagicMock() parse_properties_file(args) self.assertEquals(args.persistence_type, "local") with open(tf1.name, 'w') as fout: fout.write("\n") fout.write(PERSISTENCE_TYPE_PROPERTY + "=remote") args = MagicMock() parse_properties_file(args) self.assertEquals(args.persistence_type, "remote") pass @not_for_platform(PLATFORM_WINDOWS) @patch("os.path.isabs") @patch("ambari_server.dbConfiguration.decrypt_password_for_alias") @patch("ambari_server.dbConfiguration_linux.get_ambari_properties") def test_configure_database_username_password_masterkey_persisted(self, get_ambari_properties_method, decrypt_password_for_alias_method, path_isabs_method): out = StringIO.StringIO() sys.stdout = out properties = Properties() properties.process_pair(JDBC_USER_NAME_PROPERTY, "fakeuser") properties.process_pair(JDBC_PASSWORD_PROPERTY, "${alias=somealias}") properties.process_pair(JDBC_DATABASE_NAME_PROPERTY, "fakedbname") properties.process_pair(SECURITY_KEY_IS_PERSISTED, "True") get_ambari_properties_method.return_value = properties decrypt_password_for_alias_method.return_value = "falepasswd" args = MagicMock() args.master_key = None del args.database_index del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.sid_or_sname del args.jdbc_url dbms = OracleConfig(args, properties, "local") self.assertTrue(decrypt_password_for_alias_method.called) self.assertFalse(path_isabs_method.called) self.assertEquals("fakeuser", dbms.database_username) self.assertEquals("falepasswd", dbms.database_password) sys.stdout = sys.__stdout__ pass @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.dbConfiguration_linux.read_password") def test_configure_database_password(self, read_password_method): out = StringIO.StringIO() sys.stdout = out read_password_method.return_value = "fakepasswd" result = LinuxDBMSConfig._configure_database_password(True) self.assertTrue(read_password_method.called) self.assertEquals("fakepasswd", result) result = LinuxDBMSConfig._configure_database_password(True) self.assertEquals("fakepasswd", result) result = LinuxDBMSConfig._configure_database_password(True) self.assertEquals("fakepasswd", result) sys.stdout = sys.__stdout__ pass @patch("os.path.exists") @patch("ambari_server.setupSecurity.get_is_secure") @patch("ambari_server.setupSecurity.get_is_persisted") @patch("ambari_server.setupSecurity.remove_password_file") @patch("ambari_server.setupSecurity.save_passwd_for_alias") @patch("ambari_server.setupSecurity.read_master_key") @patch("ambari_server.setupSecurity.read_ambari_user") @patch("ambari_server.setupSecurity.get_master_key_location") @patch("ambari_server.setupSecurity.update_properties_2") @patch("ambari_server.setupSecurity.save_master_key") @patch("ambari_server.setupSecurity.get_YN_input") @patch("ambari_server.setupSecurity.search_file") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.is_root") def test_setup_master_key_not_persist(self, is_root_method, get_ambari_properties_method, search_file_message, get_YN_input_method, save_master_key_method, update_properties_method, get_master_key_location_method, read_ambari_user_method, read_master_key_method, save_passwd_for_alias_method, remove_password_file_method, get_is_persisted_method, get_is_secure_method, exists_mock): is_root_method.return_value = True p = Properties() FAKE_PWD_STRING = "fakepasswd" p.process_pair(JDBC_PASSWORD_PROPERTY, FAKE_PWD_STRING) p.process_pair(LDAP_MGR_PASSWORD_PROPERTY, FAKE_PWD_STRING) p.process_pair(SSL_TRUSTSTORE_PASSWORD_PROPERTY, FAKE_PWD_STRING) p.process_pair(JDBC_RCA_PASSWORD_FILE_PROPERTY, FAKE_PWD_STRING) get_ambari_properties_method.return_value = p read_master_key_method.return_value = "aaa" get_YN_input_method.return_value = False read_ambari_user_method.return_value = None save_passwd_for_alias_method.return_value = 0 get_is_persisted_method.return_value = (True, "filepath") get_is_secure_method.return_value = False exists_mock.return_value = False setup_master_key() self.assertTrue(get_YN_input_method.called) self.assertTrue(read_master_key_method.called) self.assertTrue(read_ambari_user_method.called) self.assertTrue(update_properties_method.called) self.assertFalse(save_master_key_method.called) self.assertTrue(save_passwd_for_alias_method.called) self.assertEquals(3, save_passwd_for_alias_method.call_count) self.assertTrue(remove_password_file_method.called) result_expected = {JDBC_PASSWORD_PROPERTY: get_alias_string(JDBC_RCA_PASSWORD_ALIAS), JDBC_RCA_PASSWORD_FILE_PROPERTY: get_alias_string(JDBC_RCA_PASSWORD_ALIAS), LDAP_MGR_PASSWORD_PROPERTY: get_alias_string(LDAP_MGR_PASSWORD_ALIAS), SSL_TRUSTSTORE_PASSWORD_PROPERTY: get_alias_string(SSL_TRUSTSTORE_PASSWORD_ALIAS), SECURITY_IS_ENCRYPTION_ENABLED: 'true'} sorted_x = sorted(result_expected.iteritems(), key=operator.itemgetter(0)) sorted_y = sorted(update_properties_method.call_args[0][1].iteritems(), key=operator.itemgetter(0)) self.assertEquals(sorted_x, sorted_y) pass @patch("ambari_server.setupSecurity.save_passwd_for_alias") @patch("os.path.exists") @patch("ambari_server.setupSecurity.get_is_secure") @patch("ambari_server.setupSecurity.get_is_persisted") @patch("ambari_server.setupSecurity.read_master_key") @patch("ambari_server.setupSecurity.read_ambari_user") @patch("ambari_server.setupSecurity.get_master_key_location") @patch("ambari_server.setupSecurity.update_properties_2") @patch("ambari_server.setupSecurity.save_master_key") @patch("ambari_server.setupSecurity.get_YN_input") @patch("ambari_server.serverConfiguration.search_file") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.is_root") def test_setup_master_key_persist(self, is_root_method, get_ambari_properties_method, search_file_message, get_YN_input_method, save_master_key_method, update_properties_method, get_master_key_location_method, read_ambari_user_method, read_master_key_method, get_is_persisted_method, get_is_secure_method, exists_mock, save_passwd_for_alias_method): is_root_method.return_value = True p = Properties() FAKE_PWD_STRING = "fakepasswd" p.process_pair(JDBC_PASSWORD_PROPERTY, FAKE_PWD_STRING) get_ambari_properties_method.return_value = p search_file_message.return_value = "propertiesfile" read_master_key_method.return_value = "aaa" get_YN_input_method.side_effect = [True, False] read_ambari_user_method.return_value = None get_is_persisted_method.return_value = (True, "filepath") get_is_secure_method.return_value = False exists_mock.return_value = False save_passwd_for_alias_method.return_value = 0 setup_master_key() self.assertTrue(get_YN_input_method.called) self.assertTrue(read_master_key_method.called) self.assertTrue(read_ambari_user_method.called) self.assertTrue(update_properties_method.called) self.assertTrue(save_master_key_method.called) result_expected = {JDBC_PASSWORD_PROPERTY: get_alias_string(JDBC_RCA_PASSWORD_ALIAS), SECURITY_IS_ENCRYPTION_ENABLED: 'true'} sorted_x = sorted(result_expected.iteritems(), key=operator.itemgetter(0)) sorted_y = sorted(update_properties_method.call_args[0][1].iteritems(), key=operator.itemgetter(0)) self.assertEquals(sorted_x, sorted_y) pass @patch("ambari_server.setupSecurity.read_master_key") @patch("ambari_server.setupSecurity.remove_password_file") @patch("os.path.exists") @patch("ambari_server.setupSecurity.read_ambari_user") @patch("ambari_server.setupSecurity.get_master_key_location") @patch("ambari_server.setupSecurity.save_passwd_for_alias") @patch("ambari_server.setupSecurity.read_passwd_for_alias") @patch("ambari_server.setupSecurity.update_properties_2") @patch("ambari_server.setupSecurity.save_master_key") @patch("ambari_server.setupSecurity.get_validated_string_input") @patch("ambari_server.setupSecurity.get_YN_input") @patch("ambari_server.setupSecurity.search_file") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.is_root") def test_reset_master_key_persisted(self, is_root_method, get_ambari_properties_method, search_file_message, get_YN_input_method, get_validated_string_input_method, save_master_key_method, update_properties_method, read_passwd_for_alias_method, save_passwd_for_alias_method, get_master_key_location_method, read_ambari_user_method, exists_mock, remove_password_file_method, read_master_key_method): # Testing call under non-root is_root_method.return_value = False try: setup_master_key() self.fail("Should throw exception") except FatalException as fe: # Expected self.assertTrue("root-level" in fe.reason) pass # Testing call under root is_root_method.return_value = True search_file_message.return_value = "filepath" read_ambari_user_method.return_value = None p = Properties() FAKE_PWD_STRING = '${alias=fakealias}' p.process_pair(JDBC_PASSWORD_PROPERTY, FAKE_PWD_STRING) p.process_pair(LDAP_MGR_PASSWORD_PROPERTY, FAKE_PWD_STRING) p.process_pair(SSL_TRUSTSTORE_PASSWORD_PROPERTY, FAKE_PWD_STRING) p.process_pair(JDBC_RCA_PASSWORD_FILE_PROPERTY, FAKE_PWD_STRING) get_ambari_properties_method.return_value = p get_YN_input_method.side_effect = [True, True] read_master_key_method.return_value = "aaa" read_passwd_for_alias_method.return_value = "fakepassword" save_passwd_for_alias_method.return_value = 0 exists_mock.return_value = False setup_master_key() self.assertTrue(save_master_key_method.called) self.assertTrue(get_YN_input_method.called) self.assertTrue(read_master_key_method.called) self.assertTrue(update_properties_method.called) self.assertTrue(read_passwd_for_alias_method.called) self.assertTrue(3, read_passwd_for_alias_method.call_count) self.assertTrue(3, save_passwd_for_alias_method.call_count) result_expected = {JDBC_PASSWORD_PROPERTY: get_alias_string(JDBC_RCA_PASSWORD_ALIAS), JDBC_RCA_PASSWORD_FILE_PROPERTY: get_alias_string(JDBC_RCA_PASSWORD_ALIAS), LDAP_MGR_PASSWORD_PROPERTY: get_alias_string(LDAP_MGR_PASSWORD_ALIAS), SSL_TRUSTSTORE_PASSWORD_PROPERTY: get_alias_string(SSL_TRUSTSTORE_PASSWORD_ALIAS), SECURITY_IS_ENCRYPTION_ENABLED: 'true'} sorted_x = sorted(result_expected.iteritems(), key=operator.itemgetter(0)) sorted_y = sorted(update_properties_method.call_args[0][1].iteritems(), key=operator.itemgetter(0)) self.assertEquals(sorted_x, sorted_y) pass @patch("ambari_server.setupSecurity.get_is_persisted") @patch("ambari_server.setupSecurity.get_is_secure") @patch("ambari_server.setupSecurity.remove_password_file") @patch("os.path.exists") @patch("ambari_server.setupSecurity.read_ambari_user") @patch("ambari_server.setupSecurity.get_master_key_location") @patch("ambari_server.setupSecurity.save_passwd_for_alias") @patch("ambari_server.setupSecurity.read_passwd_for_alias") @patch("ambari_server.setupSecurity.update_properties_2") @patch("ambari_server.setupSecurity.save_master_key") @patch("ambari_server.setupSecurity.get_validated_string_input") @patch("ambari_server.setupSecurity.get_YN_input") @patch("ambari_server.setupSecurity.search_file") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.is_root") def test_reset_master_key_not_persisted(self, is_root_method, get_ambari_properties_method, search_file_message, get_YN_input_method, get_validated_string_input_method, save_master_key_method, update_properties_method, read_passwd_for_alias_method, save_passwd_for_alias_method, get_master_key_location_method, read_ambari_user_method, exists_mock, remove_password_file_method, get_is_secure_method, get_is_persisted_method): is_root_method.return_value = True search_file_message.return_value = False read_ambari_user_method.return_value = None p = Properties() FAKE_PWD_STRING = '${alias=fakealias}' p.process_pair(JDBC_PASSWORD_PROPERTY, FAKE_PWD_STRING) p.process_pair(LDAP_MGR_PASSWORD_PROPERTY, FAKE_PWD_STRING) p.process_pair(SSL_TRUSTSTORE_PASSWORD_PROPERTY, FAKE_PWD_STRING) p.process_pair(JDBC_RCA_PASSWORD_FILE_PROPERTY, FAKE_PWD_STRING) get_ambari_properties_method.return_value = p get_YN_input_method.side_effect = [True, False] get_validated_string_input_method.return_value = "aaa" read_passwd_for_alias_method.return_value = "fakepassword" save_passwd_for_alias_method.return_value = 0 exists_mock.return_value = False get_is_secure_method.return_value = True get_is_persisted_method.return_value = (True, "filePath") setup_master_key() self.assertFalse(save_master_key_method.called) self.assertTrue(get_YN_input_method.called) self.assertTrue(get_validated_string_input_method.called) self.assertTrue(update_properties_method.called) self.assertTrue(read_passwd_for_alias_method.called) self.assertTrue(3, read_passwd_for_alias_method.call_count) self.assertTrue(3, save_passwd_for_alias_method.call_count) self.assertFalse(save_master_key_method.called) result_expected = {JDBC_PASSWORD_PROPERTY: get_alias_string(JDBC_RCA_PASSWORD_ALIAS), JDBC_RCA_PASSWORD_FILE_PROPERTY: get_alias_string(JDBC_RCA_PASSWORD_ALIAS), LDAP_MGR_PASSWORD_PROPERTY: get_alias_string(LDAP_MGR_PASSWORD_ALIAS), SSL_TRUSTSTORE_PASSWORD_PROPERTY: get_alias_string(SSL_TRUSTSTORE_PASSWORD_ALIAS), SECURITY_IS_ENCRYPTION_ENABLED: 'true'} sorted_x = sorted(result_expected.iteritems(), key=operator.itemgetter(0)) sorted_y = sorted(update_properties_method.call_args[0][1].iteritems(), key=operator.itemgetter(0)) self.assertEquals(sorted_x, sorted_y) pass @staticmethod @OsFamilyFuncImpl(OSConst.WINSRV_FAMILY) def _init_test_ldap_properties_map_invalid_input_1(): ldap_properties_map = \ { LDAP_PRIMARY_URL_PROPERTY: "a:3", "authentication.ldap.secondaryUrl": "b:2", "authentication.ldap.useSSL": "false", "authentication.ldap.usernameAttribute": "user", "authentication.ldap.baseDn": "uid", "authentication.ldap.bindAnonymously": "true", "authentication.ldap.referral": "follow", "client.security": "ldap", "ambari.ldap.isConfigured": "true" } return ldap_properties_map @staticmethod @OsFamilyFuncImpl(OsFamilyImpl.DEFAULT) def _init_test_ldap_properties_map_invalid_input_1(): ldap_properties_map = \ { LDAP_PRIMARY_URL_PROPERTY: "a:3", "authentication.ldap.secondaryUrl": "b:2", "authentication.ldap.useSSL": "false", "authentication.ldap.userObjectClass": "user", "authentication.ldap.usernameAttribute": "uid", "authentication.ldap.groupObjectClass": "group", "authentication.ldap.groupNamingAttr": "cn", "authentication.ldap.groupMembershipAttr": "member", "authentication.ldap.dnAttribute": "dn", "authentication.ldap.baseDn": "base", "authentication.ldap.referral": "follow", "authentication.ldap.bindAnonymously": "true", "client.security": "ldap", "ambari.ldap.isConfigured": "true" } return ldap_properties_map @staticmethod @OsFamilyFuncImpl(OSConst.WINSRV_FAMILY) def _init_test_ldap_properties_map_invalid_input_2(): ldap_properties_map = \ { LDAP_PRIMARY_URL_PROPERTY: "a:3", "authentication.ldap.useSSL": "false", "authentication.ldap.usernameAttribute": "user", "authentication.ldap.baseDn": "uid", "authentication.ldap.bindAnonymously": "true", "authentication.ldap.referral": "follow", "client.security": "ldap", "ambari.ldap.isConfigured": "true" } return ldap_properties_map @staticmethod @OsFamilyFuncImpl(OsFamilyImpl.DEFAULT) def _init_test_ldap_properties_map_invalid_input_2(): ldap_properties_map = \ { LDAP_PRIMARY_URL_PROPERTY: "a:3", "authentication.ldap.useSSL": "false", "authentication.ldap.userObjectClass": "user", "authentication.ldap.usernameAttribute": "uid", "authentication.ldap.groupObjectClass": "group", "authentication.ldap.groupNamingAttr": "cn", "authentication.ldap.groupMembershipAttr": "member", "authentication.ldap.dnAttribute": "dn", "authentication.ldap.baseDn": "base", "authentication.ldap.referral": "follow", "authentication.ldap.bindAnonymously": "true", "client.security": "ldap", "ambari.ldap.isConfigured": "true" } return ldap_properties_map @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("__builtin__.raw_input") @patch("ambari_server.setupSecurity.get_is_secure") @patch("ambari_server.setupSecurity.get_YN_input") @patch("ambari_server.setupSecurity.update_properties_2") @patch("ambari_server.setupSecurity.search_file") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.is_root") def test_setup_ldap_invalid_input(self, is_root_method, get_ambari_properties_method, search_file_message, update_properties_method, get_YN_input_method, get_is_secure_method, raw_input_mock): out = StringIO.StringIO() sys.stdout = out is_root_method.return_value = True search_file_message.return_value = "filepath" configs = {SECURITY_MASTER_KEY_LOCATION: "filepath", SECURITY_KEYS_DIR: tempfile.gettempdir(), SECURITY_IS_ENCRYPTION_ENABLED: "true" } get_ambari_properties_method.return_value = configs raw_input_mock.side_effect = ['a:3', 'b:b', 'hody', 'b:2', 'false', 'user', 'uid', 'group', 'cn', 'member', 'dn', 'base', 'follow', 'true'] set_silent(False) get_YN_input_method.return_value = True setup_ldap() ldap_properties_map = TestAmbariServer._init_test_ldap_properties_map_invalid_input_1() sorted_x = sorted(ldap_properties_map.iteritems(), key=operator.itemgetter(0)) sorted_y = sorted(update_properties_method.call_args[0][1].iteritems(), key=operator.itemgetter(0)) self.assertEquals(sorted_x, sorted_y) self.assertTrue(get_YN_input_method.called) self.assertEquals(14, raw_input_mock.call_count) raw_input_mock.reset_mock() raw_input_mock.side_effect = ['a:3', '', 'b:2', 'false', 'user', 'uid', 'group', 'cn', 'member', 'dn', 'base', 'follow', 'true'] setup_ldap() ldap_properties_map = TestAmbariServer._init_test_ldap_properties_map_invalid_input_2() sorted_x = sorted(ldap_properties_map.iteritems(), key=operator.itemgetter(0)) sorted_y = sorted(update_properties_method.call_args[0][1].iteritems(), key=operator.itemgetter(0)) self.assertEquals(sorted_x, sorted_y) self.assertEquals(13, raw_input_mock.call_count) sys.stdout = sys.__stdout__ pass @staticmethod @OsFamilyFuncImpl(OSConst.WINSRV_FAMILY) def _init_test_ldap_properties_map(): ldap_properties_map = \ { "authentication.ldap.primaryUrl": "test", "authentication.ldap.secondaryUrl": "test", "authentication.ldap.useSSL": "false", "authentication.ldap.usernameAttribute": "test", "authentication.ldap.baseDn": "test", "authentication.ldap.bindAnonymously": "false", "authentication.ldap.managerDn": "test", "authentication.ldap.referral": "test", "client.security": "ldap", LDAP_MGR_PASSWORD_PROPERTY: "ldap-password.dat", "ambari.ldap.isConfigured": "true" } return ldap_properties_map @staticmethod @OsFamilyFuncImpl(OsFamilyImpl.DEFAULT) def _init_test_ldap_properties_map(): ldap_properties_map = \ { "authentication.ldap.primaryUrl": "test", "authentication.ldap.secondaryUrl": "test", "authentication.ldap.useSSL": "false", "authentication.ldap.userObjectClass": "test", "authentication.ldap.usernameAttribute": "test", "authentication.ldap.baseDn": "test", "authentication.ldap.bindAnonymously": "false", "authentication.ldap.managerDn": "test", "authentication.ldap.groupObjectClass": "test", "authentication.ldap.groupMembershipAttr": "test", "authentication.ldap.groupNamingAttr": "test", "authentication.ldap.dnAttribute": "test", "authentication.ldap.referral": "test", "client.security": "ldap", LDAP_MGR_PASSWORD_PROPERTY: "ldap-password.dat", "ambari.ldap.isConfigured": "true" } return ldap_properties_map @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.setupSecurity.get_is_secure") @patch("ambari_server.setupSecurity.encrypt_password") @patch("ambari_server.setupSecurity.save_passwd_for_alias") @patch("ambari_server.setupSecurity.get_YN_input") @patch("ambari_server.setupSecurity.update_properties_2") @patch("ambari_server.setupSecurity.configure_ldap_password") @patch("ambari_server.setupSecurity.get_validated_string_input") @patch("ambari_server.serverConfiguration.search_file") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.is_root") @patch("ambari_server.setupSecurity.read_password") @patch("os.path.exists") def test_setup_ldap(self, exists_method, read_password_method, is_root_method, get_ambari_properties_method, search_file_message, get_validated_string_input_method, configure_ldap_password_method, update_properties_method, get_YN_input_method, save_passwd_for_alias_method, encrypt_password_method, get_is_secure_method): out = StringIO.StringIO() sys.stdout = out # Testing call under non-root is_root_method.return_value = False try: setup_ldap() self.fail("Should throw exception") except FatalException as fe: # Expected self.assertTrue("root-level" in fe.reason) pass # Testing call under root is_root_method.return_value = True search_file_message.return_value = "filepath" configs = {SECURITY_MASTER_KEY_LOCATION: "filepath", SECURITY_KEYS_DIR: tempfile.gettempdir(), SECURITY_IS_ENCRYPTION_ENABLED: "true" } get_ambari_properties_method.return_value = configs configure_ldap_password_method.return_value = "password" save_passwd_for_alias_method.return_value = 0 encrypt_password_method.return_value = get_alias_string(LDAP_MGR_PASSWORD_ALIAS) def yn_input_side_effect(*args, **kwargs): if 'TrustStore' in args[0]: return False else: return True #get_YN_input_method.side_effect = yn_input_side_effect() get_YN_input_method.side_effect = [True, ] def valid_input_side_effect(*args, **kwargs): if 'Bind anonymously' in args[0]: return 'false' if args[1] == "true" or args[1] == "false": return args[1] else: return "test" get_validated_string_input_method.side_effect = valid_input_side_effect setup_ldap() ldap_properties_map = TestAmbariServer._init_test_ldap_properties_map() sorted_x = sorted(ldap_properties_map.iteritems(), key=operator.itemgetter(0)) sorted_y = sorted(update_properties_method.call_args[0][1].iteritems(), key=operator.itemgetter(0)) self.assertEquals(sorted_x, sorted_y) self.assertTrue(update_properties_method.called) self.assertTrue(configure_ldap_password_method.called) self.assertTrue(get_validated_string_input_method.called) self.assertTrue(get_YN_input_method.called) # truststore not found case def os_path_exists(*args, **kwargs): if "bogus" in args[0]: return False else: return True pass def input_enable_ssl(*args, **kwargs): if 'Bind anonymously' in args[0]: return 'false' if "SSL" in args[0]: return "true" if "Path to TrustStore file" in args[0]: if input_enable_ssl.path_counter < 2: input_enable_ssl.path_counter += 1 return "bogus" else: return "valid" if args[1] == "true" or args[1] == "false": return args[1] else: return "test" pass input_enable_ssl.path_counter = 0 exists_method.side_effect = os_path_exists get_validated_string_input_method.side_effect = input_enable_ssl read_password_method.return_value = "password" get_YN_input_method.reset_mock() get_YN_input_method.side_effect = [True, True] update_properties_method.reset_mock() setup_ldap() self.assertTrue(read_password_method.called) ldap_properties_map = \ { "authentication.ldap.primaryUrl": "test", "authentication.ldap.secondaryUrl": "test", "authentication.ldap.useSSL": "true", "authentication.ldap.usernameAttribute": "test", "authentication.ldap.baseDn": "test", "authentication.ldap.dnAttribute": "test", "authentication.ldap.bindAnonymously": "false", "authentication.ldap.managerDn": "test", "client.security": "ldap", "ssl.trustStore.type": "test", "ssl.trustStore.path": "valid", "ssl.trustStore.password": "password", LDAP_MGR_PASSWORD_PROPERTY: get_alias_string(LDAP_MGR_PASSWORD_ALIAS) } sorted_x = sorted(ldap_properties_map.iteritems(), key=operator.itemgetter(0)) sorted_y = sorted(update_properties_method.call_args[0][1].iteritems(), key=operator.itemgetter(0)) sys.stdout = sys.__stdout__ pass @patch("urllib2.urlopen") @patch("ambari_server.setupSecurity.get_validated_string_input") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.is_server_runing") @patch("ambari_server.setupSecurity.is_root") def test_ldap_sync_all(self, is_root_method, is_server_runing_mock, get_ambari_properties_mock, get_validated_string_input_mock, urlopen_mock): is_root_method.return_value = True is_server_runing_mock.return_value = (True, 0) properties = Properties() properties.process_pair(IS_LDAP_CONFIGURED, 'true') properties.process_pair(CLIENT_API_PORT_PROPERTY, '8080') get_ambari_properties_mock.return_value = properties get_validated_string_input_mock.side_effect = ['admin', 'admin'] response = MagicMock() response.getcode.side_effect = [201, 200, 200] response.read.side_effect = ['{"resources" : [{"href" : "http://c6401.ambari.apache.org:8080/api/v1/ldap_sync_events/16","Event" : {"id" : 16}}]}', '{"Event":{"status" : "RUNNING","summary" : {"groups" : {"created" : 0,"removed" : 0,"updated" : 0},"memberships" : {"created" : 0,"removed" : 0},"users" : {"created" : 0,"removed" : 0,"updated" : 0}}}}', '{"Event":{"status" : "COMPLETE","summary" : {"groups" : {"created" : 1,"removed" : 0,"updated" : 0},"memberships" : {"created" : 5,"removed" : 0},"users" : {"created" : 5,"removed" : 0,"updated" : 0}}}}'] urlopen_mock.return_value = response options = MagicMock() options.ldap_sync_all = True options.ldap_sync_existing = False options.ldap_sync_users = None options.ldap_sync_groups = None sync_ldap(options) url = '{0}://{1}:{2!s}{3}'.format('http', '127.0.0.1', '8080', '/api/v1/ldap_sync_events') request = urlopen_mock.call_args_list[0][0][0] self.assertEquals(url, str(request.get_full_url())) self.assertEquals('[{"Event": {"specs": [{"principal_type": "users", "sync_type": "all"}, {"principal_type": "groups", "sync_type": "all"}]}}]', request.data) self.assertTrue(response.getcode.called) self.assertTrue(response.read.called) pass @patch("__builtin__.open") @patch("os.path.exists") @patch("urllib2.urlopen") @patch("ambari_server.setupSecurity.get_validated_string_input") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.is_server_runing") @patch("ambari_server.setupSecurity.is_root") def test_ldap_sync_users(self, is_root_method, is_server_runing_mock, get_ambari_properties_mock, get_validated_string_input_mock, urlopen_mock, os_path_exists_mock, open_mock): os_path_exists_mock.return_value = 1 f = MagicMock() f.__enter__().read.return_value = "bob, tom" open_mock.return_value = f is_root_method.return_value = True is_server_runing_mock.return_value = (True, 0) properties = Properties() properties.process_pair(IS_LDAP_CONFIGURED, 'true') get_ambari_properties_mock.return_value = properties get_validated_string_input_mock.side_effect = ['admin', 'admin'] response = MagicMock() response.getcode.side_effect = [201, 200, 200] response.read.side_effect = ['{"resources" : [{"href" : "http://c6401.ambari.apache.org:8080/api/v1/ldap_sync_events/16","Event" : {"id" : 16}}]}', '{"Event":{"status" : "RUNNING","summary" : {"groups" : {"created" : 0,"removed" : 0,"updated" : 0},"memberships" : {"created" : 0,"removed" : 0},"users" : {"created" : 0,"removed" : 0,"updated" : 0}}}}', '{"Event":{"status" : "COMPLETE","summary" : {"groups" : {"created" : 1,"removed" : 0,"updated" : 0},"memberships" : {"created" : 5,"removed" : 0},"users" : {"created" : 5,"removed" : 0,"updated" : 0}}}}'] urlopen_mock.return_value = response options = MagicMock() options.ldap_sync_all = False options.ldap_sync_existing = False options.ldap_sync_users = 'users.txt' options.ldap_sync_groups = None sync_ldap(options) request = urlopen_mock.call_args_list[0][0][0] self.assertEquals('[{"Event": {"specs": [{"principal_type": "users", "sync_type": "specific", "names": "bob, tom"}]}}]', request.data) self.assertTrue(response.getcode.called) self.assertTrue(response.read.called) pass @patch("__builtin__.open") @patch("os.path.exists") @patch("urllib2.urlopen") @patch("ambari_server.setupSecurity.get_validated_string_input") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.is_server_runing") @patch("ambari_server.setupSecurity.is_root") def test_ldap_sync_groups(self, is_root_method, is_server_runing_mock, get_ambari_properties_mock, get_validated_string_input_mock, urlopen_mock, os_path_exists_mock, open_mock): os_path_exists_mock.return_value = 1 f = MagicMock() f.__enter__().read.return_value = "group1, group2" open_mock.return_value = f is_root_method.return_value = True is_server_runing_mock.return_value = (True, 0) properties = Properties() properties.process_pair(IS_LDAP_CONFIGURED, 'true') get_ambari_properties_mock.return_value = properties get_validated_string_input_mock.side_effect = ['admin', 'admin'] response = MagicMock() response.getcode.side_effect = [201, 200, 200] response.read.side_effect = ['{"resources" : [{"href" : "http://c6401.ambari.apache.org:8080/api/v1/ldap_sync_events/16","Event" : {"id" : 16}}]}', '{"Event":{"status" : "RUNNING","summary" : {"groups" : {"created" : 0,"removed" : 0,"updated" : 0},"memberships" : {"created" : 0,"removed" : 0},"users" : {"created" : 0,"removed" : 0,"updated" : 0}}}}', '{"Event":{"status" : "COMPLETE","summary" : {"groups" : {"created" : 1,"removed" : 0,"updated" : 0},"memberships" : {"created" : 5,"removed" : 0},"users" : {"created" : 5,"removed" : 0,"updated" : 0}}}}'] urlopen_mock.return_value = response options = MagicMock() options.ldap_sync_all = False options.ldap_sync_existing = False options.ldap_sync_users = None options.ldap_sync_groups = 'groups.txt' sync_ldap(options) request = urlopen_mock.call_args_list[0][0][0] self.assertEquals('[{"Event": {"specs": [{"principal_type": "groups", "sync_type": "specific", "names": "group1, group2"}]}}]', request.data) self.assertTrue(response.getcode.called) self.assertTrue(response.read.called) pass @patch("urllib2.urlopen") @patch("ambari_server.setupSecurity.get_validated_string_input") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.is_server_runing") @patch("ambari_server.setupSecurity.is_root") def test_ldap_sync_ssl(self, is_root_method, is_server_runing_mock, get_ambari_properties_mock, get_validated_string_input_mock, urlopen_mock): is_root_method.return_value = True is_server_runing_mock.return_value = (True, 0) properties = Properties() properties.process_pair(IS_LDAP_CONFIGURED, 'true') properties.process_pair(SSL_API, 'true') properties.process_pair(SSL_API_PORT, '8443') get_ambari_properties_mock.return_value = properties get_validated_string_input_mock.side_effect = ['admin', 'admin'] response = MagicMock() response.getcode.side_effect = [201, 200, 200] response.read.side_effect = ['{"resources" : [{"href" : "https://c6401.ambari.apache.org:8443/api/v1/ldap_sync_events/16","Event" : {"id" : 16}}]}', '{"Event":{"status" : "RUNNING","summary" : {"groups" : {"created" : 0,"removed" : 0,"updated" : 0},"memberships" : {"created" : 0,"removed" : 0},"users" : {"created" : 0,"removed" : 0,"updated" : 0}}}}', '{"Event":{"status" : "COMPLETE","summary" : {"groups" : {"created" : 1,"removed" : 0,"updated" : 0},"memberships" : {"created" : 5,"removed" : 0},"users" : {"created" : 5,"removed" : 0,"updated" : 0}}}}'] urlopen_mock.return_value = response options = MagicMock() options.ldap_sync_all = True options.ldap_sync_existing = False options.ldap_sync_users = None options.ldap_sync_groups = None sync_ldap(options) url = '{0}://{1}:{2!s}{3}'.format('https', '127.0.0.1', '8443', '/api/v1/ldap_sync_events') request = urlopen_mock.call_args_list[0][0][0] self.assertEquals(url, str(request.get_full_url())) self.assertTrue(response.getcode.called) self.assertTrue(response.read.called) pass @patch("urllib2.urlopen") @patch("ambari_server.setupSecurity.get_validated_string_input") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.is_server_runing") @patch("ambari_server.setupSecurity.is_root") def test_ldap_sync_existing(self, is_root_method, is_server_runing_mock, get_ambari_properties_mock, get_validated_string_input_mock, urlopen_mock): is_root_method.return_value = True is_server_runing_mock.return_value = (True, 0) properties = Properties() properties.process_pair(IS_LDAP_CONFIGURED, 'true') get_ambari_properties_mock.return_value = properties get_validated_string_input_mock.side_effect = ['admin', 'admin'] response = MagicMock() response.getcode.side_effect = [201, 200, 200] response.read.side_effect = ['{"resources" : [{"href" : "http://c6401.ambari.apache.org:8080/api/v1/ldap_sync_events/16","Event" : {"id" : 16}}]}', '{"Event":{"status" : "RUNNING","summary" : {"groups" : {"created" : 0,"removed" : 0,"updated" : 0},"memberships" : {"created" : 0,"removed" : 0},"users" : {"created" : 0,"removed" : 0,"updated" : 0}}}}', '{"Event":{"status" : "COMPLETE","summary" : {"groups" : {"created" : 1,"removed" : 0,"updated" : 0},"memberships" : {"created" : 5,"removed" : 0},"users" : {"created" : 5,"removed" : 0,"updated" : 0}}}}'] urlopen_mock.return_value = response options = MagicMock() options.ldap_sync_all = False options.ldap_sync_existing = True options.ldap_sync_users = None options.ldap_sync_groups = None sync_ldap(options) self.assertTrue(response.getcode.called) self.assertTrue(response.read.called) pass @patch("urllib2.urlopen") @patch("ambari_server.setupSecurity.get_validated_string_input") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.is_server_runing") @patch("ambari_server.setupSecurity.is_root") def test_ldap_sync_no_sync_mode(self, is_root_method, is_server_runing_mock, get_ambari_properties_mock, get_validated_string_input_mock, urlopen_mock): is_root_method.return_value = True is_server_runing_mock.return_value = (True, 0) properties = Properties() properties.process_pair(IS_LDAP_CONFIGURED, 'true') get_ambari_properties_mock.return_value = properties get_validated_string_input_mock.side_effect = ['admin', 'admin'] response = MagicMock() response.getcode.side_effect = [201, 200, 200] response.read.side_effect = ['{"resources" : [{"href" : "http://c6401.ambari.apache.org:8080/api/v1/ldap_sync_events/16","Event" : {"id" : 16}}]}', '{"Event":{"status" : "RUNNING","summary" : {"groups" : {"created" : 0,"removed" : 0,"updated" : 0},"memberships" : {"created" : 0,"removed" : 0},"users" : {"created" : 0,"removed" : 0,"updated" : 0}}}}', '{"Event":{"status" : "COMPLETE","summary" : {"groups" : {"created" : 1,"removed" : 0,"updated" : 0},"memberships" : {"created" : 5,"removed" : 0},"users" : {"created" : 5,"removed" : 0,"updated" : 0}}}}'] urlopen_mock.return_value = response options = MagicMock() del options.ldap_sync_all del options.ldap_sync_existing del options.ldap_sync_users del options.ldap_sync_groups try: sync_ldap(options) self.fail("Should fail with exception") except FatalException as e: pass pass @patch("urllib2.urlopen") @patch("ambari_server.setupSecurity.get_validated_string_input") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.is_server_runing") @patch("ambari_server.setupSecurity.is_root") def test_ldap_sync_error_status(self, is_root_method, is_server_runing_mock, get_ambari_properties_mock, get_validated_string_input_mock, urlopen_mock): is_root_method.return_value = True is_server_runing_mock.return_value = (True, 0) properties = Properties() properties.process_pair(IS_LDAP_CONFIGURED, 'true') get_ambari_properties_mock.return_value = properties get_validated_string_input_mock.side_effect = ['admin', 'admin'] response = MagicMock() response.getcode.side_effect = [201, 200] response.read.side_effect = ['{"resources" : [{"href" : "http://c6401.ambari.apache.org:8080/api/v1/ldap_sync_events/16","Event" : {"id" : 16}}]}', '{"Event":{"status" : "ERROR","status_detail" : "Error!!","summary" : {"groups" : {"created" : 0,"removed" : 0,"updated" : 0},"memberships" : {"created" : 0,"removed" : 0},"users" : {"created" : 0,"removed" : 0,"updated" : 0}}}}'] urlopen_mock.return_value = response options = MagicMock() options.ldap_sync_all = False options.ldap_sync_existing = False options.ldap_sync_users = None options.ldap_sync_groups = None try: sync_ldap(options) self.fail("Should fail with exception") except FatalException as e: pass pass @patch("urllib2.urlopen") @patch("urllib2.Request") @patch("base64.encodestring") @patch("ambari_server.setupSecurity.is_root") @patch("ambari_server.setupSecurity.is_server_runing") @patch("ambari_server.setupSecurity.get_ambari_properties") @patch("ambari_server.setupSecurity.get_validated_string_input") def test_sync_ldap_forbidden(self, get_validated_string_input_method, get_ambari_properties_method, is_server_runing_method, is_root_method, encodestring_method, request_constructor, urlopen_method): options = MagicMock() options.ldap_sync_all = True options.ldap_sync_existing = False options.ldap_sync_users = None options.ldap_sync_groups = None is_root_method.return_value = False try: sync_ldap(options) self.fail("Should throw exception if not root") except FatalException as fe: # Expected self.assertTrue("root-level" in fe.reason) pass is_root_method.return_value = True is_server_runing_method.return_value = (None, None) try: sync_ldap(options) self.fail("Should throw exception if ambari is stopped") except FatalException as fe: # Expected self.assertTrue("not running" in fe.reason) pass is_server_runing_method.return_value = (True, None) configs = MagicMock() configs.get_property.return_value = None get_ambari_properties_method.return_value = configs try: sync_ldap(options) self.fail("Should throw exception if ldap is not configured") except FatalException as fe: # Expected self.assertTrue("not configured" in fe.reason) pass configs.get_property.return_value = 'true' get_validated_string_input_method.return_value = 'admin' encodestring_method.return_value = 'qwe123' requestMocks = [MagicMock()] request_constructor.side_effect = requestMocks response = MagicMock() response.getcode.return_value = 403 urlopen_method.return_value = response try: sync_ldap(options) self.fail("Should throw exception if return code != 200") except FatalException as fe: # Expected self.assertTrue("status code" in fe.reason) pass pass @patch("ambari_server.setupSecurity.is_root") def test_sync_ldap_ambari_stopped(self, is_root_method): is_root_method.return_value = False options = MagicMock() options.ldap_sync_all = True options.ldap_sync_existing = False options.ldap_sync_users = None options.ldap_sync_groups = None try: sync_ldap(options) self.fail("Should throw exception if not root") except FatalException as fe: # Expected self.assertTrue("root-level" in fe.reason) pass pass @patch("ambari_server.setupSecurity.is_root") @patch("ambari_server.setupSecurity.is_server_runing") def test_sync_ldap_ambari_stopped(self, is_server_runing_method, is_root_method): is_root_method.return_value = True is_server_runing_method.return_value = (None, None) options = MagicMock() options.ldap_sync_all = True options.ldap_sync_existing = False options.ldap_sync_users = None options.ldap_sync_groups = None try: sync_ldap(options) self.fail("Should throw exception if ambari is stopped") except FatalException as fe: # Expected self.assertTrue("not running" in fe.reason) pass pass @patch("ambari_server.setupSecurity.is_root") @patch("ambari_server.setupSecurity.is_server_runing") @patch("ambari_server.setupSecurity.get_ambari_properties") def test_sync_ldap_not_configured(self, get_ambari_properties_method, is_server_runing_method, is_root_method): is_root_method.return_value = True is_server_runing_method.return_value = (True, None) configs = MagicMock() configs.get_property.return_value = None get_ambari_properties_method.return_value = configs options = MagicMock() options.ldap_sync_all = True del options.ldap_sync_existing del options.ldap_sync_users del options.ldap_sync_groups try: sync_ldap(options) self.fail("Should throw exception if ldap is not configured") except FatalException as fe: # Expected self.assertTrue("not configured" in fe.reason) pass pass @patch("__builtin__.open") @patch("os.path.exists") def test_get_ldap_event_spec_names(self, os_path_exists_mock, open_mock): os_path_exists_mock.return_value = 1 f = MagicMock() f.__enter__().read.return_value = "\n\n\t some group, \tanother group, \n\t\tgrp, \ngroup*\n\n\n\n" open_mock.return_value = f bodies = [{"Event":{"specs":[]}}] body = bodies[0] events = body['Event'] specs = events['specs'] new_specs = [{"principal_type":"groups","sync_type":"specific","names":""}] get_ldap_event_spec_names("groups.txt", specs, new_specs) self.assertEquals("[{'Event': {'specs': [{'principal_type': 'groups', 'sync_type': 'specific', 'names': ' some group, another group, grp, group*'}]}}]", str(bodies)) pass @patch("ambari_server.setupSecurity.read_password") def test_configure_ldap_password(self, read_password_method): out = StringIO.StringIO() sys.stdout = out read_password_method.return_value = "blah" configure_ldap_password() self.assertTrue(read_password_method.called) sys.stdout = sys.__stdout__ pass @patch("ambari_server.userInput.get_validated_string_input") def test_read_password(self, get_validated_string_input_method): out = StringIO.StringIO() sys.stdout = out passwordDefault = "" passwordPrompt = 'Enter Manager Password* : ' passwordPattern = ".*" passwordDescr = "Invalid characters in password." get_validated_string_input_method.side_effect = ['', 'aaa', 'aaa'] password = read_password(passwordDefault, passwordPattern, passwordPrompt, passwordDescr) self.assertTrue(3, get_validated_string_input_method.call_count) self.assertEquals('aaa', password) get_validated_string_input_method.reset_mock() get_validated_string_input_method.side_effect = ['aaa', 'aaa'] password = read_password(passwordDefault, passwordPattern, passwordPrompt, passwordDescr) self.assertTrue(2, get_validated_string_input_method.call_count) self.assertEquals('aaa', password) get_validated_string_input_method.reset_mock() get_validated_string_input_method.side_effect = ['aaa'] password = read_password('aaa', passwordPattern, passwordPrompt, passwordDescr) self.assertTrue(1, get_validated_string_input_method.call_count) self.assertEquals('aaa', password) sys.stdout = sys.__stdout__ pass def test_generate_random_string(self): random_str_len = 100 str1 = generate_random_string(random_str_len) self.assertTrue(len(str1) == random_str_len) str2 = generate_random_string(random_str_len) self.assertTrue(str1 != str2) pass @patch("__builtin__.open") @patch("ambari_server.serverConfiguration.search_file") @patch("ambari_server.serverConfiguration.backup_file_in_temp") def test_update_properties_2(self, backup_file_in_temp_mock, search_file_mock, open_mock): conf_file = "ambari.properties" propertyMap = {"1": "1", "2": "2"} properties = MagicMock() f = MagicMock(name="file") # f.__enter__.return_value = f #mimic file behavior search_file_mock.return_value = conf_file open_mock.return_value = f update_properties_2(properties, propertyMap) properties.store_ordered.assert_called_with(f.__enter__.return_value) backup_file_in_temp_mock.assert_called_with(conf_file) self.assertEquals(2, properties.removeOldProp.call_count) self.assertEquals(2, properties.process_pair.call_count) properties = MagicMock() backup_file_in_temp_mock.reset_mock() open_mock.reset_mock() update_properties_2(properties, None) properties.store_ordered.assert_called_with(f.__enter__.return_value) backup_file_in_temp_mock.assert_called_with(conf_file) self.assertFalse(properties.removeOldProp.called) self.assertFalse(properties.process_pair.called) pass def test_regexps(self): res = re.search(REGEX_HOSTNAME_PORT, "") self.assertTrue(res is None) res = re.search(REGEX_HOSTNAME_PORT, "ddd") self.assertTrue(res is None) res = re.search(REGEX_HOSTNAME_PORT, "gg:ff") self.assertTrue(res is None) res = re.search(REGEX_HOSTNAME_PORT, "gg:55444325") self.assertTrue(res is None) res = re.search(REGEX_HOSTNAME_PORT, "gg:555") self.assertTrue(res is not None) res = re.search(REGEX_TRUE_FALSE, "") self.assertTrue(res is not None) res = re.search(REGEX_TRUE_FALSE, "t") self.assertTrue(res is None) res = re.search(REGEX_TRUE_FALSE, "trrrr") self.assertTrue(res is None) res = re.search(REGEX_TRUE_FALSE, "true|false") self.assertTrue(res is None) res = re.search(REGEX_TRUE_FALSE, "true") self.assertTrue(res is not None) res = re.search(REGEX_TRUE_FALSE, "false") self.assertTrue(res is not None) res = re.search(REGEX_ANYTHING, "") self.assertTrue(res is not None) res = re.search(REGEX_ANYTHING, "t") self.assertTrue(res is not None) res = re.search(REGEX_ANYTHING, "trrrr") self.assertTrue(res is not None) pass def get_sample(self, sample): """ Returns sample file content as string with normalized line endings """ path = self.get_samples_dir(sample) return self.get_file_string(path) def get_file_string(self, file): """ Returns file content as string with normalized line endings """ string = open(file, 'r').read() return self.normalize(string) def normalize(self, string): """ Normalizes line ending in string according to platform-default encoding """ return string.replace("\n", os.linesep) def get_samples_dir(self, sample): """ Returns full file path by sample name """ testdir = os.path.dirname(__file__) return os.path.dirname(testdir) + os.sep + "resources" + os.sep \ + 'TestAmbaryServer.samples/' + sample @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.dbConfiguration_linux.get_ambari_properties") def test_is_jdbc_user_changed(self, get_ambari_properties_mock): previous_user = "previous_user" new_user = "new_user" props = Properties() props.process_pair(JDBC_USER_NAME_PROPERTY, previous_user) get_ambari_properties_mock.return_value = props #check if users are different result = PGConfig._is_jdbc_user_changed(new_user) self.assertTrue(result) #check if users are equal result = PGConfig._is_jdbc_user_changed(previous_user) self.assertFalse(result) #check if one of users is None result = PGConfig._is_jdbc_user_changed(None) self.assertEqual(None, result) pass @not_for_platform(PLATFORM_WINDOWS) @patch("ambari_server.serverConfiguration.write_property") @patch("ambari_server.serverConfiguration.get_ambari_properties") @patch("ambari_server.serverConfiguration.get_ambari_version") def test_check_database_name_property(self, get_ambari_version_mock, get_ambari_properties_mock, write_property_mock): parser = OptionParser() parser.add_option('--database', default=None, help="Database to use embedded|oracle|mysql|mssql|postgres", dest="dbms") args = parser.parse_args() # negative case get_ambari_properties_mock.return_value = {JDBC_DATABASE_NAME_PROPERTY: ""} try: result = check_database_name_property() self.fail("Should fail with exception") except FatalException as e: self.assertTrue('DB Name property not set in config file.' in e.reason) # positive case dbname = "ambari" get_ambari_properties_mock.reset_mock() get_ambari_properties_mock.return_value = {JDBC_DATABASE_NAME_PROPERTY: dbname} try: result = check_database_name_property() except FatalException: self.fail("Setup should be successful") # Check upgrade. In Ambari < 1.7.1 "database" property contained db name for local db dbname = "ambari" database = "ambari" persistence = "local" get_ambari_properties_mock.reset_mock() get_ambari_properties_mock.return_value = {JDBC_DATABASE_NAME_PROPERTY: dbname, JDBC_DATABASE_PROPERTY: database, PERSISTENCE_TYPE_PROPERTY: persistence} try: result = check_database_name_property(upgrade=True) except FatalException: self.fail("Setup should be successful") self.assertTrue(write_property_mock.called) @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_commons.firewall.run_os_command") @patch("ambari_server.dbConfiguration_linux.PGConfig._is_jdbc_user_changed") @patch("ambari_server.serverSetup.verify_setup_allowed") @patch("ambari_server.serverSetup.get_YN_input") @patch("ambari_server.serverSetup.configure_os_settings") @patch("ambari_server.serverSetup.download_and_install_jdk") @patch.object(PGConfig, "_configure_postgres") @patch.object(PGConfig, "_check_postgre_up") @patch("ambari_server.serverSetup.check_ambari_user") @patch("ambari_server.serverSetup.check_jdbc_drivers") @patch("ambari_server.serverSetup.check_selinux") @patch("ambari_server.serverSetup.is_root") @patch.object(PGConfig, "_setup_db") @patch("ambari_server.serverSetup.get_is_secure") @patch("ambari_server.dbConfiguration_linux.store_password_file") @patch("ambari_server.serverSetup.extract_views") @patch("ambari_server.serverSetup.adjust_directory_permissions") @patch("sys.exit") @patch("__builtin__.raw_input") @patch("ambari_server.serverSetup.expand_jce_zip_file") def test_ambariServerSetupWithCustomDbName(self, expand_jce_zip_file_mock, raw_input, exit_mock, adjust_dirs_mock, extract_views_mock, store_password_file_mock, get_is_secure_mock, setup_db_mock, is_root_mock, #is_local_database_mock, check_selinux_mock, check_jdbc_drivers_mock, check_ambari_user_mock, check_postgre_up_mock, configure_postgres_mock, download_jdk_mock, configure_os_settings_mock, get_YN_input, verify_setup_allowed_method, is_jdbc_user_changed_mock, run_os_command_mock): args = MagicMock() raw_input.return_value = "" get_YN_input.return_value = False verify_setup_allowed_method.return_value = 0 is_root_mock.return_value = True check_selinux_mock.return_value = 0 check_ambari_user_mock.return_value = (0, False, 'user', None) check_jdbc_drivers_mock.return_value = 0 check_postgre_up_mock.return_value = "running", 0, "", "" #is_local_database_mock.return_value = True configure_postgres_mock.return_value = 0, "", "" download_jdk_mock.return_value = 0 configure_os_settings_mock.return_value = 0 is_jdbc_user_changed_mock.return_value = False setup_db_mock.return_value = (0, None, None) get_is_secure_mock.return_value = False store_password_file_mock.return_value = "password" extract_views_mock.return_value = 0 run_os_command_mock.return_value = 3,"","" new_db = "newDBName" args.dbms = "postgres" args.database_name = new_db args.postgres_schema = new_db args.database_username = "user" args.database_password = "password" args.jdbc_driver= None args.jdbc_db = None args.must_set_database_options = True del args.database_index del args.persistence_type tempdir = tempfile.gettempdir() prop_file = os.path.join(tempdir, "ambari.properties") with open(prop_file, "w") as f: f.write("server.jdbc.database_name=oldDBName") f.close() os.environ[AMBARI_CONF_VAR] = tempdir try: result = setup(args) except FatalException as ex: self.fail("Setup should be successful") properties = get_ambari_properties() self.assertTrue(JDBC_DATABASE_NAME_PROPERTY in properties.keys()) value = properties[JDBC_DATABASE_NAME_PROPERTY] self.assertEqual(value, new_db) del os.environ[AMBARI_CONF_VAR] os.remove(prop_file) pass @only_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.serverSetup.service_setup") @patch("ambari_server.dbConfiguration_windows.MSSQLConfig._execute_db_script") @patch("ambari_server.dbConfiguration_windows.store_password_file") @patch("ambari_server.dbConfiguration_windows.MSSQLConfig._is_jdbc_driver_installed") @patch("ambari_server.serverSetup.verify_setup_allowed") @patch("ambari_server.serverSetup.get_YN_input") @patch("ambari_server.serverSetup.configure_os_settings") @patch("ambari_server.serverSetup.download_and_install_jdk") @patch("ambari_server.serverSetup.check_firewall") @patch("ambari_server.serverSetup.check_ambari_user") @patch("ambari_server.serverSetup.check_jdbc_drivers") @patch("ambari_server.serverSetup.is_root") @patch("ambari_server.serverSetup.extract_views") @patch("ambari_server.serverSetup.adjust_directory_permissions") def test_ambariServerSetupWithCustomDbName(self, adjust_dirs_mock, extract_views_mock, is_root_mock, check_jdbc_drivers_mock, check_ambari_user_mock, check_firewall_mock, download_jdk_mock, configure_os_settings_mock, get_YN_input, verify_setup_allowed_method, is_jdbc_driver_installed_mock, store_password_file_mock, execute_db_script_mock, service_setup_mock): args = MagicMock() get_YN_input.return_value = False verify_setup_allowed_method.return_value = 0 is_root_mock.return_value = True check_ambari_user_mock.return_value = (0, False, 'user', None) check_jdbc_drivers_mock.return_value = 0 download_jdk_mock.return_value = 0 configure_os_settings_mock.return_value = 0 is_jdbc_driver_installed_mock.return_value = True store_password_file_mock.return_value = "password.dat" extract_views_mock.return_value = 0 new_db = "newDBName" del args.dbms del args.database_index del args.database_host del args.database_port args.database_name = new_db args.database_username = "user" args.database_password = "password" del args.database_windows_auth args.jdbc_driver= None args.jdbc_db = None args.must_set_database_options = True del args.default_database_host del args.persistence_type del args.init_db_script_file del args.cleanup_db_script_file tempdir = tempfile.gettempdir() prop_file = os.path.join(tempdir, "ambari.properties") with open(prop_file, "w") as f: f.write("server.jdbc.database_name=oldDBName") f.close() os.environ[AMBARI_CONF_VAR] = tempdir try: result = setup(args) except FatalException as ex: self.fail("Setup should be successful") properties = get_ambari_properties() self.assertTrue(JDBC_DATABASE_NAME_PROPERTY in properties.keys()) value = properties[JDBC_DATABASE_NAME_PROPERTY] self.assertEqual(value, new_db) self.assertEqual(store_password_file_mock.call_count, 2) self.assertEqual(execute_db_script_mock.call_count, 2) del os.environ[AMBARI_CONF_VAR] os.remove(prop_file) pass def test_is_valid_filepath(self): temp_dir = tempfile.gettempdir() temp_file = tempfile.NamedTemporaryFile(mode='r') # Correct path to an existing file self.assertTrue(temp_file) # Correct path to an existing directory self.assertFalse(is_valid_filepath(temp_dir), \ 'is_valid_filepath(path) should return False is path is a directory') # Incorrect path self.assertFalse(is_valid_filepath('')) pass @patch("os.listdir") @patch("os.path.exists") @patch("ambari_server.serverUpgrade.load_stack_values") @patch("ambari_server.serverUpgrade.get_ambari_properties") @patch("ambari_server.serverUpgrade.run_metainfo_upgrade") def test_upgrade_local_repo(self, run_metainfo_upgrade_mock, get_ambari_properties_mock, load_stack_values_mock, os_path_exists_mock, os_listdir_mock): from mock.mock import call args = MagicMock() args.persistence_type = "local" def load_values_side_effect(*args, **kwargs): res = {} res['a'] = 'http://oldurl' if -1 != args[1].find("HDPLocal"): res['a'] = 'http://newurl' return res load_stack_values_mock.side_effect = load_values_side_effect properties = Properties() get_ambari_properties_mock.return_value = properties os_path_exists_mock.return_value = 1 os_listdir_mock.return_value = ['1.1'] upgrade_local_repo(args) self.assertTrue(get_ambari_properties_mock.called) self.assertTrue(load_stack_values_mock.called) self.assertTrue(run_metainfo_upgrade_mock.called) run_metainfo_upgrade_mock.assert_called_with({'a': 'http://newurl'}) pass @patch("os.listdir") @patch("os.path.exists") @patch("ambari_server.serverUpgrade.load_stack_values") @patch("ambari_server.serverUpgrade.get_ambari_properties") @patch("ambari_server.serverUpgrade.run_metainfo_upgrade") def test_upgrade_local_repo_nochange(self, run_metainfo_upgrade_mock, get_ambari_properties_mock, load_stack_values_mock, os_path_exists_mock, os_listdir_mock): from mock.mock import call args = MagicMock() args.persistence_type = "local" def load_values_side_effect(*args, **kwargs): res = {} res['a'] = 'http://oldurl' return res load_stack_values_mock.side_effect = load_values_side_effect properties = Properties() get_ambari_properties_mock.return_value = properties os_path_exists_mock.return_value = 1 os_listdir_mock.return_value = ['1.1'] upgrade_local_repo(args) self.assertTrue(get_ambari_properties_mock.called) self.assertTrue(load_stack_values_mock.called) self.assertTrue(run_metainfo_upgrade_mock.called) run_metainfo_upgrade_mock.assert_called_with({}) pass @patch("os.path.exists") @patch.object(ResourceFilesKeeper, "perform_housekeeping") def test_refresh_stack_hash(self, perform_housekeeping_mock, path_exists_mock): path_exists_mock.return_value = True properties = Properties() refresh_stack_hash(properties) self.assertTrue(perform_housekeeping_mock.called) pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.dbConfiguration_linux.run_os_command") @patch("ambari_server.dbConfiguration_linux.print_error_msg") def test_change_objects_owner_both(self, print_error_msg_mock, run_os_command_mock): args = MagicMock() args.master_key = None del args.database_index del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.persistence_type stdout = " stdout " stderr = " stderr " run_os_command_mock.return_value = 1, stdout, stderr set_verbose(True) self.assertRaises(FatalException, change_objects_owner, args) print_error_msg_mock.assert_any_call("stderr:\nstderr") print_error_msg_mock.assert_any_call("stdout:\nstdout") pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.dbConfiguration_linux.run_os_command") @patch("ambari_server.dbConfiguration_linux.print_error_msg") def test_change_objects_owner_only_stdout(self, print_error_msg_mock, run_os_command_mock): args = MagicMock() del args.database_index del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.persistence_type stdout = " stdout " stderr = "" run_os_command_mock.return_value = 1, stdout, stderr set_verbose(True) self.assertRaises(FatalException, change_objects_owner, args) print_error_msg_mock.assert_called_once_with("stdout:\nstdout") pass @not_for_platform(PLATFORM_WINDOWS) @patch.object(OSCheck, "os_distribution", new = MagicMock(return_value = os_distro_value)) @patch("ambari_server.dbConfiguration_linux.run_os_command") @patch("ambari_server.dbConfiguration_linux.print_error_msg") def test_change_objects_owner_only_stderr(self, print_error_msg_mock, run_os_command_mock): args = MagicMock() del args.database_index del args.dbms del args.database_host del args.database_port del args.database_name del args.database_username del args.database_password del args.persistence_type stdout = "" stderr = " stderr " run_os_command_mock.return_value = 1, stdout, stderr set_verbose(True) self.assertRaises(FatalException, change_objects_owner, args) print_error_msg_mock.assert_called_once_with("stderr:\nstderr") pass

38.357632

256

0.716026

e711398ea4e871a318346faf850e72c2d78ad99d

632

py

Python

src/z3c/objpath/tests.py

zopefoundation/z3c.objpath

bc4947b105a6851d06d09a205f8fffcb8088507f

[ "ZPL-2.1" ]

1

2021-03-05T17:27:29.000Z

src/z3c/objpath/tests.py

zopefoundation/z3c.objpath

bc4947b105a6851d06d09a205f8fffcb8088507f

[ "ZPL-2.1" ]

5

2018-03-12T17:28:42.000Z

2021-09-21T06:16:30.000Z

src/z3c/objpath/tests.py

zopefoundation/z3c.objpath

bc4947b105a6851d06d09a205f8fffcb8088507f

[ "ZPL-2.1" ]

null

from zope.interface.verify import verifyObject import doctest import unittest class ObjectPathTests(unittest.TestCase): """Testing .path.*""" def test_module_provides_interface(self): from .interfaces import IObjectPath from . import _path self.assertTrue(verifyObject(IObjectPath, _path)) def test_suite(): optionflags = ( doctest.ELLIPSIS | doctest.REPORT_NDIFF | doctest.NORMALIZE_WHITESPACE ) return unittest.TestSuite([ unittest.makeSuite(ObjectPathTests), doctest.DocFileSuite( 'README.rst', optionflags=optionflags) ])

23.407407

57

0.68038

c4f12b4bf90aa328a2e7eaf42e80c231ec54ab36

3,505

py

Python

python/tink/integration/gcpkms/_gcp_kms_aead_test.py

szaydel/tink

e231fe638eb1f1ed8f1d45cc665ee98736c781d6

[ "Apache-2.0" ]

null

python/tink/integration/gcpkms/_gcp_kms_aead_test.py

szaydel/tink

e231fe638eb1f1ed8f1d45cc665ee98736c781d6

[ "Apache-2.0" ]

null

python/tink/integration/gcpkms/_gcp_kms_aead_test.py

szaydel/tink

e231fe638eb1f1ed8f1d45cc665ee98736c781d6

[ "Apache-2.0" ]

null

# Copyright 2019 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Tests for tink.python.tink.integration.gcp_kms_aead.""" import os from absl.testing import absltest from tink import core from tink.integration import gcpkms from tink.testing import helper CREDENTIAL_PATH = os.path.join(helper.tink_root_path(), 'testdata/credential.json') KEY_URI = 'gcp-kms://projects/tink-test-infrastructure/locations/global/keyRings/unit-and-integration-testing/cryptoKeys/aead-key' LOCAL_KEY_URI = 'gcp-kms://projects/tink-test-infrastructure/locations/europe-west1/keyRings/unit-and-integration-test/cryptoKeys/aead-key' BAD_KEY_URI = 'aws-kms://arn:aws:kms:us-east-2:235739564943:key/3ee50705-5a82-4f5b-9753-05c4f473922f' if 'TEST_SRCDIR' in os.environ: # Set root certificates for gRPC in Bazel Test which are needed on MacOS os.environ['GRPC_DEFAULT_SSL_ROOTS_FILE_PATH'] = os.path.join( os.environ['TEST_SRCDIR'], 'google_root_pem/file/downloaded') class GcpKmsAeadTest(absltest.TestCase): def test_encrypt_decrypt(self): gcp_client = gcpkms.GcpKmsClient(KEY_URI, CREDENTIAL_PATH) aead = gcp_client.get_aead(KEY_URI) plaintext = b'helloworld' ciphertext = aead.encrypt(plaintext, b'') self.assertEqual(plaintext, aead.decrypt(ciphertext, b'')) plaintext = b'hello' associated_data = b'world' ciphertext = aead.encrypt(plaintext, associated_data) self.assertEqual(plaintext, aead.decrypt(ciphertext, associated_data)) def test_encrypt_decrypt_localized_uri(self): gcp_client = gcpkms.GcpKmsClient(LOCAL_KEY_URI, CREDENTIAL_PATH) aead = gcp_client.get_aead(LOCAL_KEY_URI) plaintext = b'helloworld' ciphertext = aead.encrypt(plaintext, b'') self.assertEqual(plaintext, aead.decrypt(ciphertext, b'')) plaintext = b'hello' associated_data = b'world' ciphertext = aead.encrypt(plaintext, associated_data) self.assertEqual(plaintext, aead.decrypt(ciphertext, associated_data)) def test_encrypt_with_bad_uri(self): with self.assertRaises(core.TinkError): gcp_client = gcpkms.GcpKmsClient(KEY_URI, CREDENTIAL_PATH) gcp_client.get_aead(BAD_KEY_URI) def test_corrupted_ciphertext(self): gcp_client = gcpkms.GcpKmsClient(KEY_URI, CREDENTIAL_PATH) aead = gcp_client.get_aead(KEY_URI) plaintext = b'helloworld' ciphertext = aead.encrypt(plaintext, b'') self.assertEqual(plaintext, aead.decrypt(ciphertext, b'')) # Corrupt each byte once and check that decryption fails # NOTE: Only starting at 4th byte here, as the 3rd byte is malleable # (see b/146633745). for byte_idx in range(3, len(ciphertext)): tmp_ciphertext = list(ciphertext) tmp_ciphertext[byte_idx] ^= 1 corrupted_ciphertext = bytes(tmp_ciphertext) with self.assertRaises(core.TinkError): aead.decrypt(corrupted_ciphertext, b'') if __name__ == '__main__': # TODO(b/154273145): re-enable this. pass # absltest.main()

38.097826

139

0.74408

8fb74104745e4e194de6e52378c617c2b9ca62ea

5,050

py

Python

m2cgen/assemblers/svm.py

bcampbell-prosper/m2cgen

cc049fe5cd7060c2f0cd5a0331e3aa85fac2a336

[ "MIT" ]

3

2021-06-29T02:43:40.000Z

2022-03-28T07:41:59.000Z

m2cgen/assemblers/svm.py

bcampbell-prosper/m2cgen

cc049fe5cd7060c2f0cd5a0331e3aa85fac2a336

[ "MIT" ]

null

m2cgen/assemblers/svm.py

bcampbell-prosper/m2cgen

cc049fe5cd7060c2f0cd5a0331e3aa85fac2a336

[ "MIT" ]

3

2021-08-06T07:51:37.000Z

2022-03-28T07:41:42.000Z

from m2cgen import ast from m2cgen.assemblers import utils from m2cgen.assemblers.base import ModelAssembler class SVMModelAssembler(ModelAssembler): def __init__(self, model): super().__init__(model) supported_kernels = { "rbf": self._rbf_kernel, "sigmoid": self._sigmoid_kernel, "poly": self._poly_kernel, "linear": self._linear_kernel } kernel_type = model.kernel if kernel_type not in supported_kernels: raise ValueError("Unsupported kernel type {}".format(kernel_type)) self._kernel_fun = supported_kernels[kernel_type] n_features = len(model.support_vectors_[0]) gamma = model.gamma if gamma == "auto" or gamma == "auto_deprecated": gamma = 1.0 / n_features self._gamma_expr = ast.NumVal(gamma) self._neg_gamma_expr = utils.sub(ast.NumVal(0), ast.NumVal(gamma), to_reuse=True) self._output_size = 1 if type(model).__name__ in ("SVC", "NuSVC"): n_classes = len(model.n_support_) if n_classes > 2: self._output_size = n_classes def assemble(self): if self._output_size > 1: return self._assemble_multi_class_output() else: return self._assemble_single_output() def _assemble_single_output(self): support_vectors = self.model.support_vectors_ coef = self.model.dual_coef_[0] intercept = self.model.intercept_[0] kernel_exprs = self._apply_kernel(support_vectors) kernel_weight_mul_ops = [] for index, value in enumerate(coef): kernel_weight_mul_ops.append( utils.mul(kernel_exprs[index], ast.NumVal(value))) return utils.apply_op_to_expressions( ast.BinNumOpType.ADD, ast.NumVal(intercept), *kernel_weight_mul_ops) def _assemble_multi_class_output(self): support_vectors = self.model.support_vectors_ coef = self.model.dual_coef_ intercept = self.model.intercept_ n_support = self.model.n_support_ n_support_len = len(n_support) kernel_exprs = self._apply_kernel(support_vectors, to_reuse=True) support_ranges = [] for i in range(n_support_len): range_start = sum(n_support[:i]) range_end = range_start + n_support[i] support_ranges.append((range_start, range_end)) # One-vs-one decisions. decisions = [] for i in range(n_support_len): for j in range(i + 1, n_support_len): kernel_weight_mul_ops = [ utils.mul(kernel_exprs[k], ast.NumVal(coef[i][k])) for k in range(*support_ranges[j]) ] kernel_weight_mul_ops.extend([ utils.mul(kernel_exprs[k], ast.NumVal(coef[j - 1][k])) for k in range(*support_ranges[i]) ]) decision = utils.apply_op_to_expressions( ast.BinNumOpType.ADD, ast.NumVal(intercept[len(decisions)]), *kernel_weight_mul_ops ) decisions.append(decision) # TODO convert One-vs-one decisions to One-vs-rest return ast.VectorVal(decisions) def _apply_kernel(self, support_vectors, to_reuse=False): kernel_exprs = [] for v in support_vectors: kernel = self._kernel_fun(v) kernel_exprs.append(ast.SubroutineExpr(kernel, to_reuse=to_reuse)) return kernel_exprs def _rbf_kernel(self, support_vector): elem_wise = [ ast.PowExpr( utils.sub(ast.NumVal(support_element), ast.FeatureRef(i)), ast.NumVal(2) ) for i, support_element in enumerate(support_vector) ] kernel = utils.apply_op_to_expressions(ast.BinNumOpType.ADD, *elem_wise) kernel = utils.mul(self._neg_gamma_expr, kernel) return ast.ExpExpr(kernel) def _sigmoid_kernel(self, support_vector): kernel = self._linear_kernel_with_gama_and_coef(support_vector) return ast.TanhExpr(kernel) def _poly_kernel(self, support_vector): kernel = self._linear_kernel_with_gama_and_coef(support_vector) return ast.PowExpr(kernel, ast.NumVal(self.model.degree)) def _linear_kernel(self, support_vector): elem_wise = [ utils.mul(ast.NumVal(support_element), ast.FeatureRef(i)) for i, support_element in enumerate(support_vector) ] return utils.apply_op_to_expressions(ast.BinNumOpType.ADD, *elem_wise) def _linear_kernel_with_gama_and_coef(self, support_vector): kernel = self._linear_kernel(support_vector) kernel = utils.mul(self._gamma_expr, kernel) return utils.add(kernel, ast.NumVal(self.model.coef0))

36.594203

78

0.611485

9c86779fcc28c2dee798286233823a667a8aa9fd

1,828

py

Python

Lib/site-packages/sphinx/environment/collectors/indexentries.py

nemarugommula/ecommerce

60185e79655fbaf0fcad9e877a886fe9eb3c4451

[ "bzip2-1.0.6" ]

3

2020-01-04T16:46:59.000Z

2020-10-09T03:04:31.000Z

Lib/site-packages/sphinx/environment/collectors/indexentries.py

nemarugommula/ecommerce

60185e79655fbaf0fcad9e877a886fe9eb3c4451

[ "bzip2-1.0.6" ]

10

2021-06-16T20:48:32.000Z

2021-10-04T18:22:02.000Z

Lib/site-packages/sphinx/environment/collectors/indexentries.py

nemarugommula/ecommerce

60185e79655fbaf0fcad9e877a886fe9eb3c4451

[ "bzip2-1.0.6" ]

2

2019-11-02T08:03:09.000Z

2020-06-29T14:52:15.000Z

""" sphinx.environment.collectors.indexentries ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ Index entries collector for sphinx.environment. :copyright: Copyright 2007-2019 by the Sphinx team, see AUTHORS. :license: BSD, see LICENSE for details. """ from typing import Any, Dict, Set from docutils import nodes from sphinx import addnodes from sphinx.application import Sphinx from sphinx.environment import BuildEnvironment from sphinx.environment.collectors import EnvironmentCollector from sphinx.util import split_index_msg, logging logger = logging.getLogger(__name__) class IndexEntriesCollector(EnvironmentCollector): name = 'indices' def clear_doc(self, app: Sphinx, env: BuildEnvironment, docname: str) -> None: env.indexentries.pop(docname, None) def merge_other(self, app: Sphinx, env: BuildEnvironment, docnames: Set[str], other: BuildEnvironment) -> None: for docname in docnames: env.indexentries[docname] = other.indexentries[docname] def process_doc(self, app: Sphinx, doctree: nodes.document) -> None: docname = app.env.docname entries = app.env.indexentries[docname] = [] for node in doctree.traverse(addnodes.index): try: for entry in node['entries']: split_index_msg(entry[0], entry[1]) except ValueError as exc: logger.warning(str(exc), location=node) node.parent.remove(node) else: for entry in node['entries']: entries.append(entry) def setup(app: Sphinx) -> Dict[str, Any]: app.add_env_collector(IndexEntriesCollector) return { 'version': 'builtin', 'parallel_read_safe': True, 'parallel_write_safe': True, }

31.517241

82

0.641685

ab705f28ba8114d712a9c43f6a0f9792ddd17d5e

5,779

py

Python

neural_net.py

gioypi/penthy

938566af92b519cb57a7f0f1f22885f4b6a92292

[ "MIT" ]

null

neural_net.py

gioypi/penthy

938566af92b519cb57a7f0f1f22885f4b6a92292

[ "MIT" ]

null

neural_net.py

gioypi/penthy

938566af92b519cb57a7f0f1f22885f4b6a92292

[ "MIT" ]

null

"""Create a Convolutional Neural Network with Keras and train it to tell truly lossless and transcoded audio apart. Build a Keras CNN to evaluate audio compression based on spectograms. Use spectogram images extracted with the audio_manipulation module as a dataset. Save the trained Network, but not the dataset. A network output of '1' corresponds to a spectogram derived from a truly lossless source. An output of '0' corresponds to a spectogram derived from audio transcoded to mp3 and back to a lossless format. Only possible mp3 transcoding is inspected. Even if a file is verified as truly lossless in terms of mp3 transcoding, it could still be upsampled, transcoded from a different format or altered in other ways. """ import audio_manipulation as am import time import wakepy import numpy as np import tensorflow as tf from keras.models import Sequential from keras.layers import Dense, Flatten from keras.layers import Conv2D, MaxPooling2D, Dropout def main(): # Number of samples from the input dataset used in each update within an epoch. BATCH_SIZE = 16 # Number of epochs to train the network. EPOCH_NUM = 50 # Proportion of the input dataset used for validation, instead of training. # Float between 0 and 1. PROP_VALID = 0.06 # Path to the file or directory where the model will be saved after training. MODEL_PATH = "saved_models/trained_penthy" # Check that tensorflow recognizes the GPU. print("Tensorflow GPUs Available: ", len(tf.config.list_physical_devices('GPU'))) wakepy.set_keepawake(keep_screen_awake=False) # Prevent OS from sleeping during long training sessions. print("Extracting spectograms...") start_time = time.monotonic() spect_true = np.array(am.extract_spectogram_from_dir("dataset_files/true_flac_44-16")) in_ds = tf.data.Dataset.from_tensor_slices((spect_true, np.array([1] * spect_true.shape[0]))) # [spect stands for spectogram, trans and transc stand for transcoded] # For the transcoded samples, use various bitrates and compression qualities. trans_list = am.extract_spectogram_from_dir("dataset_files/flac_44-16_transcoded_from_mp3_320") trans_list.extend(am.extract_spectogram_from_dir("dataset_files/flac_44-16_transcoded_from_mp3_128")) trans_list.extend(am.extract_spectogram_from_dir("dataset_files/flac_44-16_transc_from_mp3_320_prime")) spect_trans = np.array(trans_list) temp_ds = tf.data.Dataset.from_tensor_slices((spect_trans, np.array([0] * spect_trans.shape[0]))) in_ds = in_ds.concatenate(temp_ds) end_time = time.monotonic() # Real time passed, not time in CPU/GPU. print("Spectograms ready. Creation duration: %.4f minutes" % ((end_time - start_time) / 60)) # print("Input dataset:", in_ds) # print(list(in_ds.as_numpy_iterator())) print("Preparing dataset...") start_time = time.monotonic() num_elements = spect_true.shape[0] + spect_trans.shape[0] in_ds = in_ds.shuffle(num_elements, reshuffle_each_iteration=False) num_valid = int(num_elements * PROP_VALID) num_train = num_elements - num_valid valid_ds = in_ds.take(num_valid) train_ds = in_ds.skip(num_valid) valid_ds = valid_ds.batch(BATCH_SIZE) train_ds = train_ds.batch(BATCH_SIZE) train_ds = train_ds.shuffle(num_train, reshuffle_each_iteration=True) # Reshuffle after each epoch. end_time = time.monotonic() print("Dataset ready. Preparation duration: %.4f minutes" % ((end_time - start_time) / 60)) print("Dataset size:", num_elements, "samples") print("of which", num_train, "used for training and", num_valid, "used for validation.") print("Creating neural network...") net = Sequential() net.add(Conv2D(10, (3, 3), padding="valid", data_format="channels_last", activation="relu", use_bias=True, input_shape=(am.HEIGHT, am.WIDTH, 3), kernel_initializer="random_normal")) net.add(Conv2D(10, (3, 3), padding="valid", data_format="channels_last", activation="relu", use_bias=True, kernel_initializer="random_normal")) net.add(MaxPooling2D((2, 2), padding="valid", data_format="channels_last")) net.add(Conv2D(8, (3, 3), padding="valid", data_format="channels_last", activation="relu", use_bias=True, kernel_initializer="random_normal")) net.add(Conv2D(8, (3, 3), padding="valid", data_format="channels_last", activation="relu", use_bias=True, kernel_initializer="random_normal")) net.add(MaxPooling2D((2, 2), padding="valid", data_format="channels_last")) net.add(Flatten(data_format="channels_last")) net.add(Dropout(0.2)) net.add(Dense(32, activation="relu", use_bias=True, kernel_initializer="random_normal")) net.add(Dropout(0.2)) net.add(Dense(16, activation="relu", use_bias=True, kernel_initializer="random_normal")) net.add(Dense(1, activation="sigmoid", use_bias=True, kernel_initializer="random_normal")) print("Neural network created.") net.summary() print("Training neural network...") start_time = time.monotonic() net.compile(optimizer=tf.keras.optimizers.Adadelta(learning_rate=0.005, rho=0.95), loss=tf.keras.losses.BinaryCrossentropy(from_logits=False), metrics=["accuracy"]) net.fit(train_ds, epochs=EPOCH_NUM, verbose=1, validation_data=valid_ds) end_time = time.monotonic() print("Training complete. Training duration: %.4f minutes" % ((end_time - start_time) / 60)) print("Saving neural network to file...") net.save(MODEL_PATH, save_format=tf) print("Network saved.") wakepy.unset_keepawake() if __name__ == "__main__": main()

52.063063

118

0.71483

72c71119cd90849738f63158e442f5b421f4185f

3,601

py

Python

imitator/pose_imitation/data_process/convert_clip.py

Garfield-kh/PoseTriplet

eb93132f99161bd776dafbcb713e9fb43e501c36

[ "MIT" ]

9

2022-03-30T04:40:11.000Z

2022-03-31T16:03:27.000Z

imitator/pose_imitation/data_process/convert_clip.py

Garfield-kh/PoseTriplet

eb93132f99161bd776dafbcb713e9fb43e501c36

[ "MIT" ]

null

imitator/pose_imitation/data_process/convert_clip.py

Garfield-kh/PoseTriplet

eb93132f99161bd776dafbcb713e9fb43e501c36

[ "MIT" ]

null

import os import sys sys.path.append(os.getcwd()) from utils import * from utils.transformation import quaternion_from_euler from mujoco_py import load_model_from_path from mocap.skeleton import Skeleton from mocap.pose import load_bvh_file, interpolated_traj import pickle import glob import argparse import time parser = argparse.ArgumentParser() parser.add_argument('--render', action='store_true', default=True) parser.add_argument('--model-id', type=str, default='humanoid_1205_orig') parser.add_argument('--mocap-id', type=str, default='0626') # default: 0213 parser.add_argument('--range', type=int, default=None) # default: (5, 20) parser.add_argument('--skt-id', type=str, default='take_000') parser.add_argument('--mocap-fr', type=int, default=30) # default 120 parser.add_argument('--dt', type=float, default=1/30) parser.add_argument('--offset-z', type=float, default=0.0) args = parser.parse_args() model_file = 'assets/mujoco_models/%s.xml' % args.model_id model = load_model_from_path(model_file) body_qposaddr = get_body_qposaddr(model) skt_bvh = os.path.expanduser('datasets/traj_debug/%s_%s.bvh' % (args.mocap_id, args.skt_id)) exclude_bones = {'Thumb', 'Index', 'Middle', 'Ring', 'Pinky', 'End', 'Toe'} spec_channels = {'LeftForeArm': ['Zrotation'], 'RightForeArm': ['Zrotation'], 'LeftLeg': ['Xrotation'], 'RightLeg': ['Xrotation']} skeleton = Skeleton() skeleton.load_from_bvh(skt_bvh, exclude_bones, spec_channels) def get_qpos(pose, bone_addr): """ :param pose: - ind1 = [a, b] ind2 = [a', b'] :param bone_addr: bvh address :return: """ qpos = np.zeros(model.nq) for bone_name, ind2 in body_qposaddr.items(): ind1 = bone_addr[bone_name] if ind1[0] == 0: trans = pose[ind1[0]:ind1[0] + 3].copy() angles = pose[ind1[0] + 3:ind1[1]].copy() quat = quaternion_from_euler(angles[0], angles[1], angles[2], 'rxyz') qpos[ind2[0]:ind2[0] + 3] = trans qpos[ind2[0] + 3:ind2[1]] = quat else: qpos[ind2[0]:ind2[1]] = pose[ind1[0]:ind1[1]] return qpos def get_poses(bvh_file): time0_get_poses = time.time() # time start load. poses, bone_addr = load_bvh_file(bvh_file, skeleton) poses_samp = interpolated_traj(poses, args.dt, mocap_fr=args.mocap_fr) qpos_traj = [] for i in range(poses_samp.shape[0]): cur_pose = poses_samp[i, :] cur_qpos = get_qpos(cur_pose, bone_addr) qpos_traj.append(cur_qpos) qpos_traj = np.vstack(qpos_traj) qpos_traj[:, 2] += args.offset_z time_cost_get_poses = time.time() - time0_get_poses # time spend. print('-----> get_poses spends {:.2f}s on {} with {:0>6d} frames'.format(time_cost_get_poses, bvh_file, poses.shape[0])) return qpos_traj bvh_files = glob.glob(os.path.expanduser('datasets/traj_debug/%s_*.bvh' % args.mocap_id)) bvh_files.sort() if args.range is not None: bvh_files = bvh_files[args.range[0]: args.range[1]] print('bvh_files:', bvh_files) tmp_dict = {} for file in bvh_files: print('extracting trajectory from %s' % file) qpos_traj = get_poses(file) name = os.path.splitext(os.path.basename(file))[0] tmp_dict[name] = {} tmp_dict[name]['predicted_3d_qpos'] = qpos_traj # with open('./datasets/traj_new/traj_dict_ego.pkl', 'wb') as f: # pickle.dump(tmp_dict, f, pickle.HIGHEST_PROTOCOL) with open('./datasets/traj_debug/traj_dict_626.pkl', 'wb') as f: pickle.dump(tmp_dict, f, pickle.HIGHEST_PROTOCOL)

36.01

103

0.666482

9c96cf9407e71d09abd07104cf5bd27e2599e27a

1,789

py

Python

src/PROBE/start_search.py

lelis-research/PyGames-synthesis

0c597243c04ce511d8ae5cfd52b1c043267b4503

[ "MIT" ]

1

2021-06-03T15:54:16.000Z

src/PROBE/start_search.py

olivier-vadiaval/catcher-synthesis

0c597243c04ce511d8ae5cfd52b1c043267b4503

[ "MIT" ]

3

2021-07-26T19:58:31.000Z

2021-07-27T17:35:51.000Z

src/PROBE/start_search.py

olivier-vadiaval/catcher-synthesis

0c597243c04ce511d8ae5cfd52b1c043267b4503

[ "MIT" ]

null

""" start_search.py Author: Olivier Vadiavaloo Description: This module provides the implementation of the driver code for the probe synthesizer. It creates the list of rules, the pcfg, the logger object and the probe object. """ from math import log10, floor from src.dsl import * from src.PROBE.rule import * from src.PROBE.probe import * from src.Utils.logger import Logger from src.Evaluation.evaluation import * def start_probe(time_limit, log_file, is_parallel, game): rules = [ const_rule, var_arr_rule, var_from_arr_rule, var_scalar_rule, non_player_pos_rule, non_player_dir_rule, player_pos_rule, for_each_rule, ite_rule, it_rule, strategy_rule, ra_rule, plus_rule, minus_rule, times_rule, divide_rule, gt_rule, lt_rule, eq_rule ] uniform_prob = 1 / len(rules) uniform_cost = floor(-1 * log10(uniform_prob)) pcfg = {} for rule in rules: pcfg[rule] = {probability_key: uniform_prob, cost_key: uniform_cost} pcfg['dsfs'] = [NonPlayerObjectPosition, NonPlayerObjectApproaching, PlayerPosition] pcfg['constants'] = [0.5, 2] pcfg['scalars'] = [ VarArray.new('actions'), VarScalar.new('paddle_width'), VarFromArray.new('actions', 0), VarFromArray.new('actions', 1), VarFromArray.new('actions', 2) ] eval_factory = EvaluationFactory(0, 10, False, 'NORMAL') eval_funct = eval_factory.get_eval_fun(game) logger = Logger( log_file, 'PROBE (Guided Bottom-Up Search)', {'time': time_limit} ) synthesizer = Probe() synthesizer.probe(pcfg, rules, eval_funct, time_limit, logger, is_parallel)

25.557143

88

0.645053

accd1f7105b898defa161501056b7fe028407de4

71,262

py

Python

pygments/lexers/templates.py

zaibacu/pygments

8d110f8dc23f9154277625f3b3555f03ba68093d

[ "BSD-2-Clause" ]

16

2020-09-20T22:32:54.000Z

2021-04-02T17:14:25.000Z

pygments/lexers/templates.py

zaibacu/pygments

8d110f8dc23f9154277625f3b3555f03ba68093d

[ "BSD-2-Clause" ]

301

2020-10-03T10:46:31.000Z

2022-03-27T23:46:23.000Z

pygments/lexers/templates.py

zaibacu/pygments

8d110f8dc23f9154277625f3b3555f03ba68093d

[ "BSD-2-Clause" ]

2

2020-09-17T08:27:12.000Z

2021-08-23T11:13:52.000Z

# -*- coding: utf-8 -*- """ pygments.lexers.templates ~~~~~~~~~~~~~~~~~~~~~~~~~ Lexers for various template engines' markup. :copyright: Copyright 2006-2020 by the Pygments team, see AUTHORS. :license: BSD, see LICENSE for details. """ import re from pygments.lexers.html import HtmlLexer, XmlLexer from pygments.lexers.javascript import JavascriptLexer, LassoLexer from pygments.lexers.css import CssLexer from pygments.lexers.php import PhpLexer from pygments.lexers.python import PythonLexer from pygments.lexers.perl import PerlLexer from pygments.lexers.jvm import JavaLexer, TeaLangLexer from pygments.lexers.data import YamlLexer from pygments.lexer import Lexer, DelegatingLexer, RegexLexer, bygroups, \ include, using, this, default, combined from pygments.token import Error, Punctuation, Whitespace, \ Text, Comment, Operator, Keyword, Name, String, Number, Other, Token from pygments.util import html_doctype_matches, looks_like_xml __all__ = ['HtmlPhpLexer', 'XmlPhpLexer', 'CssPhpLexer', 'JavascriptPhpLexer', 'ErbLexer', 'RhtmlLexer', 'XmlErbLexer', 'CssErbLexer', 'JavascriptErbLexer', 'SmartyLexer', 'HtmlSmartyLexer', 'XmlSmartyLexer', 'CssSmartyLexer', 'JavascriptSmartyLexer', 'DjangoLexer', 'HtmlDjangoLexer', 'CssDjangoLexer', 'XmlDjangoLexer', 'JavascriptDjangoLexer', 'GenshiLexer', 'HtmlGenshiLexer', 'GenshiTextLexer', 'CssGenshiLexer', 'JavascriptGenshiLexer', 'MyghtyLexer', 'MyghtyHtmlLexer', 'MyghtyXmlLexer', 'MyghtyCssLexer', 'MyghtyJavascriptLexer', 'MasonLexer', 'MakoLexer', 'MakoHtmlLexer', 'MakoXmlLexer', 'MakoJavascriptLexer', 'MakoCssLexer', 'JspLexer', 'CheetahLexer', 'CheetahHtmlLexer', 'CheetahXmlLexer', 'CheetahJavascriptLexer', 'EvoqueLexer', 'EvoqueHtmlLexer', 'EvoqueXmlLexer', 'ColdfusionLexer', 'ColdfusionHtmlLexer', 'ColdfusionCFCLexer', 'VelocityLexer', 'VelocityHtmlLexer', 'VelocityXmlLexer', 'SspLexer', 'TeaTemplateLexer', 'LassoHtmlLexer', 'LassoXmlLexer', 'LassoCssLexer', 'LassoJavascriptLexer', 'HandlebarsLexer', 'HandlebarsHtmlLexer', 'YamlJinjaLexer', 'LiquidLexer', 'TwigLexer', 'TwigHtmlLexer', 'Angular2Lexer', 'Angular2HtmlLexer'] class ErbLexer(Lexer): """ Generic `ERB <http://ruby-doc.org/core/classes/ERB.html>`_ (Ruby Templating) lexer. Just highlights ruby code between the preprocessor directives, other data is left untouched by the lexer. All options are also forwarded to the `RubyLexer`. """ name = 'ERB' aliases = ['erb'] mimetypes = ['application/x-ruby-templating'] _block_re = re.compile(r'(<%%|%%>|<%=|<%#|<%-|<%|-%>|%>|^%[^%].*?$)', re.M) def __init__(self, **options): from pygments.lexers.ruby import RubyLexer self.ruby_lexer = RubyLexer(**options) Lexer.__init__(self, **options) def get_tokens_unprocessed(self, text): """ Since ERB doesn't allow "<%" and other tags inside of ruby blocks we have to use a split approach here that fails for that too. """ tokens = self._block_re.split(text) tokens.reverse() state = idx = 0 try: while True: # text if state == 0: val = tokens.pop() yield idx, Other, val idx += len(val) state = 1 # block starts elif state == 1: tag = tokens.pop() # literals if tag in ('<%%', '%%>'): yield idx, Other, tag idx += 3 state = 0 # comment elif tag == '<%#': yield idx, Comment.Preproc, tag val = tokens.pop() yield idx + 3, Comment, val idx += 3 + len(val) state = 2 # blocks or output elif tag in ('<%', '<%=', '<%-'): yield idx, Comment.Preproc, tag idx += len(tag) data = tokens.pop() r_idx = 0 for r_idx, r_token, r_value in \ self.ruby_lexer.get_tokens_unprocessed(data): yield r_idx + idx, r_token, r_value idx += len(data) state = 2 elif tag in ('%>', '-%>'): yield idx, Error, tag idx += len(tag) state = 0 # % raw ruby statements else: yield idx, Comment.Preproc, tag[0] r_idx = 0 for r_idx, r_token, r_value in \ self.ruby_lexer.get_tokens_unprocessed(tag[1:]): yield idx + 1 + r_idx, r_token, r_value idx += len(tag) state = 0 # block ends elif state == 2: tag = tokens.pop() if tag not in ('%>', '-%>'): yield idx, Other, tag else: yield idx, Comment.Preproc, tag idx += len(tag) state = 0 except IndexError: return def analyse_text(text): if '<%' in text and '%>' in text: return 0.4 class SmartyLexer(RegexLexer): """ Generic `Smarty <http://smarty.php.net/>`_ template lexer. Just highlights smarty code between the preprocessor directives, other data is left untouched by the lexer. """ name = 'Smarty' aliases = ['smarty'] filenames = ['*.tpl'] mimetypes = ['application/x-smarty'] flags = re.MULTILINE | re.DOTALL tokens = { 'root': [ (r'[^{]+', Other), (r'(\{)(\*.*?\*)(\})', bygroups(Comment.Preproc, Comment, Comment.Preproc)), (r'(\{php\})(.*?)(\{/php\})', bygroups(Comment.Preproc, using(PhpLexer, startinline=True), Comment.Preproc)), (r'(\{)(/?[a-zA-Z_]\w*)(\s*)', bygroups(Comment.Preproc, Name.Function, Text), 'smarty'), (r'\{', Comment.Preproc, 'smarty') ], 'smarty': [ (r'\s+', Text), (r'\{', Comment.Preproc, '#push'), (r'\}', Comment.Preproc, '#pop'), (r'#[a-zA-Z_]\w*#', Name.Variable), (r'\$[a-zA-Z_]\w*(\.\w+)*', Name.Variable), (r'[~!%^&*()+=|\[\]:;,.<>/?@-]', Operator), (r'(true|false|null)\b', Keyword.Constant), (r"[0-9](\.[0-9]*)?(eE[+-][0-9])?[flFLdD]?|" r"0[xX][0-9a-fA-F]+[Ll]?", Number), (r'"(\\\\|\\"|[^"])*"', String.Double), (r"'(\\\\|\\'|[^'])*'", String.Single), (r'[a-zA-Z_]\w*', Name.Attribute) ] } def analyse_text(text): rv = 0.0 if re.search(r'\{if\s+.*?\}.*?\{/if\}', text): rv += 0.15 if re.search(r'\{include\s+file=.*?\}', text): rv += 0.15 if re.search(r'\{foreach\s+.*?\}.*?\{/foreach\}', text): rv += 0.15 if re.search(r'\{\$.*?\}', text): rv += 0.01 return rv class VelocityLexer(RegexLexer): """ Generic `Velocity <http://velocity.apache.org/>`_ template lexer. Just highlights velocity directives and variable references, other data is left untouched by the lexer. """ name = 'Velocity' aliases = ['velocity'] filenames = ['*.vm', '*.fhtml'] flags = re.MULTILINE | re.DOTALL identifier = r'[a-zA-Z_]\w*' tokens = { 'root': [ (r'[^{#$]+', Other), (r'(#)(\*.*?\*)(#)', bygroups(Comment.Preproc, Comment, Comment.Preproc)), (r'(##)(.*?$)', bygroups(Comment.Preproc, Comment)), (r'(#\{?)(' + identifier + r')(\}?)(\s?\()', bygroups(Comment.Preproc, Name.Function, Comment.Preproc, Punctuation), 'directiveparams'), (r'(#\{?)(' + identifier + r')(\}|\b)', bygroups(Comment.Preproc, Name.Function, Comment.Preproc)), (r'\$!?\{?', Punctuation, 'variable') ], 'variable': [ (identifier, Name.Variable), (r'$', Punctuation, 'funcparams'), (r'(\.)(' + identifier + r')', bygroups(Punctuation, Name.Variable), '#push'), (r'\}', Punctuation, '#pop'), default('#pop') ], 'directiveparams': [ (r'(&&|\|\||==?|!=?|[-<>+*%&|^/])|\b(eq|ne|gt|lt|ge|le|not|in)\b', Operator), (r'\[', Operator, 'rangeoperator'), (r'\b' + identifier + r'\b', Name.Function), include('funcparams') ], 'rangeoperator': [ (r'\.\.', Operator), include('funcparams'), (r'\]', Operator, '#pop') ], 'funcparams': [ (r'\$!?\{?', Punctuation, 'variable'), (r'\s+', Text), (r'[,:]', Punctuation), (r'"(\\\\|\\"|[^"])*"', String.Double), (r"'(\\\\|\\'|[^'])*'", String.Single), (r"0[xX][0-9a-fA-F]+[Ll]?", Number), (r"\b[0-9]+\b", Number), (r'(true|false|null)\b', Keyword.Constant), (r'\(', Punctuation, '#push'), (r'$', Punctuation, '#pop'), (r'\{', Punctuation, '#push'), (r'\}', Punctuation, '#pop'), (r'\[', Punctuation, '#push'), (r'\]', Punctuation, '#pop'), ] } def analyse_text(text): rv = 0.0 if re.search(r'#\{?macro\}?$.*?$.*?#\{?end\}?', text): rv += 0.25 if re.search(r'#\{?if\}?$.+?$.*?#\{?end\}?', text): rv += 0.15 if re.search(r'#\{?foreach\}?$.+?$.*?#\{?end\}?', text): rv += 0.15 if re.search(r'\$!?\{?[a-zA-Z_]\w*($[^)]*$)?' r'(\.\w+($[^)]*$)?)*\}?', text): rv += 0.01 return rv class VelocityHtmlLexer(DelegatingLexer): """ Subclass of the `VelocityLexer` that highlights unlexed data with the `HtmlLexer`. """ name = 'HTML+Velocity' aliases = ['html+velocity'] alias_filenames = ['*.html', '*.fhtml'] mimetypes = ['text/html+velocity'] def __init__(self, **options): super().__init__(HtmlLexer, VelocityLexer, **options) class VelocityXmlLexer(DelegatingLexer): """ Subclass of the `VelocityLexer` that highlights unlexed data with the `XmlLexer`. """ name = 'XML+Velocity' aliases = ['xml+velocity'] alias_filenames = ['*.xml', '*.vm'] mimetypes = ['application/xml+velocity'] def __init__(self, **options): super().__init__(XmlLexer, VelocityLexer, **options) def analyse_text(text): rv = VelocityLexer.analyse_text(text) - 0.01 if looks_like_xml(text): rv += 0.4 return rv class DjangoLexer(RegexLexer): """ Generic `django <http://www.djangoproject.com/documentation/templates/>`_ and `jinja <https://jinja.pocoo.org/jinja/>`_ template lexer. It just highlights django/jinja code between the preprocessor directives, other data is left untouched by the lexer. """ name = 'Django/Jinja' aliases = ['django', 'jinja'] mimetypes = ['application/x-django-templating', 'application/x-jinja'] flags = re.M | re.S tokens = { 'root': [ (r'[^{]+', Other), (r'\{\{', Comment.Preproc, 'var'), # jinja/django comments (r'\{[*#].*?[*#]\}', Comment), # django comments (r'(\{%)(-?\s*)(comment)(\s*-?)(%\})(.*?)' r'(\{%)(-?\s*)(endcomment)(\s*-?)(%\})', bygroups(Comment.Preproc, Text, Keyword, Text, Comment.Preproc, Comment, Comment.Preproc, Text, Keyword, Text, Comment.Preproc)), # raw jinja blocks (r'(\{%)(-?\s*)(raw)(\s*-?)(%\})(.*?)' r'(\{%)(-?\s*)(endraw)(\s*-?)(%\})', bygroups(Comment.Preproc, Text, Keyword, Text, Comment.Preproc, Text, Comment.Preproc, Text, Keyword, Text, Comment.Preproc)), # filter blocks (r'(\{%)(-?\s*)(filter)(\s+)([a-zA-Z_]\w*)', bygroups(Comment.Preproc, Text, Keyword, Text, Name.Function), 'block'), (r'(\{%)(-?\s*)([a-zA-Z_]\w*)', bygroups(Comment.Preproc, Text, Keyword), 'block'), (r'\{', Other) ], 'varnames': [ (r'(\|)(\s*)([a-zA-Z_]\w*)', bygroups(Operator, Text, Name.Function)), (r'(is)(\s+)(not)?(\s+)?([a-zA-Z_]\w*)', bygroups(Keyword, Text, Keyword, Text, Name.Function)), (r'(_|true|false|none|True|False|None)\b', Keyword.Pseudo), (r'(in|as|reversed|recursive|not|and|or|is|if|else|import|' r'with(?:(?:out)?\s*context)?|scoped|ignore\s+missing)\b', Keyword), (r'(loop|block|super|forloop)\b', Name.Builtin), (r'[a-zA-Z_][\w-]*', Name.Variable), (r'\.\w+', Name.Variable), (r':?"(\\\\|\\"|[^"])*"', String.Double), (r":?'(\\\\|\\'|[^'])*'", String.Single), (r'([{}()\[\]+\-*/%,:~]|[><=]=?|!=)', Operator), (r"[0-9](\.[0-9]*)?(eE[+-][0-9])?[flFLdD]?|" r"0[xX][0-9a-fA-F]+[Ll]?", Number), ], 'var': [ (r'\s+', Text), (r'(-?)(\}\})', bygroups(Text, Comment.Preproc), '#pop'), include('varnames') ], 'block': [ (r'\s+', Text), (r'(-?)(%\})', bygroups(Text, Comment.Preproc), '#pop'), include('varnames'), (r'.', Punctuation) ] } def analyse_text(text): rv = 0.0 if re.search(r'\{%\s*(block|extends)', text) is not None: rv += 0.4 if re.search(r'\{%\s*if\s*.*?%\}', text) is not None: rv += 0.1 if re.search(r'\{\{.*?\}\}', text) is not None: rv += 0.1 return rv class MyghtyLexer(RegexLexer): """ Generic `myghty templates`_ lexer. Code that isn't Myghty markup is yielded as `Token.Other`. .. versionadded:: 0.6 .. _myghty templates: http://www.myghty.org/ """ name = 'Myghty' aliases = ['myghty'] filenames = ['*.myt', 'autodelegate'] mimetypes = ['application/x-myghty'] tokens = { 'root': [ (r'\s+', Text), (r'(?s)(<%(?:def|method))(\s*)(.*?)(>)(.*?)(</%\2\s*>)', bygroups(Name.Tag, Text, Name.Function, Name.Tag, using(this), Name.Tag)), (r'(?s)(<%\w+)(.*?)(>)(.*?)(</%\2\s*>)', bygroups(Name.Tag, Name.Function, Name.Tag, using(PythonLexer), Name.Tag)), (r'(<&[^|])(.*?)(,.*?)?(&>)', bygroups(Name.Tag, Name.Function, using(PythonLexer), Name.Tag)), (r'(?s)(<&\|)(.*?)(,.*?)?(&>)', bygroups(Name.Tag, Name.Function, using(PythonLexer), Name.Tag)), (r'</&>', Name.Tag), (r'(?s)(<%!?)(.*?)(%>)', bygroups(Name.Tag, using(PythonLexer), Name.Tag)), (r'(?<=^)#[^\n]*(\n|\Z)', Comment), (r'(?<=^)(%)([^\n]*)(\n|\Z)', bygroups(Name.Tag, using(PythonLexer), Other)), (r"""(?sx) (.+?) # anything, followed by: (?: (?<=\n)(?=[%#]) | # an eval or comment line (?=</?[%&]) | # a substitution or block or # call start or end # - don't consume (\\\n) | # an escaped newline \Z # end of string )""", bygroups(Other, Operator)), ] } class MyghtyHtmlLexer(DelegatingLexer): """ Subclass of the `MyghtyLexer` that highlights unlexed data with the `HtmlLexer`. .. versionadded:: 0.6 """ name = 'HTML+Myghty' aliases = ['html+myghty'] mimetypes = ['text/html+myghty'] def __init__(self, **options): super().__init__(HtmlLexer, MyghtyLexer, **options) class MyghtyXmlLexer(DelegatingLexer): """ Subclass of the `MyghtyLexer` that highlights unlexed data with the `XmlLexer`. .. versionadded:: 0.6 """ name = 'XML+Myghty' aliases = ['xml+myghty'] mimetypes = ['application/xml+myghty'] def __init__(self, **options): super().__init__(XmlLexer, MyghtyLexer, **options) class MyghtyJavascriptLexer(DelegatingLexer): """ Subclass of the `MyghtyLexer` that highlights unlexed data with the `JavascriptLexer`. .. versionadded:: 0.6 """ name = 'JavaScript+Myghty' aliases = ['js+myghty', 'javascript+myghty'] mimetypes = ['application/x-javascript+myghty', 'text/x-javascript+myghty', 'text/javascript+mygthy'] def __init__(self, **options): super().__init__(JavascriptLexer, MyghtyLexer, **options) class MyghtyCssLexer(DelegatingLexer): """ Subclass of the `MyghtyLexer` that highlights unlexed data with the `CssLexer`. .. versionadded:: 0.6 """ name = 'CSS+Myghty' aliases = ['css+myghty'] mimetypes = ['text/css+myghty'] def __init__(self, **options): super().__init__(CssLexer, MyghtyLexer, **options) class MasonLexer(RegexLexer): """ Generic `mason templates`_ lexer. Stolen from Myghty lexer. Code that isn't Mason markup is HTML. .. _mason templates: http://www.masonhq.com/ .. versionadded:: 1.4 """ name = 'Mason' aliases = ['mason'] filenames = ['*.m', '*.mhtml', '*.mc', '*.mi', 'autohandler', 'dhandler'] mimetypes = ['application/x-mason'] tokens = { 'root': [ (r'\s+', Text), (r'(?s)(<%doc>)(.*?)(</%doc>)', bygroups(Name.Tag, Comment.Multiline, Name.Tag)), (r'(?s)(<%(?:def|method))(\s*)(.*?)(>)(.*?)(</%\2\s*>)', bygroups(Name.Tag, Text, Name.Function, Name.Tag, using(this), Name.Tag)), (r'(?s)(<%\w+)(.*?)(>)(.*?)(</%\2\s*>)', bygroups(Name.Tag, Name.Function, Name.Tag, using(PerlLexer), Name.Tag)), (r'(?s)(<&[^|])(.*?)(,.*?)?(&>)', bygroups(Name.Tag, Name.Function, using(PerlLexer), Name.Tag)), (r'(?s)(<&\|)(.*?)(,.*?)?(&>)', bygroups(Name.Tag, Name.Function, using(PerlLexer), Name.Tag)), (r'</&>', Name.Tag), (r'(?s)(<%!?)(.*?)(%>)', bygroups(Name.Tag, using(PerlLexer), Name.Tag)), (r'(?<=^)#[^\n]*(\n|\Z)', Comment), (r'(?<=^)(%)([^\n]*)(\n|\Z)', bygroups(Name.Tag, using(PerlLexer), Other)), (r"""(?sx) (.+?) # anything, followed by: (?: (?<=\n)(?=[%#]) | # an eval or comment line (?=</?[%&]) | # a substitution or block or # call start or end # - don't consume (\\\n) | # an escaped newline \Z # end of string )""", bygroups(using(HtmlLexer), Operator)), ] } def analyse_text(text): result = 0.0 if re.search(r'</%(class|doc|init)%>', text) is not None: result = 1.0 elif re.search(r'<&.+&>', text, re.DOTALL) is not None: result = 0.11 return result class MakoLexer(RegexLexer): """ Generic `mako templates`_ lexer. Code that isn't Mako markup is yielded as `Token.Other`. .. versionadded:: 0.7 .. _mako templates: http://www.makotemplates.org/ """ name = 'Mako' aliases = ['mako'] filenames = ['*.mao'] mimetypes = ['application/x-mako'] tokens = { 'root': [ (r'(\s*)(%)(\s*end(?:\w+))(\n|\Z)', bygroups(Text, Comment.Preproc, Keyword, Other)), (r'(\s*)(%)([^\n]*)(\n|\Z)', bygroups(Text, Comment.Preproc, using(PythonLexer), Other)), (r'(\s*)(##[^\n]*)(\n|\Z)', bygroups(Text, Comment.Preproc, Other)), (r'(?s)<%doc>.*?</%doc>', Comment.Preproc), (r'(<%)([\w.:]+)', bygroups(Comment.Preproc, Name.Builtin), 'tag'), (r'(</%)([\w.:]+)(>)', bygroups(Comment.Preproc, Name.Builtin, Comment.Preproc)), (r'<%(?=([\w.:]+))', Comment.Preproc, 'ondeftags'), (r'(?s)(<%(?:!?))(.*?)(%>)', bygroups(Comment.Preproc, using(PythonLexer), Comment.Preproc)), (r'(\$\{)(.*?)(\})', bygroups(Comment.Preproc, using(PythonLexer), Comment.Preproc)), (r'''(?sx) (.+?) # anything, followed by: (?: (?<=\n)(?=%|\#\#) | # an eval or comment line (?=\#\*) | # multiline comment (?=</?%) | # a python block # call start or end (?=\$\{) | # a substitution (?<=\n)(?=\s*%) | # - don't consume (\\\n) | # an escaped newline \Z # end of string ) ''', bygroups(Other, Operator)), (r'\s+', Text), ], 'ondeftags': [ (r'<%', Comment.Preproc), (r'(?<=<%)(include|inherit|namespace|page)', Name.Builtin), include('tag'), ], 'tag': [ (r'((?:\w+)\s*=)(\s*)(".*?")', bygroups(Name.Attribute, Text, String)), (r'/?\s*>', Comment.Preproc, '#pop'), (r'\s+', Text), ], 'attr': [ ('".*?"', String, '#pop'), ("'.*?'", String, '#pop'), (r'[^\s>]+', String, '#pop'), ], } class MakoHtmlLexer(DelegatingLexer): """ Subclass of the `MakoLexer` that highlights unlexed data with the `HtmlLexer`. .. versionadded:: 0.7 """ name = 'HTML+Mako' aliases = ['html+mako'] mimetypes = ['text/html+mako'] def __init__(self, **options): super().__init__(HtmlLexer, MakoLexer, **options) class MakoXmlLexer(DelegatingLexer): """ Subclass of the `MakoLexer` that highlights unlexed data with the `XmlLexer`. .. versionadded:: 0.7 """ name = 'XML+Mako' aliases = ['xml+mako'] mimetypes = ['application/xml+mako'] def __init__(self, **options): super().__init__(XmlLexer, MakoLexer, **options) class MakoJavascriptLexer(DelegatingLexer): """ Subclass of the `MakoLexer` that highlights unlexed data with the `JavascriptLexer`. .. versionadded:: 0.7 """ name = 'JavaScript+Mako' aliases = ['js+mako', 'javascript+mako'] mimetypes = ['application/x-javascript+mako', 'text/x-javascript+mako', 'text/javascript+mako'] def __init__(self, **options): super().__init__(JavascriptLexer, MakoLexer, **options) class MakoCssLexer(DelegatingLexer): """ Subclass of the `MakoLexer` that highlights unlexed data with the `CssLexer`. .. versionadded:: 0.7 """ name = 'CSS+Mako' aliases = ['css+mako'] mimetypes = ['text/css+mako'] def __init__(self, **options): super().__init__(CssLexer, MakoLexer, **options) # Genshi and Cheetah lexers courtesy of Matt Good. class CheetahPythonLexer(Lexer): """ Lexer for handling Cheetah's special $ tokens in Python syntax. """ def get_tokens_unprocessed(self, text): pylexer = PythonLexer(**self.options) for pos, type_, value in pylexer.get_tokens_unprocessed(text): if type_ == Token.Error and value == '$': type_ = Comment.Preproc yield pos, type_, value class CheetahLexer(RegexLexer): """ Generic `cheetah templates`_ lexer. Code that isn't Cheetah markup is yielded as `Token.Other`. This also works for `spitfire templates`_ which use the same syntax. .. _cheetah templates: http://www.cheetahtemplate.org/ .. _spitfire templates: http://code.google.com/p/spitfire/ """ name = 'Cheetah' aliases = ['cheetah', 'spitfire'] filenames = ['*.tmpl', '*.spt'] mimetypes = ['application/x-cheetah', 'application/x-spitfire'] tokens = { 'root': [ (r'(##[^\n]*)$', (bygroups(Comment))), (r'#[*](.|\n)*?[*]#', Comment), (r'#end[^#\n]*(?:#|$)', Comment.Preproc), (r'#slurp$', Comment.Preproc), (r'(#[a-zA-Z]+)([^#\n]*)(#|$)', (bygroups(Comment.Preproc, using(CheetahPythonLexer), Comment.Preproc))), # TODO support other Python syntax like $foo['bar'] (r'(\$)([a-zA-Z_][\w.]*\w)', bygroups(Comment.Preproc, using(CheetahPythonLexer))), (r'(?s)(\$\{!?)(.*?)(\})', bygroups(Comment.Preproc, using(CheetahPythonLexer), Comment.Preproc)), (r'''(?sx) (.+?) # anything, followed by: (?: (?=\#[#a-zA-Z]*) | # an eval comment (?=\$[a-zA-Z_{]) | # a substitution \Z # end of string ) ''', Other), (r'\s+', Text), ], } class CheetahHtmlLexer(DelegatingLexer): """ Subclass of the `CheetahLexer` that highlights unlexed data with the `HtmlLexer`. """ name = 'HTML+Cheetah' aliases = ['html+cheetah', 'html+spitfire', 'htmlcheetah'] mimetypes = ['text/html+cheetah', 'text/html+spitfire'] def __init__(self, **options): super().__init__(HtmlLexer, CheetahLexer, **options) class CheetahXmlLexer(DelegatingLexer): """ Subclass of the `CheetahLexer` that highlights unlexed data with the `XmlLexer`. """ name = 'XML+Cheetah' aliases = ['xml+cheetah', 'xml+spitfire'] mimetypes = ['application/xml+cheetah', 'application/xml+spitfire'] def __init__(self, **options): super().__init__(XmlLexer, CheetahLexer, **options) class CheetahJavascriptLexer(DelegatingLexer): """ Subclass of the `CheetahLexer` that highlights unlexed data with the `JavascriptLexer`. """ name = 'JavaScript+Cheetah' aliases = ['js+cheetah', 'javascript+cheetah', 'js+spitfire', 'javascript+spitfire'] mimetypes = ['application/x-javascript+cheetah', 'text/x-javascript+cheetah', 'text/javascript+cheetah', 'application/x-javascript+spitfire', 'text/x-javascript+spitfire', 'text/javascript+spitfire'] def __init__(self, **options): super().__init__(JavascriptLexer, CheetahLexer, **options) class GenshiTextLexer(RegexLexer): """ A lexer that highlights `genshi <http://genshi.edgewall.org/>`_ text templates. """ name = 'Genshi Text' aliases = ['genshitext'] mimetypes = ['application/x-genshi-text', 'text/x-genshi'] tokens = { 'root': [ (r'[^#$\s]+', Other), (r'^(\s*)(##.*)$', bygroups(Text, Comment)), (r'^(\s*)(#)', bygroups(Text, Comment.Preproc), 'directive'), include('variable'), (r'[#$\s]', Other), ], 'directive': [ (r'\n', Text, '#pop'), (r'(?:def|for|if)\s+.*', using(PythonLexer), '#pop'), (r'(choose|when|with)([^\S\n]+)(.*)', bygroups(Keyword, Text, using(PythonLexer)), '#pop'), (r'(choose|otherwise)\b', Keyword, '#pop'), (r'(end\w*)([^\S\n]*)(.*)', bygroups(Keyword, Text, Comment), '#pop'), ], 'variable': [ (r'(?<!\$)(\$\{)(.+?)(\})', bygroups(Comment.Preproc, using(PythonLexer), Comment.Preproc)), (r'(?<!\$)(\$)([a-zA-Z_][\w.]*)', Name.Variable), ] } class GenshiMarkupLexer(RegexLexer): """ Base lexer for Genshi markup, used by `HtmlGenshiLexer` and `GenshiLexer`. """ flags = re.DOTALL tokens = { 'root': [ (r'[^<$]+', Other), (r'(<\?python)(.*?)(\?>)', bygroups(Comment.Preproc, using(PythonLexer), Comment.Preproc)), # yield style and script blocks as Other (r'<\s*(script|style)\s*.*?>.*?<\s*/\1\s*>', Other), (r'<\s*py:[a-zA-Z0-9]+', Name.Tag, 'pytag'), (r'<\s*[a-zA-Z0-9:.]+', Name.Tag, 'tag'), include('variable'), (r'[<$]', Other), ], 'pytag': [ (r'\s+', Text), (r'[\w:-]+\s*=', Name.Attribute, 'pyattr'), (r'/?\s*>', Name.Tag, '#pop'), ], 'pyattr': [ ('(")(.*?)(")', bygroups(String, using(PythonLexer), String), '#pop'), ("(')(.*?)(')", bygroups(String, using(PythonLexer), String), '#pop'), (r'[^\s>]+', String, '#pop'), ], 'tag': [ (r'\s+', Text), (r'py:[\w-]+\s*=', Name.Attribute, 'pyattr'), (r'[\w:-]+\s*=', Name.Attribute, 'attr'), (r'/?\s*>', Name.Tag, '#pop'), ], 'attr': [ ('"', String, 'attr-dstring'), ("'", String, 'attr-sstring'), (r'[^\s>]*', String, '#pop') ], 'attr-dstring': [ ('"', String, '#pop'), include('strings'), ("'", String) ], 'attr-sstring': [ ("'", String, '#pop'), include('strings'), ("'", String) ], 'strings': [ ('[^"\'$]+', String), include('variable') ], 'variable': [ (r'(?<!\$)(\$\{)(.+?)(\})', bygroups(Comment.Preproc, using(PythonLexer), Comment.Preproc)), (r'(?<!\$)(\$)([a-zA-Z_][\w\.]*)', Name.Variable), ] } class HtmlGenshiLexer(DelegatingLexer): """ A lexer that highlights `genshi <http://genshi.edgewall.org/>`_ and `kid <http://kid-templating.org/>`_ kid HTML templates. """ name = 'HTML+Genshi' aliases = ['html+genshi', 'html+kid'] alias_filenames = ['*.html', '*.htm', '*.xhtml'] mimetypes = ['text/html+genshi'] def __init__(self, **options): super().__init__(HtmlLexer, GenshiMarkupLexer, **options) def analyse_text(text): rv = 0.0 if re.search(r'\$\{.*?\}', text) is not None: rv += 0.2 if re.search(r'py:(.*?)=["\']', text) is not None: rv += 0.2 return rv + HtmlLexer.analyse_text(text) - 0.01 class GenshiLexer(DelegatingLexer): """ A lexer that highlights `genshi <http://genshi.edgewall.org/>`_ and `kid <http://kid-templating.org/>`_ kid XML templates. """ name = 'Genshi' aliases = ['genshi', 'kid', 'xml+genshi', 'xml+kid'] filenames = ['*.kid'] alias_filenames = ['*.xml'] mimetypes = ['application/x-genshi', 'application/x-kid'] def __init__(self, **options): super().__init__(XmlLexer, GenshiMarkupLexer, **options) def analyse_text(text): rv = 0.0 if re.search(r'\$\{.*?\}', text) is not None: rv += 0.2 if re.search(r'py:(.*?)=["\']', text) is not None: rv += 0.2 return rv + XmlLexer.analyse_text(text) - 0.01 class JavascriptGenshiLexer(DelegatingLexer): """ A lexer that highlights javascript code in genshi text templates. """ name = 'JavaScript+Genshi Text' aliases = ['js+genshitext', 'js+genshi', 'javascript+genshitext', 'javascript+genshi'] alias_filenames = ['*.js'] mimetypes = ['application/x-javascript+genshi', 'text/x-javascript+genshi', 'text/javascript+genshi'] def __init__(self, **options): super().__init__(JavascriptLexer, GenshiTextLexer, **options) def analyse_text(text): return GenshiLexer.analyse_text(text) - 0.05 class CssGenshiLexer(DelegatingLexer): """ A lexer that highlights CSS definitions in genshi text templates. """ name = 'CSS+Genshi Text' aliases = ['css+genshitext', 'css+genshi'] alias_filenames = ['*.css'] mimetypes = ['text/css+genshi'] def __init__(self, **options): super().__init__(CssLexer, GenshiTextLexer, **options) def analyse_text(text): return GenshiLexer.analyse_text(text) - 0.05 class RhtmlLexer(DelegatingLexer): """ Subclass of the ERB lexer that highlights the unlexed data with the html lexer. Nested Javascript and CSS is highlighted too. """ name = 'RHTML' aliases = ['rhtml', 'html+erb', 'html+ruby'] filenames = ['*.rhtml'] alias_filenames = ['*.html', '*.htm', '*.xhtml'] mimetypes = ['text/html+ruby'] def __init__(self, **options): super().__init__(HtmlLexer, ErbLexer, **options) def analyse_text(text): rv = ErbLexer.analyse_text(text) - 0.01 if html_doctype_matches(text): # one more than the XmlErbLexer returns rv += 0.5 return rv class XmlErbLexer(DelegatingLexer): """ Subclass of `ErbLexer` which highlights data outside preprocessor directives with the `XmlLexer`. """ name = 'XML+Ruby' aliases = ['xml+erb', 'xml+ruby'] alias_filenames = ['*.xml'] mimetypes = ['application/xml+ruby'] def __init__(self, **options): super().__init__(XmlLexer, ErbLexer, **options) def analyse_text(text): rv = ErbLexer.analyse_text(text) - 0.01 if looks_like_xml(text): rv += 0.4 return rv class CssErbLexer(DelegatingLexer): """ Subclass of `ErbLexer` which highlights unlexed data with the `CssLexer`. """ name = 'CSS+Ruby' aliases = ['css+erb', 'css+ruby'] alias_filenames = ['*.css'] mimetypes = ['text/css+ruby'] def __init__(self, **options): super().__init__(CssLexer, ErbLexer, **options) def analyse_text(text): return ErbLexer.analyse_text(text) - 0.05 class JavascriptErbLexer(DelegatingLexer): """ Subclass of `ErbLexer` which highlights unlexed data with the `JavascriptLexer`. """ name = 'JavaScript+Ruby' aliases = ['js+erb', 'javascript+erb', 'js+ruby', 'javascript+ruby'] alias_filenames = ['*.js'] mimetypes = ['application/x-javascript+ruby', 'text/x-javascript+ruby', 'text/javascript+ruby'] def __init__(self, **options): super().__init__(JavascriptLexer, ErbLexer, **options) def analyse_text(text): return ErbLexer.analyse_text(text) - 0.05 class HtmlPhpLexer(DelegatingLexer): """ Subclass of `PhpLexer` that highlights unhandled data with the `HtmlLexer`. Nested Javascript and CSS is highlighted too. """ name = 'HTML+PHP' aliases = ['html+php'] filenames = ['*.phtml'] alias_filenames = ['*.php', '*.html', '*.htm', '*.xhtml', '*.php[345]'] mimetypes = ['application/x-php', 'application/x-httpd-php', 'application/x-httpd-php3', 'application/x-httpd-php4', 'application/x-httpd-php5'] def __init__(self, **options): super().__init__(HtmlLexer, PhpLexer, **options) def analyse_text(text): rv = PhpLexer.analyse_text(text) - 0.01 if html_doctype_matches(text): rv += 0.5 return rv class XmlPhpLexer(DelegatingLexer): """ Subclass of `PhpLexer` that highlights unhandled data with the `XmlLexer`. """ name = 'XML+PHP' aliases = ['xml+php'] alias_filenames = ['*.xml', '*.php', '*.php[345]'] mimetypes = ['application/xml+php'] def __init__(self, **options): super().__init__(XmlLexer, PhpLexer, **options) def analyse_text(text): rv = PhpLexer.analyse_text(text) - 0.01 if looks_like_xml(text): rv += 0.4 return rv class CssPhpLexer(DelegatingLexer): """ Subclass of `PhpLexer` which highlights unmatched data with the `CssLexer`. """ name = 'CSS+PHP' aliases = ['css+php'] alias_filenames = ['*.css'] mimetypes = ['text/css+php'] def __init__(self, **options): super().__init__(CssLexer, PhpLexer, **options) def analyse_text(text): return PhpLexer.analyse_text(text) - 0.05 class JavascriptPhpLexer(DelegatingLexer): """ Subclass of `PhpLexer` which highlights unmatched data with the `JavascriptLexer`. """ name = 'JavaScript+PHP' aliases = ['js+php', 'javascript+php'] alias_filenames = ['*.js'] mimetypes = ['application/x-javascript+php', 'text/x-javascript+php', 'text/javascript+php'] def __init__(self, **options): super().__init__(JavascriptLexer, PhpLexer, **options) def analyse_text(text): return PhpLexer.analyse_text(text) class HtmlSmartyLexer(DelegatingLexer): """ Subclass of the `SmartyLexer` that highlights unlexed data with the `HtmlLexer`. Nested Javascript and CSS is highlighted too. """ name = 'HTML+Smarty' aliases = ['html+smarty'] alias_filenames = ['*.html', '*.htm', '*.xhtml', '*.tpl'] mimetypes = ['text/html+smarty'] def __init__(self, **options): super().__init__(HtmlLexer, SmartyLexer, **options) def analyse_text(text): rv = SmartyLexer.analyse_text(text) - 0.01 if html_doctype_matches(text): rv += 0.5 return rv class XmlSmartyLexer(DelegatingLexer): """ Subclass of the `SmartyLexer` that highlights unlexed data with the `XmlLexer`. """ name = 'XML+Smarty' aliases = ['xml+smarty'] alias_filenames = ['*.xml', '*.tpl'] mimetypes = ['application/xml+smarty'] def __init__(self, **options): super().__init__(XmlLexer, SmartyLexer, **options) def analyse_text(text): rv = SmartyLexer.analyse_text(text) - 0.01 if looks_like_xml(text): rv += 0.4 return rv class CssSmartyLexer(DelegatingLexer): """ Subclass of the `SmartyLexer` that highlights unlexed data with the `CssLexer`. """ name = 'CSS+Smarty' aliases = ['css+smarty'] alias_filenames = ['*.css', '*.tpl'] mimetypes = ['text/css+smarty'] def __init__(self, **options): super().__init__(CssLexer, SmartyLexer, **options) def analyse_text(text): return SmartyLexer.analyse_text(text) - 0.05 class JavascriptSmartyLexer(DelegatingLexer): """ Subclass of the `SmartyLexer` that highlights unlexed data with the `JavascriptLexer`. """ name = 'JavaScript+Smarty' aliases = ['js+smarty', 'javascript+smarty'] alias_filenames = ['*.js', '*.tpl'] mimetypes = ['application/x-javascript+smarty', 'text/x-javascript+smarty', 'text/javascript+smarty'] def __init__(self, **options): super().__init__(JavascriptLexer, SmartyLexer, **options) def analyse_text(text): return SmartyLexer.analyse_text(text) - 0.05 class HtmlDjangoLexer(DelegatingLexer): """ Subclass of the `DjangoLexer` that highlights unlexed data with the `HtmlLexer`. Nested Javascript and CSS is highlighted too. """ name = 'HTML+Django/Jinja' aliases = ['html+django', 'html+jinja', 'htmldjango'] alias_filenames = ['*.html', '*.htm', '*.xhtml'] mimetypes = ['text/html+django', 'text/html+jinja'] def __init__(self, **options): super().__init__(HtmlLexer, DjangoLexer, **options) def analyse_text(text): rv = DjangoLexer.analyse_text(text) - 0.01 if html_doctype_matches(text): rv += 0.5 return rv class XmlDjangoLexer(DelegatingLexer): """ Subclass of the `DjangoLexer` that highlights unlexed data with the `XmlLexer`. """ name = 'XML+Django/Jinja' aliases = ['xml+django', 'xml+jinja'] alias_filenames = ['*.xml'] mimetypes = ['application/xml+django', 'application/xml+jinja'] def __init__(self, **options): super().__init__(XmlLexer, DjangoLexer, **options) def analyse_text(text): rv = DjangoLexer.analyse_text(text) - 0.01 if looks_like_xml(text): rv += 0.4 return rv class CssDjangoLexer(DelegatingLexer): """ Subclass of the `DjangoLexer` that highlights unlexed data with the `CssLexer`. """ name = 'CSS+Django/Jinja' aliases = ['css+django', 'css+jinja'] alias_filenames = ['*.css'] mimetypes = ['text/css+django', 'text/css+jinja'] def __init__(self, **options): super().__init__(CssLexer, DjangoLexer, **options) def analyse_text(text): return DjangoLexer.analyse_text(text) - 0.05 class JavascriptDjangoLexer(DelegatingLexer): """ Subclass of the `DjangoLexer` that highlights unlexed data with the `JavascriptLexer`. """ name = 'JavaScript+Django/Jinja' aliases = ['js+django', 'javascript+django', 'js+jinja', 'javascript+jinja'] alias_filenames = ['*.js'] mimetypes = ['application/x-javascript+django', 'application/x-javascript+jinja', 'text/x-javascript+django', 'text/x-javascript+jinja', 'text/javascript+django', 'text/javascript+jinja'] def __init__(self, **options): super().__init__(JavascriptLexer, DjangoLexer, **options) def analyse_text(text): return DjangoLexer.analyse_text(text) - 0.05 class JspRootLexer(RegexLexer): """ Base for the `JspLexer`. Yields `Token.Other` for area outside of JSP tags. .. versionadded:: 0.7 """ tokens = { 'root': [ (r'<%\S?', Keyword, 'sec'), # FIXME: I want to make these keywords but still parse attributes. (r'</?jsp:(forward|getProperty|include|plugin|setProperty|useBean).*?>', Keyword), (r'[^<]+', Other), (r'<', Other), ], 'sec': [ (r'%>', Keyword, '#pop'), # note: '\w\W' != '.' without DOTALL. (r'[\w\W]+?(?=%>|\Z)', using(JavaLexer)), ], } class JspLexer(DelegatingLexer): """ Lexer for Java Server Pages. .. versionadded:: 0.7 """ name = 'Java Server Page' aliases = ['jsp'] filenames = ['*.jsp'] mimetypes = ['application/x-jsp'] def __init__(self, **options): super().__init__(XmlLexer, JspRootLexer, **options) def analyse_text(text): rv = JavaLexer.analyse_text(text) - 0.01 if looks_like_xml(text): rv += 0.4 if '<%' in text and '%>' in text: rv += 0.1 return rv class EvoqueLexer(RegexLexer): """ For files using the Evoque templating system. .. versionadded:: 1.1 """ name = 'Evoque' aliases = ['evoque'] filenames = ['*.evoque'] mimetypes = ['application/x-evoque'] flags = re.DOTALL tokens = { 'root': [ (r'[^#$]+', Other), (r'#\[', Comment.Multiline, 'comment'), (r'\$\$', Other), # svn keywords (r'\$\w+:[^$\n]*\$', Comment.Multiline), # directives: begin, end (r'(\$)(begin|end)(\{(%)?)(.*?)((?(4)%)\})', bygroups(Punctuation, Name.Builtin, Punctuation, None, String, Punctuation)), # directives: evoque, overlay # see doc for handling first name arg: /directives/evoque/ # + minor inconsistency: the "name" in e.g. $overlay{name=site_base} # should be using(PythonLexer), not passed out as String (r'(\$)(evoque|overlay)(\{(%)?)(\s*[#\w\-"\'.]+[^=,%}]+?)?' r'(.*?)((?(4)%)\})', bygroups(Punctuation, Name.Builtin, Punctuation, None, String, using(PythonLexer), Punctuation)), # directives: if, for, prefer, test (r'(\$)(\w+)(\{(%)?)(.*?)((?(4)%)\})', bygroups(Punctuation, Name.Builtin, Punctuation, None, using(PythonLexer), Punctuation)), # directive clauses (no {} expression) (r'(\$)(else|rof|fi)', bygroups(Punctuation, Name.Builtin)), # expressions (r'(\$\{(%)?)(.*?)((!)(.*?))?((?(2)%)\})', bygroups(Punctuation, None, using(PythonLexer), Name.Builtin, None, None, Punctuation)), (r'#', Other), ], 'comment': [ (r'[^\]#]', Comment.Multiline), (r'#\[', Comment.Multiline, '#push'), (r'\]#', Comment.Multiline, '#pop'), (r'[\]#]', Comment.Multiline) ], } class EvoqueHtmlLexer(DelegatingLexer): """ Subclass of the `EvoqueLexer` that highlights unlexed data with the `HtmlLexer`. .. versionadded:: 1.1 """ name = 'HTML+Evoque' aliases = ['html+evoque'] filenames = ['*.html'] mimetypes = ['text/html+evoque'] def __init__(self, **options): super().__init__(HtmlLexer, EvoqueLexer, **options) class EvoqueXmlLexer(DelegatingLexer): """ Subclass of the `EvoqueLexer` that highlights unlexed data with the `XmlLexer`. .. versionadded:: 1.1 """ name = 'XML+Evoque' aliases = ['xml+evoque'] filenames = ['*.xml'] mimetypes = ['application/xml+evoque'] def __init__(self, **options): super().__init__(XmlLexer, EvoqueLexer, **options) class ColdfusionLexer(RegexLexer): """ Coldfusion statements """ name = 'cfstatement' aliases = ['cfs'] filenames = [] mimetypes = [] flags = re.IGNORECASE tokens = { 'root': [ (r'//.*?\n', Comment.Single), (r'/\*(?:.|\n)*?\*/', Comment.Multiline), (r'\+\+|--', Operator), (r'[-+*/^&=!]', Operator), (r'<=|>=|<|>|==', Operator), (r'mod\b', Operator), (r'(eq|lt|gt|lte|gte|not|is|and|or)\b', Operator), (r'\|\||&&', Operator), (r'\?', Operator), (r'"', String.Double, 'string'), # There is a special rule for allowing html in single quoted # strings, evidently. (r"'.*?'", String.Single), (r'\d+', Number), (r'(if|else|len|var|xml|default|break|switch|component|property|function|do|' r'try|catch|in|continue|for|return|while|required|any|array|binary|boolean|' r'component|date|guid|numeric|query|string|struct|uuid|case)\b', Keyword), (r'(true|false|null)\b', Keyword.Constant), (r'(application|session|client|cookie|super|this|variables|arguments)\b', Name.Constant), (r'([a-z_$][\w.]*)(\s*)(\()', bygroups(Name.Function, Text, Punctuation)), (r'[a-z_$][\w.]*', Name.Variable), (r'[()\[\]{};:,.\\]', Punctuation), (r'\s+', Text), ], 'string': [ (r'""', String.Double), (r'#.+?#', String.Interp), (r'[^"#]+', String.Double), (r'#', String.Double), (r'"', String.Double, '#pop'), ], } class ColdfusionMarkupLexer(RegexLexer): """ Coldfusion markup only """ name = 'Coldfusion' aliases = ['cf'] filenames = [] mimetypes = [] tokens = { 'root': [ (r'[^<]+', Other), include('tags'), (r'<[^<>]*', Other), ], 'tags': [ (r'', Comment), (r'<cfoutput.*?>', Name.Builtin, 'cfoutput'), (r'(?s)(<cfscript.*?>)(.+?)(</cfscript.*?>)', bygroups(Name.Builtin, using(ColdfusionLexer), Name.Builtin)), # negative lookbehind is for strings with embedded > (r'(?s)(</?cf(?:component|include|if|else|elseif|loop|return|' r'dbinfo|dump|abort|location|invoke|throw|file|savecontent|' r'mailpart|mail|header|content|zip|image|lock|argument|try|' r'catch|break|directory|http|set|function|param)\b)(.*?)((?<!\\)>)', bygroups(Name.Builtin, using(ColdfusionLexer), Name.Builtin)), ], 'cfoutput': [ (r'[^#<]+', Other), (r'(#)(.*?)(#)', bygroups(Punctuation, using(ColdfusionLexer), Punctuation)), # (r'<cfoutput.*?>', Name.Builtin, '#push'), (r'</cfoutput.*?>', Name.Builtin, '#pop'), include('tags'), (r'(?s)<[^<>]*', Other), (r'#', Other), ], 'cfcomment': [ (r'', Comment.Multiline, '#pop'), (r'([^<-]|<(?!!---)|-(?!-->))+', Comment.Multiline), ], } class ColdfusionHtmlLexer(DelegatingLexer): """ Coldfusion markup in html """ name = 'Coldfusion HTML' aliases = ['cfm'] filenames = ['*.cfm', '*.cfml'] mimetypes = ['application/x-coldfusion'] def __init__(self, **options): super().__init__(HtmlLexer, ColdfusionMarkupLexer, **options) class ColdfusionCFCLexer(DelegatingLexer): """ Coldfusion markup/script components .. versionadded:: 2.0 """ name = 'Coldfusion CFC' aliases = ['cfc'] filenames = ['*.cfc'] mimetypes = [] def __init__(self, **options): super().__init__(ColdfusionHtmlLexer, ColdfusionLexer, **options) class SspLexer(DelegatingLexer): """ Lexer for Scalate Server Pages. .. versionadded:: 1.4 """ name = 'Scalate Server Page' aliases = ['ssp'] filenames = ['*.ssp'] mimetypes = ['application/x-ssp'] def __init__(self, **options): super().__init__(XmlLexer, JspRootLexer, **options) def analyse_text(text): rv = 0.0 if re.search(r'val \w+\s*:', text): rv += 0.6 if looks_like_xml(text): rv += 0.2 if '<%' in text and '%>' in text: rv += 0.1 return rv class TeaTemplateRootLexer(RegexLexer): """ Base for the `TeaTemplateLexer`. Yields `Token.Other` for area outside of code blocks. .. versionadded:: 1.5 """ tokens = { 'root': [ (r'<%\S?', Keyword, 'sec'), (r'[^<]+', Other), (r'<', Other), ], 'sec': [ (r'%>', Keyword, '#pop'), # note: '\w\W' != '.' without DOTALL. (r'[\w\W]+?(?=%>|\Z)', using(TeaLangLexer)), ], } class TeaTemplateLexer(DelegatingLexer): """ Lexer for `Tea Templates <http://teatrove.org/>`_. .. versionadded:: 1.5 """ name = 'Tea' aliases = ['tea'] filenames = ['*.tea'] mimetypes = ['text/x-tea'] def __init__(self, **options): super().__init__(XmlLexer, TeaTemplateRootLexer, **options) def analyse_text(text): rv = TeaLangLexer.analyse_text(text) - 0.01 if looks_like_xml(text): rv += 0.4 if '<%' in text and '%>' in text: rv += 0.1 return rv class LassoHtmlLexer(DelegatingLexer): """ Subclass of the `LassoLexer` which highlights unhandled data with the `HtmlLexer`. Nested JavaScript and CSS is also highlighted. .. versionadded:: 1.6 """ name = 'HTML+Lasso' aliases = ['html+lasso'] alias_filenames = ['*.html', '*.htm', '*.xhtml', '*.lasso', '*.lasso[89]', '*.incl', '*.inc', '*.las'] mimetypes = ['text/html+lasso', 'application/x-httpd-lasso', 'application/x-httpd-lasso[89]'] def __init__(self, **options): super().__init__(HtmlLexer, LassoLexer, **options) def analyse_text(text): rv = LassoLexer.analyse_text(text) - 0.01 if html_doctype_matches(text): # same as HTML lexer rv += 0.5 return rv class LassoXmlLexer(DelegatingLexer): """ Subclass of the `LassoLexer` which highlights unhandled data with the `XmlLexer`. .. versionadded:: 1.6 """ name = 'XML+Lasso' aliases = ['xml+lasso'] alias_filenames = ['*.xml', '*.lasso', '*.lasso[89]', '*.incl', '*.inc', '*.las'] mimetypes = ['application/xml+lasso'] def __init__(self, **options): super().__init__(XmlLexer, LassoLexer, **options) def analyse_text(text): rv = LassoLexer.analyse_text(text) - 0.01 if looks_like_xml(text): rv += 0.4 return rv class LassoCssLexer(DelegatingLexer): """ Subclass of the `LassoLexer` which highlights unhandled data with the `CssLexer`. .. versionadded:: 1.6 """ name = 'CSS+Lasso' aliases = ['css+lasso'] alias_filenames = ['*.css'] mimetypes = ['text/css+lasso'] def __init__(self, **options): options['requiredelimiters'] = True super().__init__(CssLexer, LassoLexer, **options) def analyse_text(text): rv = LassoLexer.analyse_text(text) - 0.05 if re.search(r'\w+:.+?;', text): rv += 0.1 if 'padding:' in text: rv += 0.1 return rv class LassoJavascriptLexer(DelegatingLexer): """ Subclass of the `LassoLexer` which highlights unhandled data with the `JavascriptLexer`. .. versionadded:: 1.6 """ name = 'JavaScript+Lasso' aliases = ['js+lasso', 'javascript+lasso'] alias_filenames = ['*.js'] mimetypes = ['application/x-javascript+lasso', 'text/x-javascript+lasso', 'text/javascript+lasso'] def __init__(self, **options): options['requiredelimiters'] = True super().__init__(JavascriptLexer, LassoLexer, **options) def analyse_text(text): rv = LassoLexer.analyse_text(text) - 0.05 return rv class HandlebarsLexer(RegexLexer): """ Generic `handlebars <http://handlebarsjs.com/>` template lexer. Highlights only the Handlebars template tags (stuff between `{{` and `}}`). Everything else is left for a delegating lexer. .. versionadded:: 2.0 """ name = "Handlebars" aliases = ['handlebars'] tokens = { 'root': [ (r'[^{]+', Other), # Comment start {{! }} or {{!-- (r'\{\{!.*\}\}', Comment), # HTML Escaping open {{{expression (r'(\{\{\{)(\s*)', bygroups(Comment.Special, Text), 'tag'), # {{blockOpen {{#blockOpen {{/blockClose with optional tilde ~ (r'(\{\{)([#~/]+)([^\s}]*)', bygroups(Comment.Preproc, Number.Attribute, Number.Attribute), 'tag'), (r'(\{\{)(\s*)', bygroups(Comment.Preproc, Text), 'tag'), ], 'tag': [ (r'\s+', Text), # HTML Escaping close }}} (r'\}\}\}', Comment.Special, '#pop'), # blockClose}}, includes optional tilde ~ (r'(~?)(\}\})', bygroups(Number, Comment.Preproc), '#pop'), # {{opt=something}} (r'([^\s}]+)(=)', bygroups(Name.Attribute, Operator)), # Partials {{> ...}} (r'(>)(\s*)(@partial-block)', bygroups(Keyword, Text, Keyword)), (r'(#?>)(\s*)([\w-]+)', bygroups(Keyword, Text, Name.Variable)), (r'(>)(\s*)($)', bygroups(Keyword, Text, Punctuation), 'dynamic-partial'), include('generic'), ], 'dynamic-partial': [ (r'\s+', Text), (r'$', Punctuation, '#pop'), (r'(lookup)(\s+)(\.|this)(\s+)', bygroups(Keyword, Text, Name.Variable, Text)), (r'(lookup)(\s+)(\S+)', bygroups(Keyword, Text, using(this, state='variable'))), (r'[\w-]+', Name.Function), include('generic'), ], 'variable': [ (r'[()/@a-zA-Z][\w-]*', Name.Variable), (r'\.[\w-]+', Name.Variable), (r'(this\/|\.\/|(\.\.\/)+)[\w-]+', Name.Variable), ], 'generic': [ include('variable'), # borrowed from DjangoLexer (r':?"(\\\\|\\"|[^"])*"', String.Double), (r":?'(\\\\|\\'|[^'])*'", String.Single), (r"[0-9](\.[0-9]*)?(eE[+-][0-9])?[flFLdD]?|" r"0[xX][0-9a-fA-F]+[Ll]?", Number), ] } class HandlebarsHtmlLexer(DelegatingLexer): """ Subclass of the `HandlebarsLexer` that highlights unlexed data with the `HtmlLexer`. .. versionadded:: 2.0 """ name = "HTML+Handlebars" aliases = ["html+handlebars"] filenames = ['*.handlebars', '*.hbs'] mimetypes = ['text/html+handlebars', 'text/x-handlebars-template'] def __init__(self, **options): super().__init__(HtmlLexer, HandlebarsLexer, **options) class YamlJinjaLexer(DelegatingLexer): """ Subclass of the `DjangoLexer` that highlights unlexed data with the `YamlLexer`. Commonly used in Saltstack salt states. .. versionadded:: 2.0 """ name = 'YAML+Jinja' aliases = ['yaml+jinja', 'salt', 'sls'] filenames = ['*.sls'] mimetypes = ['text/x-yaml+jinja', 'text/x-sls'] def __init__(self, **options): super().__init__(YamlLexer, DjangoLexer, **options) class LiquidLexer(RegexLexer): """ Lexer for `Liquid templates <http://www.rubydoc.info/github/Shopify/liquid>`_. .. versionadded:: 2.0 """ name = 'liquid' aliases = ['liquid'] filenames = ['*.liquid'] tokens = { 'root': [ (r'[^{]+', Text), # tags and block tags (r'(\{%)(\s*)', bygroups(Punctuation, Whitespace), 'tag-or-block'), # output tags (r'(\{\{)(\s*)([^\s}]+)', bygroups(Punctuation, Whitespace, using(this, state = 'generic')), 'output'), (r'\{', Text) ], 'tag-or-block': [ # builtin logic blocks (r'(if|unless|elsif|case)(?=\s+)', Keyword.Reserved, 'condition'), (r'(when)(\s+)', bygroups(Keyword.Reserved, Whitespace), combined('end-of-block', 'whitespace', 'generic')), (r'(else)(\s*)(%\})', bygroups(Keyword.Reserved, Whitespace, Punctuation), '#pop'), # other builtin blocks (r'(capture)(\s+)([^\s%]+)(\s*)(%\})', bygroups(Name.Tag, Whitespace, using(this, state = 'variable'), Whitespace, Punctuation), '#pop'), (r'(comment)(\s*)(%\})', bygroups(Name.Tag, Whitespace, Punctuation), 'comment'), (r'(raw)(\s*)(%\})', bygroups(Name.Tag, Whitespace, Punctuation), 'raw'), # end of block (r'(end(case|unless|if))(\s*)(%\})', bygroups(Keyword.Reserved, None, Whitespace, Punctuation), '#pop'), (r'(end([^\s%]+))(\s*)(%\})', bygroups(Name.Tag, None, Whitespace, Punctuation), '#pop'), # builtin tags (assign and include are handled together with usual tags) (r'(cycle)(\s+)(?:([^\s:]*)(:))?(\s*)', bygroups(Name.Tag, Whitespace, using(this, state='generic'), Punctuation, Whitespace), 'variable-tag-markup'), # other tags or blocks (r'([^\s%]+)(\s*)', bygroups(Name.Tag, Whitespace), 'tag-markup') ], 'output': [ include('whitespace'), (r'\}\}', Punctuation, '#pop'), # end of output (r'\|', Punctuation, 'filters') ], 'filters': [ include('whitespace'), (r'\}\}', Punctuation, ('#pop', '#pop')), # end of filters and output (r'([^\s|:]+)(:?)(\s*)', bygroups(Name.Function, Punctuation, Whitespace), 'filter-markup') ], 'filter-markup': [ (r'\|', Punctuation, '#pop'), include('end-of-tag'), include('default-param-markup') ], 'condition': [ include('end-of-block'), include('whitespace'), (r'([^\s=!><]+)(\s*)([=!><]=?)(\s*)(\S+)(\s*)(%\})', bygroups(using(this, state = 'generic'), Whitespace, Operator, Whitespace, using(this, state = 'generic'), Whitespace, Punctuation)), (r'\b!', Operator), (r'\bnot\b', Operator.Word), (r'([\w.\'"]+)(\s+)(contains)(\s+)([\w.\'"]+)', bygroups(using(this, state = 'generic'), Whitespace, Operator.Word, Whitespace, using(this, state = 'generic'))), include('generic'), include('whitespace') ], 'generic-value': [ include('generic'), include('end-at-whitespace') ], 'operator': [ (r'(\s*)((=|!|>|<)=?)(\s*)', bygroups(Whitespace, Operator, None, Whitespace), '#pop'), (r'(\s*)(\bcontains\b)(\s*)', bygroups(Whitespace, Operator.Word, Whitespace), '#pop'), ], 'end-of-tag': [ (r'\}\}', Punctuation, '#pop') ], 'end-of-block': [ (r'%\}', Punctuation, ('#pop', '#pop')) ], 'end-at-whitespace': [ (r'\s+', Whitespace, '#pop') ], # states for unknown markup 'param-markup': [ include('whitespace'), # params with colons or equals (r'([^\s=:]+)(\s*)(=|:)', bygroups(Name.Attribute, Whitespace, Operator)), # explicit variables (r'(\{\{)(\s*)([^\s}])(\s*)(\}\})', bygroups(Punctuation, Whitespace, using(this, state = 'variable'), Whitespace, Punctuation)), include('string'), include('number'), include('keyword'), (r',', Punctuation) ], 'default-param-markup': [ include('param-markup'), (r'.', Text) # fallback for switches / variables / un-quoted strings / ... ], 'variable-param-markup': [ include('param-markup'), include('variable'), (r'.', Text) # fallback ], 'tag-markup': [ (r'%\}', Punctuation, ('#pop', '#pop')), # end of tag include('default-param-markup') ], 'variable-tag-markup': [ (r'%\}', Punctuation, ('#pop', '#pop')), # end of tag include('variable-param-markup') ], # states for different values types 'keyword': [ (r'\b(false|true)\b', Keyword.Constant) ], 'variable': [ (r'[a-zA-Z_]\w*', Name.Variable), (r'(?<=\w)\.(?=\w)', Punctuation) ], 'string': [ (r"'[^']*'", String.Single), (r'"[^"]*"', String.Double) ], 'number': [ (r'\d+\.\d+', Number.Float), (r'\d+', Number.Integer) ], 'generic': [ # decides for variable, string, keyword or number include('keyword'), include('string'), include('number'), include('variable') ], 'whitespace': [ (r'[ \t]+', Whitespace) ], # states for builtin blocks 'comment': [ (r'(\{%)(\s*)(endcomment)(\s*)(%\})', bygroups(Punctuation, Whitespace, Name.Tag, Whitespace, Punctuation), ('#pop', '#pop')), (r'.', Comment) ], 'raw': [ (r'[^{]+', Text), (r'(\{%)(\s*)(endraw)(\s*)(%\})', bygroups(Punctuation, Whitespace, Name.Tag, Whitespace, Punctuation), '#pop'), (r'\{', Text) ], } class TwigLexer(RegexLexer): """ `Twig <http://twig.sensiolabs.org/>`_ template lexer. It just highlights Twig code between the preprocessor directives, other data is left untouched by the lexer. .. versionadded:: 2.0 """ name = 'Twig' aliases = ['twig'] mimetypes = ['application/x-twig'] flags = re.M | re.S # Note that a backslash is included in the following two patterns # PHP uses a backslash as a namespace separator _ident_char = r'[\\\w-]|[^\x00-\x7f]' _ident_begin = r'(?:[\\_a-z]|[^\x00-\x7f])' _ident_end = r'(?:' + _ident_char + ')*' _ident_inner = _ident_begin + _ident_end tokens = { 'root': [ (r'[^{]+', Other), (r'\{\{', Comment.Preproc, 'var'), # twig comments (r'\{\#.*?\#\}', Comment), # raw twig blocks (r'(\{%)(-?\s*)(raw)(\s*-?)(%\})(.*?)' r'(\{%)(-?\s*)(endraw)(\s*-?)(%\})', bygroups(Comment.Preproc, Text, Keyword, Text, Comment.Preproc, Other, Comment.Preproc, Text, Keyword, Text, Comment.Preproc)), (r'(\{%)(-?\s*)(verbatim)(\s*-?)(%\})(.*?)' r'(\{%)(-?\s*)(endverbatim)(\s*-?)(%\})', bygroups(Comment.Preproc, Text, Keyword, Text, Comment.Preproc, Other, Comment.Preproc, Text, Keyword, Text, Comment.Preproc)), # filter blocks (r'(\{%%)(-?\s*)(filter)(\s+)(%s)' % _ident_inner, bygroups(Comment.Preproc, Text, Keyword, Text, Name.Function), 'tag'), (r'(\{%)(-?\s*)([a-zA-Z_]\w*)', bygroups(Comment.Preproc, Text, Keyword), 'tag'), (r'\{', Other), ], 'varnames': [ (r'(\|)(\s*)(%s)' % _ident_inner, bygroups(Operator, Text, Name.Function)), (r'(is)(\s+)(not)?(\s*)(%s)' % _ident_inner, bygroups(Keyword, Text, Keyword, Text, Name.Function)), (r'(?i)(true|false|none|null)\b', Keyword.Pseudo), (r'(in|not|and|b-and|or|b-or|b-xor|is' r'if|elseif|else|import' r'constant|defined|divisibleby|empty|even|iterable|odd|sameas' r'matches|starts\s+with|ends\s+with)\b', Keyword), (r'(loop|block|parent)\b', Name.Builtin), (_ident_inner, Name.Variable), (r'\.' + _ident_inner, Name.Variable), (r'\.[0-9]+', Number), (r':?"(\\\\|\\"|[^"])*"', String.Double), (r":?'(\\\\|\\'|[^'])*'", String.Single), (r'([{}()\[\]+\-*/,:~%]|\.\.|\?|:|\*\*|\/\/|!=|[><=]=?)', Operator), (r"[0-9](\.[0-9]*)?(eE[+-][0-9])?[flFLdD]?|" r"0[xX][0-9a-fA-F]+[Ll]?", Number), ], 'var': [ (r'\s+', Text), (r'(-?)(\}\})', bygroups(Text, Comment.Preproc), '#pop'), include('varnames') ], 'tag': [ (r'\s+', Text), (r'(-?)(%\})', bygroups(Text, Comment.Preproc), '#pop'), include('varnames'), (r'.', Punctuation), ], } class TwigHtmlLexer(DelegatingLexer): """ Subclass of the `TwigLexer` that highlights unlexed data with the `HtmlLexer`. .. versionadded:: 2.0 """ name = "HTML+Twig" aliases = ["html+twig"] filenames = ['*.twig'] mimetypes = ['text/html+twig'] def __init__(self, **options): super().__init__(HtmlLexer, TwigLexer, **options) class Angular2Lexer(RegexLexer): """ Generic `angular2 <http://victorsavkin.com/post/119943127151/angular-2-template-syntax>`_ template lexer. Highlights only the Angular template tags (stuff between `{{` and `}}` and special attributes: '(event)=', '[property]=', '[(twoWayBinding)]='). Everything else is left for a delegating lexer. .. versionadded:: 2.1 """ name = "Angular2" aliases = ['ng2'] tokens = { 'root': [ (r'[^{([*#]+', Other), # {{meal.name}} (r'(\{\{)(\s*)', bygroups(Comment.Preproc, Text), 'ngExpression'), # (click)="deleteOrder()"; [value]="test"; [(twoWayTest)]="foo.bar" (r'([([]+)([\w:.-]+)([\])]+)(\s*)(=)(\s*)', bygroups(Punctuation, Name.Attribute, Punctuation, Text, Operator, Text), 'attr'), (r'([([]+)([\w:.-]+)([\])]+)(\s*)', bygroups(Punctuation, Name.Attribute, Punctuation, Text)), # *ngIf="..."; #f="ngForm" (r'([*#])([\w:.-]+)(\s*)(=)(\s*)', bygroups(Punctuation, Name.Attribute, Text, Operator, Text), 'attr'), (r'([*#])([\w:.-]+)(\s*)', bygroups(Punctuation, Name.Attribute, Text)), ], 'ngExpression': [ (r'\s+(\|\s+)?', Text), (r'\}\}', Comment.Preproc, '#pop'), # Literals (r':?(true|false)', String.Boolean), (r':?"(\\\\|\\"|[^"])*"', String.Double), (r":?'(\\\\|\\'|[^'])*'", String.Single), (r"[0-9](\.[0-9]*)?(eE[+-][0-9])?[flFLdD]?|" r"0[xX][0-9a-fA-F]+[Ll]?", Number), # Variabletext (r'[a-zA-Z][\w-]*($.*$)?', Name.Variable), (r'\.[\w-]+($.*$)?', Name.Variable), # inline If (r'(\?)(\s*)([^}\s]+)(\s*)(:)(\s*)([^}\s]+)(\s*)', bygroups(Operator, Text, String, Text, Operator, Text, String, Text)), ], 'attr': [ ('".*?"', String, '#pop'), ("'.*?'", String, '#pop'), (r'[^\s>]+', String, '#pop'), ], } class Angular2HtmlLexer(DelegatingLexer): """ Subclass of the `Angular2Lexer` that highlights unlexed data with the `HtmlLexer`. .. versionadded:: 2.0 """ name = "HTML + Angular2" aliases = ["html+ng2"] filenames = ['*.ng2'] def __init__(self, **options): super().__init__(HtmlLexer, Angular2Lexer, **options)

31.587766

89

0.495931

c10810c72bd415507fd08f829d642393752240a3

5,633

py

Python

depccg/semantics/ccg2lambda/parse.py

erezagami/depccg

15347f93e4c6c923c343e53bcb873e0f2f954446

[ "MIT" ]

null

depccg/semantics/ccg2lambda/parse.py

erezagami/depccg

15347f93e4c6c923c343e53bcb873e0f2f954446

[ "MIT" ]

null

depccg/semantics/ccg2lambda/parse.py

erezagami/depccg

15347f93e4c6c923c343e53bcb873e0f2f954446

[ "MIT" ]

null

#!/usr/bin/python3 # -*- coding: utf-8 -*- # # Copyright 2015 Pascual Martinez-Gomez # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import logging from lxml import etree from multiprocessing import Pool from multiprocessing import Lock import os import sys from nltk.sem.logic import LogicalExpressionException from .ccg2lambda_tools import assign_semantics_to_ccg from .semantic_index import SemanticIndex from .logic_parser import lexpr from .nltk2normal import remove_true logger = logging.getLogger(__name__) SEMANTIC_INDEX=None GOLD_TREES=True NBEST=0 SENTENCES=None kMaxTasksPerChild=None lock = Lock() def parse(ccg, templates, nbest=0, ncores=3): global SEMANTIC_INDEX global SENTENCES global NBEST NBEST = nbest if not os.path.exists(templates): print('File does not exist: {0}'.format(templates)) sys.exit(1) logger.info(templates) SEMANTIC_INDEX = SemanticIndex(templates) SENTENCES = ccg.findall('.//sentence') sentence_inds = range(len(SENTENCES)) sem_nodes_lists = semantic_parse_sentences(sentence_inds, ncores) assert len(sem_nodes_lists) == len(SENTENCES), \ 'Element mismatch: {0} vs {1}'.format(len(sem_nodes_lists), len(SENTENCES)) logging.info('Adding XML semantic nodes to sentences...') formulas_list = [] for sentence, (sem_nodes, formulas) in zip(SENTENCES, sem_nodes_lists): formulas = [str(remove_true(lexpr(formula))) for formula in formulas] formulas_list.append(formulas) sentence.extend(sem_nodes) logging.info('Finished adding XML semantic nodes to sentences.') root_xml_str = serialize_tree(ccg) return root_xml_str, formulas_list def semantic_parse_sentences(sentence_inds, ncores=1): if ncores <= 1: sem_nodes_lists = semantic_parse_sentences_seq(sentence_inds) else: sem_nodes_lists = semantic_parse_sentences_par(sentence_inds, ncores) results = [([etree.fromstring(s) for s in sem_nodes], formulas) for sem_nodes, formulas in sem_nodes_lists] return results def semantic_parse_sentences_par(sentence_inds, ncores=3): pool = Pool(processes=ncores, maxtasksperchild=kMaxTasksPerChild) results = pool.map(semantic_parse_sentence, sentence_inds) pool.close() pool.join() return results def semantic_parse_sentences_seq(sentence_inds): results = [] for sentence_ind in sentence_inds: result = semantic_parse_sentence(sentence_ind) results.append(result) return results def semantic_parse_sentence(sentence_ind): """ `sentence` is an lxml tree with tokens and ccg nodes. It returns an lxml semantics node. """ global lock sentence = SENTENCES[sentence_ind] sem_nodes = [] formulas = [] tree_indices = [int(sentence.get('gold_tree', '0')) + 1] if NBEST != 1: tree_indices = get_tree_indices(sentence, NBEST) for tree_index in tree_indices: sem_node = etree.Element('semantics') try: sem_tree = assign_semantics_to_ccg( sentence, SEMANTIC_INDEX, tree_index) filter_attributes(sem_tree) sem_node.extend(sem_tree.xpath('.//descendant-or-self::span')) sem_node.set('status', 'success') sem_node.set('ccg_id', sentence.xpath('./ccg[{0}]/@id'.format(tree_index))[0]) sem_node.set('root', sentence.xpath('./ccg[{0}]/@root'.format(tree_index))[0]) formulas.append(sem_tree.attrib['sem']) except Exception as e: sem_node.set('status', 'failed') # from pudb import set_trace; set_trace() sentence_surf = ' '.join(sentence.xpath('tokens/token/@surf')) lock.acquire() logging.error('An error occurred: {0}\nSentence: {1}\nTree XML:\n{2}'.format( e, sentence_surf, etree.tostring(sentence, encoding='utf-8', pretty_print=True).decode('utf-8'))) lock.release() # print('x', end='', file=sys.stdout) formulas.append('FAILED!') sem_nodes.append(sem_node) sem_nodes = [etree.tostring(sem_node) for sem_node in sem_nodes] return sem_nodes, formulas def get_tree_indices(sentence, nbest): num_ccg_trees = int(sentence.xpath('count(./ccg)')) if nbest < 1: nbest = num_ccg_trees return list(range(1, min(nbest, num_ccg_trees) + 1)) keep_attributes = set(['id', 'child', 'sem', 'type']) def filter_attributes(tree): if 'coq_type' in tree.attrib and 'child' not in tree.attrib: sem_type = \ tree.attrib['coq_type'].lstrip('["Parameter ').rstrip('."]') if sem_type: tree.attrib['type'] = sem_type attrib_to_delete = [a for a in tree.attrib.keys() if a not in keep_attributes] for a in attrib_to_delete: del tree.attrib[a] for child in tree: filter_attributes(child) return def serialize_tree(tree): tree_str = etree.tostring( tree, xml_declaration=True, encoding='utf-8', pretty_print=True) return tree_str

36.108974

95

0.677614

996f58cbc1164e772d7255dfc0e1f0c8068bf623

19,516

py

Python

kedro/template/{{ cookiecutter.repo_name }}/kedro_cli.py

andmikey/kedro

9b4e4135720609d44ffdf5248246fe805f0b5469

[ "Apache-2.0" ]

null

kedro/template/{{ cookiecutter.repo_name }}/kedro_cli.py

andmikey/kedro

9b4e4135720609d44ffdf5248246fe805f0b5469

[ "Apache-2.0" ]

null

kedro/template/{{ cookiecutter.repo_name }}/kedro_cli.py

andmikey/kedro

9b4e4135720609d44ffdf5248246fe805f0b5469

[ "Apache-2.0" ]

null

# Copyright 2018-2019 QuantumBlack Visual Analytics Limited # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, # EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES # OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE, AND # NONINFRINGEMENT. IN NO EVENT WILL THE LICENSOR OR OTHER CONTRIBUTORS # BE LIABLE FOR ANY CLAIM, DAMAGES, OR OTHER LIABILITY, WHETHER IN AN # ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF, OR IN # CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. # # The QuantumBlack Visual Analytics Limited ("QuantumBlack") name and logo # (either separately or in combination, "QuantumBlack Trademarks") are # trademarks of QuantumBlack. The License does not grant you any right or # license to the QuantumBlack Trademarks. You may not use the QuantumBlack # Trademarks or any confusingly similar mark as a trademark for your product, # or use the QuantumBlack Trademarks in any other manner that might cause # confusion in the marketplace, including but not limited to in advertising, # on websites, or on software. # # See the License for the specific language governing permissions and # limitations under the License. """Command line tools for manipulating a Kedro project. Intended to be invoked via `kedro`.""" import os import re import shutil import subprocess import sys import webbrowser from collections import Counter from glob import iglob from pathlib import Path from typing import Any, Dict, Iterable, List import anyconfig import click from click import secho, style from kedro.cli import main as kedro_main from kedro.cli.utils import ( KedroCliError, call, export_nodes, forward_command, python_call, ) from kedro.context import KEDRO_ENV_VAR, load_context from kedro.runner import SequentialRunner from kedro.utils import load_obj CONTEXT_SETTINGS = dict(help_option_names=["-h", "--help"]) # get our package onto the python path PROJ_PATH = Path(__file__).resolve().parent os.environ["IPYTHONDIR"] = str(PROJ_PATH / ".ipython") NO_DEPENDENCY_MESSAGE = """{0} is not installed. Please make sure {0} is in src/requirements.txt and run `kedro install`.""" TAG_ARG_HELP = """Construct the pipeline using only nodes which have this tag attached. Option can be used multiple times, what results in a pipeline constructed from nodes having any of those tags.""" PIPELINE_ARG_HELP = """Name of the modular pipeline to run. If not set, the project pipeline is run by default.""" ENV_ARG_HELP = """Run the pipeline in a configured environment. If not specified, pipeline will run using environment `local`.""" NODE_ARG_HELP = """Run only nodes with specified names.""" FROM_NODES_HELP = """A list of node names which should be used as a starting point.""" TO_NODES_HELP = """A list of node names which should be used as an end point.""" FROM_INPUTS_HELP = ( """A list of dataset names which should be used as a starting point.""" ) PARALLEL_ARG_HELP = """Run the pipeline using the `ParallelRunner`. If not specified, use the `SequentialRunner`. This flag cannot be used together with --runner.""" OPEN_ARG_HELP = """Open the documentation in your default browser after building.""" RUNNER_ARG_HELP = """Specify a runner that you want to run the pipeline with. This option cannot be used together with --parallel.""" CONVERT_ALL_HELP = """Extract the nodes from all notebooks in the Kedro project directory, including sub-folders.""" OVERWRITE_HELP = """If Python file already exists for the equivalent notebook, overwrite its contents.""" LOAD_VERSION_HELP = """Specify a particular dataset version (timestamp) for loading.""" CONFIG_FILE_HELP = """Specify a YAML configuration file to load the run command arguments from. If command line arguments are provided, they will override the loaded ones.""" PARAMS_ARG_HELP = """Specify extra parameters that you want to pass to the context initializer. Items must be separated by comma, keys - by colon, example: param1:value1,param2:value2. Each parameter is split by the first comma, so parameter values are allowed to contain colons, parameter keys are not.""" def _split_string(ctx, param, value): return [item for item in value.split(",") if item] def _split_params(ctx, param, value): result = {} for item in _split_string(ctx, param, value): item = item.split(":", 1) if len(item) != 2: ctx.fail( "Invalid format of `{}` option: Item `{}` must contain a key and " "a value separated by `:`.".format(param.name, item[0]) ) key = item[0].strip() if not key: ctx.fail( "Invalid format of `{}` option: Parameter key cannot be " "an empty string.".format(param.name) ) value = item[1].strip() try: value = float(value) except ValueError: pass else: value = int(value) if value.is_integer() else value result[key] = value return result def _reformat_load_versions(ctx, param, value) -> Dict[str, str]: """Reformat data structure from tuple to dictionary for `load-version`. E.g ('dataset1:time1', 'dataset2:time2') -> {"dataset1": "time1", "dataset2": "time2"}. """ load_version_separator = ":" load_versions_dict = {} for load_version in value: load_version_list = load_version.split(load_version_separator, 1) if len(load_version_list) != 2: raise ValueError( "Expected the form of `load_version` to be " "`dataset_name:YYYY-MM-DDThh.mm.ss.sssZ`," "found {} instead".format(load_version) ) load_versions_dict[load_version_list[0]] = load_version_list[1] return load_versions_dict def _config_file_callback(ctx, param, value): """Config file callback, that replaces command line options with config file values. If command line options are passed, they override config file values. """ ctx.default_map = ctx.default_map or {} section = ctx.info_name if value: config = anyconfig.load(value)[section] ctx.default_map.update(config) return value @click.group(context_settings=CONTEXT_SETTINGS, name=__file__) def cli(): """Command line tools for manipulating a Kedro project.""" @cli.command() @click.option( "--from-inputs", type=str, default="", help=FROM_INPUTS_HELP, callback=_split_string ) @click.option( "--from-nodes", type=str, default="", help=FROM_NODES_HELP, callback=_split_string ) @click.option( "--to-nodes", type=str, default="", help=TO_NODES_HELP, callback=_split_string ) @click.option("--node", "-n", "node_names", type=str, multiple=True, help=NODE_ARG_HELP) @click.option( "--runner", "-r", type=str, default=None, multiple=False, help=RUNNER_ARG_HELP ) @click.option("--parallel", "-p", is_flag=True, multiple=False, help=PARALLEL_ARG_HELP) @click.option( "--env", "-e", type=str, default=None, multiple=False, envvar=KEDRO_ENV_VAR, help=ENV_ARG_HELP, ) @click.option("--tag", "-t", type=str, multiple=True, help=TAG_ARG_HELP) @click.option( "--load-version", "-lv", type=str, multiple=True, help=LOAD_VERSION_HELP, callback=_reformat_load_versions, ) @click.option("--pipeline", type=str, default=None, help=PIPELINE_ARG_HELP) @click.option( "--config", "-c", type=click.Path(exists=True, dir_okay=False, resolve_path=True), help=CONFIG_FILE_HELP, callback=_config_file_callback, ) @click.option( "--params", type=str, default="", help=PARAMS_ARG_HELP, callback=_split_params ) def run( tag, env, parallel, runner, node_names, to_nodes, from_nodes, from_inputs, load_version, pipeline, config, params, ): """Run the pipeline.""" if parallel and runner: raise KedroCliError( "Both --parallel and --runner options cannot be used together. " "Please use either --parallel or --runner." ) if parallel: runner = "ParallelRunner" runner_class = load_obj(runner, "kedro.runner") if runner else SequentialRunner context = load_context(Path.cwd(), env=env, extra_params=params) context.run( tags=tag, runner=runner_class(), node_names=node_names, from_nodes=from_nodes, to_nodes=to_nodes, from_inputs=from_inputs, load_versions=load_version, pipeline_name=pipeline, ) @forward_command(cli, forward_help=True) def test(args): """Run the test suite.""" try: import pytest # pylint: disable=unused-import except ImportError: raise KedroCliError(NO_DEPENDENCY_MESSAGE.format("pytest")) else: python_call("pytest", args) @cli.command() @click.argument("files", type=click.Path(exists=True), nargs=-1) def lint(files): """Run flake8, isort and (on Python >=3.6) black.""" # pylint: disable=unused-import if not files: files = ("src/tests", "src/{{ cookiecutter.python_package }}") try: import flake8 import isort except ImportError as exc: raise KedroCliError(NO_DEPENDENCY_MESSAGE.format(exc.name)) python_call("flake8", ("--max-line-length=88",) + files) python_call("isort", ("-rc", "-tc", "-up", "-fgw=0", "-m=3", "-w=88") + files) if sys.version_info[:2] >= (3, 6): try: import black except ImportError: raise KedroCliError(NO_DEPENDENCY_MESSAGE.format("black")) python_call("black", files) @cli.command() def install(): """Install project dependencies from both requirements.txt and environment.yml (optional).""" if (Path.cwd() / "src" / "environment.yml").is_file(): call(["conda", "install", "--file", "src/environment.yml", "--yes"]) pip_command = ["install", "-U", "-r", "src/requirements.txt"] if os.name == "posix": python_call("pip", pip_command) else: command = [sys.executable, "-m", "pip"] + pip_command subprocess.Popen(command, creationflags=subprocess.CREATE_NEW_CONSOLE) @forward_command(cli, forward_help=True) def ipython(args): """Open IPython with project specific variables loaded.""" if "-h" not in args and "--help" not in args: ipython_message() call(["ipython"] + list(args)) @cli.command() def package(): """Package the project as a Python egg and wheel.""" call([sys.executable, "setup.py", "clean", "--all", "bdist_egg"], cwd="src") call([sys.executable, "setup.py", "clean", "--all", "bdist_wheel"], cwd="src") @cli.command("build-docs") @click.option( "--open", "-o", "open_docs", is_flag=True, multiple=False, default=False, help=OPEN_ARG_HELP, ) def build_docs(open_docs): """Build the project documentation.""" python_call("pip", ["install", "src/[docs]"]) python_call("pip", ["install", "-r", "src/requirements.txt"]) python_call( "ipykernel", ["install", "--user", "--name={{ cookiecutter.python_package }}"] ) shutil.rmtree("docs/build", ignore_errors=True) call( [ "sphinx-apidoc", "--module-first", "-o", "docs/source", "src/{{ cookiecutter.python_package }}", ] ) call(["sphinx-build", "-M", "html", "docs/source", "docs/build", "-a"]) if open_docs: docs_page = (Path.cwd() / "docs" / "build" / "html" / "index.html").as_uri() secho("Opening {}".format(docs_page)) webbrowser.open(docs_page) @cli.command("build-reqs") def build_reqs(): """Build the project dependency requirements.""" requirements_path = Path.cwd() / "src" / "requirements.in" if not requirements_path.is_file(): secho("No requirements.in found. Copying contents from requirements.txt...") contents = (Path.cwd() / "src" / "requirements.txt").read_text() requirements_path.write_text(contents) python_call("piptools", ["compile", str(requirements_path)]) secho( ( "Requirements built! Please update requirements.in " "if you'd like to make a change in your project's dependencies, " "and re-run build-reqs to generate the new requirements.txt." ) ) @cli.command("activate-nbstripout") def activate_nbstripout(): """Install the nbstripout git hook to automatically clean notebooks.""" secho( ( "Notebook output cells will be automatically cleared before committing" " to git." ), fg="yellow", ) try: import nbstripout # pylint: disable=unused-import except ImportError: raise KedroCliError(NO_DEPENDENCY_MESSAGE.format("nbstripout")) try: res = subprocess.run( ["git", "rev-parse", "--git-dir"], stdout=subprocess.PIPE, stderr=subprocess.PIPE, ) if res.returncode: raise KedroCliError("Not a git repository. Run `git init` first.") except FileNotFoundError: raise KedroCliError("Git executable not found. Install Git first.") call(["nbstripout", "--install"]) def _build_jupyter_command( base: str, ip: str, all_kernels: bool, args: Iterable[str] ) -> List[str]: cmd = [base, "--ip", ip] if not all_kernels: project_name = "{{ cookiecutter.project_name }}" kernel_name = re.sub(r"[^\w]+", "", project_name).strip() or "Kedro" cmd += [ "--NotebookApp.kernel_spec_manager_class=kedro.cli.jupyter.SingleKernelSpecManager", "--KernelSpecManager.default_kernel_name='{}'".format(kernel_name), ] return cmd + list(args) def _build_jupyter_env(kedro_env: str) -> Dict[str, Any]: """Build the environment dictionary that gets injected into the subprocess running Jupyter. Since the subprocess has access only to the environment variables passed in, we need to copy the current environment and add ``KEDRO_ENV_VAR``. """ if not kedro_env: return {} jupyter_env = os.environ.copy() jupyter_env[KEDRO_ENV_VAR] = kedro_env return {"env": jupyter_env} @cli.group() def jupyter(): """Open Jupyter Notebook / Lab with project specific variables loaded, or convert notebooks into Kedro code. """ @forward_command(jupyter, "notebook", forward_help=True) @click.option("--ip", type=str, default="127.0.0.1") @click.option("--all-kernels", is_flag=True, default=False) @click.option( "--env", "-e", type=str, default=None, multiple=False, envvar=KEDRO_ENV_VAR, help=ENV_ARG_HELP, ) def jupyter_notebook(ip, all_kernels, env, args): """Open Jupyter Notebook with project specific variables loaded.""" if "-h" not in args and "--help" not in args: ipython_message(all_kernels) arguments = _build_jupyter_command( "notebook", ip=ip, all_kernels=all_kernels, args=args ) python_call_kwargs = _build_jupyter_env(env) python_call("jupyter", arguments, **python_call_kwargs) @forward_command(jupyter, "lab", forward_help=True) @click.option("--ip", type=str, default="127.0.0.1") @click.option("--all-kernels", is_flag=True, default=False) @click.option( "--env", "-e", type=str, default=None, multiple=False, envvar=KEDRO_ENV_VAR, help=ENV_ARG_HELP, ) def jupyter_lab(ip, all_kernels, env, args): """Open Jupyter Lab with project specific variables loaded.""" if "-h" not in args and "--help" not in args: ipython_message(all_kernels) arguments = _build_jupyter_command("lab", ip=ip, all_kernels=all_kernels, args=args) python_call_kwargs = _build_jupyter_env(env) python_call("jupyter", arguments, **python_call_kwargs) @jupyter.command("convert") @click.option("--all", "all_flag", is_flag=True, help=CONVERT_ALL_HELP) @click.option("-y", "overwrite_flag", is_flag=True, help=OVERWRITE_HELP) @click.argument( "filepath", type=click.Path(exists=True, dir_okay=False, resolve_path=True), required=False, nargs=-1, ) def convert_notebook(all_flag, overwrite_flag, filepath): """Convert selected or all notebooks found in a Kedro project to Kedro code, by exporting code from the appropriately-tagged cells: Cells tagged as `node` will be copied over to a Python file matching the name of the notebook, under `src/<package_name>/nodes`. *Note*: Make sure your notebooks have unique names! FILEPATH: Path(s) to exact notebook file(s) to be converted. Both relative and absolute paths are accepted. Should not be provided if --all flag is already present. """ context = load_context(Path.cwd()) if not filepath and not all_flag: secho( "Please specify a notebook filepath " "or add '--all' to convert all notebooks." ) sys.exit(1) kedro_project_path = context.project_path kedro_package_name = "{{cookiecutter.python_package}}" if all_flag: # pathlib glob does not ignore hidden directories, # whereas Python glob does, which is more useful in # ensuring checkpoints will not be included pattern = kedro_project_path / "**" / "*.ipynb" notebooks = sorted(Path(p) for p in iglob(str(pattern), recursive=True)) else: notebooks = [Path(f) for f in filepath] counter = Counter(n.stem for n in notebooks) non_unique_names = [name for name, counts in counter.items() if counts > 1] if non_unique_names: raise KedroCliError( "Found non-unique notebook names! " "Please rename the following: {}".format(", ".join(non_unique_names)) ) for notebook in notebooks: secho("Converting notebook '{}'...".format(str(notebook))) output_path = ( kedro_project_path / "src" / kedro_package_name / "nodes" / "{}.py".format(notebook.stem) ) if output_path.is_file(): overwrite = overwrite_flag or click.confirm( "Output file {} already exists. Overwrite?".format(str(output_path)), default=False, ) if overwrite: export_nodes(notebook, output_path) else: export_nodes(notebook, output_path) secho("Done!") def ipython_message(all_kernels=True): """Show a message saying how we have configured the IPython env.""" ipy_vars = ["startup_error", "context"] secho("-" * 79, fg="cyan") secho("Starting a Kedro session with the following variables in scope") secho(", ".join(ipy_vars), fg="green") secho( "Use the line magic {} to refresh them".format( style("%reload_kedro", fg="green") ) ) secho("or to see the error message if they are undefined") if not all_kernels: secho("The choice of kernels is limited to the default one.", fg="yellow") secho("(restart with --all-kernels to get access to others)", fg="yellow") secho("-" * 79, fg="cyan") if __name__ == "__main__": os.chdir(str(PROJ_PATH)) kedro_main()

32.966216

96

0.660228

122d5cb2917c380c4e070985bb2c90648ddff57a

414

py

Python

hangie.py

Srinivassan-Ramamurthy/python_programs

53b390669c7e88532c67d80b758a9199d6fde8cf

[ "bzip2-1.0.6" ]

null

hangie.py

Srinivassan-Ramamurthy/python_programs

53b390669c7e88532c67d80b758a9199d6fde8cf

[ "bzip2-1.0.6" ]

null

hangie.py

Srinivassan-Ramamurthy/python_programs

53b390669c7e88532c67d80b758a9199d6fde8cf

[ "bzip2-1.0.6" ]

null

hangman=[' _______',' |/ |',' | (_)',' | \|/',' | |',' | / \\',' |',' _|___'] a='aeroplane' c=[] for i in a: c.append('_ ') print(*c) n=len(a) def inp(): user=input("enter the word") for i in range(len(a)): if(a[i] == user): c[i] = user print(*c) for i in range(8): inp()

20.7

135

0.321256

29ec37c71cdee3430a2cc2065ec481d0b1ed6bf4

455

py

Python

tests/small-build/test_api.py

NaxoAI/conceptnet5

2ec9fbff06d63fc303f8f2b1b62fd1ceed8e4b74

[ "Apache-2.0" ]

null

tests/small-build/test_api.py

NaxoAI/conceptnet5

2ec9fbff06d63fc303f8f2b1b62fd1ceed8e4b74

[ "Apache-2.0" ]

null

tests/small-build/test_api.py

NaxoAI/conceptnet5

2ec9fbff06d63fc303f8f2b1b62fd1ceed8e4b74

[ "Apache-2.0" ]

1

2021-08-05T13:34:32.000Z

from conceptnet5 import api from nose.tools import eq_ def test_related_query(): # Test that we can look up related terms result = api.query_related('/c/en/test', limit=3) eq_(len(result['related']), 3) def test_related_query_malformed(): # Test that we fulfill a query for related terms to a nonsense URI, and # there are simply no results result = api.query_related('/c/en,test', limit=3) eq_(len(result['related']), 0)

26.764706

75

0.696703

3ea08a45f63f2f005ce24582aa32c12b73c4a15e

115

py

Python

aws_config/configure/config_utils.py

rwalk/straw

1940d521538635d5eab394d0ed4c87caf366b0c7

[ "MIT" ]

58

2016-06-03T18:16:32.000Z

2021-08-11T19:01:03.000Z

aws_config/configure/config_utils.py

rwalk333/straw

1940d521538635d5eab394d0ed4c87caf366b0c7

[ "MIT" ]

1

2019-08-22T14:22:14.000Z

aws_config/configure/config_utils.py

rwalk/straw

1940d521538635d5eab394d0ed4c87caf366b0c7

[ "MIT" ]

18

2016-06-23T02:24:51.000Z

2022-01-20T11:17:53.000Z

#!/usr/bin/python3 def quiet_wrap(cmd): return(" ".join(["nohup",cmd, "< /dev/null > std.out 2> std.err &"]))

23

73

0.582609

b22d31bee0f54f3f318466edea3b4df9e587a99b

299

py

Python

output/models/nist_data/atomic/unsigned_byte/schema_instance/nistschema_sv_iv_atomic_unsigned_byte_min_inclusive_1_xsd/__init__.py

tefra/xsdata-w3c-tests

b6b6a4ac4e0ab610e4b50d868510a8b7105b1a5f

[ "MIT" ]

1

2021-08-14T17:59:21.000Z

output/models/nist_data/atomic/unsigned_byte/schema_instance/nistschema_sv_iv_atomic_unsigned_byte_min_inclusive_1_xsd/__init__.py

tefra/xsdata-w3c-tests

b6b6a4ac4e0ab610e4b50d868510a8b7105b1a5f

[ "MIT" ]

4

2020-02-12T21:30:44.000Z

2020-04-15T20:06:46.000Z

output/models/nist_data/atomic/unsigned_byte/schema_instance/nistschema_sv_iv_atomic_unsigned_byte_min_inclusive_1_xsd/__init__.py

tefra/xsdata-w3c-tests

b6b6a4ac4e0ab610e4b50d868510a8b7105b1a5f

[ "MIT" ]

null

from output.models.nist_data.atomic.unsigned_byte.schema_instance.nistschema_sv_iv_atomic_unsigned_byte_min_inclusive_1_xsd.nistschema_sv_iv_atomic_unsigned_byte_min_inclusive_1 import NistschemaSvIvAtomicUnsignedByteMinInclusive1 __all__ = [ "NistschemaSvIvAtomicUnsignedByteMinInclusive1", ]

49.833333

230

0.909699

89a352d5cf8a637b912708e03cd14b07232e67d5

3,306

py

Python

mmdet/models/roi_heads/roi_extractors/generic_roi_extractor.py

yypurpose/mmdetection

ec6bfd96eae0af047c623f3d1ec31b0b3f1f4a6c

[ "Apache-2.0" ]

null

mmdet/models/roi_heads/roi_extractors/generic_roi_extractor.py

yypurpose/mmdetection

ec6bfd96eae0af047c623f3d1ec31b0b3f1f4a6c

[ "Apache-2.0" ]

null

mmdet/models/roi_heads/roi_extractors/generic_roi_extractor.py

yypurpose/mmdetection

ec6bfd96eae0af047c623f3d1ec31b0b3f1f4a6c

[ "Apache-2.0" ]

null

from mmcv.cnn.bricks import build_plugin_layer from mmcv.runner import force_fp32 from mmdet.models.builder import ROI_EXTRACTORS from .base_roi_extractor import BaseRoIExtractor @ROI_EXTRACTORS.register_module() class GenericRoIExtractor(BaseRoIExtractor): """Extract RoI features from all level feature maps levels. This is the implementation of `A novel Region of Interest Extraction Layer for Instance Segmentation <https://arxiv.org/abs/2004.13665>`_. Args: aggregation (str): The method to aggregate multiple feature maps. Options are 'sum', 'concat'. Default: 'sum'. pre_cfg (dict | None): Specify pre-processing modules. Default: None. post_cfg (dict | None): Specify post-processing modules. Default: None. kwargs (keyword arguments): Arguments that are the same as :class:`BaseRoIExtractor`. """ def __init__(self, aggregation='sum', pre_cfg=None, post_cfg=None, **kwargs): super(GenericRoIExtractor, self).__init__(**kwargs) assert aggregation in ['sum', 'concat'] self.aggregation = aggregation self.with_post = post_cfg is not None self.with_pre = pre_cfg is not None # build pre/post processing modules if self.with_post: self.post_module = build_plugin_layer(post_cfg, '_post_module')[1] if self.with_pre: self.pre_module = build_plugin_layer(pre_cfg, '_pre_module')[1] @force_fp32(apply_to=('feats', ), out_fp16=True) def forward(self, feats, rois, roi_scale_factor=None): """Forward function.""" if len(feats) == 1: return self.roi_layers[0](feats[0], rois) out_size = self.roi_layers[0].output_size num_levels = len(feats) roi_feats = feats[0].new_zeros( rois.size(0), self.out_channels, *out_size) # some times rois is an empty tensor if roi_feats.shape[0] == 0: return roi_feats if roi_scale_factor is not None: rois = self.roi_rescale(rois, roi_scale_factor) # mark the starting channels for concat mode start_channels = 0 for i in range(num_levels): roi_feats_t = self.roi_layers[i](feats[i], rois) end_channels = start_channels + roi_feats_t.size(1) if self.with_pre: # apply pre-processing to a RoI extracted from each layer roi_feats_t = self.pre_module(roi_feats_t) if self.aggregation == 'sum': # and sum them all roi_feats += roi_feats_t else: # and concat them along channel dimension roi_feats[:, start_channels:end_channels] = roi_feats_t # update channels starting position start_channels = end_channels # check if concat channels match at the end if self.aggregation == 'concat': assert start_channels == self.out_channels if self.with_post: # apply post-processing before return the result roi_feats = self.post_module(roi_feats) return roi_feats

39.357143

80

0.613128

45372e214f923de5d79ced5fa1ccf9adf7237631

4,187

py

Python

iblrig/fake_task_settings.py

int-brain-lab/iblr

18569278fc2d8cd3266adb2a5f660a43f8f2582e

[ "MIT" ]

13

2018-08-07T21:56:08.000Z

2021-12-06T17:53:37.000Z

iblrig/fake_task_settings.py

int-brain-lab/iblr

18569278fc2d8cd3266adb2a5f660a43f8f2582e

[ "MIT" ]

360

2018-07-24T16:35:26.000Z

2022-03-23T15:28:56.000Z

iblrig/fake_task_settings.py

int-brain-lab/iblr

18569278fc2d8cd3266adb2a5f660a43f8f2582e

[ "MIT" ]

15

2019-03-12T16:25:05.000Z

2021-09-06T10:30:24.000Z

# ============================================================================= # TASK PARAMETER DEFINITION (should appear on GUI) init trial objects values # ============================================================================= # IBL rig root folder IBLRIG_FOLDER = "C:\\iblrig" IBLRIG_DATA_FOLDER = None # If None data folder will be ..\\iblrig_data from IBLRIG_FOLDER # noqa # SOUND, AMBIENT SENSOR, AND VIDEO RECORDINGS RECORD_SOUND = True RECORD_AMBIENT_SENSOR_DATA = True # REWARDS AUTOMATIC_CALIBRATION = True # Wether to look for a calibration session and func to define the valve opening time # noqa CALIBRATION_VALUE = ( 0.067 # calibration value for 3ul of target reward amount (ignored if automatic ON) # noqa ) REWARD_AMOUNT = 3.0 # (µl) Amount of reward to be delivered upon correct choice each trial (overwitten if adaptive ON) # noqa REWARD_TYPE = "Water 10% Sucrose" # Water, Water 10% Sucrose, Water 15% Sucrose, Water 2% Citric Acid (Guo et al.. PLoS One 2014) # noqa # TASK NTRIALS = 2000 # Number of trials for the current session USE_AUTOMATIC_STOPPING_CRITERIONS = ( True # Weather to check for the Automatic stopping criterions or not # noqa ) USE_VISUAL_STIMULUS = True # Run the visual stim in bonsai BONSAI_EDITOR = False # Whether to open the visual stim Bonsai editor or not REPEAT_ON_ERROR = True # STATE TIMERS QUIESCENCE_THRESHOLDS = [-2, 2] # degree QUIESCENT_PERIOD = 0.2 # + x, where x~exp(0.35), t ∈ 0.2 <= R <= 0.5 INTERACTIVE_DELAY = 0.0 # (s) how long after stim onset the CL starts RESPONSE_WINDOW = 60 # Time to move the wheel after go tone (seconds) ITI_CORRECT = 1 # how long the stim should stay visible after CORRECT choice ITI_ERROR = 2 # how long the stim should stay visible after ERROR choice # VISUAL STIM STIM_POSITIONS = [-35, 35] # All possible positions for this session (deg) STIM_PROBABILITY_LEFT = 0.5 STIM_FREQ = 0.10 # Probably constant - NOT IN USE STIM_ANGLE = 0.0 # Vertical orientation of Gabor patch - NOT IN USE STIM_SIGMA = 7.0 # (azimuth_degree) Size of Gabor patch STIM_GAIN = 8.0 # (azimuth_degree/mm) Gain of the RE to stimulus movement (used if ADAPTIVE_GAIN = FALSE) # noqa SYNC_SQUARE_X = 1.33 SYNC_SQUARE_Y = -1.03 # SOUNDS SOFT_SOUND = "xonar" # Use software sound 'xonar', 'sysdefault' or False for BpodSoundCard # noqa SOUND_BOARD_BPOD_PORT = "Serial3" # (on Bpod) - Ignored if using SOFT_SOUND WHITE_NOISE_DURATION = 0.5 # Length of noise burst WHITE_NOISE_AMPLITUDE = 0.05 GO_TONE_DURATION = 0.1 # Length of tone GO_TONE_FREQUENCY = 5000 # 5KHz GO_TONE_AMPLITUDE = 0.0272 # [0->1] 0.0272 for 70dB SPL Xonar # ADAPTIVE PARAMETERS # ADAPTIVE REWARD PARAMETERS (IGNORED IF ADAPTIVE_REWARD = False) ADAPTIVE_REWARD = True # wether to increase reware at session start usin AR_* criteria # noqa AR_INIT_VALUE = 3 # µl AR_MAX_VALUE = 3 AR_MIN_VALUE = 1.5 # (µl) 1.5 µl for sugar water, 2 µl for normal water AR_STEP = 0.1 # µl AR_CRIT = 200 # number of trials performed # CONTRASTS CONTRAST_SET = [ 1.0, 0.5, 0.25, 0.125, 0.0625, 0.0, ] # Full contrast set, used if adaptive contrast = False # noqa REPEAT_CONTRASTS = [1.0, 0.5] # Contrasts to be repeated if error # ADAPTIVE_CONTRAST PARAMETERS (IGNORED IF ADAPTIVE_CONTRAST = False) ADAPTIVE_CONTRAST = True # Wether to use Adaptive contrast rule or not AC_INIT_CONTRASTS = [1.0, 0.5] AC_BUFFER_SIZE = 50 # Buffer size to compute preformance for each contrast AC_PERF_CRIT = 0.7 # Criterion for adding next contrast L AND R have to pass AC_NTRIALS_TO_SIX = 200 # Number of trials after 0.125 to introduce the 6% contrast # noqa AC_NTRIALS_TO_ZERO = 400 # Number of trials after 0.125 to introduce the 0% contrast # noqa AC_NTRIALS_TO_REMOVE_50 = 600 # Number of trials after 0.125 to remove the 50% contrst # noqa # ADAPTIVE_GAIN PARAMETERS (IGNORED IF ADAPTIVE_GAIN = False) ADAPTIVE_GAIN = True AG_INIT_VALUE = 8.0 # Adaptive Gain init value (azimuth_degree/mm) AG_MIN_VALUE = 4.0 # (azimuth_degree/mm) # POSITION BIAS FOR REPEATED TRIALS RESPONSE_BUFFER_LENGTH = 10 # POOP COUNT LOGGING POOP_COUNT = True # Wether to ask for a poop count at the end of the session

49.845238

138

0.713637

170433965815e07d5153c51b0f81b61abb305be9

258

py

Python

sphinxcontrib/test_reports/directives/__init__.py

lassebn/sphinx-test-reports

1655c81a3b9e79cd46244810cd7f3ef8fb84c1aa

[ "MIT" ]

null

sphinxcontrib/test_reports/directives/__init__.py

lassebn/sphinx-test-reports

1655c81a3b9e79cd46244810cd7f3ef8fb84c1aa

[ "MIT" ]

null

sphinxcontrib/test_reports/directives/__init__.py

lassebn/sphinx-test-reports

1655c81a3b9e79cd46244810cd7f3ef8fb84c1aa

[ "MIT" ]

1

2021-08-18T10:15:17.000Z

from .test_common import TestCommonDirective from .test_file import TestFileDirective, TestFile from .test_suite import TestSuiteDirective, TestSuite from .test_case import TestCaseDirective, TestCase from .test_report import TestReportDirective, TestReport

43

56

0.872093

1979af5fb3706350953c3cf7542c026719d5d908

18,865

py

Python

official/nlp/bert/run_classifier.py

akshit-protonn/models

38c8c6fe4144c93d6aadd19981c2b90570c29eba

[ "Apache-2.0" ]

82,518

2016-02-05T12:07:23.000Z

2022-03-31T23:09:47.000Z

official/nlp/bert/run_classifier.py

akshit-protonn/models

38c8c6fe4144c93d6aadd19981c2b90570c29eba

[ "Apache-2.0" ]

9,021

2016-03-08T01:02:05.000Z

2022-03-31T08:06:35.000Z

official/nlp/bert/run_classifier.py

akshit-protonn/models

38c8c6fe4144c93d6aadd19981c2b90570c29eba

[ "Apache-2.0" ]

54,341

2016-02-06T17:19:55.000Z

2022-03-31T10:27:44.000Z

# Copyright 2021 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """BERT classification or regression finetuning runner in TF 2.x.""" import functools import json import math import os # Import libraries from absl import app from absl import flags from absl import logging import gin import tensorflow as tf from official.common import distribute_utils from official.modeling import performance from official.nlp import optimization from official.nlp.bert import bert_models from official.nlp.bert import common_flags from official.nlp.bert import configs as bert_configs from official.nlp.bert import input_pipeline from official.nlp.bert import model_saving_utils from official.utils.misc import keras_utils flags.DEFINE_enum( 'mode', 'train_and_eval', ['train_and_eval', 'export_only', 'predict'], 'One of {"train_and_eval", "export_only", "predict"}. `train_and_eval`: ' 'trains the model and evaluates in the meantime. ' '`export_only`: will take the latest checkpoint inside ' 'model_dir and export a `SavedModel`. `predict`: takes a checkpoint and ' 'restores the model to output predictions on the test set.') flags.DEFINE_string('train_data_path', None, 'Path to training data for BERT classifier.') flags.DEFINE_string('eval_data_path', None, 'Path to evaluation data for BERT classifier.') flags.DEFINE_string( 'input_meta_data_path', None, 'Path to file that contains meta data about input ' 'to be used for training and evaluation.') flags.DEFINE_integer('train_data_size', None, 'Number of training samples ' 'to use. If None, uses the full train data. ' '(default: None).') flags.DEFINE_string('predict_checkpoint_path', None, 'Path to the checkpoint for predictions.') flags.DEFINE_integer( 'num_eval_per_epoch', 1, 'Number of evaluations per epoch. The purpose of this flag is to provide ' 'more granular evaluation scores and checkpoints. For example, if original ' 'data has N samples and num_eval_per_epoch is n, then each epoch will be ' 'evaluated every N/n samples.') flags.DEFINE_integer('train_batch_size', 32, 'Batch size for training.') flags.DEFINE_integer('eval_batch_size', 32, 'Batch size for evaluation.') common_flags.define_common_bert_flags() FLAGS = flags.FLAGS LABEL_TYPES_MAP = {'int': tf.int64, 'float': tf.float32} def get_loss_fn(num_classes): """Gets the classification loss function.""" def classification_loss_fn(labels, logits): """Classification loss.""" labels = tf.squeeze(labels) log_probs = tf.nn.log_softmax(logits, axis=-1) one_hot_labels = tf.one_hot( tf.cast(labels, dtype=tf.int32), depth=num_classes, dtype=tf.float32) per_example_loss = -tf.reduce_sum( tf.cast(one_hot_labels, dtype=tf.float32) * log_probs, axis=-1) return tf.reduce_mean(per_example_loss) return classification_loss_fn def get_dataset_fn(input_file_pattern, max_seq_length, global_batch_size, is_training, label_type=tf.int64, include_sample_weights=False, num_samples=None): """Gets a closure to create a dataset.""" def _dataset_fn(ctx=None): """Returns tf.data.Dataset for distributed BERT pretraining.""" batch_size = ctx.get_per_replica_batch_size( global_batch_size) if ctx else global_batch_size dataset = input_pipeline.create_classifier_dataset( tf.io.gfile.glob(input_file_pattern), max_seq_length, batch_size, is_training=is_training, input_pipeline_context=ctx, label_type=label_type, include_sample_weights=include_sample_weights, num_samples=num_samples) return dataset return _dataset_fn def run_bert_classifier(strategy, bert_config, input_meta_data, model_dir, epochs, steps_per_epoch, steps_per_loop, eval_steps, warmup_steps, initial_lr, init_checkpoint, train_input_fn, eval_input_fn, training_callbacks=True, custom_callbacks=None, custom_metrics=None): """Run BERT classifier training using low-level API.""" max_seq_length = input_meta_data['max_seq_length'] num_classes = input_meta_data.get('num_labels', 1) is_regression = num_classes == 1 def _get_classifier_model(): """Gets a classifier model.""" classifier_model, core_model = ( bert_models.classifier_model( bert_config, num_classes, max_seq_length, hub_module_url=FLAGS.hub_module_url, hub_module_trainable=FLAGS.hub_module_trainable)) optimizer = optimization.create_optimizer(initial_lr, steps_per_epoch * epochs, warmup_steps, FLAGS.end_lr, FLAGS.optimizer_type) classifier_model.optimizer = performance.configure_optimizer( optimizer, use_float16=common_flags.use_float16(), use_graph_rewrite=common_flags.use_graph_rewrite()) return classifier_model, core_model # tf.keras.losses objects accept optional sample_weight arguments (eg. coming # from the dataset) to compute weighted loss, as used for the regression # tasks. The classification tasks, using the custom get_loss_fn don't accept # sample weights though. loss_fn = (tf.keras.losses.MeanSquaredError() if is_regression else get_loss_fn(num_classes)) # Defines evaluation metrics function, which will create metrics in the # correct device and strategy scope. if custom_metrics: metric_fn = custom_metrics elif is_regression: metric_fn = functools.partial( tf.keras.metrics.MeanSquaredError, 'mean_squared_error', dtype=tf.float32) else: metric_fn = functools.partial( tf.keras.metrics.SparseCategoricalAccuracy, 'accuracy', dtype=tf.float32) # Start training using Keras compile/fit API. logging.info('Training using TF 2.x Keras compile/fit API with ' 'distribution strategy.') return run_keras_compile_fit( model_dir, strategy, _get_classifier_model, train_input_fn, eval_input_fn, loss_fn, metric_fn, init_checkpoint, epochs, steps_per_epoch, steps_per_loop, eval_steps, training_callbacks=training_callbacks, custom_callbacks=custom_callbacks) def run_keras_compile_fit(model_dir, strategy, model_fn, train_input_fn, eval_input_fn, loss_fn, metric_fn, init_checkpoint, epochs, steps_per_epoch, steps_per_loop, eval_steps, training_callbacks=True, custom_callbacks=None): """Runs BERT classifier model using Keras compile/fit API.""" with strategy.scope(): training_dataset = train_input_fn() evaluation_dataset = eval_input_fn() if eval_input_fn else None bert_model, sub_model = model_fn() optimizer = bert_model.optimizer if init_checkpoint: checkpoint = tf.train.Checkpoint(model=sub_model, encoder=sub_model) checkpoint.read(init_checkpoint).assert_existing_objects_matched() if not isinstance(metric_fn, (list, tuple)): metric_fn = [metric_fn] bert_model.compile( optimizer=optimizer, loss=loss_fn, metrics=[fn() for fn in metric_fn], steps_per_execution=steps_per_loop) summary_dir = os.path.join(model_dir, 'summaries') summary_callback = tf.keras.callbacks.TensorBoard(summary_dir) checkpoint = tf.train.Checkpoint(model=bert_model, optimizer=optimizer) checkpoint_manager = tf.train.CheckpointManager( checkpoint, directory=model_dir, max_to_keep=None, step_counter=optimizer.iterations, checkpoint_interval=0) checkpoint_callback = keras_utils.SimpleCheckpoint(checkpoint_manager) if training_callbacks: if custom_callbacks is not None: custom_callbacks += [summary_callback, checkpoint_callback] else: custom_callbacks = [summary_callback, checkpoint_callback] history = bert_model.fit( x=training_dataset, validation_data=evaluation_dataset, steps_per_epoch=steps_per_epoch, epochs=epochs, validation_steps=eval_steps, callbacks=custom_callbacks) stats = {'total_training_steps': steps_per_epoch * epochs} if 'loss' in history.history: stats['train_loss'] = history.history['loss'][-1] if 'val_accuracy' in history.history: stats['eval_metrics'] = history.history['val_accuracy'][-1] return bert_model, stats def get_predictions_and_labels(strategy, trained_model, eval_input_fn, is_regression=False, return_probs=False): """Obtains predictions of trained model on evaluation data. Note that list of labels is returned along with the predictions because the order changes on distributing dataset over TPU pods. Args: strategy: Distribution strategy. trained_model: Trained model with preloaded weights. eval_input_fn: Input function for evaluation data. is_regression: Whether it is a regression task. return_probs: Whether to return probabilities of classes. Returns: predictions: List of predictions. labels: List of gold labels corresponding to predictions. """ @tf.function def test_step(iterator): """Computes predictions on distributed devices.""" def _test_step_fn(inputs): """Replicated predictions.""" inputs, labels = inputs logits = trained_model(inputs, training=False) if not is_regression: probabilities = tf.nn.softmax(logits) return probabilities, labels else: return logits, labels outputs, labels = strategy.run(_test_step_fn, args=(next(iterator),)) # outputs: current batch logits as a tuple of shard logits outputs = tf.nest.map_structure(strategy.experimental_local_results, outputs) labels = tf.nest.map_structure(strategy.experimental_local_results, labels) return outputs, labels def _run_evaluation(test_iterator): """Runs evaluation steps.""" preds, golds = list(), list() try: with tf.experimental.async_scope(): while True: probabilities, labels = test_step(test_iterator) for cur_probs, cur_labels in zip(probabilities, labels): if return_probs: preds.extend(cur_probs.numpy().tolist()) else: preds.extend(tf.math.argmax(cur_probs, axis=1).numpy()) golds.extend(cur_labels.numpy().tolist()) except (StopIteration, tf.errors.OutOfRangeError): tf.experimental.async_clear_error() return preds, golds test_iter = iter(strategy.distribute_datasets_from_function(eval_input_fn)) predictions, labels = _run_evaluation(test_iter) return predictions, labels def export_classifier(model_export_path, input_meta_data, bert_config, model_dir): """Exports a trained model as a `SavedModel` for inference. Args: model_export_path: a string specifying the path to the SavedModel directory. input_meta_data: dictionary containing meta data about input and model. bert_config: Bert configuration file to define core bert layers. model_dir: The directory where the model weights and training/evaluation summaries are stored. Raises: Export path is not specified, got an empty string or None. """ if not model_export_path: raise ValueError('Export path is not specified: %s' % model_export_path) if not model_dir: raise ValueError('Export path is not specified: %s' % model_dir) # Export uses float32 for now, even if training uses mixed precision. tf.keras.mixed_precision.set_global_policy('float32') classifier_model = bert_models.classifier_model( bert_config, input_meta_data.get('num_labels', 1), hub_module_url=FLAGS.hub_module_url, hub_module_trainable=False)[0] model_saving_utils.export_bert_model( model_export_path, model=classifier_model, checkpoint_dir=model_dir) def run_bert(strategy, input_meta_data, model_config, train_input_fn=None, eval_input_fn=None, init_checkpoint=None, custom_callbacks=None, custom_metrics=None): """Run BERT training.""" # Enables XLA in Session Config. Should not be set for TPU. keras_utils.set_session_config(FLAGS.enable_xla) performance.set_mixed_precision_policy(common_flags.dtype()) epochs = FLAGS.num_train_epochs * FLAGS.num_eval_per_epoch train_data_size = ( input_meta_data['train_data_size'] // FLAGS.num_eval_per_epoch) if FLAGS.train_data_size: train_data_size = min(train_data_size, FLAGS.train_data_size) logging.info('Updated train_data_size: %s', train_data_size) steps_per_epoch = int(train_data_size / FLAGS.train_batch_size) warmup_steps = int(epochs * train_data_size * 0.1 / FLAGS.train_batch_size) eval_steps = int( math.ceil(input_meta_data['eval_data_size'] / FLAGS.eval_batch_size)) if not strategy: raise ValueError('Distribution strategy has not been specified.') if not custom_callbacks: custom_callbacks = [] if FLAGS.log_steps: custom_callbacks.append( keras_utils.TimeHistory( batch_size=FLAGS.train_batch_size, log_steps=FLAGS.log_steps, logdir=FLAGS.model_dir)) trained_model, _ = run_bert_classifier( strategy, model_config, input_meta_data, FLAGS.model_dir, epochs, steps_per_epoch, FLAGS.steps_per_loop, eval_steps, warmup_steps, FLAGS.learning_rate, init_checkpoint or FLAGS.init_checkpoint, train_input_fn, eval_input_fn, custom_callbacks=custom_callbacks, custom_metrics=custom_metrics) if FLAGS.model_export_path: model_saving_utils.export_bert_model( FLAGS.model_export_path, model=trained_model) return trained_model def custom_main(custom_callbacks=None, custom_metrics=None): """Run classification or regression. Args: custom_callbacks: list of tf.keras.Callbacks passed to training loop. custom_metrics: list of metrics passed to the training loop. """ gin.parse_config_files_and_bindings(FLAGS.gin_file, FLAGS.gin_param) with tf.io.gfile.GFile(FLAGS.input_meta_data_path, 'rb') as reader: input_meta_data = json.loads(reader.read().decode('utf-8')) label_type = LABEL_TYPES_MAP[input_meta_data.get('label_type', 'int')] include_sample_weights = input_meta_data.get('has_sample_weights', False) if not FLAGS.model_dir: FLAGS.model_dir = '/tmp/bert20/' bert_config = bert_configs.BertConfig.from_json_file(FLAGS.bert_config_file) if FLAGS.mode == 'export_only': export_classifier(FLAGS.model_export_path, input_meta_data, bert_config, FLAGS.model_dir) return strategy = distribute_utils.get_distribution_strategy( distribution_strategy=FLAGS.distribution_strategy, num_gpus=FLAGS.num_gpus, tpu_address=FLAGS.tpu) eval_input_fn = get_dataset_fn( FLAGS.eval_data_path, input_meta_data['max_seq_length'], FLAGS.eval_batch_size, is_training=False, label_type=label_type, include_sample_weights=include_sample_weights) if FLAGS.mode == 'predict': num_labels = input_meta_data.get('num_labels', 1) with strategy.scope(): classifier_model = bert_models.classifier_model( bert_config, num_labels)[0] checkpoint = tf.train.Checkpoint(model=classifier_model) latest_checkpoint_file = ( FLAGS.predict_checkpoint_path or tf.train.latest_checkpoint(FLAGS.model_dir)) assert latest_checkpoint_file logging.info('Checkpoint file %s found and restoring from ' 'checkpoint', latest_checkpoint_file) checkpoint.restore( latest_checkpoint_file).assert_existing_objects_matched() preds, _ = get_predictions_and_labels( strategy, classifier_model, eval_input_fn, is_regression=(num_labels == 1), return_probs=True) output_predict_file = os.path.join(FLAGS.model_dir, 'test_results.tsv') with tf.io.gfile.GFile(output_predict_file, 'w') as writer: logging.info('***** Predict results *****') for probabilities in preds: output_line = '\t'.join( str(class_probability) for class_probability in probabilities) + '\n' writer.write(output_line) return if FLAGS.mode != 'train_and_eval': raise ValueError('Unsupported mode is specified: %s' % FLAGS.mode) train_input_fn = get_dataset_fn( FLAGS.train_data_path, input_meta_data['max_seq_length'], FLAGS.train_batch_size, is_training=True, label_type=label_type, include_sample_weights=include_sample_weights, num_samples=FLAGS.train_data_size) run_bert( strategy, input_meta_data, bert_config, train_input_fn, eval_input_fn, custom_callbacks=custom_callbacks, custom_metrics=custom_metrics) def main(_): custom_main(custom_callbacks=None, custom_metrics=None) if __name__ == '__main__': flags.mark_flag_as_required('bert_config_file') flags.mark_flag_as_required('input_meta_data_path') flags.mark_flag_as_required('model_dir') app.run(main)

36.489362

80

0.680732

53be355cbf73c27ff19e6c062e1158bac91f1576

1,657

py

Python

src/plume/utils/extended_path.py

malarinv/plume-asr

79aa5e85788070aad688d41fbbf9f8b1f8aa8fb5

[ "MIT" ]

null

src/plume/utils/extended_path.py

malarinv/plume-asr

79aa5e85788070aad688d41fbbf9f8b1f8aa8fb5

[ "MIT" ]

null

src/plume/utils/extended_path.py

malarinv/plume-asr

79aa5e85788070aad688d41fbbf9f8b1f8aa8fb5

[ "MIT" ]

null

from pathlib import Path import json from .lazy_import import lazy_module yaml = lazy_module("ruamel.yaml") pydub = lazy_module("pydub") class ExtendedPath(type(Path())): """docstring for ExtendedPath.""" def read_json(self, verbose=False): if verbose: print(f"reading json from {self}") with self.open("r") as jf: return json.load(jf) def read_yaml(self, verbose=False): yaml_o = yaml.YAML(typ="safe", pure=True) if verbose: print(f"reading yaml from {self}") with self.open("r") as yf: return yaml_o.load(yf) def read_jsonl(self, verbose=False): if verbose: print(f"reading jsonl from {self}") with self.open("r") as jf: for ln in jf.readlines(): yield json.loads(ln) def read_audio_segment(self): return pydub.AudioSegment.from_file(self) def write_json(self, data, verbose=False): if verbose: print(f"writing json to {self}") self.parent.mkdir(parents=True, exist_ok=True) with self.open("w") as jf: json.dump(data, jf, indent=2) def write_yaml(self, data, verbose=False): yaml_o = yaml.YAML() if verbose: print(f"writing yaml to {self}") with self.open("w") as yf: yaml_o.dump(data, yf) def write_jsonl(self, data, verbose=False): if verbose: print(f"writing jsonl to {self}") self.parent.mkdir(parents=True, exist_ok=True) with self.open("w") as jf: for d in data: jf.write(json.dumps(d) + "\n")

29.070175

54

0.578153

bcfaf0265ce5962a6aa97718ae60a18dfc49299c

2,408

py

Python

controllers/stats.py

himansu1997/eden

1e2cf2b00f55da46b1ce3e6b7ad44b5345d7a1dc

[ "MIT" ]

205

2015-01-20T08:26:09.000Z

2022-03-27T19:59:33.000Z

controllers/stats.py

himansu1997/eden

1e2cf2b00f55da46b1ce3e6b7ad44b5345d7a1dc

[ "MIT" ]

249

2015-02-10T09:56:35.000Z

2022-03-23T19:54:36.000Z

controllers/stats.py

himansu1997/eden

1e2cf2b00f55da46b1ce3e6b7ad44b5345d7a1dc

[ "MIT" ]

231

2015-02-10T09:33:17.000Z

2022-02-18T19:56:05.000Z

# -*- coding: utf-8 -*- """ Sahana Eden Stats Controller """ if not settings.has_module(c): raise HTTP(404, body="Module disabled: %s" % c) # ----------------------------------------------------------------------------- def index(): """ Module's Home Page """ return s3db.cms_index(c, alt_function="index_alt") # ----------------------------------------------------------------------------- def index_alt(): """ Module homepage for non-Admin users when no CMS content found """ # Just redirect to the Demographic Data s3_redirect_default(URL(f = "demographic_data", args = "summary", )) # ----------------------------------------------------------------------------- def parameter(): """ REST Controller """ return s3_rest_controller() # ----------------------------------------------------------------------------- def data(): """ REST Controller """ return s3_rest_controller() # ----------------------------------------------------------------------------- def source(): """ REST Controller """ return s3_rest_controller() # ----------------------------------------------------------------------------- def demographic(): """ REST Controller """ return s3_rest_controller() # ----------------------------------------------------------------------------- def demographic_data(): """ REST Controller """ return s3_rest_controller() # ----------------------------------------------------------------------------- def demographic_aggregate(): """ REST Controller """ def clear_aggregates(r, **attr): if not auth.s3_has_role("ADMIN"): auth.permission.fail() s3db.stats_demographic_rebuild_all_aggregates() redirect(URL(c = "stats", f = "demographic_aggregate", args = "", )) s3db.set_method("stats", "demographic_aggregate", method = "clear", action = clear_aggregates, ) output = s3_rest_controller() return output # ----------------------------------------------------------------------------- def impact_type(): """ REST Controller for impact types """ return s3_rest_controller() # END =========================================================================

28.329412

79

0.382475

d539dcc03b28d213ba1dfd6b4732fe577d9e0dfb

69,375

py

Python

tensorlayerx/backend/ops/paddle_nn.py

tensorlayer/TensorLayerX

4e3e6f13687309dda7787f0b86e35a62bb3adbad

[ "Apache-2.0" ]

34

2021-12-03T08:19:23.000Z

2022-03-13T08:34:34.000Z

tensorlayerx/backend/ops/paddle_nn.py

tensorlayer/TensorLayerX

4e3e6f13687309dda7787f0b86e35a62bb3adbad

[ "Apache-2.0" ]

null

tensorlayerx/backend/ops/paddle_nn.py

tensorlayer/TensorLayerX

4e3e6f13687309dda7787f0b86e35a62bb3adbad

[ "Apache-2.0" ]

3

2021-12-28T16:57:20.000Z

2022-03-18T02:23:14.000Z

#! /usr/bin/python # -*- coding: utf-8 -*- import paddle as pd from paddle import framework import paddle.nn.functional as F import numpy as np import paddle.fluid as fluid from paddle.nn import initializer as I from paddle.fluid.layers.utils import map_structure, flatten, pack_sequence_as from paddle.fluid.data_feeder import convert_dtype from paddle.fluid.dygraph import Layer, LayerList from paddle.nn.layer.rnn import RNNCellBase import warnings import math def padding_format(padding): """ Checks that the padding format correspond format. Parameters ---------- padding : str Must be one of the following:"same", "SAME", "VALID", "valid" Returns ------- str "SAME" or "VALID" """ if padding in ["SAME", "same"]: padding = "SAME" elif padding in ["VALID", "valid"]: padding = "VALID" elif padding == None: padding = None elif isinstance(padding, tuple) or isinstance(padding, int): return padding else: raise Exception("Unsupported padding: " + str(padding)) return padding def preprocess_1d_format(data_format, padding): """ Checks that the 1-D dataformat format correspond format. Parameters ---------- data_format : str Must be one of the following:"channels_last","NWC","NCW","channels_first" padding : str Must be one of the following:"same","valid","SAME","VALID" Returns ------- str "NWC" or "NCW" and "SAME" or "VALID" """ if data_format in ["channels_last", "NWC", "NLC"]: data_format = "NLC" elif data_format in ["channels_first", "NCW", "NCL"]: data_format = "NCL" elif data_format == None: data_format = None else: raise Exception("Unsupported data format: " + str(data_format)) padding = padding_format(padding) return data_format, padding def preprocess_2d_format(data_format, padding): """ Checks that the 2-D dataformat format correspond format. Parameters ---------- data_format : str Must be one of the following:"channels_last","NHWC","NCHW","channels_first" padding : str Must be one of the following:"same","valid","SAME","VALID" Returns ------- str "NHWC" or "NCHW" and "SAME" or "VALID" """ if data_format in ["channels_last", "NHWC", "nhwc"]: data_format = "NHWC" elif data_format in ["channels_first", "NCHW", "nchw"]: data_format = "NCHW" elif data_format == None: data_format = None else: raise Exception("Unsupported data format: " + str(data_format)) padding = padding_format(padding) return data_format, padding def preprocess_3d_format(data_format, padding): """ Checks that the 3-D dataformat format correspond format. Parameters ---------- data_format : str Must be one of the following:"channels_last","NDHWC","NCDHW","channels_first" padding : str Must be one of the following:"same","valid","SAME","VALID" Returns ------- str "NDHWC" or "NCDHW" and "SAME" or "VALID" """ if data_format in ['channels_last', 'NDHWC']: data_format = 'NDHWC' elif data_format in ['channels_first', 'NCDHW']: data_format = 'NCDHW' elif data_format == None: data_format = None else: raise Exception("Unsupported data format: " + str(data_format)) padding = padding_format(padding) return data_format, padding def nchw_to_nhwc(x): """ Channels first to channels last Parameters ---------- x : tensor channels first tensor data Returns ------- channels last tensor data """ if len(x.shape) == 3: x = pd.transpose(x, (0, 2, 1)) elif len(x.shape) == 4: x = pd.transpose(x, (0, 2, 3, 1)) elif len(x.shape) == 5: x = pd.transpose(x, (0, 2, 3, 4, 1)) else: raise Exception("Unsupported dimensions") return x def nhwc_to_nchw(x): """ Channles last to channels first Parameters ---------- x : tensor channels last tensor data Returns ------- channels first tensor data """ if len(x.shape) == 3: x = pd.transpose(x, (0, 2, 1)) elif len(x.shape) == 4: x = pd.transpose(x, (0, 3, 1, 2)) elif len(x.shape) == 5: x = pd.transpose(x, (0, 4, 1, 2, 3)) else: raise Exception("Unsupported dimensions") return x class ReLU(object): def __init__(self): pass def __call__(self, x): return F.relu(x) def relu(x): """ Computes rectified linear: max(features, 0). Parameters ---------- x : tensor Must be one of the following types: float32, float64, int32, uint8, int16, int8, int64, bfloat16, uint16, half, uint32, uint64, qint8. Returns ------- A Tensor. Has the same type as features. """ return F.relu(x) class ELU(object): def __init__(self, alpha=1.0): self.alpha = alpha def __call__(self, x): return F.elu(x, alpha=self.alpha) def elu(x, alpha=1.0): """ Computes exponential linear: `exp(features) - 1` if < 0, `features` otherwise. See [Fast and Accurate Deep Network Learning by Exponential Linear Units (ELUs) ](http://arxiv.org/abs/1511.07289) Parameters ---------- x : tensor Must be one of the following types: half, bfloat16, float32, float64. Returns ------- A Tensor with the same type as features. """ return F.elu(x, alpha=alpha) class ReLU6(object): def __init__(self): pass def __call__(self, x): return F.relu6(x) def relu6(x): """ Computes Rectified Linear 6: min(max(features, 0), 6). Parameters ---------- x : tensor Must be one of the following types: float32, float64, int32, uint8, int16, int8, int64, bfloat16, uint16, half, uint32, uint64, qint8. Returns ------- A Tensor with the same type as features. """ return F.relu6(x) class LeakyReLU(object): def __init__(self, negative_slope=0.2): self.negative_slope = negative_slope def __call__(self, x): return F.leaky_relu(x, negative_slope=self.negative_slope) def leaky_relu(x, negative_slope=0.01): """ Compute the Leaky ReLU activation function. Parameters ---------- x : tensor representing preactivation values. Must be one of the following types: float16, float32, float64, int32, int64. Returns ------- The activation value. """ return F.leaky_relu(x, negative_slope) class Softplus(object): def __init__(self): pass def __call__(self, x): return F.softplus(x) class Tanh(object): def __init__(self): pass def __call__(self, x): return F.tanh(x) class Sigmoid(object): def __init__(self): pass def __call__(self, x): return F.sigmoid(x) def sigmoid(x): """ Computes sigmoid of x element-wise. Parameters ---------- x : tensor A Tensor with type float16, float32, float64, complex64, or complex128. Returns ------- A Tensor with the same type as x. """ return F.sigmoid(x) class Softmax(object): def __init__(self, axis = -1): self.axis = axis def __call__(self, x): return F.softmax(x, axis=self.axis) def softmax(logits, axis=-1): """ Computes softmax activations. Parameters ---------- logits : tensor Must be one of the following types: half, float32, float64. axis : int The dimension softmax would be performed on. The default is -1 which indicates the last dimension. Returns ------- A Tensor. Has the same type and shape as logits. """ return F.softmax(logits, axis=axis) class GeLU(object): def __init__(self, approximate=False): self.approximate = approximate def __call__(self, x): return F.gelu(x, approximate=self.approximate) def gelu(x, approximate=False): return F.gelu(x, approximate=approximate) class Dropout(object): def __init__(self, p, seed=1): self.p = p self.seed = seed def __call__(self, inputs): output = F.dropout(inputs, p=self.p, mode='upscale_in_train') return output class BiasAdd(object): """ Adds bias to value. Parameters ---------- x : tensor A Tensor with type float, double, int64, int32, uint8, int16, int8, complex64, or complex128. bias : tensor Must be the same type as value unless value is a quantized type, in which case a different quantized type may be used. Returns ------- A Tensor with the same type as value. """ def __init__(self, data_format='channels_last'): super(BiasAdd, self).__init__() if data_format in ['channels_first', 'NCL', 'NCW', 'NCHW', 'NCDHW']: self.data_format = 'channels_first' elif data_format in ['channels_last', 'NLC', 'NWC', 'NHWC', 'NDHWC']: self.data_format = 'channels_last' else: raise ("Unsupported data format: " + str(data_format)) def __call__(self, x, bias): if len(x.shape) > 2 and self.data_format == 'channels_first': x = nchw_to_nhwc(x) outputs = pd.add(x, bias) if len(x.shape) > 2 and self.data_format == 'channels_first': outputs = nhwc_to_nchw(outputs) return outputs def bias_add(x, bias): """ Adds bias to value. Parameters ---------- x : tensor A Tensor with type float, double, int64, int32, uint8, int16, int8, complex64, or complex128. bias : tensor Must be the same type as value unless value is a quantized type, in which case a different quantized type may be used. data_format : A string. 'N...C' and 'NC...' are supported. name : str A name for the operation (optional). Returns ------- A Tensor with the same type as value. """ #TODO the bias_add only supports channels_last outputs = pd.add(x, bias) return outputs class Conv1D(object): def __init__(self, stride, padding, data_format='NWC', dilations=None, out_channel=None, k_size=None): super(Conv1D, self).__init__() self.data_format, self.padding = preprocess_1d_format(padding=padding, data_format=data_format) self.stride = stride self.dilations = dilations def __call__(self, input, filters): output = F.conv1d( x=input, weight=filters, stride=self.stride, dilation=self.dilations, data_format=self.data_format, padding=self.padding ) return output def conv1d(input, filters, stride, padding, data_format='NWC', dilations=None, name=None): """ Computes a 1-D convolution given 3-D input and filter tensors. Parameters ---------- input : tensor A 3D Tensor. Must be of type float16, float32, or float64 filters : tensor A 3D Tensor. Must have the same type as input. stride : int of list An int or list of ints that has length 1 or 3. The number of entries by which the filter is moved right at each step. padding : string 'SAME' or 'VALID' data_format : string An optional string from "NWC", "NCW". Defaults to "NWC", the data is stored in the order of [batch, in_width, in_channels]. The "NCW" format stores data as [batch, in_channels, in_width]. dilations : int or list An int or list of ints that has length 1 or 3 which defaults to 1. The dilation factor for each dimension of input. If set to k > 1, there will be k-1 skipped cells between each filter element on that dimension. Dilations in the batch and depth dimensions must be 1. name : string A name for the operation (optional). Returns ------- A Tensor. Has the same type as input. """ outputs = F.conv1d( x=input, weight=filters, stride=stride, padding=padding, data_format=data_format, dilation=dilations, name=name ) return outputs class Conv2D(object): def __init__(self, strides, padding, data_format='NHWC', dilations=None, out_channel=None, k_size=None): self.data_format, self.padding = preprocess_2d_format(data_format, padding) if self.data_format is 'NHWC': self._stride = (strides[1], strides[2]) self._dilation = (dilations[1], dilations[2]) elif self.data_format is 'NCHW': self._stride = (strides[2], strides[3]) self._dilation = (dilations[2], dilations[3]) def __call__(self, inputs, filters): outputs = F.conv2d( x=inputs, weight=filters, stride=self._stride, dilation=self._dilation, padding=self.padding, data_format=self.data_format ) return outputs def conv2d(input, filters, strides, padding, data_format='NCHW', dilations=None): """ Computes a 2-D convolution given 4-D input and filters tensors. Parameters ---------- input : tensor Must be one of the following types: half, bfloat16, float32, float64. A 4-D tensor. The dimension order is interpreted according to the value of data_format, see below for details. filters : tensor Must have the same type as input. A 4-D tensor of shape [filter_height, filter_width, in_channels, out_channels] strides : int of list The stride of the sliding window for each dimension of input. If a single value is given it is replicated in the H and W dimension. By default the N and C dimensions are set to 1. The dimension order is determined by the value of data_format, see below for details. padding : string "SAME" or "VALID" data_format : string "NHWC", "NCHW". Defaults to "NCHW". dilations : list or ints list of ints that has length 1, 2 or 4, defaults to 1. The dilation factor for each dimension ofinput. Returns ------- A Tensor. Has the same type as input. """ data_format, padding = preprocess_2d_format(data_format, padding) if data_format is 'NHWC': _stride = (strides[1], strides[2]) _dilation = (dilations[1], dilations[2]) elif data_format is 'NCHW': _stride = (strides[2], strides[3]) _dilation = (dilations[2], dilations[3]) outputs = F.conv2d( x=input, weight=filters, stride=_stride, dilation=_dilation, padding=padding, data_format=data_format ) return outputs class Conv3D(object): def __init__(self, strides, padding, data_format='NDHWC', dilations=None, out_channel=None, k_size=None): self.data_format, self.padding = preprocess_3d_format(data_format, padding) if self.data_format is 'NDHWC': self._strides = (strides[1], strides[2], strides[3]) self._dilations = (dilations[1], dilations[2], dilations[3]) elif self.data_format is 'NCDHW': self._strides = (strides[2], strides[3], strides[4]) self._dilations = (dilations[2], dilations[3], dilations[4]) def __call__(self, input, filters): outputs = F.conv3d( x=input, weight=filters, stride=self._strides, dilation=self._dilations, data_format=self.data_format, padding=self.padding ) return outputs def conv3d(input, filters, strides, padding, data_format='NDHWC', dilations=None, name=None): """ Computes a 3-D convolution given 5-D input and filters tensors. Parameters ---------- input : tensor Must be one of the following types: half, bfloat16, float32, float64. Shape [batch, in_depth, in_height, in_width, in_channels]. filters : tensor Must have the same type as input. Shape [filter_depth, filter_height, filter_width, in_channels, out_channels]. in_channels must match between input and filters. strides : tuple of ints A list of ints that has length >= 5. 1-D tensor of length 5. The stride of the sliding window for each dimension of input. Must have strides[0] = strides[4] = 1. padding : string A string from: "SAME", "VALID". The type of padding algorithm to use. data_format : string An optional string from: "NDHWC", "NCDHW". Defaults to "NDHWC". The data format of the input and output data. With the default format "NDHWC", the data is stored in the order of: [batch, in_depth, in_height, in_width, in_channels]. Alternatively, the format could be "NCDHW", the data storage order is: [batch, in_channels, in_depth, in_height, in_width]. dilations : touple of ints Defaults to [1, 1, 1, 1, 1]. 1-D tensor of length 5. The dilation factor for each dimension of input. If set to k > 1, there will be k-1 skipped cells between each filter element on that dimension. The dimension order is determined by the value of data_format, see above for details. Dilations in the batch and depth dimensions must be 1. name : string A name for the operation (optional). Returns ------- A Tensor. Has the same type as input. """ data_format, padding = preprocess_3d_format(data_format, padding) if data_format is 'NDHWC': _strides = (strides[1], strides[2], strides[3]) _dilations = (dilations[1], dilations[2], dilations[3]) elif data_format is 'NCDHW': _strides = (strides[2], strides[3], strides[4]) _dilations = (dilations[2], dilations[3], dilations[4]) outputs = F.conv3d( x=input, weight=filters, stride=_strides, dilation=_dilations, data_format=data_format, padding=padding, name=name ) return outputs def lrn(inputs, depth_radius, bias, alpha, beta): """ Local Response Normalization. Parameters ---------- inputs : tensor Must be one of the following types: half, bfloat16, float32. 4-D. depth_radius : int Defaults to 5. 0-D. Half-width of the 1-D normalization window. bias : float Defaults to 1. An offset (usually positive to avoid dividing by 0). alpha : float Defaults to 1. A scale factor, usually positive. beta : float Defaults to 0.5. An exponent. Returns ------- A Tensor. Has the same type as input. """ pass def moments(x, axes, shift=None, keepdims=False): """ Calculates the mean and variance of x. Parameters ---------- x : tensor A Tensor axes : ints Axes along which to compute mean and variance. shift : int Not used in the current implementation. keepdims : bool produce moments with the same dimensionality as the input. Returns ------- Two Tensor objects: mean and variance. """ pass class MaxPool1d(object): def __init__(self, ksize, strides, padding, data_format=None): self.data_format, self.padding = preprocess_1d_format(data_format=data_format, padding=padding) self.ksize = ksize self.strides = strides def __call__(self, inputs): if self.data_format == 'NLC': inputs = nhwc_to_nchw(inputs) outputs = F.max_pool1d(inputs, self.ksize, self.strides, self.padding) if self.data_format == 'NLC': outputs = nchw_to_nhwc(outputs) return outputs class MaxPool(object): def __init__(self, ksize, strides, padding, data_format=None): self.data_format, self.padding = preprocess_2d_format(data_format, padding) self.ksize = ksize if self.data_format is 'NHWC': self._stride = (strides[1], strides[2]) elif self.data_format is 'NCHW': self._stride = (strides[2], strides[3]) def __call__(self, inputs): outputs = F.max_pool2d( x=inputs, kernel_size=self.ksize, stride=self._stride, padding=self.padding, data_format=self.data_format ) return outputs def max_pool(input, ksize, strides, padding, data_format=None): """ Performs the max pooling on the input. Parameters ---------- input : tensor Tensor of rank N+2, of shape [batch_size] + input_spatial_shape + [num_channels] if data_format does not start with "NC" (default), or [batch_size, num_channels] + input_spatial_shape if data_format starts with "NC". Pooling happens over the spatial dimensions only. ksize : int or list of ints An int or list of ints that has length 1, N or N+2. The size of the window for each dimension of the input tensor. strides : int or list of ints An int or list of ints that has length 1, N or N+2. The stride of the sliding window for each dimension of the input tensor. padding : string 'VALID' or 'SAME'. The padding algorithm. See the "returns" section of tf.ops.convolution for details. Returns ------- A Tensor of format specified by data_format. The max pooled output tensor. """ pass class AvgPool1d(object): def __init__(self, ksize, strides, padding, data_format=None): self.data_format, self.padding = preprocess_1d_format(data_format=data_format, padding=padding) self.ksize = ksize self.strides = strides def __call__(self, inputs): if self.data_format == 'NLC': inputs = nhwc_to_nchw(inputs) outputs = F.avg_pool1d(inputs, self.ksize, self.strides, self.padding) if self.data_format == 'NLC': outputs = nchw_to_nhwc(outputs) return outputs class AvgPool(object): def __init__(self, ksize, strides, padding, data_format=None): self.data_format, self.padding = preprocess_2d_format(data_format, padding) self.filter_size = ksize if self.data_format is 'NHWC': self._stride = (strides[1], strides[2]) elif self.data_format is 'NCHW': self._stride = (strides[2], strides[3]) def __call__(self, inputs): outputs = F.avg_pool2d( inputs, kernel_size=self.filter_size, stride=self._stride, padding=self.padding, data_format=self.data_format ) return outputs def avg_pool(input, ksize, strides, padding): """ Performs the avg pooling on the input. Parameters ---------- input : tensor Tensor of rank N+2, of shape [batch_size] + input_spatial_shape + [num_channels] if data_format does not start with "NC" (default), or [batch_size, num_channels] + input_spatial_shape if data_format starts with "NC". Pooling happens over the spatial dimensions only. ksize : int or list of ints An int or list of ints that has length 1, N or N+2. The size of the window for each dimension of the input tensor. strides : int or list of ints An int or list of ints that has length 1, N or N+2. The stride of the sliding window for each dimension of the input tensor. padding : string 'VALID' or 'SAME'. The padding algorithm. See the "returns" section of tf.ops.convolution for details. Returns ------- A Tensor of format specified by data_format. The average pooled output tensor. """ pass class MaxPool3d(object): def __init__(self, ksize, strides, padding, data_format=None): self.data_format, self.padding = preprocess_3d_format(data_format, padding) self.ksize = ksize if self.data_format == 'NCDHW': self.strides = (strides[2], strides[3], strides[4]) if self.data_format == 'NDHWC': self.strides = (strides[1], strides[2], strides[3]) def __call__(self, inputs): outputs = F.max_pool3d( inputs, kernel_size=self.ksize, stride=self.strides, padding=self.padding, data_format=self.data_format ) return outputs def max_pool3d(input, ksize, strides, padding, data_format=None, name=None): """ Performs the max pooling on the input. Parameters ---------- input : tensor A 5-D Tensor of the format specified by data_format. ksize : int or list of ints An int or list of ints that has length 1, 3 or 5. The size of the window for each dimension of the input tensor. strides : int or list of ints An int or list of ints that has length 1, 3 or 5. The stride of the sliding window for each dimension of the input tensor. padding : string 'VALID' or 'SAME'. The padding algorithm. See the "returns" section of tf.ops.convolution for details. data_format : string "NDHWC", "NCDHW". Defaults to "NDHWC". The data format of the input and output data. With the default format "NDHWC", the data is stored in the order of: [batch, in_depth, in_height, in_width, in_channels]. Alternatively, the format could be "NCDHW", the data storage order is: [batch, in_channels, in_depth, in_height, in_width]. name : string A name for the operation (optional). Returns ------- A Tensor of format specified by data_format. The max pooled output tensor. """ pass class AvgPool3d(object): def __init__(self, ksize, strides, padding, data_format=None): self.data_format, self.padding = preprocess_3d_format(data_format, padding) self.ksize = ksize if self.data_format == 'NCDHW': self.strides = (strides[2], strides[3], strides[4]) if self.data_format == 'NDHWC': self.strides = (strides[1], strides[2], strides[3]) def __call__(self, inputs): outputs = F.avg_pool3d( inputs, kernel_size=self.ksize, stride=self.strides, padding=self.padding, data_format=self.data_format ) return outputs def avg_pool3d(input, ksize, strides, padding, data_format=None, name=None): """ Performs the average pooling on the input. Parameters ---------- input : tensor A 5-D Tensor of shape [batch, height, width, channels] and type float32, float64, qint8, quint8, or qint32. ksize : int or list of ints An int or list of ints that has length 1, 3 or 5. The size of the window for each dimension of the input tensor. strides : int or list of ints An int or list of ints that has length 1, 3 or 5. The stride of the sliding window for each dimension of the input tensor. padding : string 'VALID' or 'SAME'. The padding algorithm. See the "returns" section of tf.ops.convolution for details. data_format : string 'NDHWC' and 'NCDHW' are supported. name : string Optional name for the operation. Returns ------- A Tensor with the same type as value. The average pooled output tensor. """ pass def pool(input, window_shape, pooling_type, strides=None, padding='VALID', data_format=None, dilations=None, name=None): """ Performs an N-D pooling operation. Parameters ---------- input : tensor Tensor of rank N+2, of shape [batch_size] + input_spatial_shape + [num_channels] if data_format does not start with "NC" (default), or [batch_size, num_channels] + input_spatial_shape if data_format starts with "NC". Pooling happens over the spatial dimensions only. window_shape : int Sequence of N ints >= 1. pooling_type : string Specifies pooling operation, must be "AVG" or "MAX". strides : ints Sequence of N ints >= 1. Defaults to [1]*N. If any value of strides is > 1, then all values of dilation_rate must be 1. padding : string The padding algorithm, must be "SAME" or "VALID". Defaults to "SAME". See the "returns" section of tf.ops.convolution for details. data_format : string Specifies whether the channel dimension of the input and output is the last dimension (default, or if data_format does not start with "NC"), or the second dimension (if data_format starts with "NC"). For N=1, the valid values are "NWC" (default) and "NCW". For N=2, the valid values are "NHWC" (default) and "NCHW". For N=3, the valid values are "NDHWC" (default) and "NCDHW". dilations : list of ints Dilation rate. List of N ints >= 1. Defaults to [1]*N. If any value of dilation_rate is > 1, then all values of strides must be 1. name : string Optional. Name of the op. Returns ------- Tensor of rank N+2, of shape [batch_size] + output_spatial_shape + [num_channels] """ pass class DepthwiseConv2d(object): def __init__(self, strides, padding, data_format=None, dilations=None, ksize=None, channel_multiplier=1): self.data_format, self.padding = preprocess_2d_format(data_format, padding) if self.data_format == 'NHWC': self._stride = (strides[1], strides[2]) if self.data_format == 'NCHW': self._stride = (strides[2], strides[3]) self.dilations = dilations self.channel_multiplier = channel_multiplier def __call__(self, input, filter, point_filter=None): if self.data_format == 'NHWC': channel = input.shape[-1] elif self.data_format == 'NCHW': channel = input.shape[1] depthwise_conv = F.conv2d( input, filter, data_format=self.data_format, groups=channel, dilation=self.dilations, stride=self._stride, padding=self.padding ) pointwise_conv = F.conv2d(depthwise_conv, point_filter, data_format=self.data_format, padding=self.padding) return pointwise_conv def depthwise_conv2d(input, filter, strides, padding, data_format=None, dilations=None, name=None): """ Depthwise 2-D convolution. Parameters ---------- input : tensor 4-D with shape according to data_format. filter : tensor 4-D with shape [filter_height, filter_width, in_channels, channel_multiplier]. strides : list 1-D of size 4. The stride of the sliding window for each dimension of input. padding : string 'VALID' or 'SAME'. The padding algorithm. See the "returns" section of tf.ops.convolution for details. data_format : string The data format for input. Either "NHWC" (default) or "NCHW". dilations : list 1-D of size 2. The dilation rate in which we sample input values across the height and width dimensions in atrous convolution. If it is greater than 1, then all values of strides must be 1. name : string A name for this operation (optional). Returns ------- A 4-D Tensor with shape according to data_format. E.g., for "NHWC" format, shape is [batch, out_height, out_width, in_channels * channel_multiplier]. """ pass class Conv1d_transpose(object): def __init__( self, stride, padding, data_format='NWC', dilations=None, out_channel=None, k_size=None, in_channels=None ): self.stride = stride self.dilations = dilations self.data_format, self.padding = preprocess_1d_format(data_format, padding) def __call__(self, input, filters): out = F.conv1d_transpose( x=input, weight=filters, padding=self.padding, stride=self.stride, dilation=self.dilations, data_format=self.data_format, ) return out def conv1d_transpose( input, filters, output_shape, stride, padding='SAME', data_format='NWC', dilations=None, name=None ): """ The transpose of conv1d. Parameters ---------- input : tensor A 3-D Tensor of type float and shape [batch, in_width, in_channels] for NWC data format or [batch, in_channels, in_width] for NCW data format. filters : tensor A 3-D Tensor with the same type as value and shape [filter_width, output_channels, in_channels]. filter's in_channels dimension must match that of value. output_shape : tensor A 1-D Tensor, containing three elements, representing the output shape of the deconvolution op. strides : list An int or list of ints that has length 1 or 3. The number of entries by which the filter is moved right at each step. padding : string 'VALID' or 'SAME'. The padding algorithm. See the "returns" section of tf.ops.convolution for details. data_format : string 'NWC' and 'NCW' are supported. dilations : list An int or list of ints that has length 1 or 3 which defaults to 1. The dilation factor for each dimension of input. If set to k > 1, there will be k-1 skipped cells between each filter element on that dimension. Dilations in the batch and depth dimensions must be 1. name : string Optional name for the returned tensor. Returns ------- A Tensor with the same type as value. """ data_format, padding = preprocess_1d_format(data_format, padding) output = F.conv1d_transpose( x=input, weight=filters, stride=stride, padding=padding, dilation=dilations, data_format=data_format, output_size=output_shape, ) return output class Conv2d_transpose(object): def __init__( self, strides, padding, data_format='NHWC', dilations=None, name=None, out_channel=None, k_size=None, in_channels=None ): self.strides = strides self.dilations = dilations self.data_format, self.padding = preprocess_2d_format(data_format, padding) def __call__(self, input, filters): output = F.conv2d_transpose( x=input, weight=filters, stride=self.strides, padding=self.padding, dilation=self.dilations, data_format=self.data_format ) return output def conv2d_transpose( input, filters, output_shape, strides, padding='SAME', data_format='NHWC', dilations=None, name=None ): """ The transpose of conv2d. Parameters ---------- input : tensor A 4-D Tensor of type float and shape [batch, height, width, in_channels] for NHWC data format or [batch, in_channels, height, width] for NCHW data format. filters : tensor A 4-D Tensor with the same type as input and shape [height, width, output_channels, in_channels]. filter's in_channels dimension must match that of input. output_shape : tensor A 1-D Tensor representing the output shape of the deconvolution op. strides : list An int or list of ints that has length 1, 2 or 4. The stride of the sliding window for each dimension of input. If a single value is given it is replicated in the H and W dimension. By default the N and C dimensions are set to 0. The dimension order is determined by the value of data_format, see below for details. padding : string 'VALID' or 'SAME'. The padding algorithm. See the "returns" section of tf.ops.convolution for details. data_format : string 'NHWC' and 'NCHW' are supported. dilations : list An int or list of ints that has length 1, 2 or 4, defaults to 1. name : string Optional name for the returned tensor. Returns ------- A Tensor with the same type as input. """ data_format, padding = preprocess_2d_format(data_format, padding) output = F.conv2d_transpose( x=input, weight=filters, output_size=output_shape, stride=strides, padding=padding, dilation=dilations, data_format=data_format, ) return output class Conv3d_transpose(object): def __init__( self, strides, padding, data_format='NDHWC', dilations=None, name=None, out_channel=None, k_size=None, in_channels=None ): self.strides = strides self.dilations = dilations self.data_format, self.padding = preprocess_3d_format(data_format, padding) def __call__(self, input, filters): output = F.conv3d_transpose( x=input, weight=filters, stride=self.strides, padding=self.padding, dilation=self.dilations, data_format=self.data_format ) return output def conv3d_transpose( input, filters, output_shape, strides, padding='SAME', data_format='NDHWC', dilations=None, name=None ): """ The transpose of conv3d. Parameters ---------- input : tensor A 5-D Tensor of type float and shape [batch, height, width, in_channels] for NHWC data format or [batch, in_channels, height, width] for NCHW data format. filters : tensor A 5-D Tensor with the same type as value and shape [height, width, output_channels, in_channels]. filter's in_channels dimension must match that of value. output_shape : tensor A 1-D Tensor representing the output shape of the deconvolution op. strides : list An int or list of ints that has length 1, 3 or 5. padding : string 'VALID' or 'SAME'. The padding algorithm. See the "returns" section of tf.ops.convolution for details. data_format : string 'NDHWC' and 'NCDHW' are supported. dilations : list of ints An int or list of ints that has length 1, 3 or 5, defaults to 1. name : string Optional name for the returned tensor. Returns ------- A Tensor with the same type as value. """ data_format, padding = preprocess_3d_format(data_format, padding) output = F.conv3d_transpose( x=input, weight=filters, output_size=output_shape, stride=strides, padding=padding, dilation=dilations, data_format=data_format, ) return output class BatchNorm(object): def __init__( self, decay=0.9, epsilon=0.00001, beta=None, gamma=None, moving_mean=None, moving_var=None, num_features=None, data_format='channels_last', is_train=False ): self.decay = decay self.epsilon = epsilon self.data_format = data_format self.beta = beta self.gamma = gamma self.moving_mean = moving_mean self.moving_var = moving_var self.num_features = num_features self.is_train = is_train self.axes = None def __call__(self, inputs): data_format = self.channel_format(inputs) outputs = pd.nn.functional.batch_norm( inputs, self.moving_mean, self.moving_var, weight=self.gamma, bias=self.beta, training=self.is_train, momentum=self.decay, epsilon=self.epsilon, data_format=data_format ) return outputs def channel_format(self, inputs): """ return "NC", "NCL", "NCHW", "NCDHW", "NLC", "NHWC" or "NDHWC". """ len_in_shape = len(inputs.shape) if len_in_shape == 2: return 'NC' if self.data_format == 'channels_last': if len_in_shape == 3: return 'NLC' if len_in_shape == 4: return 'NHWC' if len_in_shape == 5: return 'NDHWC' if self.data_format == 'channels_first': if len_in_shape == 3: return 'NCL' if len_in_shape == 4: return 'NCHW' if len_in_shape == 5: return 'NCDHW' class GroupConv2D(object): def __init__(self, strides, padding, data_format, dilations, out_channel, k_size, groups): self.out_channel = out_channel self.k_size = k_size self.groups = groups self.data_format, self.padding = preprocess_2d_format(data_format, padding) if self.data_format is 'NHWC': self.strides = (strides[1], strides[2]) self.dilations = (dilations[1], dilations[2]) elif self.data_format is 'NCHW': self.strides = (strides[2], strides[3]) self.dilations = (dilations[2], dilations[3]) def __call__(self, inputs, filters): outputs = F.conv2d( inputs, weight=filters, stride=self.strides, padding=self.padding, dilation=self.dilations, groups=self.groups, data_format=self.data_format ) return outputs class SeparableConv1D(object): def __init__(self, stride, padding, data_format, dilations, out_channel, k_size, in_channel, depth_multiplier): self.stride = stride self.dilations = dilations self.out_channel = out_channel self.k_size = k_size self.in_channel = int(in_channel) self.depth_multiplier = depth_multiplier self.data_format, self.padding = preprocess_1d_format(data_format, padding) def __call__(self, inputs, depthwise_filters, pointwise_filters): outputs = F.conv1d( inputs, weight=depthwise_filters, stride=self.stride, padding=self.padding, dilation=self.dilations, groups=self.in_channel, data_format=self.data_format ) outputs = F.conv1d( outputs, weight=pointwise_filters, stride=1, padding=self.padding, dilation=1, groups=1, data_format=self.data_format ) return outputs class SeparableConv2D(object): def __init__(self, strides, padding, data_format, dilations, out_channel, k_size, in_channel, depth_multiplier): self.out_channel = out_channel self.k_size = k_size self.in_channel = int(in_channel) self.depth_multiplier = depth_multiplier self.data_format, self.padding = preprocess_2d_format(data_format, padding) if self.data_format is 'NHWC': self.strides = (strides[1], strides[2]) self.dilations = (dilations[1], dilations[2]) elif self.data_format is 'NCHW': self.strides = (strides[2], strides[3]) self.dilations = (dilations[2], dilations[3]) def __call__(self, inputs, depthwise_filters, pointwise_filters): outputs = F.conv2d( inputs, weight=depthwise_filters, stride=self.strides, padding=self.padding, dilation=self.dilations, groups=self.in_channel, data_format=self.data_format ) outputs = F.conv2d( outputs, weight=pointwise_filters, stride=1, padding=self.padding, dilation=1, groups=1, data_format=self.data_format ) return outputs class AdaptiveMeanPool1D(object): def __init__(self, output_size, data_format): self.data_format, _ = preprocess_1d_format(data_format, None) self.output_size = output_size def __call__(self, input): if self.data_format == 'NLC': input = nhwc_to_nchw(input) output = F.adaptive_avg_pool1d(input, self.output_size) if self.data_format == 'NLC': output = nchw_to_nhwc(output) return output class AdaptiveMeanPool2D(object): def __init__(self, output_size, data_format): self.data_format, _ = preprocess_2d_format(data_format, None) self.output_size = output_size def __call__(self, inputs): return F.adaptive_avg_pool2d(inputs, output_size=self.output_size, data_format=self.data_format) class AdaptiveMeanPool3D(object): def __init__(self, output_size, data_format): self.data_format, _ = preprocess_3d_format(data_format, None) self.output_size = output_size def __call__(self, inputs): return F.adaptive_avg_pool3d(inputs, output_size=self.output_size, data_format=self.data_format) class AdaptiveMaxPool1D(object): def __init__(self, output_size, data_format): self.data_format, _ = preprocess_1d_format(data_format, None) self.output_size = output_size def __call__(self, input): if self.data_format == 'NLC': input = nhwc_to_nchw(input) output = F.adaptive_max_pool1d(input, self.output_size) if self.data_format == 'NLC': output = nchw_to_nhwc(output) return output class AdaptiveMaxPool2D(object): def __init__(self, output_size, data_format): self.data_format, _ = preprocess_2d_format(data_format, None) self.output_size = output_size def __call__(self, inputs): if self.data_format == 'NHWC': inputs = nhwc_to_nchw(inputs) output = F.adaptive_max_pool2d(inputs, self.output_size) if self.data_format == 'NHWC': output = nchw_to_nhwc(output) return output class AdaptiveMaxPool3D(object): def __init__(self, output_size, data_format): self.data_format, _ = preprocess_3d_format(data_format, None) self.output_size = output_size def __call__(self, inputs): if self.data_format == 'NDHWC': inputs = nhwc_to_nchw(inputs) output = F.adaptive_max_pool3d(inputs, self.output_size) if self.data_format == 'NDHWC': output = nchw_to_nhwc(output) return output class BinaryConv2D(object): def __init__(self, strides, padding, data_format, dilations, out_channel, k_size, in_channel): pass def __call__(self, inputs, filters): raise NotImplementedError class DorefaConv2D(object): def __init__(self, bitW, bitA, strides, padding, data_format, dilations, out_channel, k_size, in_channel): pass def __call__(self, inputs, filters): raise NotImplementedError class rnncell(RNNCellBase): def __init__(self, weight_ih, weight_hh, bias_ih, bias_hh, act): super(rnncell, self).__init__() self.weight_ih = weight_ih self.weight_hh = weight_hh self.bias_ih = bias_ih self.bias_hh = bias_hh self.act_fn = F.relu if act == 'relu' else F.tanh self.input_size = weight_ih.shape[1] def forward(self, input, h): i2h = pd.matmul(input, self.weight_ih, transpose_y=True) if self.bias_ih is not None: i2h += self.bias_ih h2h = pd.matmul(h, self.weight_hh, transpose_y=True) if self.bias_hh is not None: h2h += self.bias_hh h = self.act_fn(i2h + h2h) return h, h class lstmcell(RNNCellBase): def __init__(self, weight_ih, weight_hh, bias_ih, bias_hh, act=None): super(lstmcell, self).__init__() self.weight_ih = weight_ih self.weight_hh = weight_hh self.bias_ih = bias_ih self.bias_hh = bias_hh self.gate_act_fn = F.sigmoid self.act_fn = F.tanh self.input_size = weight_ih.shape[1] def forward(self, inputs, h, c): gates = pd.matmul(inputs, self.weight_ih, transpose_y=True) if self.bias_ih is not None: gates += self.bias_ih gates += pd.matmul(h, self.weight_hh, transpose_y=True) if self.bias_hh is not None: gates += self.bias_hh gates_slices = pd.split(gates, num_or_sections=4, axis=-1) i = self.gate_act_fn(gates_slices[0]) f = self.gate_act_fn(gates_slices[1]) o = self.gate_act_fn(gates_slices[3]) c = f * c + i * self.act_fn(gates_slices[2]) h = o * self.act_fn(c) return h, h, c class grucell(RNNCellBase): def __init__(self, weight_ih, weight_hh, bias_ih, bias_hh, act=None): super(grucell, self).__init__() self.weight_ih = weight_ih self.weight_hh = weight_hh self.bias_ih = bias_ih self.bias_hh = bias_hh self.gate_act_fn = F.sigmoid self.act_fn = F.tanh self.input_size = weight_ih.shape[1] def forward(self, input, h): x_gates = pd.matmul(input, self.weight_ih, transpose_y=True) if self.bias_ih is not None: x_gates = x_gates + self.bias_ih h_gates = pd.matmul(h, self.weight_hh, transpose_y=True) if self.bias_hh is not None: h_gates = h_gates + self.bias_hh x_r, x_z, x_c = pd.split(x_gates, num_or_sections=3, axis=-1) h_r, h_z, h_c = pd.split(h_gates, num_or_sections=3, axis=-1) r = self.gate_act_fn(x_r + h_r) z = self.gate_act_fn(x_z + h_z) c = self.act_fn(x_c + r * h_c) # apply reset gate after mm h = (h - c) * z + c return h, h def split_states(states, bidirectional=False, state_components=1): if state_components == 1: states = pd.unstack(states) if not bidirectional: return states else: return list(zip(states[::2], states[1::2])) else: assert len(states) == state_components states = tuple([pd.unstack(item) for item in states]) if not bidirectional: return list(zip(*states)) else: states = list(zip(*states)) return list(zip(states[::2], states[1::2])) def concat_states(states, bidirectional=False, state_components=1): if state_components == 1: return pd.stack(flatten(states)) else: states = flatten(states) componnets = [] for i in range(state_components): componnets.append(states[i::state_components]) return tuple([pd.stack(item) for item in componnets]) class rnnbase(LayerList): def __init__( self, mode, input_size, hidden_size, num_layers, bias, batch_first, dropout, bidirectional, is_train, w_ih, w_hh, b_ih, b_hh, ): super(rnnbase, self).__init__() self.mode = mode self.input_size = input_size self.hidden_size = hidden_size self.num_layers = num_layers self.time_major = False if batch_first else True self.dropout = dropout self.bidirect = 2 if bidirectional else 1 self.state_components = 2 if mode == 'LSTM' else 1 self.training = is_train self.w_ih = w_ih self.w_hh = w_hh self.b_ih = b_ih self.b_hh = b_hh self.bias = bias RNN = pd.nn.RNN BiRNN = pd.nn.BiRNN kwargs = {"weight_ih_attr": None, "weight_hh_attr": None, "bias_ih_attr": self.bias, "bias_hh_attr": self.bias} act = None rnn_cls = None if mode == "LSTM": rnn_cls = pd.nn.LSTMCell elif mode == "GRU": rnn_cls = pd.nn.GRUCell elif mode == 'RNN_TANH': rnn_cls = pd.nn.SimpleRNNCell kwargs["activation"] = 'tanh' elif mode == 'RNN_RELU': rnn_cls = pd.nn.SimpleRNNCell kwargs["activation"] = 'relu' if not bidirectional: is_reverse = False for i in range(self.num_layers): weight_ih = self.w_ih[i] weight_hh = self.w_hh[i] if self.bias: bias_ih = self.b_ih[i] bias_hh = self.b_hh[i] else: bias_ih = None bias_hh = None cell = rnn_cls(input_size=self.input_size, hidden_size=self.hidden_size, **kwargs) cell.weight_ih = weight_ih cell.weight_hh = weight_hh cell.bias_ih = bias_ih cell.bias_hh = bias_hh # cell = rnn_cls(weight_ih, weight_hh, bias_ih, bias_hh, act) self.append(RNN(cell, is_reverse, self.time_major)) else: for i in range(self.num_layers): weight_ih_fw = self.w_ih[2 * i] weight_hh_fw = self.w_hh[2 * i] weight_ih_bw = self.w_ih[2 * i + 1] weight_hh_bw = self.w_hh[2 * i + 1] if self.bias: bias_ih_fw = self.b_ih[2 * i] bias_hh_fw = self.b_hh[2 * i] bias_ih_bw = self.b_ih[2 * i + 1] bias_hh_bw = self.b_hh[2 * i + 1] else: bias_ih_fw = None bias_hh_fw = None bias_ih_bw = None bias_hh_bw = None layer_input_size = self.input_size if i == 0 else self.hidden_size * self.bidirect cell_fw = rnn_cls(input_size=layer_input_size, hidden_size=self.hidden_size, **kwargs) cell_fw.weight_ih = weight_ih_fw cell_fw.weight_hh = weight_hh_fw cell_fw.bias_ih = bias_ih_fw cell_fw.bias_hh = bias_hh_fw cell_bw = rnn_cls(input_size=layer_input_size, hidden_size=self.hidden_size, **kwargs) cell_bw.weight_ih = weight_ih_bw cell_bw.weight_hh = weight_hh_bw cell_bw.bias_ih = bias_ih_bw cell_bw.bias_hh = bias_hh_bw self.append(BiRNN(cell_fw, cell_bw, self.time_major)) self.could_use_cudnn = True self.could_use_cudnn &= len(self.parameters()) == num_layers * 4 * self.bidirect param_names = [] for layer in range(self.num_layers): for direction in range(self.bidirect): suffix = '_reverse' if direction == 1 else '' param_names.extend(['weight_ih_l{}{}', 'weight_hh_l{}{}']) if bias != False: param_names.append('bias_ih_l{}{}') if bias != False: param_names.append('bias_hh_l{}{}') param_names = [x.format(layer, suffix) for x in param_names] for name, param in zip(param_names, self.parameters()): setattr(self, name, param) self.flatten_parameters() def flatten_parameters(self): if self.could_use_cudnn: params = self.parameters(include_sublayers=False) shape = [np.prod(param.shape) for param in params] self._all_weights = [None] * len(params) for i, param in enumerate(params): offset = 0 if i % 4 < 2 else (2 * self.num_layers * self.bidirect) layer_idx = i // 4 self._all_weights[offset + layer_idx * 2 + i % 2] = param self._flat_weight = [ self.create_parameter( shape=[np.sum(shape)], dtype=params[0].dtype, default_initializer=I.Constant(0.0) ) ] self._dropout_state = self.create_variable(dtype=fluid.core.VarDesc.VarType.UINT8) with fluid.program_guard(fluid.default_startup_program(), fluid.default_startup_program()): with framework.no_grad(): self._helper.append_op( type="coalesce_tensor", inputs={"Input": self._all_weights}, outputs={ "Output": self._all_weights, "FusedOutput": self._flat_weight }, attrs={ "copy_data": True, "use_align": False, "dtype": params[0].dtype } ) def _cudnn_impl(self, inputs, initial_states, sequence_length): if not self.time_major: inputs = pd.tensor.transpose(inputs, [1, 0, 2]) out = self._helper.create_variable_for_type_inference(inputs.dtype) state = [self._helper.create_variable_for_type_inference(inputs.dtype) for i in range(self.state_components)] reserve = self._helper.create_variable_for_type_inference( dtype=fluid.core.VarDesc.VarType.UINT8, stop_gradient=True ) inputs = { 'Input': inputs, 'WeightList': self._all_weights, 'PreState': initial_states, 'SequenceLength': sequence_length } attrs = { 'dropout_prob': self.dropout, 'is_bidirec': self.bidirect == 2, 'input_size': self.input_size, 'hidden_size': self.hidden_size, 'num_layers': self.num_layers, 'mode': self.mode, 'is_test': not self.training } outputs = { 'Out': out, 'State': state, 'Reserve': reserve, 'DropoutState': self._dropout_state, } self._helper.append_op(type="rnn", inputs=inputs, outputs=outputs, attrs=attrs) out = pd.tensor.transpose(out, [1, 0, 2]) if not self.time_major else out return out, tuple(state) if len(state) > 1 else state[0] def forward(self, inputs, initial_states=None): batch_index = 1 if self.time_major else 0 dtype = inputs.dtype sequence_length = None if initial_states is None: state_shape = (self.num_layers * self.bidirect, -1, self.hidden_size) if self.state_components == 1: initial_states = pd.fluid.layers.fill_constant_batch_size_like( inputs, state_shape, dtype, 0, batch_index, 1 ) else: initial_states = tuple( [ pd.fluid.layers.fill_constant_batch_size_like(inputs, state_shape, dtype, 0, batch_index, 1) for _ in range(self.state_components) ] ) if self.could_use_cudnn: # Add CPU kernel and dispatch in backend later return self._cudnn_impl(inputs, initial_states, sequence_length) states = split_states(initial_states, self.bidirect == 2, self.state_components) final_states = [] for i, rnn_layer in enumerate(self): if i > 0: inputs = F.dropout(inputs, self.dropout, training=self.training, mode="upscale_in_train") outputs, final_state = rnn_layer(inputs, states[i], sequence_length) final_states.append(final_state) inputs = outputs final_states = concat_states(final_states, self.bidirect == 2, self.state_components) return outputs, final_states class layernorm(object): def __init__(self, normalized_shape, gamma, beta, eps, input_shape): self.normalized_shape = normalized_shape self.gamma = gamma self.beta = beta self.eps = eps self.input_shape = input_shape def __call__(self, input): scale = pd.flatten(self.gamma) offset = pd.flatten(self.beta) output = pd.nn.functional.layer_norm( input, normalized_shape=self.normalized_shape, weight=scale, bias=offset, epsilon=self.eps ) return output class multiheadattention(object): def __init__( self, embed_dim, num_heads, dropout, batch_first, need_weights, q_weight, k_weight, v_weight, out_weight, q_bias, k_bias, v_bias, out_bias, train, ): self.embed_dim_check = embed_dim self.num_heads = num_heads self.dropout = dropout self.batch_first = batch_first self.need_weights = need_weights self.q_weight = q_weight self.k_weight = k_weight self.v_weight = v_weight self.out_weight = out_weight self.q_bias = q_bias self.k_bias = k_bias self.v_bias = v_bias self.out_bias = out_bias self.train = train def __call__(self, q, k, v, attn_mask, key_padding_mask): #transpose tensor shape k = q if k is None else k v = q if v is None else v if self.batch_first: q = pd.transpose(q, perm=(1, 0, 2)) k = pd.transpose(k, perm=(1, 0, 2)) v = pd.transpose(v, perm=(1, 0, 2)) #check tensor shape tgt_len, batch_size, embed_dim = q.shape src_len, _, _ = k.shape if embed_dim != self.embed_dim_check: raise ValueError("Expecting embedding dimension is {}, but got {}".format(self.embed_dim_check, embed_dim)) head_dim = embed_dim // self.num_heads if head_dim * self.num_heads != embed_dim: raise ValueError("embedding dimension {} not divisible by num_heads {}".format(embed_dim, self.num_heads)) if k.shape[:2] != v.shape[:2]: raise ValueError( "key's sequence length and batch size {} do not match value's {}".format(k.shape[:2], v.shape[:2]) ) #compute q k v linear projection q = F.linear(q, self.q_weight, self.q_bias) k = F.linear(k, self.k_weight, self.k_bias) v = F.linear(v, self.v_weight, self.v_bias) # check and prep attention mask if attn_mask is not None: if convert_dtype(attn_mask.dtype) == 'uint8': warnings.warn("attn_mask tensor dtype should better be bool.") attn_mask = pd.cast(attn_mask, dtype='bool') elif convert_dtype(attn_mask.dtype) not in ('float32', 'float64', 'bool'): raise TypeError( "attn_mask tensor dtype should be in ('float32', 'float64', 'bool','uint8')," "but got {}".format(attn_mask.dtype) ) if attn_mask.dim() == 2: if attn_mask.shape != [tgt_len, src_len]: raise ValueError( "The shape of 2D attn_mask should be {}, but got {}.".format( [tgt_len, src_len], attn_mask.shape ) ) attn_mask = pd.unsqueeze(attn_mask, axis=0) elif attn_mask.dim() == 3: size_3d = [batch_size * self.num_heads, tgt_len, src_len] if attn_mask.shape != size_3d: raise ValueError( "The shape of 3D attn_mask should be {}, but got {}.".format(size_3d, attn_mask.shape) ) else: raise ValueError("attn_mask's dimension {} is not supported.".format(attn_mask.dim())) # prep mulithead q k v q = pd.transpose(pd.reshape(q, shape=(tgt_len, batch_size * self.num_heads, head_dim)), perm=(1, 0, 2)) k = pd.transpose(pd.reshape(k, shape=(src_len, batch_size * self.num_heads, head_dim)), perm=(1, 0, 2)) v = pd.transpose(pd.reshape(v, shape=(src_len, batch_size * self.num_heads, head_dim)), perm=(1, 0, 2)) #check and prep key padding mask if key_padding_mask is not None: if key_padding_mask.shape != [batch_size, src_len]: raise ValueError( "Expecting key_padding_mask shape is {}, but got {}.".format( [batch_size, src_len], key_padding_mask.shape ) ) if convert_dtype(key_padding_mask.dtype) == 'uint8': warnings.warn("key_padding_mask tensor dtype should better be bool.") key_padding_mask = pd.cast(key_padding_mask, dtype='bool') elif convert_dtype(key_padding_mask.dtype) != 'bool': raise TypeError( "key_padding_mask tensor dtype should be 'bool' or 'uint8', but got {}.".format( key_padding_mask.dtype ) ) key_padding_mask = key_padding_mask.reshape((batch_size, 1, 1, src_len)).expand( (-1, self.num_heads, -1, -1) ).reshape((batch_size * self.num_heads, 1, src_len)) if attn_mask is None: attn_mask = key_padding_mask elif convert_dtype(attn_mask.dtype) == 'bool': attn_mask = pd.logical_or(attn_mask, key_padding_mask) else: # attn_mask = attn_mask.expand((self.num_heads * batch_size, -1, -1)) # key_padding_mask = key_padding_mask.expand((-1,tgt_len, -1)) # attn_mask = attn_mask.numpy() # key_padding_mask = key_padding_mask.numpy() # attn_mask[key_padding_mask] = float('-inf') # attn_mask = pd.to_tensor(attn_mask, dtype='float32') key_padding_mask_inf = pd.full_like(key_padding_mask, fill_value=float('-inf'), dtype='float32') attn_mask = pd.where(key_padding_mask, key_padding_mask_inf, attn_mask) #convert bool mask to float if attn_mask is not None and convert_dtype(attn_mask.dtype) == 'bool': # new_attn_mask = pd.zeros_like(attn_mask, dtype='float32') # np_new_attn_mask = new_attn_mask.numpy() # np_attn_mask = attn_mask.numpy() # np_new_attn_mask[np_attn_mask] = float('-inf') # attn_mask = pd.to_tensor(np_new_attn_mask, dtype='float32') new_attn_mask_zero = pd.zeros_like(attn_mask, dtype='float32') new_attn_mask_inf = pd.ones_like(attn_mask, dtype='float32') * -np.inf attn_mask = pd.where(attn_mask, new_attn_mask_inf, new_attn_mask_zero) # attention and out projection q = q / math.sqrt(embed_dim) k = pd.transpose(k, perm=(0, 2, 1)) attn = pd.bmm(q, k) if attn_mask is not None: attn += attn_mask attn = pd.nn.functional.softmax(attn) if self.dropout: attn = F.dropout(attn, self.dropout, training=self.train, mode="upscale_in_train") output = pd.bmm(attn, v) output = pd.reshape(pd.transpose(output, perm=(1, 0, 2)), shape=(tgt_len, batch_size, embed_dim)) output = F.linear(output, weight=self.out_weight, bias=self.out_bias) if self.batch_first: output = pd.transpose(output, perm=(1, 0, 2)) if self.need_weights: attn = pd.reshape(attn, shape=(batch_size, self.num_heads, tgt_len, src_len)) attn = pd.sum(attn, axis=1) / self.num_heads return output, attn else: return output, None class BinaryDense(object): def __init__(self, weights, bias): self.weights = weights self.bias = bias def __call__(self, inputs): raise NotImplementedError class DorefaDense(object): def __init__(self, weights, bias, bitW, bitA): self.weights = weights self.bias = bias self.bitW = bitW self.bitA = bitA def __call__(self, inputs): raise NotImplementedError class TernaryDense(object): def __init__(self, weights, bias): self.weights = weights self.bias = bias def __call__(self, inputs): raise NotImplementedError class QuanDense(object): def __init__(self, weights, bias, bitW, bitA): self.weights = weights self.bias = bias self.bitW = bitW self.bitA = bitA def __call__(self, inputs): raise NotImplementedError class QuanDenseBn(object): def __init__( self, weights, scale_para, offset_para, moving_mean, moving_variance, decay, bitW, bitA, epsilon, is_train ): self.weights = weights self.scale_para = scale_para self.offset_para = offset_para self.moving_mean = moving_mean self.moving_variance = moving_variance self.decay = decay self.bitW = bitW self.bitA = bitA self.epsilon = epsilon self.is_train = is_train def __call__(self, inputs): raise NotImplementedError class TernaryConv(object): def __init__(self, weights, strides, padding, data_format, dilations): self.weights = weights self.strides = strides self.dilations = dilations self.data_format, self.padding = preprocess_2d_format(data_format, padding) def __call__(self, inputs): raise NotImplementedError class QuanConv(object): def __init__(self, weights, strides, padding, data_format, dilations, bitW, bitA): self.weights = weights self.strides = strides self.dilations = dilations self.data_format, self.padding = preprocess_2d_format(data_format, padding) self.bitW = bitW self.bitA = bitA def __call__(self, inputs): raise NotImplementedError class QuanConvBn(object): def __init__( self, weights, scale_para, offset_para, moving_mean, moving_variance, strides, padding, data_format, dilations, bitW, bitA, decay, epsilon, is_train ): self.weights = weights self.strides = strides self.dilations = dilations self.data_format, self.padding = preprocess_2d_format(data_format, padding) self.bitW = bitW self.bitA = bitA self.scale_para = scale_para self.offset_para = offset_para self.moving_mean = moving_mean self.moving_variance = moving_variance self.decay = decay self.epsilon = epsilon self.is_train = is_train def __call__(self, inputs): raise NotImplementedError class PReLU(object): def __init__(self, data_format): self.data_format, _ = preprocess_2d_format(data_format, None) def __call__(self, input, weight): return F.prelu(input, weight, data_format=self.data_format) def prelu(input, weight, data_format): data_format, _ = preprocess_2d_format(data_format, None) return F.prelu(input, weight, data_format=data_format)

34.15805

148

0.619459

70e8371498b0e891c36ea2b78808ae580cb9fedc

1,047

py

Python

alife/alife_shelter.py

flags/Reactor-3

b41a2904c9ec8cc14bcee03611602d0e568acf12

[ "MIT" ]

56

2015-04-20T08:31:29.000Z

2021-12-19T14:05:18.000Z

alife/alife_shelter.py

HexDecimal/Reactor-3

b41a2904c9ec8cc14bcee03611602d0e568acf12

[ "MIT" ]

2

2018-07-24T11:24:41.000Z

2021-05-16T03:04:53.000Z

alife/alife_shelter.py

HexDecimal/Reactor-3

b41a2904c9ec8cc14bcee03611602d0e568acf12

[ "MIT" ]

9

2015-11-03T02:56:20.000Z

2021-04-28T08:19:57.000Z

from globals import * import life as lfe import references import judgement import chunks import goals import maps import random STATE = 'shelter' TIER = TIER_SURVIVAL-.1 def get_tier(life): if not lfe.execute_raw(life, 'discover', 'desires_shelter') and lfe.execute_raw(life, 'state', 'shelter'): return TIER_IDLE-.1 return TIER def tick(life): if not 'shelter' in life['state_flags']: life['state_flags']['shelter'] = judgement.get_best_shelter(life) if not life['state_flags']['shelter'] in life['known_chunks']: judgement.judge_chunk(life, life['state_flags']['shelter']) if not chunks.get_flag(life, life['state_flags']['shelter'], 'shelter_cover'): return False if not list(life['pos'][:2]) in chunks.get_flag(life, life['state_flags']['shelter'], 'shelter_cover'): if not lfe.path_dest(life) or (not chunks.position_is_in_chunk(lfe.path_dest(life), life['state_flags']['shelter'])): _cover = chunks.get_flag(life, life['state_flags']['shelter'], 'shelter_cover') lfe.walk_to(life, random.choice(_cover))

29.083333

119

0.727794

5f1f40fdb37c506c6a6922dc33154cee6361df5a

1,434

py

Python

agrc/messaging.py

stdavis/agrc.python

cd9a25c21f283ee01a0e59b2328f29991e396864

[ "MIT" ]

2

2016-09-29T16:52:28.000Z

2018-05-07T23:08:51.000Z

agrc/messaging.py

stdavis/agrc.python

cd9a25c21f283ee01a0e59b2328f29991e396864

[ "MIT" ]

4

2015-02-17T14:23:17.000Z

2016-11-08T15:53:35.000Z

agrc/messaging.py

agrc/agrc.python

0e211baa58c99d55e53568648cd22912a4d466b8

[ "MIT" ]

4

2015-09-10T13:39:54.000Z

2018-07-23T16:08:21.000Z

from smtplib import SMTP from email.mime.text import MIMEText class Emailer: # set this to True to prevent emails from actually being sent fromAddress = 'noreply@utah.gov' server = 'send.state.ut.us' port = 25 def __init__(self, toAddress, testing=False): """ split multiple emails addresses with a ';' (e.g. toAddress='hello@test.com;hello2@test.com') """ self.testing = testing if toAddress is not None: self.toAddress = toAddress else: raise Exception('You must provide a toAddress') if testing: print('Emailer: Testing only. No emails will be sent!') def sendEmail(self, subject, body, toAddress=False): """ sends an email using the agrcpythonemailer@gmail.com account """ if not toAddress: toAddress = self.toAddress toAddress = toAddress.split(';') message = MIMEText(body) message['Subject'] = subject message['From'] = self.fromAddress message['To'] = ','.join(toAddress) if not self.testing: s = SMTP(self.server, self.port) s.sendmail(self.fromAddress, toAddress, message.as_string()) s.quit() print('email sent') else: print('***Begin Test Email Message***') print(message) print('***End Test Email Message***')

28.68

100

0.580893

0b2f87b299d3b2252148a658feea4abd7016f8c3

118

py

Python

secrets.py

borisboychev/Instagram-bot

d6ea1d6e954d081117bd84459ac871b3bb233bc0

[ "MIT" ]

null

secrets.py

borisboychev/Instagram-bot

d6ea1d6e954d081117bd84459ac871b3bb233bc0

[ "MIT" ]

null

secrets.py

borisboychev/Instagram-bot

d6ea1d6e954d081117bd84459ac871b3bb233bc0

[ "MIT" ]

null

""""ENTER YOUR CREDENTIALS HERE""" username = "" # <- ENTER USERNAME HERE password = "" # <- ENTER PASSWORD HERE

23.6

39

0.627119

7b40f6c26b26e8aa8e5b7b3e58579f15d476c2e6

1,370

py

Python

tests/ut_repytests_testsocketclose.py

SeattleTestbed/repy_v1

f40a02e2e398b1ec67fede84b41a264ae7356d2c

[ "MIT" ]

1

2021-08-18T05:58:17.000Z

tests/ut_repytests_testsocketclose.py

SeattleTestbed/repy_v1

f40a02e2e398b1ec67fede84b41a264ae7356d2c

[ "MIT" ]

3

2015-11-17T21:01:03.000Z

2016-07-14T09:08:04.000Z

tests/ut_repytests_testsocketclose.py

SeattleTestbed/repy_v1

f40a02e2e398b1ec67fede84b41a264ae7356d2c

[ "MIT" ]

5

2015-07-02T13:29:23.000Z

2021-09-25T07:48:30.000Z

#pragma repy """ Author: Armon Dadgar Description: This tests the behavior of sockets when close() is called and there is data in the recv buffer. "Bad" behavior would be if new_conn throws a "Socket closed" exception. Good behavior is a clean termination. When we call close(), it is possible that a TCP RST packet would be sent, and that the receiver of the RST packet dumps all the data in the recv buffer. Then, if a read were to be made on the recv buffer, it is empty and the connection is closed, so a "Socket closed" exception would be raised. However, if we do not send a TCP RST, and only send a FIN packet, then the data from the recv buffer can be read without causing a "Socket closed" exception. This test is to guarentee the "good" behavior, by which we avoid sending a RST packet. """ # Handle a new connection def new_conn(ip,port,sock,ch1,ch2): # Values to send values = "1 2 3 4 5 " # Send this sock.send(values) # Get the response sleep(0.4) response = sock.recv(4) # Done sock.close() stopcomm(ch2) if callfunc == "initialize": # Get the ip ip = getmyip() # Setup listener waitforconn(ip,<connport>,new_conn) # Connect sock = openconn(ip,<connport>) # Read the first 2 numbers num1 = sock.recv(2) num2 = sock.recv(2) # Close now sock.send("bad!") sock.close()

22.833333

63

0.692701

f43dc6258f7e9dbcd6962376a790c90f57a1a7b4

1,585

py

Python

fbtor/test/BitVecConvertTest.py

Aimmig/FloatingBoolector

039ca8be5e9527613a26ce423c6e4817a0b3a2cd

[ "MIT" ]

null

fbtor/test/BitVecConvertTest.py

Aimmig/FloatingBoolector

039ca8be5e9527613a26ce423c6e4817a0b3a2cd

[ "MIT" ]

null

fbtor/test/BitVecConvertTest.py

Aimmig/FloatingBoolector

039ca8be5e9527613a26ce423c6e4817a0b3a2cd

[ "MIT" ]

null

from fbtor.BitVecConvert import BitVecConvStatic from fbtor.FBoolectorTypes import FPType, RMode, WIDTH, MAN, EXP from .test_converter import * import pytest """ Test cases for the string to bitstring implementation: """ def test_Zero(): for t in FPType: for r in RMode: for sign in ["+","-"]: res = BitVecConvStatic.convertToBinary(sign+"0",t,r) signbit = "0" if sign == "-": signbit ="1" assert res == (signbit + (t.value[WIDTH]-1)*"0") def test_Inf(): for t in FPType: for r in RMode: for sign in ["+","-"]: res = BitVecConvStatic.convertToBinary(sign+"inf",t,r) signbit = "0" if sign == "-": signbit ="1" assert res == (signbit + t.value[EXP]*"1"+ t.value[MAN]*"0") @pytest.mark.parametrize('inp,s,e,m,fptype,rmode', subnormal) def test_subnormal(inp,s,e,m, fptype,rmode): assert BitVecConvStatic.convertToBinary(inp,fptype,rmode) == s+e+m @pytest.mark.parametrize('inp,s,e,m,fptype,rmode', small) def test_small(inp,s,e,m, fptype,rmode): assert BitVecConvStatic.convertToBinary(inp,fptype,rmode) == s+e+m @pytest.mark.parametrize('inp,s,e,m,fptype,rmode', large) def test_large(inp,s,e,m, fptype,rmode): assert BitVecConvStatic.convertToBinary(inp,fptype,rmode) == s+e+m @pytest.mark.parametrize('inp,s,e,m,fptype,rmode', normal) def test_normal(inp,s,e,m, fptype,rmode): assert BitVecConvStatic.convertToBinary(inp,fptype,rmode) == s+e+m

35.222222

76

0.615773

b2e9dbbaa4223a1edded083c8c33627936e2e0aa

5,593

py

Python

pxr/usd/usdShade/testenv/testUsdShadeCoordSysAPI.py

DougRogers-DigitalFish/USD

d8a405a1344480f859f025c4f97085143efacb53

[ "BSD-2-Clause" ]

3,680

2016-07-26T18:28:11.000Z

2022-03-31T09:55:05.000Z

pxr/usd/usdShade/testenv/testUsdShadeCoordSysAPI.py

DougRogers-DigitalFish/USD

d8a405a1344480f859f025c4f97085143efacb53

[ "BSD-2-Clause" ]

1,759

2016-07-26T19:19:59.000Z

2022-03-31T21:24:00.000Z

pxr/usd/usdShade/testenv/testUsdShadeCoordSysAPI.py

DougRogers-DigitalFish/USD

d8a405a1344480f859f025c4f97085143efacb53

[ "BSD-2-Clause" ]

904

2016-07-26T18:33:40.000Z

2022-03-31T09:55:16.000Z

#!/pxrpythonsubst # # Copyright 2017 Pixar # # Licensed under the Apache License, Version 2.0 (the "Apache License") # with the following modification; you may not use this file except in # compliance with the Apache License and the following modification to it: # Section 6. Trademarks. is deleted and replaced with: # # 6. Trademarks. This License does not grant permission to use the trade # names, trademarks, service marks, or product names of the Licensor # and its affiliates, except as required to comply with Section 4(c) of # the License and to reproduce the content of the NOTICE file. # # You may obtain a copy of the Apache License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the Apache License with the above modification is # distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the Apache License for the specific # language governing permissions and limitations under the Apache License. import sys, unittest from pxr import Usd, UsdShade, UsdGeom, Sdf class TestUsdShadeCoordSysAPI(unittest.TestCase): def test_CoordSys(self): stage = Usd.Stage.Open('test.usda') # Test CanContainPropertyName self.assertTrue(UsdShade.CoordSysAPI.CanContainPropertyName( stage.GetPropertyAtPath('/World.coordSys:worldSpace').GetName())) self.assertFalse(UsdShade.CoordSysAPI.CanContainPropertyName( stage.GetPropertyAtPath('/World.xformOp:translate').GetName())) world = stage.GetPrimAtPath('/World') model = stage.GetPrimAtPath('/World/Model') geom = stage.GetPrimAtPath('/World/Model/Geom') box = stage.GetPrimAtPath('/World/Model/Geom/Box') worldCoords = UsdShade.CoordSysAPI(world) modelCoords = UsdShade.CoordSysAPI(model) geomCoords = UsdShade.CoordSysAPI(geom) boxCoords = UsdShade.CoordSysAPI(box) # Local Bindings self.assertEqual( worldCoords.GetLocalBindings(), [('worldSpace', '/World.coordSys:worldSpace', '/World/Space')]) self.assertEqual( modelCoords.GetLocalBindings(), [('instanceSpace', '/World/Model.coordSys:instanceSpace', '/World/Model'), ('modelSpace', '/World/Model.coordSys:modelSpace', '/World/Model/Geom'), ('paintSpace', '/World/Model.coordSys:paintSpace', '/World/Model/Place3dTexture')]) self.assertEqual( geomCoords.GetLocalBindings(), []) self.assertEqual( boxCoords.GetLocalBindings(), []) # Full (including inherited) Bindings self.assertEqual( worldCoords.FindBindingsWithInheritance(), [('worldSpace', '/World.coordSys:worldSpace', '/World/Space')]) self.assertEqual( modelCoords.FindBindingsWithInheritance(), [('instanceSpace', '/World/Model.coordSys:instanceSpace', '/World/Model'), ('modelSpace', '/World/Model.coordSys:modelSpace', '/World/Model/Geom'), ('paintSpace', '/World/Model.coordSys:paintSpace', '/World/Model/Place3dTexture'), ('worldSpace', '/World.coordSys:worldSpace', '/World/Space')]) self.assertEqual( geomCoords.FindBindingsWithInheritance(), [('instanceSpace', '/World/Model.coordSys:instanceSpace', '/World/Model'), ('modelSpace', '/World/Model.coordSys:modelSpace', '/World/Model/Geom'), ('paintSpace', '/World/Model.coordSys:paintSpace', '/World/Model/Place3dTexture'), ('worldSpace', '/World.coordSys:worldSpace', '/World/Space')]) self.assertEqual( boxCoords.FindBindingsWithInheritance(), [('instanceSpace', '/World/Model.coordSys:instanceSpace', '/World/Model'), ('modelSpace', '/World/Model.coordSys:modelSpace', '/World/Model/Geom'), ('paintSpace', '/World/Model.coordSys:paintSpace', '/World/Model/Place3dTexture'), ('worldSpace', '/World.coordSys:worldSpace', '/World/Space')]) # Bind relName = UsdShade.CoordSysAPI.GetCoordSysRelationshipName('boxSpace') self.assertFalse(geom.HasRelationship(relName)) geomCoords.Bind('boxSpace', box.GetPath()) self.assertTrue(geom.HasRelationship(relName)) self.assertEqual( geomCoords.GetLocalBindings(), [('boxSpace', '/World/Model/Geom.coordSys:boxSpace', box.GetPath())]) # BlockBinding self.assertTrue(geom.HasRelationship(relName)) self.assertTrue(geom.GetRelationship(relName).HasAuthoredTargets()) self.assertNotEqual(geom.GetRelationship(relName).GetTargets(), []) geomCoords.BlockBinding('boxSpace') self.assertEqual( geomCoords.GetLocalBindings(), []) self.assertEqual(geom.GetRelationship(relName).GetTargets(), []) self.assertTrue(geom.GetRelationship(relName).HasAuthoredTargets()) # ClearBinding geomCoords.ClearBinding('boxSpace', False) self.assertTrue(geom.HasRelationship(relName)) self.assertFalse(geom.GetRelationship(relName).HasAuthoredTargets()) geomCoords.ClearBinding('boxSpace', True) self.assertFalse(geom.HasRelationship(relName)) if __name__ == '__main__': unittest.main()

44.744

78

0.650456

47aea8df3617f50ad11ea9a1efac0b4af064b14f

6,856

py

Python

pluginsmanager/model/system/system_effect.py

SpotlightKid/PluginsManager

2dcc9f6a79b48e9c9be82efffd855352fa15c5c7

[ "Apache-2.0" ]

9

2017-05-24T09:55:34.000Z

2020-06-22T03:55:51.000Z

pluginsmanager/model/system/system_effect.py

SpotlightKid/PluginsManager

2dcc9f6a79b48e9c9be82efffd855352fa15c5c7

[ "Apache-2.0" ]

97

2016-11-17T16:30:35.000Z

2021-10-09T00:27:56.000Z

pluginsmanager/model/system/system_effect.py

SpotlightKid/PluginsManager

2dcc9f6a79b48e9c9be82efffd855352fa15c5c7

[ "Apache-2.0" ]

3

2017-05-21T19:20:38.000Z

2019-11-04T23:53:59.000Z

# Copyright 2017 SrMouraSilva # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from pluginsmanager.model.effect import Effect from pluginsmanager.model.system.system_input import SystemInput from pluginsmanager.model.system.system_output import SystemOutput from pluginsmanager.model.system.system_midi_input import SystemMidiInput from pluginsmanager.model.system.system_midi_output import SystemMidiOutput from pluginsmanager.util.dict_tuple import DictTuple class SystemEffect(Effect): """ Representation of the system instance: audio and/or midi interfaces. System output is equivalent with audio input: You connect the instrument in the audio card input and it captures and send the audio to :class:`.SystemOutput` for you connect in a input plugins. System input is equivalent with audio output: The audio card receives the audio processed in your :class:`.SystemInput` and send it to audio card output for you connects in amplifier, headset. Because no autodetection of existing ports in audio card has been implemented, you must explicitly inform in the creation of the SystemEffect object:: >>> sys_effect = SystemEffect('system', ('capture_1', 'capture_2'), ('playback_1', 'playback_2')) Unlike effects that should be added in the pedalboard, SystemEffects MUST NOT:: >>> builder = Lv2EffectBuilder() >>> pedalboard = Pedalboard('Rocksmith') >>> reverb = builder.build('http://calf.sourceforge.net/plugins/Reverb') >>> pedalboard.append(reverb) However the pedalboard must have the connections:: >>> pedalboard.connect(sys_effect.outputs[0], reverb.inputs[0]) An bypass example:: >>> pedalboard = Pedalboard('Bypass example') >>> sys_effect = SystemEffect('system', ('capture_1', 'capture_2'), ('playback_1', 'playback_2')) >>> pedalboard.connect(sys_effect.outputs[0], sys_effect.inputs[0]) >>> pedalboard.connect(sys_effect.outputs[1], sys_effect.inputs[1]) You can create multiple SystemEffect for multiple audio/midi interfaces. In the following example, exists Jack provides audio system ports and two midi ports are added by I/O ports:: >>> audio_system = SystemEffect('system', inputs=['playback_1', 'playback_2']) >>> midi_system = SystemEffect('ttymidi', midi_outputs=['MIDI_in'], midi_inputs=['MIDI_out']) >>> pedalboard = Pedalboard('MDA-EP') >>> ep = builder.build('http://moddevices.com/plugins/mda/EPiano') >>> pedalboard.connect(ep.outputs[0], audio_system.inputs[0]) >>> pedalboard.connect(ep.outputs[1], audio_system.inputs[1]) >>> pedalboard.connect(audio_system.midi_outputs[0], ep.midi_inputs[0]) You can check the audio/midi ports defined in your environment using `jack_lsp`_:: root@zynthian:~ # As example in Zynthian project: http://zynthian.org root@zynthian:~ jack_lsp -A system:playback_1 alsa_pcm:hw:0:in1 system:playback_2 alsa_pcm:hw:0:in2 ttymidi:MIDI_in ttymidi:MIDI_out Zyncoder:output Zyncoder:input .. _jack_lsp: http://manpages.ubuntu.com/manpages/xenial/man1/jack_lsp.1.html If you prefer, you can use a unique SystemEffect if `alias` the ports:: localhost@localdomain:~ jack_alias system:midi_capture1 ttymidi:MIDI_in localhost@localdomain:~ jack_alias system:midi_playback1 ttymidi:MIDI_out >>> sys_effect = SystemEffect( ... 'system', ... inputs=['playback_1', 'playback_2'], ... midi_outputs=['midi_capture1'], ... midi_inputs=['midi_playback1'] ... ) >>> pedalboard = Pedalboard('MDA-EP') >>> ep = builder.build('http://moddevices.com/plugins/mda/EPiano') >>> pedalboard.connect(ep.outputs[0], sys_effect.inputs[0]) >>> pedalboard.connect(ep.outputs[1], sys_effect.inputs[1]) >>> pedalboard.connect(sys_effect.midi_outputs[0], ep.midi_inputs[0]) :param string representation: Audio card representation. Usually 'system' :param tuple(string) outputs: Tuple of outputs representation. Usually a output representation starts with ``capture_`` :param tuple(string) inputs: Tuple of inputs representation. Usually a input representation starts with ``playback_`` :param tuple(string) midi_outputs: Tuple of midi outputs representation. :param tuple(string) midi_inputs: Tuple of midi inputs representation. """ def __init__(self, representation, outputs=None, inputs=None, midi_outputs=None, midi_inputs=None): super(SystemEffect, self).__init__() self.representation = representation self._params = tuple() inputs = inputs if inputs is not None else [] inputs = [SystemInput(self, effect_input) for effect_input in inputs] self._inputs = DictTuple(inputs, lambda _input: str(_input)) outputs = outputs if outputs is not None else [] outputs = [SystemOutput(self, effect_output) for effect_output in outputs] self._outputs = DictTuple(outputs, lambda _output: str(_output)) midi_inputs = midi_inputs if midi_inputs is not None else [] midi_inputs = [SystemMidiInput(self, effect_input) for effect_input in midi_inputs] self._midi_inputs = DictTuple(midi_inputs, lambda _input: str(_input)) midi_outputs = midi_outputs if midi_outputs is not None else [] midi_outputs = [SystemMidiOutput(self, effect_output) for effect_output in midi_outputs] self._midi_outputs = DictTuple(midi_outputs, lambda _output: str(_output)) def __str__(self): return self.representation @property def __dict__(self): return { 'technology': 'system', } @property def is_possible_connect_itself(self): """ return bool: Is possible connect the with it self? """ return True @property def is_unique_for_all_pedalboards(self): """ return bool: Is unique for all pedalboards? Example: :class:`.SystemEffect` is unique for all pedalboards """ return True @property def use_real_identifier(self): """ return bool: For this audio plugin, is necessary use the real effect identifier? """ return True

41.551515

103

0.695741

17f81bc5a26cc05a274106a86bf22043abde1f97

329

py

Python

rastervision/v2/learner/learner_pipeline.py

carderne/raster-vision

915fbcd3263d8f2193e65c2cd0eb53e050a47a01

[ "Apache-2.0" ]

1

2019-11-07T10:02:23.000Z

rastervision/v2/learner/learner_pipeline.py

carderne/raster-vision

915fbcd3263d8f2193e65c2cd0eb53e050a47a01

[ "Apache-2.0" ]

null

rastervision/v2/learner/learner_pipeline.py

carderne/raster-vision

915fbcd3263d8f2193e65c2cd0eb53e050a47a01

[ "Apache-2.0" ]

null

from rastervision.v2.core.pipeline import Pipeline LEARNER_PIPELINE = 'learner_pipeline' class LearnerPipeline(Pipeline): commands = ['train'] gpu_commands = ['train'] def train(self): learner_cfg = self.config.learner learner = learner_cfg.build(learner_cfg, self.tmp_dir) learner.main()

23.5

62

0.699088

b65b70d840a6989ac50381689635aa979903c55f

163

py

Python

artext/__init__.py

nlpcl-lab/artext

e216fae54932d4f0dc47b251bc67416d687dbcf3

[ "MIT" ]

null

artext/__init__.py

nlpcl-lab/artext

e216fae54932d4f0dc47b251bc67416d687dbcf3

[ "MIT" ]

1

2019-11-23T05:36:14.000Z

2019-12-06T11:16:06.000Z

artext/__init__.py

nlpcl-lab/artext

e216fae54932d4f0dc47b251bc67416d687dbcf3

[ "MIT" ]

null

from artext import config from artext import utils from artext.artext import Artext version_info = (0, 2, 5) __version__ = '.'.join(str(c) for c in version_info)

23.285714

52

0.754601

68c348959272043b3442a15128f4448b580f83ad

52,243

py

Python

src/skmultiflow/metrics/measure_collection.py

mertozer94/scikit-multiflow

a6e719cad900805a85d17143c05a3da9dd4987e8

[ "BSD-3-Clause" ]

null

src/skmultiflow/metrics/measure_collection.py

mertozer94/scikit-multiflow

a6e719cad900805a85d17143c05a3da9dd4987e8

[ "BSD-3-Clause" ]

null

src/skmultiflow/metrics/measure_collection.py

mertozer94/scikit-multiflow

a6e719cad900805a85d17143c05a3da9dd4987e8

[ "BSD-3-Clause" ]

null

import numpy as np from skmultiflow.utils.data_structures import FastBuffer, FastComplexBuffer, ConfusionMatrix, MOLConfusionMatrix from skmultiflow.utils import check_weights from timeit import default_timer as timer class ClassificationMeasurements(object): """ Class used to keep updated statistics about a classifier, in order to be able to provide, at any given moment, any relevant metric about that classifier. It combines a ConfusionMatrix object, with some additional statistics, to compute a range of performance metrics. In order to keep statistics updated, the class won't require lots of information, but two: the predictions and true labels. At any given moment, it can compute the following statistics: accuracy, kappa, kappa_t, kappa_m, majority_class and error rate. Parameters ---------- targets: list A list containing the possible labels. dtype: data type (Default: numpy.int64) The data type of the existing labels. Examples -------- """ def __init__(self, targets=None, dtype=np.int64): super().__init__() if targets is not None: self.n_targets = len(targets) else: self.n_targets = 2 self.confusion_matrix = ConfusionMatrix(self.n_targets, dtype) self.last_true_label = None self.last_prediction = None self.last_sample = None self.sample_count = 0 self.majority_classifier = 0 self.correct_no_change = 0 self.targets = targets def reset(self): if self.targets is not None: self.n_targets = len(self.targets) else: self.n_targets = 2 self.last_true_label = None self.last_prediction = None self.last_sample = None self.sample_count = 0 self.majority_classifier = 0 self.correct_no_change = 0 self.confusion_matrix.restart(self.n_targets) def add_result(self, y_true, y_pred, weight=1.0): """ Updates its statistics with the results of a prediction. Parameters ---------- y_true: int The true label. y_pred: int The classifier's prediction weight: float Sample's weight """ check_weights(weight) true_y = self._get_target_index(y_true, True) pred = self._get_target_index(y_pred, True) self.confusion_matrix.update(true_y, pred) self.sample_count += 1 if self.get_majority_class() == y_true: self.majority_classifier += weight if self.last_true_label == y_true: self.correct_no_change += weight self.last_true_label = y_true self.last_prediction = y_pred def get_last(self): return self.last_true_label, self.last_prediction def get_majority_class(self): """ Computes the true majority class. Returns ------- int The true majority class. """ if (self.n_targets is None) or (self.n_targets == 0): return False majority_class = 0 max_prob = 0.0 for i in range(self.n_targets): sum_value = 0.0 for j in range(self.n_targets): sum_value += self.confusion_matrix.value_at(i, j) sum_value = sum_value / self.sample_count if sum_value > max_prob: max_prob = sum_value majority_class = i return majority_class def get_accuracy(self): """ Computes the accuracy. Returns ------- float The accuracy. """ sum_value = 0.0 n, _ = self.confusion_matrix.shape() for i in range(n): sum_value += self.confusion_matrix.value_at(i, i) try: return sum_value / self.sample_count except ZeroDivisionError: return 0.0 def get_incorrectly_classified_ratio(self): return 1.0 - self.get_accuracy() def _get_target_index(self, target, add_label=False): """ Computes the index of an element in the self.targets list. Also reshapes the ConfusionMatrix and adds new found targets if add is True. Parameters ---------- target: int A class label. add_label: bool Either to add new found labels to the targets list or not. Returns ------- int The target index in the self.targets list. """ if (self.targets is None) and add_label: self.targets = [] self.targets.append(target) self.n_targets = len(self.targets) self.confusion_matrix.reshape(len(self.targets), len(self.targets)) elif (self.targets is None) and (not add_label): return None if (target not in self.targets) and add_label: self.targets.append(target) self.n_targets = len(self.targets) self.confusion_matrix.reshape(len(self.targets), len(self.targets)) for i in range(len(self.targets)): if self.targets[i] == target: return i return None def get_kappa(self): """ Computes the Cohen's kappa coefficient. Returns ------- float The Cohen's kappa coefficient. """ p0 = self.get_accuracy() pc = 0.0 n_rows, n_cols = self.confusion_matrix.shape() for i in range(n_rows): row = self.confusion_matrix.row(i) column = self.confusion_matrix.column(i) sum_row = np.sum(row) / self.sample_count sum_column = np.sum(column) / self.sample_count pc += sum_row * sum_column if pc == 1: return 1 return (p0 - pc) / (1.0 - pc) def get_kappa_t(self): """ Computes the Cohen's kappa T coefficient. This measures the temporal correlation between samples. Returns ------- float The Cohen's kappa T coefficient. """ p0 = self.get_accuracy() if self.sample_count != 0: pc = self.correct_no_change / self.sample_count else: pc = 0 if pc == 1: return 1 return (p0 - pc) / (1.0 - pc) def get_g_mean(self): """ Compute the G-mean of the classifier. Returns ------- float The G-mean """ tn = self.confusion_matrix.value_at(0, 0) fp = self.confusion_matrix.value_at(0, 1) if tn + fp == 0: specificity = 0 else: specificity = tn / (tn + fp) sensitivity = self.get_recall() return np.sqrt((sensitivity * specificity)) def get_f1_score(self): """ Compute the F1-score of the classifier. Returns ------- float The F1-score """ precision = self.get_precision() recall = self.get_recall() if recall + precision == 0: return 0.0 else: return 2 * (precision * recall) / (precision + recall) def get_precision(self): """ compute the precision of the classifier. Returns ------- float The precision """ tp = self.confusion_matrix.value_at(1, 1) fp = self.confusion_matrix.value_at(0, 1) if tp + fp == 0: return 0.0 else: return tp / (tp + fp) def get_recall(self): """ Compute the recall. Returns ------- float The recall. """ tp = self.confusion_matrix.value_at(1, 1) fn = self.confusion_matrix.value_at(1, 0) if tp + fn == 0: return 0.0 else: return tp / (tp + fn) def get_kappa_m(self): """ Computes the Cohen's kappa M coefficient. Returns ------- float The Cohen's kappa M coefficient. """ p0 = self.get_accuracy() if self.sample_count != 0: pc = self.majority_classifier / self.sample_count else: pc = 0 if pc == 1: return 1 return (p0 - pc) / (1.0 - pc) @property def _matrix(self): return self.confusion_matrix.matrix def get_info(self): return '{}:'.format(type(self).__name__) + \ ' - sample_count: {}'.format(self.sample_count) + \ ' - accuracy: {:.6f}'.format(self.get_accuracy()) + \ ' - kappa: {:.6f}'.format(self.get_kappa()) + \ ' - kappa_t: {:.6f}'.format(self.get_kappa_t()) + \ ' - kappa_m: {:.6f}'.format(self.get_kappa_m()) + \ ' - f1-score: {:.6f}'.format(self.get_f1_score()) + \ ' - precision: {:.6f}'.format(self.get_precision()) + \ ' - recall: {:.6f}'.format(self.get_recall()) + \ ' - G-mean: {:.6f}'.format(self.get_g_mean()) + \ ' - majority_class: {}'.format(self.get_majority_class()) class WindowClassificationMeasurements(object): """ This class will maintain a fixed sized window of the newest information about one classifier. It can provide, as requested, any of the relevant current metrics about the classifier, measured inside the window. To keep track of statistics inside a window, the class will use a ConfusionMatrix object, alongside FastBuffers, to simulate fixed sized windows of the important classifier's attributes. Its functionality is somewhat similar to those of the ClassificationMeasurements class. The difference is that the statistics kept by this class are local, or partial, while the statistics kept by the ClassificationMeasurements class are global. At any given moment, it can compute the following statistics: accuracy, kappa, kappa_t, kappa_m, majority_class and error rate. Parameters ---------- targets: list A list containing the possible labels. dtype: data type (Default: numpy.int64) The data type of the existing labels. window_size: int (Default: 200) The width of the window. Determines how many samples the object can see. Examples -------- """ def __init__(self, targets=None, dtype=np.int64, window_size=200): super().__init__() if targets is not None: self.n_targets = len(targets) else: self.n_targets = 2 self.confusion_matrix = ConfusionMatrix(self.n_targets, dtype) self.last_class = None self.targets = targets self.window_size = window_size self.true_labels = FastBuffer(window_size) self.predictions = FastBuffer(window_size) self.temp = 0 self.last_prediction = None self.last_true_label = None self.last_sample = None self.majority_classifier = 0 self.correct_no_change = 0 self.majority_classifier_correction = FastBuffer(window_size) self.correct_no_change_correction = FastBuffer(window_size) def reset(self): if self.targets is not None: self.n_targets = len(self.targets) else: self.n_targets = 2 self.true_labels = FastBuffer(self.window_size) self.predictions = FastBuffer(self.window_size) self.temp = 0 self.last_prediction = None self.last_true_label = None self.last_sample = None self.majority_classifier = 0 self.correct_no_change = 0 self.confusion_matrix.restart(self.n_targets) self.majority_classifier_correction = FastBuffer(self.window_size) self.correct_no_change_correction = FastBuffer(self.window_size) def add_result(self, y_true, y_pred, weight=1.0): """ Updates its statistics with the results of a prediction. If needed it will remove samples from the observation window. Parameters ---------- y_true: int The true label. y_pred: int The classifier's prediction weight: float Sample's weight """ check_weights(weight) true_y = self._get_target_index(y_true, True) pred = self._get_target_index(y_pred, True) old_true = self.true_labels.add_element(np.array([y_true])) old_predict = self.predictions.add_element(np.array([y_pred])) # Verify if it's needed to decrease the count of any label # pair in the confusion matrix if (old_true is not None) and (old_predict is not None): self.temp += 1 self.confusion_matrix.remove(self._get_target_index(old_true[0]), self._get_target_index(old_predict[0])) self.correct_no_change += self.correct_no_change_correction.peek() self.majority_classifier += self.majority_classifier_correction.peek() # Verify if it's needed to decrease the majority_classifier count if (self.get_majority_class() == y_true) and (self.get_majority_class() is not None): self.majority_classifier += weight self.majority_classifier_correction.add_element([-1]) else: self.majority_classifier_correction.add_element([0]) # Verify if it's needed to decrease the correct_no_change if (self.last_true_label == y_true) and (self.last_true_label is not None): self.correct_no_change += weight self.correct_no_change_correction.add_element([-1]) else: self.correct_no_change_correction.add_element([0]) self.confusion_matrix.update(true_y, pred, weight=weight) self.last_true_label = y_true self.last_prediction = y_pred def get_last(self): return self.last_true_label, self.last_prediction def get_majority_class(self): """ Computes the window/current true majority class. Returns ------- int The true window/current majority class. """ if (self.n_targets is None) or (self.n_targets == 0): return None majority_class = 0 max_prob = 0.0 for i in range(self.n_targets): sum_value = 0.0 for j in range(self.n_targets): sum_value += self.confusion_matrix.value_at(i, j) sum_value = sum_value / self.true_labels.get_current_size() if sum_value > max_prob: max_prob = sum_value majority_class = i return majority_class def get_accuracy(self): """ Computes the window/current accuracy. Returns ------- float The window/current accuracy. """ sum_value = 0.0 n, _ = self.confusion_matrix.shape() for i in range(n): sum_value += self.confusion_matrix.value_at(i, i) try: return sum_value / self.true_labels.get_current_size() except ZeroDivisionError: return 0.0 def get_incorrectly_classified_ratio(self): return 1.0 - self.get_accuracy() def _get_target_index(self, target, add=False): """ Computes the index of an element in the self.targets list. Also reshapes the ConfusionMatrix and adds new found targets if add is True. Parameters ---------- target: int A class label. add: bool Either to add new found labels to the targets list or not. Returns ------- int The target index in the self.targets list. """ if (self.targets is None) and add: self.targets = [] self.targets.append(target) self.n_targets = len(self.targets) self.confusion_matrix.reshape(len(self.targets), len(self.targets)) elif (self.targets is None) and (not add): return None if target not in self.targets and add: self.targets.append(target) self.n_targets = len(self.targets) self.confusion_matrix.reshape(len(self.targets), len(self.targets)) for i in range(len(self.targets)): if self.targets[i] == target: return i return None def get_kappa(self): """ Computes the window/current Cohen's kappa coefficient. Returns ------- float The window/current Cohen's kappa coefficient. """ p0 = self.get_accuracy() pc = 0.0 n_rows, n_cols = self.confusion_matrix.shape() for i in range(n_rows): row = self.confusion_matrix.row(i) column = self.confusion_matrix.column(i) sum_row = np.sum(row) / self.true_labels.get_current_size() sum_column = np.sum(column) / self.true_labels.get_current_size() pc += sum_row * sum_column if pc == 1: return 1 return (p0 - pc) / (1.0 - pc) def get_kappa_t(self): """ Computes the window/current Cohen's kappa T coefficient. This measures the temporal correlation between samples. Returns ------- float The window/current Cohen's kappa T coefficient. """ p0 = self.get_accuracy() if self.sample_count != 0: pc = self.correct_no_change / self.sample_count else: pc = 0 if pc == 1: return 1 return (p0 - pc) / (1.0 - pc) def get_kappa_m(self): """ Computes the window/current Cohen's kappa M coefficient. Returns ------- float The window/current Cohen's kappa M coefficient. """ p0 = self.get_accuracy() if self.sample_count != 0: pc = self.majority_classifier / self.sample_count else: pc = 0 if pc == 1: return 1 return (p0 - pc) / (1.0 - pc) def get_g_mean(self): """ Compute the G-mean of the classifier. Returns ------- float The G-mean """ tn = self.confusion_matrix.value_at(0, 0) fp = self.confusion_matrix.value_at(0, 1) if tn + fp == 0: specificity = 0 else: specificity = tn / (tn + fp) sensitivity = self.get_recall() return np.sqrt((sensitivity * specificity)) def get_f1_score(self): """ Compute the F1-score of the classifier. Returns ------- float The F1-score """ precision = self.get_precision() recall = self.get_recall() if recall + precision == 0: return 0.0 else: return 2 * (precision * recall) / (precision + recall) def get_precision(self): """ compute the precision of the classifier. Returns ------- float The precision """ tp = self.confusion_matrix.value_at(1, 1) fp = self.confusion_matrix.value_at(0, 1) if tp + fp == 0: return 0.0 else: return tp / (tp + fp) def get_recall(self): """ Compute the recall. Returns ------- float The recall. """ tp = self.confusion_matrix.value_at(1, 1) fn = self.confusion_matrix.value_at(1, 0) if tp + fn == 0: return 0.0 else: return tp / (tp + fn) @property def _matrix(self): return self.confusion_matrix.matrix @property def sample_count(self): return self.true_labels.get_current_size() def get_info(self): return '{}:'.format(type(self).__name__) + \ ' - sample_count: {}'.format(self.sample_count) + \ ' - window_size: {}'.format(self.window_size) + \ ' - accuracy: {:.6f}'.format(self.get_accuracy()) + \ ' - kappa: {:.6f}'.format(self.get_kappa()) + \ ' - kappa_t: {:.6f}'.format(self.get_kappa_t()) + \ ' - kappa_m: {:.6f}'.format(self.get_kappa_m()) + \ ' - f1-score: {:.6f}'.format(self.get_f1_score()) + \ ' - precision: {:.6f}'.format(self.get_precision()) + \ ' - recall: {:.6f}'.format(self.get_recall()) + \ ' - G-mean: {:.6f}'.format(self.get_g_mean()) + \ ' - majority_class: {}'.format(self.get_majority_class()) class MultiTargetClassificationMeasurements(object): """ This class will keep updated statistics about a multi output classifier, using a confusion matrix adapted to multi output problems, the MOLConfusionMatrix, alongside other relevant attributes. The performance metrics for multi output tasks are different from those used for normal classification tasks. Thus, the statistics provided by this class are different from those provided by the ClassificationMeasurements and from the WindowClassificationMeasurements. At any given moment, it can compute the following statistics: hamming_loss, hamming_score, exact_match and j_index. Parameters ---------- targets: list A list containing the possible labels. dtype: data type (Default: numpy.int64) The data type of the existing labels. Examples -------- """ def __init__(self, targets=None, dtype=np.int64): super().__init__() if targets is not None: self.n_targets = len(targets) else: self.n_targets = 0 self.confusion_matrix = MOLConfusionMatrix(self.n_targets, dtype) self.last_true_label = None self.last_prediction = None self.sample_count = 0 self.targets = targets self.exact_match_count = 0 self.j_sum = 0 def reset(self): if self.targets is not None: self.n_targets = len(self.targets) else: self.n_targets = 0 self.confusion_matrix.restart(self.n_targets) self.last_true_label = None self.last_prediction = None self.sample_count = 0 self.exact_match_count = 0 self.j_sum = 0 def add_result(self, y_true, y_pred): """ Updates its statistics with the results of a prediction. Adds the result to the MOLConfusionMatrix and update exact_matches and j-index sum counts. Parameters ---------- y_true: list or numpy.ndarray The true label. y_pred: list or numpy.ndarray The classifier's prediction """ self.last_true_label = y_true self.last_prediction = y_pred m = 0 if isinstance(y_true, np.ndarray): m = y_true.size elif isinstance(y_true, list): m = len(y_true) self.n_targets = m equal = True for i in range(m): self.confusion_matrix.update(i, y_true[i], y_pred[i]) # update exact_match count if y_true[i] != y_pred[i]: equal = False # update exact_match if equal: self.exact_match_count += 1 # update j_index count inter = sum((y_true * y_pred) > 0) * 1. union = sum((y_true + y_pred) > 0) * 1. if union > 0: self.j_sum += inter / union elif np.sum(y_true) == 0: self.j_sum += 1 self.sample_count += 1 def get_last(self): return self.last_true_label, self.last_prediction def get_hamming_loss(self): """ Computes the Hamming loss, which is the complement of the Hamming score metric. Returns ------- float The hamming loss. """ return 1.0 - self.get_hamming_score() def get_hamming_score(self): """ Computes the Hamming score, defined as the number of correctly classified labels divided by the total number of labels classified. Returns ------- float The Hamming score. """ try: return self.confusion_matrix.get_sum_main_diagonal() / (self.sample_count * self.n_targets) except ZeroDivisionError: return 0.0 def get_exact_match(self): """ Computes the exact match metric. This is the most strict multi output metric, defined as the number of samples that have all their labels correctly classified, divided by the total number of samples. Returns ------- float The exact match metric. """ return self.exact_match_count / self.sample_count def get_j_index(self): """ Computes the Jaccard index, also known as the intersection over union metric. It is calculated by dividing the number of correctly classified labels by the union of predicted and true labels. Returns ------- float The Jaccard index. """ return self.j_sum / self.sample_count def get_total_sum(self): return self.confusion_matrix.get_total_sum() @property def _matrix(self): return self.confusion_matrix.matrix def get_info(self): return '{}:'.format(type(self).__name__) + \ ' - sample_count: {}'.format(self.sample_count) + \ ' - hamming_loss: {:.6f}'.format(self.get_hamming_loss()) + \ ' - hamming_score: {:.6f}'.format(self.get_hamming_score()) + \ ' - exact_match: {:.6f}'.format(self.get_exact_match()) + \ ' - j_index: {:.6f}'.format(self.get_j_index()) class WindowMultiTargetClassificationMeasurements(object): """ This class will maintain a fixed sized window of the newest information about one classifier. It can provide, as requested, any of the relevant current metrics about the classifier, measured inside the window. This class will keep updated statistics about a multi output classifier, using a confusion matrix adapted to multi output problems, the MOLConfusionMatrix, alongside other of the classifier's relevant attributes stored in ComplexFastBuffer objects, which will simulate fixed sized windows. Its functionality is somewhat similar to those of the MultiTargetClassificationMeasurements class. The difference is that the statistics kept by this class are local, or partial, while the statistics kept by the MultiTargetClassificationMeasurements class are global. At any given moment, it can compute the following statistics: hamming_loss, hamming_score, exact_match and j_index. Parameters ---------- targets: list A list containing the possible labels. dtype: data type (Default: numpy.int64) The data type of the existing labels. window_size: int (Default: 200) The width of the window. Determines how many samples the object can see. Examples -------- """ def __init__(self, targets=None, dtype=np.int64, window_size=200): super().__init__() if targets is not None: self.n_targets = len(targets) else: self.n_targets = 0 self.confusion_matrix = MOLConfusionMatrix(self.n_targets, dtype) self.last_true_label = None self.last_prediction = None self.targets = targets self.window_size = window_size self.exact_match_count = 0 self.j_sum = 0 self.true_labels = FastComplexBuffer(window_size, self.n_targets) self.predictions = FastComplexBuffer(window_size, self.n_targets) def reset(self): if self.targets is not None: self.n_targets = len(self.targets) else: self.n_targets = 0 self.confusion_matrix.restart(self.n_targets) self.last_true_label = None self.last_prediction = None self.exact_match_count = 0 self.j_sum = 0 self.true_labels = FastComplexBuffer(self.window_size, self.n_targets) self.predictions = FastComplexBuffer(self.window_size, self.n_targets) def add_result(self, y_true, y_pred): """ Updates its statistics with the results of a prediction. Adds the result to the MOLConfusionMatrix, and updates the ComplexFastBuffer objects. Parameters ---------- y_true: list or numpy.ndarray The true label. y_pred: list or numpy.ndarray The classifier's prediction """ self.last_true_label = y_true self.last_prediction = y_pred m = 0 if hasattr(y_true, 'size'): m = y_true.size elif hasattr(y_true, 'append'): m = len(y_true) self.n_targets = m for i in range(m): self.confusion_matrix.update(i, y_true[i], y_pred[i]) old_true = self.true_labels.add_element(y_true) old_predict = self.predictions.add_element(y_pred) if (old_true is not None) and (old_predict is not None): for i in range(m): self.confusion_matrix.remove(old_true[0][i], old_predict[0][i]) def get_last(self): return self.last_true_label, self.last_prediction def get_hamming_loss(self): """ Computes the window/current Hamming loss, which is the complement of the Hamming score metric. Returns ------- float The window/current hamming loss. """ return 1.0 - self.get_hamming_score() def get_hamming_score(self): """ Computes the window/current Hamming score, defined as the number of correctly classified labels divided by the total number of labels classified. Returns ------- float The window/current hamming score. """ return hamming_score(self.true_labels.get_queue(), self.predictions.get_queue()) def get_exact_match(self): """ Computes the window/current exact match metric. This is the most strict multi output metric, defined as the number of samples that have all their labels correctly classified, divided by the total number of samples. Returns ------- float The window/current exact match metric. """ return exact_match(self.true_labels.get_queue(), self.predictions.get_queue()) def get_j_index(self): """ Computes the window/current Jaccard index, also known as the intersection over union metric. It is calculated by dividing the number of correctly classified labels by the union of predicted and true labels. Returns ------- float The window/current Jaccard index. """ return j_index(self.true_labels.get_queue(), self.predictions.get_queue()) def get_total_sum(self): return self.confusion_matrix.get_total_sum() @property def matrix(self): return self.confusion_matrix.matrix @property def sample_count(self): return self.true_labels.get_current_size() def get_info(self): return '{}:'.format(type(self).__name__) + \ ' - sample_count: {}'.format(self.sample_count) + \ ' - hamming_loss: {:.6f}'.format(self.get_hamming_loss()) + \ ' - hamming_score: {:.6f}'.format(self.get_hamming_score()) + \ ' - exact_match: {:.6f}'.format(self.get_exact_match()) + \ ' - j_index: {:.6f}'.format(self.get_j_index()) class RegressionMeasurements(object): """ This class is used to keep updated statistics over a regression learner in a regression problem context. It will keep track of global metrics, that can be provided at any moment. The relevant metrics kept by an instance of this class are: MSE (mean square error) and MAE (mean absolute error). """ def __init__(self): super().__init__() self.total_square_error = 0.0 self.average_error = 0.0 self.sample_count = 0 self.last_true_label = None self.last_prediction = None def reset(self): self.total_square_error = 0.0 self.average_error = 0.0 self.sample_count = 0 self.last_true_label = None self.last_prediction = None def add_result(self, y_true, y_pred): """ Use the true value and the prediction to update the statistics. Parameters ---------- y_true: float The true value. y_pred: float The predicted value. """ self.last_true_label = y_true self.last_prediction = y_pred self.total_square_error += (y_true - y_pred) * (y_true - y_pred) self.average_error += np.absolute(y_true - y_pred) self.sample_count += 1 def get_mean_square_error(self): """ Computes the mean square error. Returns ------- float The mean square error. """ if self.sample_count == 0: return 0.0 else: return self.total_square_error / self.sample_count def get_average_error(self): """ Computes the average error. Returns ------- float The average error. """ if self.sample_count == 0: return 0.0 else: return self.average_error / self.sample_count def get_last(self): return self.last_true_label, self.last_prediction def get_info(self): return '{}:'.format(type(self).__name__) + \ ' - sample_count: {}'.format(self.sample_count) + \ ' - mean_square_error: {:.6f}'.format(self.get_mean_square_error()) + \ ' - mean_absolute_error: {:.6f}'.format(self.get_average_error()) class WindowRegressionMeasurements(object): """ This class is used to keep updated statistics over a regression learner in a regression problem context inside a fixed sized window. It uses FastBuffer objects to simulate the fixed sized windows. It will keep track of partial metrics, that can be provided at any moment. The relevant metrics kept by an instance of this class are: MSE (mean square error) and MAE (mean absolute error). """ def __init__(self, window_size=200): super().__init__() self.total_square_error = 0.0 self.average_error = 0.0 self.last_true_label = None self.last_prediction = None self.total_square_error_correction = FastBuffer(window_size) self.average_error_correction = FastBuffer(window_size) self.window_size = window_size def reset(self): self.total_square_error = 0.0 self.average_error = 0.0 self.last_true_label = None self.last_prediction = None self.total_square_error_correction = FastBuffer(self.window_size) self.average_error_correction = FastBuffer(self.window_size) def add_result(self, y_true, y_pred): """ Use the true value and the prediction to update the statistics. Parameters ---------- y_true: float The true value. y_pred: float The predicted value. """ self.last_true_label = y_true self.last_prediction = y_pred self.total_square_error += (y_true - y_pred) * (y_true - y_pred) self.average_error += np.absolute(y_true - y_pred) old_square = self.total_square_error_correction.add_element( np.array([-1 * ((y_true - y_pred) * (y_true - y_pred))])) old_average = self.average_error_correction.add_element(np.array([-1 * (np.absolute(y_true - y_pred))])) if (old_square is not None) and (old_average is not None): self.total_square_error += old_square[0] self.average_error += old_average[0] def get_mean_square_error(self): """ Computes the window/current mean square error. Returns ------- float The window/current mean square error. """ if self.sample_count == 0: return 0.0 else: return self.total_square_error / self.sample_count def get_average_error(self): """ Computes the window/current average error. Returns ------- float The window/current average error. """ if self.sample_count == 0: return 0.0 else: return self.average_error / self.sample_count def get_last(self): return self.last_true_label, self.last_prediction @property def sample_count(self): return self.total_square_error_correction.get_current_size() def get_info(self): return '{}:'.format(type(self).__name__) + \ ' - sample_count: {}'.format(self.sample_count) + \ ' - mean_square_error: {:.6f}'.format(self.get_mean_square_error()) + \ ' - mean_absolute_error: {:.6f}'.format(self.get_average_error()) class MultiTargetRegressionMeasurements(object): """ This class is used to keep updated statistics over a multi-target regression learner in a multi-target regression problem context. It will keep track of global metrics, that can be provided at any moment. The relevant metrics kept by an instance of this class are: AMSE (average mean square error), AMAE (average mean absolute error), and ARMSE (average root mean square error). """ def __init__(self): super().__init__() self.n_targets = 0 self.total_square_error = 0.0 self.average_error = 0.0 self.sample_count = 0 self.last_true_label = None self.last_prediction = None def reset(self): self.n_targets = 0 self.total_square_error = 0.0 self.average_error = 0.0 self.sample_count = 0 self.last_true_label = None self.last_prediction = None def add_result(self, y, prediction): """ Use the true value and the prediction to update the statistics. Parameters ---------- y: float or list or np.ndarray The true value(s). prediction: float or list or np.ndarray The predicted value(s). prediction: float or list or np.ndarray The predicted value(s). """ self.last_true_label = y self.last_prediction = prediction m = 0 if hasattr(y, 'size'): m = y.size elif hasattr(y, 'append'): m = len(y) self.n_targets = m self.total_square_error += (y - prediction) ** 2 self.average_error += np.absolute(y - prediction) self.sample_count += 1 def get_average_mean_square_error(self): """ Computes the average mean square error. Returns ------- float The average mean square error. """ if self.sample_count == 0: return 0.0 else: return np.sum(self.total_square_error / self.sample_count) / self.n_targets def get_average_absolute_error(self): """ Computes the average mean absolute error. Returns ------- float The average absolute error. """ if self.sample_count == 0: return 0.0 else: return np.sum(self.average_error / self.sample_count) \ / self.n_targets def get_average_root_mean_square_error(self): """ Computes the mean square error. Returns ------- float The average mean square error. """ if self.sample_count == 0: return 0.0 else: return np.sum(np.sqrt(self.total_square_error / self.sample_count)) \ / self.n_targets def get_last(self): return self.last_true_label, self.last_prediction @property def _sample_count(self): return self.sample_count def get_info(self): return 'MultiTargetRegressionMeasurements: sample_count: ' + \ str(self._sample_count) + ' - average_mean_square_error: ' + \ str(self.get_average_mean_square_error()) + ' - average_mean_absolute_error: ' + \ str(self.get_average_absolute_error()) + ' - average_root_mean_square_error: ' + \ str(self.get_average_root_mean_square_error()) class WindowMultiTargetRegressionMeasurements(object): """ This class is used to keep updated statistics over a multi-target regression learner in a multi-target regression problem context inside a fixed sized window. It uses FastBuffer objects to simulate the fixed sized windows. It will keep track of partial metrics, that can be provided at any moment. The relevant metrics kept by an instance of this class are: AMSE (average mean square error), AMAE (average mean absolute error), and ARMSE (average root mean square error). """ def __init__(self, window_size=200): super().__init__() self.n_targets = 0 self.total_square_error = 0.0 self.average_error = 0.0 self.last_true_label = None self.last_prediction = None self.total_square_error_correction = FastBuffer(window_size) self.average_error_correction = FastBuffer(window_size) self.window_size = window_size def reset(self): self.total_square_error = 0.0 self.average_error = 0.0 self.last_true_label = None self.last_prediction = None self.total_square_error_correction = FastBuffer(self.window_size) self.average_error_correction = FastBuffer(self.window_size) def add_result(self, y, prediction): """ Use the true value and the prediction to update the statistics. Parameters ---------- y: float or list or np.ndarray The true value(s). prediction: float or list or np.ndarray The predicted value(s). prediction: float or list or np.ndarray The predicted value(s). """ self.last_true_label = y self.last_prediction = prediction m = 0 if hasattr(y, 'size'): m = y.size elif hasattr(y, 'append'): m = len(y) self.n_targets = m self.total_square_error += (y - prediction) ** 2 self.average_error += np.absolute(y - prediction) old_square = self.total_square_error_correction.add_element( np.array([-1 * ((y - prediction) ** 2)]) ) old_average = self.average_error_correction.add_element( np.array([-1 * (np.absolute(y - prediction))]) ) if (old_square is not None) and (old_average is not None): self.total_square_error += old_square[0] self.average_error += old_average[0] def get_average_mean_square_error(self): """ Computes the window/current average mean square error. Returns ------- float The window/current average mean square error. """ if self._sample_count == 0: return 0.0 else: return np.sum(self.total_square_error / self._sample_count) \ / self.n_targets def get_average_absolute_error(self): """ Computes the window/current average mean absolute error. Returns ------- float The window/current average mean absolute error. """ if self._sample_count == 0: return 0.0 else: return np.sum(self.average_error / self._sample_count) \ / self.n_targets def get_average_root_mean_square_error(self): """ Computes the mean square error. Returns ------- float The average mean square error. """ if self._sample_count == 0: return 0.0 else: return np.sum(np.sqrt(self.total_square_error / self._sample_count)) \ / self.n_targets def get_last(self): return self.last_true_label, self.last_prediction @property def _sample_count(self): return self.total_square_error_correction.get_current_size() def get_info(self): return 'MultiTargetRegressionMeasurements: sample_count: ' + \ str(self._sample_count) + ' - average_mean_square_error: ' + \ str(self.get_average_mean_square_error()) + ' - average_mean_absolute_error: ' + \ str(self.get_average_absolute_error()) + ' - average_root_mean_square_error: ' + \ str(self.get_average_root_mean_square_error()) class RunningTimeMeasurements(object): """ Class used to compute the running time for each evaluated prediction model. The training, prediction, and total time are considered separately. The class accounts for the amount of time each model effectively spent on training and testing. To do so, timers for each of the actions are considered. Besides the properties getters, the available compute time methods must be used as follows: - `compute_{training, testing}_time_begin` - Perform training/action - `compute_{training, testing}_time_end` Additionally, the `update_time_measurements` method updates the total running time accounting, as well as, the total seen samples count. """ def __init__(self): super().__init__() self._training_start = None self._testing_start = None self._training_time = 0 self._testing_time = 0 self._sample_count = 0 self._total_time = 0 def reset(self): self._training_time = 0 self._testing_time = 0 self._sample_count = 0 self._total_time = 0 def compute_training_time_begin(self): """ Initiates the training time accounting. """ self._training_start = timer() def compute_training_time_end(self): """ Finishes the training time accounting. Updates current total training time. """ self._training_time += timer() - self._training_start def compute_testing_time_begin(self): """ Initiates the testing time accounting. """ self._testing_start = timer() def compute_testing_time_end(self): """ Finishes the testing time accounting. Updates current total testing time. """ self._testing_time += timer() - self._testing_start def update_time_measurements(self, increment=1): """ Updates the current total running time. Updates the number of seen samples by `increment`. """ if increment > 0: self._sample_count += increment else: self._sample_count += 1 self._total_time = self._training_time + self._testing_time def get_current_training_time(self): return self._training_time def get_current_testing_time(self): return self._testing_time def get_current_total_running_time(self): return self._total_time def get_info(self): return 'RunningTimeMeasurements: sample_count: ' + \ str(self._sample_count) + ' - Total running time: ' + \ str(self.get_current_total_running_time()) + \ ' - training_time: ' + \ str(self.get_current_training_time()) + \ ' - testing_time: ' + \ str(self.get_current_testing_time()) def hamming_score(true_labels, predicts): """ Computes de hamming score, which is known as the label-based accuracy, designed for multi-label problems. It's defined as the number of correctly predicted labels divided by all classified labels. Parameters ---------- true_labels: numpy.ndarray of shape (n_samples, n_target_tasks) A matrix with the true labels for all the classification tasks and for n_samples. predicts: numpy.ndarray of shape (n_samples, n_target_tasks) A matrix with the predictions for all the classification tasks and for n_samples. Returns ------- float The hamming score, or label-based accuracy, for the given sets. Examples -------- >>> from skmultiflow.metrics import hamming_score >>> true_labels = [[0,1,0,1],[0,0,0,1],[1,1,0,1],[1,1,1,1]] >>> predictions = [[0,1,0,1],[0,1,1,0],[0,1,0,1],[1,1,1,1]] >>> hamming_score(true_labels, predictions) 0.75 """ if not hasattr(true_labels, 'shape'): true_labels = np.asarray(true_labels) if not hasattr(predicts, 'shape'): predicts = np.asarray(predicts) N, L = true_labels.shape return np.sum((true_labels == predicts) * 1.) / N / L def j_index(true_labels, predicts): """ Computes the Jaccard Index of the given set, which is also called the 'intersection over union' in multi-label settings. It's defined as the intersection between the true label's set and the prediction's set, divided by the sum, or union, of those two sets. Parameters ---------- true_labels: numpy.ndarray of shape (n_samples, n_target_tasks) A matrix with the true labels for all the classification tasks and for n_samples. predicts: numpy.ndarray of shape (n_samples, n_target_tasks) A matrix with the predictions for all the classification tasks and for n_samples. Returns ------- float The J-index, or 'intersection over union', for the given sets. Examples -------- >>> from skmultiflow.metrics import j_index >>> true_labels = [[0,1,0,1],[0,0,0,1],[1,1,0,1],[1,1,1,1]] >>> predictions = [[0,1,0,1],[0,1,1,0],[0,1,0,1],[1,1,1,1]] >>> j_index(true_labels, predictions) 0.66666666666666663 """ if not hasattr(true_labels, 'shape'): true_labels = np.asarray(true_labels) if not hasattr(predicts, 'shape'): predicts = np.asarray(predicts) N, L = true_labels.shape s = 0.0 for i in range(N): inter = sum((true_labels[i, :] * predicts[i, :]) > 0) * 1. union = sum((true_labels[i, :] + predicts[i, :]) > 0) * 1. if union > 0: s += inter / union elif np.sum(true_labels[i, :]) == 0: s += 1. return s * 1. / N def exact_match(true_labels, predicts): """ This is the most strict metric for the multi label setting. It's defined as the percentage of samples that have all their labels correctly classified. Parameters ---------- true_labels: numpy.ndarray of shape (n_samples, n_target_tasks) A matrix with the true labels for all the classification tasks and for n_samples. predicts: numpy.ndarray of shape (n_samples, n_target_tasks) A matrix with the predictions for all the classification tasks and for n_samples. Returns ------- float The exact match percentage between the given sets. Examples -------- >>> from skmultiflow.metrics import exact_match >>> true_labels = [[0,1,0,1],[0,0,0,1],[1,1,0,1],[1,1,1,1]] >>> predictions = [[0,1,0,1],[0,1,1,0],[0,1,0,1],[1,1,1,1]] >>> exact_match(true_labels, predictions) 0.5 """ if not hasattr(true_labels, 'shape'): true_labels = np.asarray(true_labels) if not hasattr(predicts, 'shape'): predicts = np.asarray(predicts) N, L = true_labels.shape return np.sum(np.sum((true_labels == predicts) * 1, axis=1) == L) * 1. / N

31.720097

112

0.59763

5a6b89aee2cdfa442c021d4973c5e1b801e88a2f

308

py

Python

tests/runner.py

BinyaminSharet/Mtp

2683f521123edd1a40e73204eceaa5cb2d5e78aa

[ "MIT" ]

8

2016-07-24T12:02:17.000Z

2021-08-18T06:14:54.000Z

tests/runner.py

BinyaminSharet/Mtp

2683f521123edd1a40e73204eceaa5cb2d5e78aa

[ "MIT" ]

1

2017-04-18T23:00:40.000Z

2017-04-18T23:03:55.000Z

tests/runner.py

BinyaminSharet/Mtp

2683f521123edd1a40e73204eceaa5cb2d5e78aa

[ "MIT" ]

5

2016-06-22T11:44:39.000Z

2019-08-21T13:17:26.000Z

#!/usr/bin/env python import os import unittest from mtp_device_tests import * from mtp_api_tests import * from mtp_msg_tests import * from mtp_property_tests import * from mtp_object_tests import * if __name__ == '__main__': if not os.path.exists('logs'): os.mkdir('logs') unittest.main()

20.533333

34

0.730519

d9cb1564c24b5070bd04cb6dcae06149381f8ea3

191

py

Python

test/validate.py

mm333444/ProxyTool

aad1a2d900646b68b3dd2097c8abe7357a09ec6c

[ "BSD-2-Clause" ]

6

2017-09-19T04:32:00.000Z

2018-01-25T08:18:55.000Z

test/validate.py

mm333444/ProxyTool

aad1a2d900646b68b3dd2097c8abe7357a09ec6c

[ "BSD-2-Clause" ]

2

2021-03-22T17:12:39.000Z

2021-06-01T21:42:27.000Z

test/validate.py

aox-lei/ProxyTool

aad1a2d900646b68b3dd2097c8abe7357a09ec6c

[ "BSD-2-Clause" ]

null

# -*- coding:utf-8 -*- import os import sys sys.path.append(os.path.abspath(os.getcwd())) from app.validate.request_web import request_web request_web().run('http', '222.73.68.144', 8090)

19.1

48

0.712042

ece30b3a8b4e4963d61979af9763fe25def49cf7

109

py

Python

leetcode/__init__.py

Gongzq5/leetcode-helper

9a6f79db6fbefa921b852064a269e274e81a1e28

[ "MIT" ]

null

leetcode/__init__.py

Gongzq5/leetcode-helper

9a6f79db6fbefa921b852064a269e274e81a1e28

[ "MIT" ]

null

leetcode/__init__.py

Gongzq5/leetcode-helper

9a6f79db6fbefa921b852064a269e274e81a1e28

[ "MIT" ]

null

from . import array from . import list from . import reporter from . import tree from . import simple_drawer

18.166667

27

0.770642

ea81a6feb07b37fae5b45b9ea6f965b36333c3bc

2,046

py

Python

trio/tests/common_linear.py

psandahl/trio

34d1c20e6e9bd3cd18bca1a9f2a53518452bd0ff

[ "MIT" ]

null

trio/tests/common_linear.py

psandahl/trio

34d1c20e6e9bd3cd18bca1a9f2a53518452bd0ff

[ "MIT" ]

null

trio/tests/common_linear.py

psandahl/trio

34d1c20e6e9bd3cd18bca1a9f2a53518452bd0ff

[ "MIT" ]

null

import numpy as np import unittest from trio.common.camera import Camera from trio.common.linear import triangulate, solve_dlt from trio.common.math import euclidean, homogeneous from trio.common.matrix import matrix_look_at, matrix_decompose_ypr from .utils import equal_arrays class CommonLinearTestCase(unittest.TestCase): def test_linear_triangulate(self): c0 = Camera(np.array([4, 3, 0]), np.radians((-90, 0, 0)), np.radians((30, 20))) c1 = Camera(np.array([3, 3, 0]), np.radians((-90, 0, 0)), np.radians((30, 20))) xyz = np.array([3.5, 0.3, 0.35]) uv0 = c0.project(xyz) uv1 = c1.project(xyz) self.assertTrue(equal_arrays(xyz, triangulate( c0.projection_matrix, uv0, c1.projection_matrix, uv1))) def test_linear_simple_dlt(self): # Setup camera. ypr = matrix_decompose_ypr( matrix_look_at(np.array((10, 10, 10)), np.array((0, 0, 0)), np.array((0, 0, 1)))) c = Camera(np.array((10, 10, 10)), np.array(ypr), np.radians((50, 45))) # Produce points. xyzs = [np.array((-3.2, 1.3, 1.1)), np.array((-1.6, -2, 0.8)), np.array((0, 0, -1)), np.array((1.8, -1.6, -0.1)), np.array((1.2, 2.1, -0.6)), np.array((3.1, -2.7, 1.5)), np.array((3.3, 2.7, 1.8))] points = list() for xyz in xyzs: px = c.project(xyz) point = dict() point["x"] = xyz[0] point["y"] = xyz[1] point["z"] = xyz[2] point["u"] = px[0] point["v"] = px[1] points.append(point) # Run dlt. res, p = solve_dlt(points) self.assertTrue(res) # Compare projections. for xyz in xyzs: px1 = c.project(xyz) px2 = euclidean(p @ homogeneous(xyz)) self.assertTrue(equal_arrays(px1, px2))

30.537313

79

0.50782

6f5550a6f8209cedb5f586302b6b70ca4643bb71

26,967

py

Python

pandas/tests/reshape/test_crosstab.py

cgangwar11/pandas

972f491cb7fdcc3c1c2cb9f05644128f13457f87

[ "PSF-2.0", "Apache-2.0", "BSD-3-Clause-No-Nuclear-License-2014", "MIT", "ECL-2.0", "BSD-3-Clause" ]

1

2020-09-03T13:24:57.000Z

pandas/tests/reshape/test_crosstab.py

cgangwar11/pandas

972f491cb7fdcc3c1c2cb9f05644128f13457f87

[ "PSF-2.0", "Apache-2.0", "BSD-3-Clause-No-Nuclear-License-2014", "MIT", "ECL-2.0", "BSD-3-Clause" ]

null

pandas/tests/reshape/test_crosstab.py

cgangwar11/pandas

972f491cb7fdcc3c1c2cb9f05644128f13457f87

[ "PSF-2.0", "Apache-2.0", "BSD-3-Clause-No-Nuclear-License-2014", "MIT", "ECL-2.0", "BSD-3-Clause" ]

1

2020-11-20T18:19:33.000Z

import numpy as np import pytest from pandas import CategoricalIndex, DataFrame, Index, MultiIndex, Series, crosstab import pandas._testing as tm class TestCrosstab: def setup_method(self, method): df = DataFrame( { "A": [ "foo", "foo", "foo", "foo", "bar", "bar", "bar", "bar", "foo", "foo", "foo", ], "B": [ "one", "one", "one", "two", "one", "one", "one", "two", "two", "two", "one", ], "C": [ "dull", "dull", "shiny", "dull", "dull", "shiny", "shiny", "dull", "shiny", "shiny", "shiny", ], "D": np.random.randn(11), "E": np.random.randn(11), "F": np.random.randn(11), } ) self.df = df.append(df, ignore_index=True) def test_crosstab_single(self): df = self.df result = crosstab(df["A"], df["C"]) expected = df.groupby(["A", "C"]).size().unstack() tm.assert_frame_equal(result, expected.fillna(0).astype(np.int64)) def test_crosstab_multiple(self): df = self.df result = crosstab(df["A"], [df["B"], df["C"]]) expected = df.groupby(["A", "B", "C"]).size() expected = expected.unstack("B").unstack("C").fillna(0).astype(np.int64) tm.assert_frame_equal(result, expected) result = crosstab([df["B"], df["C"]], df["A"]) expected = df.groupby(["B", "C", "A"]).size() expected = expected.unstack("A").fillna(0).astype(np.int64) tm.assert_frame_equal(result, expected) def test_crosstab_ndarray(self): a = np.random.randint(0, 5, size=100) b = np.random.randint(0, 3, size=100) c = np.random.randint(0, 10, size=100) df = DataFrame({"a": a, "b": b, "c": c}) result = crosstab(a, [b, c], rownames=["a"], colnames=("b", "c")) expected = crosstab(df["a"], [df["b"], df["c"]]) tm.assert_frame_equal(result, expected) result = crosstab([b, c], a, colnames=["a"], rownames=("b", "c")) expected = crosstab([df["b"], df["c"]], df["a"]) tm.assert_frame_equal(result, expected) # assign arbitrary names result = crosstab(self.df["A"].values, self.df["C"].values) assert result.index.name == "row_0" assert result.columns.name == "col_0" def test_crosstab_non_aligned(self): # GH 17005 a = Series([0, 1, 1], index=["a", "b", "c"]) b = Series([3, 4, 3, 4, 3], index=["a", "b", "c", "d", "f"]) c = np.array([3, 4, 3]) expected = DataFrame( [[1, 0], [1, 1]], index=Index([0, 1], name="row_0"), columns=Index([3, 4], name="col_0"), ) result = crosstab(a, b) tm.assert_frame_equal(result, expected) result = crosstab(a, c) tm.assert_frame_equal(result, expected) def test_crosstab_margins(self): a = np.random.randint(0, 7, size=100) b = np.random.randint(0, 3, size=100) c = np.random.randint(0, 5, size=100) df = DataFrame({"a": a, "b": b, "c": c}) result = crosstab(a, [b, c], rownames=["a"], colnames=("b", "c"), margins=True) assert result.index.names == ("a",) assert result.columns.names == ["b", "c"] all_cols = result["All", ""] exp_cols = df.groupby(["a"]).size().astype("i8") # to keep index.name exp_margin = Series([len(df)], index=Index(["All"], name="a")) exp_cols = exp_cols.append(exp_margin) exp_cols.name = ("All", "") tm.assert_series_equal(all_cols, exp_cols) all_rows = result.loc["All"] exp_rows = df.groupby(["b", "c"]).size().astype("i8") exp_rows = exp_rows.append(Series([len(df)], index=[("All", "")])) exp_rows.name = "All" exp_rows = exp_rows.reindex(all_rows.index) exp_rows = exp_rows.fillna(0).astype(np.int64) tm.assert_series_equal(all_rows, exp_rows) def test_crosstab_margins_set_margin_name(self): # GH 15972 a = np.random.randint(0, 7, size=100) b = np.random.randint(0, 3, size=100) c = np.random.randint(0, 5, size=100) df = DataFrame({"a": a, "b": b, "c": c}) result = crosstab( a, [b, c], rownames=["a"], colnames=("b", "c"), margins=True, margins_name="TOTAL", ) assert result.index.names == ("a",) assert result.columns.names == ["b", "c"] all_cols = result["TOTAL", ""] exp_cols = df.groupby(["a"]).size().astype("i8") # to keep index.name exp_margin = Series([len(df)], index=Index(["TOTAL"], name="a")) exp_cols = exp_cols.append(exp_margin) exp_cols.name = ("TOTAL", "") tm.assert_series_equal(all_cols, exp_cols) all_rows = result.loc["TOTAL"] exp_rows = df.groupby(["b", "c"]).size().astype("i8") exp_rows = exp_rows.append(Series([len(df)], index=[("TOTAL", "")])) exp_rows.name = "TOTAL" exp_rows = exp_rows.reindex(all_rows.index) exp_rows = exp_rows.fillna(0).astype(np.int64) tm.assert_series_equal(all_rows, exp_rows) msg = "margins_name argument must be a string" for margins_name in [666, None, ["a", "b"]]: with pytest.raises(ValueError, match=msg): crosstab( a, [b, c], rownames=["a"], colnames=("b", "c"), margins=True, margins_name=margins_name, ) def test_crosstab_pass_values(self): a = np.random.randint(0, 7, size=100) b = np.random.randint(0, 3, size=100) c = np.random.randint(0, 5, size=100) values = np.random.randn(100) table = crosstab( [a, b], c, values, aggfunc=np.sum, rownames=["foo", "bar"], colnames=["baz"] ) df = DataFrame({"foo": a, "bar": b, "baz": c, "values": values}) expected = df.pivot_table( "values", index=["foo", "bar"], columns="baz", aggfunc=np.sum ) tm.assert_frame_equal(table, expected) def test_crosstab_dropna(self): # GH 3820 a = np.array(["foo", "foo", "foo", "bar", "bar", "foo", "foo"], dtype=object) b = np.array(["one", "one", "two", "one", "two", "two", "two"], dtype=object) c = np.array( ["dull", "dull", "dull", "dull", "dull", "shiny", "shiny"], dtype=object ) res = crosstab(a, [b, c], rownames=["a"], colnames=["b", "c"], dropna=False) m = MultiIndex.from_tuples( [("one", "dull"), ("one", "shiny"), ("two", "dull"), ("two", "shiny")], names=["b", "c"], ) tm.assert_index_equal(res.columns, m) def test_crosstab_no_overlap(self): # GS 10291 s1 = Series([1, 2, 3], index=[1, 2, 3]) s2 = Series([4, 5, 6], index=[4, 5, 6]) actual = crosstab(s1, s2) expected = DataFrame() tm.assert_frame_equal(actual, expected) def test_margin_dropna(self): # GH 12577 # pivot_table counts null into margin ('All') # when margins=true and dropna=true df = DataFrame({"a": [1, 2, 2, 2, 2, np.nan], "b": [3, 3, 4, 4, 4, 4]}) actual = crosstab(df.a, df.b, margins=True, dropna=True) expected = DataFrame([[1, 0, 1], [1, 3, 4], [2, 3, 5]]) expected.index = Index([1.0, 2.0, "All"], name="a") expected.columns = Index([3, 4, "All"], name="b") tm.assert_frame_equal(actual, expected) df = DataFrame( {"a": [1, np.nan, np.nan, np.nan, 2, np.nan], "b": [3, np.nan, 4, 4, 4, 4]} ) actual = crosstab(df.a, df.b, margins=True, dropna=True) expected = DataFrame([[1, 0, 1], [0, 1, 1], [1, 1, 2]]) expected.index = Index([1.0, 2.0, "All"], name="a") expected.columns = Index([3.0, 4.0, "All"], name="b") tm.assert_frame_equal(actual, expected) df = DataFrame( {"a": [1, np.nan, np.nan, np.nan, np.nan, 2], "b": [3, 3, 4, 4, 4, 4]} ) actual = crosstab(df.a, df.b, margins=True, dropna=True) expected = DataFrame([[1, 0, 1], [0, 1, 1], [1, 1, 2]]) expected.index = Index([1.0, 2.0, "All"], name="a") expected.columns = Index([3, 4, "All"], name="b") tm.assert_frame_equal(actual, expected) # GH 12642 # _add_margins raises KeyError: Level None not found # when margins=True and dropna=False df = DataFrame({"a": [1, 2, 2, 2, 2, np.nan], "b": [3, 3, 4, 4, 4, 4]}) actual = crosstab(df.a, df.b, margins=True, dropna=False) expected = DataFrame([[1, 0, 1], [1, 3, 4], [2, 4, 6]]) expected.index = Index([1.0, 2.0, "All"], name="a") expected.columns = Index([3, 4, "All"], name="b") tm.assert_frame_equal(actual, expected) df = DataFrame( {"a": [1, np.nan, np.nan, np.nan, 2, np.nan], "b": [3, np.nan, 4, 4, 4, 4]} ) actual = crosstab(df.a, df.b, margins=True, dropna=False) expected = DataFrame([[1, 0, 1], [0, 1, 1], [1, 4, 6]]) expected.index = Index([1.0, 2.0, "All"], name="a") expected.columns = Index([3.0, 4.0, "All"], name="b") tm.assert_frame_equal(actual, expected) a = np.array(["foo", "foo", "foo", "bar", "bar", "foo", "foo"], dtype=object) b = np.array(["one", "one", "two", "one", "two", np.nan, "two"], dtype=object) c = np.array( ["dull", "dull", "dull", "dull", "dull", "shiny", "shiny"], dtype=object ) actual = crosstab( a, [b, c], rownames=["a"], colnames=["b", "c"], margins=True, dropna=False ) m = MultiIndex.from_arrays( [ ["one", "one", "two", "two", "All"], ["dull", "shiny", "dull", "shiny", ""], ], names=["b", "c"], ) expected = DataFrame( [[1, 0, 1, 0, 2], [2, 0, 1, 1, 5], [3, 0, 2, 1, 7]], columns=m ) expected.index = Index(["bar", "foo", "All"], name="a") tm.assert_frame_equal(actual, expected) actual = crosstab( [a, b], c, rownames=["a", "b"], colnames=["c"], margins=True, dropna=False ) m = MultiIndex.from_arrays( [["bar", "bar", "foo", "foo", "All"], ["one", "two", "one", "two", ""]], names=["a", "b"], ) expected = DataFrame( [[1, 0, 1], [1, 0, 1], [2, 0, 2], [1, 1, 2], [5, 2, 7]], index=m ) expected.columns = Index(["dull", "shiny", "All"], name="c") tm.assert_frame_equal(actual, expected) actual = crosstab( [a, b], c, rownames=["a", "b"], colnames=["c"], margins=True, dropna=True ) m = MultiIndex.from_arrays( [["bar", "bar", "foo", "foo", "All"], ["one", "two", "one", "two", ""]], names=["a", "b"], ) expected = DataFrame( [[1, 0, 1], [1, 0, 1], [2, 0, 2], [1, 1, 2], [5, 1, 6]], index=m ) expected.columns = Index(["dull", "shiny", "All"], name="c") tm.assert_frame_equal(actual, expected) def test_crosstab_normalize(self): # Issue 12578 df = DataFrame( {"a": [1, 2, 2, 2, 2], "b": [3, 3, 4, 4, 4], "c": [1, 1, np.nan, 1, 1]} ) rindex = Index([1, 2], name="a") cindex = Index([3, 4], name="b") full_normal = DataFrame([[0.2, 0], [0.2, 0.6]], index=rindex, columns=cindex) row_normal = DataFrame([[1.0, 0], [0.25, 0.75]], index=rindex, columns=cindex) col_normal = DataFrame([[0.5, 0], [0.5, 1.0]], index=rindex, columns=cindex) # Check all normalize args tm.assert_frame_equal(crosstab(df.a, df.b, normalize="all"), full_normal) tm.assert_frame_equal(crosstab(df.a, df.b, normalize=True), full_normal) tm.assert_frame_equal(crosstab(df.a, df.b, normalize="index"), row_normal) tm.assert_frame_equal(crosstab(df.a, df.b, normalize="columns"), col_normal) tm.assert_frame_equal( crosstab(df.a, df.b, normalize=1), crosstab(df.a, df.b, normalize="columns"), ) tm.assert_frame_equal( crosstab(df.a, df.b, normalize=0), crosstab(df.a, df.b, normalize="index"), ) row_normal_margins = DataFrame( [[1.0, 0], [0.25, 0.75], [0.4, 0.6]], index=Index([1, 2, "All"], name="a", dtype="object"), columns=Index([3, 4], name="b", dtype="object"), ) col_normal_margins = DataFrame( [[0.5, 0, 0.2], [0.5, 1.0, 0.8]], index=Index([1, 2], name="a", dtype="object"), columns=Index([3, 4, "All"], name="b", dtype="object"), ) all_normal_margins = DataFrame( [[0.2, 0, 0.2], [0.2, 0.6, 0.8], [0.4, 0.6, 1]], index=Index([1, 2, "All"], name="a", dtype="object"), columns=Index([3, 4, "All"], name="b", dtype="object"), ) tm.assert_frame_equal( crosstab(df.a, df.b, normalize="index", margins=True), row_normal_margins ) tm.assert_frame_equal( crosstab(df.a, df.b, normalize="columns", margins=True), col_normal_margins, ) tm.assert_frame_equal( crosstab(df.a, df.b, normalize=True, margins=True), all_normal_margins ) # Test arrays crosstab( [np.array([1, 1, 2, 2]), np.array([1, 2, 1, 2])], np.array([1, 2, 1, 2]) ) # Test with aggfunc norm_counts = DataFrame( [[0.25, 0, 0.25], [0.25, 0.5, 0.75], [0.5, 0.5, 1]], index=Index([1, 2, "All"], name="a", dtype="object"), columns=Index([3, 4, "All"], name="b"), ) test_case = crosstab( df.a, df.b, df.c, aggfunc="count", normalize="all", margins=True ) tm.assert_frame_equal(test_case, norm_counts) df = DataFrame( {"a": [1, 2, 2, 2, 2], "b": [3, 3, 4, 4, 4], "c": [0, 4, np.nan, 3, 3]} ) norm_sum = DataFrame( [[0, 0, 0.0], [0.4, 0.6, 1], [0.4, 0.6, 1]], index=Index([1, 2, "All"], name="a", dtype="object"), columns=Index([3, 4, "All"], name="b", dtype="object"), ) test_case = crosstab( df.a, df.b, df.c, aggfunc=np.sum, normalize="all", margins=True ) tm.assert_frame_equal(test_case, norm_sum) def test_crosstab_with_empties(self): # Check handling of empties df = DataFrame( { "a": [1, 2, 2, 2, 2], "b": [3, 3, 4, 4, 4], "c": [np.nan, np.nan, np.nan, np.nan, np.nan], } ) empty = DataFrame( [[0.0, 0.0], [0.0, 0.0]], index=Index([1, 2], name="a", dtype="int64"), columns=Index([3, 4], name="b"), ) for i in [True, "index", "columns"]: calculated = crosstab(df.a, df.b, values=df.c, aggfunc="count", normalize=i) tm.assert_frame_equal(empty, calculated) nans = DataFrame( [[0.0, np.nan], [0.0, 0.0]], index=Index([1, 2], name="a", dtype="int64"), columns=Index([3, 4], name="b"), ) calculated = crosstab(df.a, df.b, values=df.c, aggfunc="count", normalize=False) tm.assert_frame_equal(nans, calculated) def test_crosstab_errors(self): # Issue 12578 df = DataFrame( {"a": [1, 2, 2, 2, 2], "b": [3, 3, 4, 4, 4], "c": [1, 1, np.nan, 1, 1]} ) error = "values cannot be used without an aggfunc." with pytest.raises(ValueError, match=error): crosstab(df.a, df.b, values=df.c) error = "aggfunc cannot be used without values" with pytest.raises(ValueError, match=error): crosstab(df.a, df.b, aggfunc=np.mean) error = "Not a valid normalize argument" with pytest.raises(ValueError, match=error): crosstab(df.a, df.b, normalize="42") with pytest.raises(ValueError, match=error): crosstab(df.a, df.b, normalize=42) error = "Not a valid margins argument" with pytest.raises(ValueError, match=error): crosstab(df.a, df.b, normalize="all", margins=42) def test_crosstab_with_categorial_columns(self): # GH 8860 df = DataFrame( { "MAKE": ["Honda", "Acura", "Tesla", "Honda", "Honda", "Acura"], "MODEL": ["Sedan", "Sedan", "Electric", "Pickup", "Sedan", "Sedan"], } ) categories = ["Sedan", "Electric", "Pickup"] df["MODEL"] = df["MODEL"].astype("category").cat.set_categories(categories) result = crosstab(df["MAKE"], df["MODEL"]) expected_index = Index(["Acura", "Honda", "Tesla"], name="MAKE") expected_columns = CategoricalIndex( categories, categories=categories, ordered=False, name="MODEL" ) expected_data = [[2, 0, 0], [2, 0, 1], [0, 1, 0]] expected = DataFrame( expected_data, index=expected_index, columns=expected_columns ) tm.assert_frame_equal(result, expected) def test_crosstab_with_numpy_size(self): # GH 4003 df = DataFrame( { "A": ["one", "one", "two", "three"] * 6, "B": ["A", "B", "C"] * 8, "C": ["foo", "foo", "foo", "bar", "bar", "bar"] * 4, "D": np.random.randn(24), "E": np.random.randn(24), } ) result = crosstab( index=[df["A"], df["B"]], columns=[df["C"]], margins=True, aggfunc=np.size, values=df["D"], ) expected_index = MultiIndex( levels=[["All", "one", "three", "two"], ["", "A", "B", "C"]], codes=[[1, 1, 1, 2, 2, 2, 3, 3, 3, 0], [1, 2, 3, 1, 2, 3, 1, 2, 3, 0]], names=["A", "B"], ) expected_column = Index(["bar", "foo", "All"], dtype="object", name="C") expected_data = np.array( [ [2.0, 2.0, 4.0], [2.0, 2.0, 4.0], [2.0, 2.0, 4.0], [2.0, np.nan, 2.0], [np.nan, 2.0, 2.0], [2.0, np.nan, 2.0], [np.nan, 2.0, 2.0], [2.0, np.nan, 2.0], [np.nan, 2.0, 2.0], [12.0, 12.0, 24.0], ] ) expected = DataFrame( expected_data, index=expected_index, columns=expected_column ) tm.assert_frame_equal(result, expected) def test_crosstab_dup_index_names(self): # GH 13279 s = Series(range(3), name="foo") result = crosstab(s, s) expected_index = Index(range(3), name="foo") expected = DataFrame( np.eye(3, dtype=np.int64), index=expected_index, columns=expected_index ) tm.assert_frame_equal(result, expected) @pytest.mark.parametrize("names", [["a", ("b", "c")], [("a", "b"), "c"]]) def test_crosstab_tuple_name(self, names): s1 = Series(range(3), name=names[0]) s2 = Series(range(1, 4), name=names[1]) mi = MultiIndex.from_arrays([range(3), range(1, 4)], names=names) expected = Series(1, index=mi).unstack(1, fill_value=0) result = crosstab(s1, s2) tm.assert_frame_equal(result, expected) def test_crosstab_both_tuple_names(self): # GH 18321 s1 = Series(range(3), name=("a", "b")) s2 = Series(range(3), name=("c", "d")) expected = DataFrame( np.eye(3, dtype="int64"), index=Index(range(3), name=("a", "b")), columns=Index(range(3), name=("c", "d")), ) result = crosstab(s1, s2) tm.assert_frame_equal(result, expected) def test_crosstab_unsorted_order(self): df = DataFrame({"b": [3, 1, 2], "a": [5, 4, 6]}, index=["C", "A", "B"]) result = crosstab(df.index, [df.b, df.a]) e_idx = Index(["A", "B", "C"], name="row_0") e_columns = MultiIndex.from_tuples([(1, 4), (2, 6), (3, 5)], names=["b", "a"]) expected = DataFrame( [[1, 0, 0], [0, 1, 0], [0, 0, 1]], index=e_idx, columns=e_columns ) tm.assert_frame_equal(result, expected) def test_crosstab_normalize_multiple_columns(self): # GH 15150 df = DataFrame( { "A": ["one", "one", "two", "three"] * 6, "B": ["A", "B", "C"] * 8, "C": ["foo", "foo", "foo", "bar", "bar", "bar"] * 4, "D": [0] * 24, "E": [0] * 24, } ) result = crosstab( [df.A, df.B], df.C, values=df.D, aggfunc=np.sum, normalize=True, margins=True, ) expected = DataFrame( np.array([0] * 29 + [1], dtype=float).reshape(10, 3), columns=Index(["bar", "foo", "All"], dtype="object", name="C"), index=MultiIndex.from_tuples( [ ("one", "A"), ("one", "B"), ("one", "C"), ("three", "A"), ("three", "B"), ("three", "C"), ("two", "A"), ("two", "B"), ("two", "C"), ("All", ""), ], names=["A", "B"], ), ) tm.assert_frame_equal(result, expected) def test_margin_normalize(self): # GH 27500 df = DataFrame( { "A": ["foo", "foo", "foo", "foo", "foo", "bar", "bar", "bar", "bar"], "B": ["one", "one", "one", "two", "two", "one", "one", "two", "two"], "C": [ "small", "large", "large", "small", "small", "large", "small", "small", "large", ], "D": [1, 2, 2, 3, 3, 4, 5, 6, 7], "E": [2, 4, 5, 5, 6, 6, 8, 9, 9], } ) # normalize on index result = crosstab( [df.A, df.B], df.C, margins=True, margins_name="Sub-Total", normalize=0 ) expected = DataFrame( [[0.5, 0.5], [0.5, 0.5], [0.666667, 0.333333], [0, 1], [0.444444, 0.555556]] ) expected.index = MultiIndex( levels=[["Sub-Total", "bar", "foo"], ["", "one", "two"]], codes=[[1, 1, 2, 2, 0], [1, 2, 1, 2, 0]], names=["A", "B"], ) expected.columns = Index(["large", "small"], dtype="object", name="C") tm.assert_frame_equal(result, expected) # normalize on columns result = crosstab( [df.A, df.B], df.C, margins=True, margins_name="Sub-Total", normalize=1 ) expected = DataFrame( [ [0.25, 0.2, 0.222222], [0.25, 0.2, 0.222222], [0.5, 0.2, 0.333333], [0, 0.4, 0.222222], ] ) expected.columns = Index( ["large", "small", "Sub-Total"], dtype="object", name="C" ) expected.index = MultiIndex( levels=[["bar", "foo"], ["one", "two"]], codes=[[0, 0, 1, 1], [0, 1, 0, 1]], names=["A", "B"], ) tm.assert_frame_equal(result, expected) # normalize on both index and column result = crosstab( [df.A, df.B], df.C, margins=True, margins_name="Sub-Total", normalize=True ) expected = DataFrame( [ [0.111111, 0.111111, 0.222222], [0.111111, 0.111111, 0.222222], [0.222222, 0.111111, 0.333333], [0.000000, 0.222222, 0.222222], [0.444444, 0.555555, 1], ] ) expected.columns = Index( ["large", "small", "Sub-Total"], dtype="object", name="C" ) expected.index = MultiIndex( levels=[["Sub-Total", "bar", "foo"], ["", "one", "two"]], codes=[[1, 1, 2, 2, 0], [1, 2, 1, 2, 0]], names=["A", "B"], ) tm.assert_frame_equal(result, expected) def test_margin_normalize_multiple_columns(self): # GH 35144 # use multiple columns with margins and normalization df = DataFrame( { "A": ["foo", "foo", "foo", "foo", "foo", "bar", "bar", "bar", "bar"], "B": ["one", "one", "one", "two", "two", "one", "one", "two", "two"], "C": [ "small", "large", "large", "small", "small", "large", "small", "small", "large", ], "D": [1, 2, 2, 3, 3, 4, 5, 6, 7], "E": [2, 4, 5, 5, 6, 6, 8, 9, 9], } ) result = crosstab( index=df.C, columns=[df.A, df.B], margins=True, margins_name="margin", normalize=True, ) expected = DataFrame( [ [0.111111, 0.111111, 0.222222, 0.000000, 0.444444], [0.111111, 0.111111, 0.111111, 0.222222, 0.555556], [0.222222, 0.222222, 0.333333, 0.222222, 1.0], ], index=["large", "small", "margin"], ) expected.columns = MultiIndex( levels=[["bar", "foo", "margin"], ["", "one", "two"]], codes=[[0, 0, 1, 1, 2], [1, 2, 1, 2, 0]], names=["A", "B"], ) expected.index.name = "C" tm.assert_frame_equal(result, expected)

36.148794

88

0.457559

6581562855be0290e4b8bc7b5d28d9403415a1c1

1,514

py

Python

gapipy/resources/geo/place.py

wmak/gapipy

b6849606d4f6af24b9f871f65e87aaf0d0c013cc

[ "MIT" ]

4

2015-03-19T02:10:35.000Z

2018-10-22T19:51:44.000Z

gapipy/resources/geo/place.py

wmak/gapipy

b6849606d4f6af24b9f871f65e87aaf0d0c013cc

[ "MIT" ]

69

2015-03-11T20:58:04.000Z

2021-10-12T18:39:15.000Z

gapipy/resources/geo/place.py

wmak/gapipy

b6849606d4f6af24b9f871f65e87aaf0d0c013cc

[ "MIT" ]

1

2016-08-31T15:22:43.000Z

# Python 2 and 3 from __future__ import unicode_literals from ..base import Resource from .country import Country from .feature import Feature from .state import State from .timezone import Timezone from ..dossier import PlaceDossier class Place(Resource): _resource_name = 'places' _as_is_fields = [ 'id', 'href', 'name', 'ascii_name', 'population', 'elevation', 'latitude', 'longitude', 'bounding_box', 'alternate_names', 'admin_divisions', 'dossier_frequency', ] _date_time_fields_utc = ['date_created', 'date_last_modified'] _resource_fields = [ ('country', Country), ('state', State), ('feature', Feature), ('timezone', Timezone), ] _model_fields = [ ('place_dossier', PlaceDossier), ] _model_collection_fields = [ ('places_of_interest', 'Place') ] def __init__(self, *args, **kwargs): super(Place, self).__init__(*args, **kwargs) self._set_admin_divisions() def _set_admin_divisions(self): """Transform the raw json list of `admin_divisions` into a list of thecd ~? corresponding Place (stub) instances. """ if 'admin_divisions' in self._raw_data: raw_admin_divisions = self._raw_data['admin_divisions'] or [] admin_divisions = [ self.__class__(d, client=self._client, stub=True) for d in raw_admin_divisions ] self.admin_divisions = admin_divisions

28.566038

83

0.629458

6a4995a43ee6406642160c38d86831d3e8eff9bc

1,364

py

Python

sknano/generators/tests/test_mwnt_generator.py

haidi-ustc/scikit-nano

ef9b24165ba37918b3f520657f7311ba139b3e7d

[ "BSD-2-Clause" ]

21

2016-06-08T18:27:20.000Z

2022-03-22T08:27:46.000Z

sknano/generators/tests/test_mwnt_generator.py

haidi-ustc/scikit-nano

ef9b24165ba37918b3f520657f7311ba139b3e7d

[ "BSD-2-Clause" ]

8

2016-06-24T19:45:58.000Z

2021-03-25T21:42:29.000Z

sknano/generators/tests/test_mwnt_generator.py

scikit-nano/scikit-nano

ef9b24165ba37918b3f520657f7311ba139b3e7d

[ "BSD-2-Clause" ]

9

2016-12-08T16:35:52.000Z

2021-06-23T17:13:44.000Z

# -*- coding: utf-8 -*- from __future__ import absolute_import, division, print_function from __future__ import unicode_literals import nose from nose.tools import * from sknano.generators import MWNTGenerator from sknano.testing import GeneratorTestFixtures class TestCase(GeneratorTestFixtures): def test1(self): mwnt = MWNTGenerator(max_walls=3, Lz=1.0) print(mwnt) print(mwnt.todict()) mwnt.save() self.tmpdata.append(mwnt.fname) mwnt.save(structure_format='data') self.tmpdata.append(mwnt.fname) def test2(self): mwnt = MWNTGenerator(Ch=[(10, 10), (50, 50)], Lz=1.0) print(mwnt) print(mwnt.todict()) assert_equal(mwnt.Nwalls, 2) assert_equal(mwnt.chiral_set, set(['armchair'])) mwnt.save() self.tmpdata.append(mwnt.fname) mwnt.save(structure_format='data') self.tmpdata.append(mwnt.fname) def test3(self): mwnt = MWNTGenerator(Ch=[(5, 5), (10, 10), (20, 20)], Lz=1.0) print(mwnt) print(mwnt.todict()) assert_equal(mwnt.Nwalls, 3) assert_equal(mwnt.chiral_set, set(['armchair'])) mwnt.save() self.tmpdata.append(mwnt.fname) mwnt.save(structure_format='data') self.tmpdata.append(mwnt.fname) if __name__ == '__main__': nose.runmodule()

28.416667

69

0.63563

a2c52ac1c2b89662c1ea3f0033ad911b35123a33

13,319

py

Python

ABC_doc.py

Ally-Financial/abc-doc

20e6d3867774cf8729bbc763d6c2dc7b684fabce

[ "Apache-2.0" ]

null

ABC_doc.py

Ally-Financial/abc-doc

20e6d3867774cf8729bbc763d6c2dc7b684fabce

[ "Apache-2.0" ]

null

ABC_doc.py

Ally-Financial/abc-doc

20e6d3867774cf8729bbc763d6c2dc7b684fabce

[ "Apache-2.0" ]

null

''' * Copyright 2021 Ally Financial, Inc. * * Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except * in compliance with the License. You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software distributed under the License * is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express * or implied. See the License for the specific language governing permissions and limitations under * the License. ''' #library to capture Mouse Events from pynput.mouse import Listener from pynput import mouse import logging #library to capture Screenshot import pyautogui #library to prepare and work on word File from docx import Document from docx.shared import Inches #library to Build Application GUI import PySimpleGUI as sg #library to get and Set system details import os from datetime import datetime #library to work on images and merge 2 images from PIL import Image, ImageDraw #import pii_DetectBlur_Image #nexus v_enable_logging = True # for padding white spaces for better layout vSzInput=(3,10) vSzButton=(25,3) vSzIcon=(3,3) # parameters to be changed for individual or organizaiton needs vFinalFilenameStartWith = 'Ally - ' vFilename = 'Ally - ' vContinueProcessCapture = False # parameters to be changed for individual or organizaiton needs vScreenTextFont = 'Calibri 12' vDesktopPath = (os.environ['USERPROFILE'] + '\Desktop') # convert images or logo to 64 bit string for easy portability vLogoOnScreen = b'iVBORw0KGgoAAAANSUhEUgAAADIAAAAtCAYAAADsvzj/AAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAAFuoAABbqAeWOQxAAAAbCSURBVGhD7VlpbFRVFB6KSFQWi2Aps7xlBjAoEG2MGIlEZakUqW1nee9u0xaD+gPj8kfi0kQQBNJEgtEQBU0MEreEaExUjBL+mBgDBmIBg8aYKEESRHahMH7n9RaG8dF5M51WTfiS023ePfd8557tvoau4Ar+J0iFUkNT41Ij3Fp3bEOkISxrZUzaMsbDPJI1suMbYg3VT0SS1+jH/1sgw+UEOckJi3uZLVq5zZ+XllwrrexGfH8HRN6VdvZtZan1+H0VN/iTwsg+yCPp23mM13aEOqq0qn8H8+HhTDQzV5ryOWGKrdySv3JLnMnGW3PtiUU9Er8oixIP5VrjbTlhyZy01J+Q3dyUb4JYe9pMT09GZgzuSbHRrNqJ8QYY8QaM+o2Ma4u354iAsrM5YcuiQs/RGiJLxHCSXzOLPdUSdW7GFgN/QkmLTeW2XAPPH+g13s/QUoV0ybjCz3wbt5Wbqk6N1ltWHEOZwe7npviSvNlaIQKF0pYAIVsd5hZflrJTMb13ZVAXqhsmDOEIW+zzYtzHgEoKnTLI5JB3G1zbnajN6D+4oVwk8k9Ze2BOwU9UPJtTVjaHPNyYjAlLm1I+kpYzByR2ZxODR6JXPDIIY5TsNXKkvEGbVDpQWuPCUp9WKqHLEb33EW7yh+tCi4dp00rCEGmKF5WtTpJnCjcYTGlNeL1nJ4uxu7RtweFYYg63RVc5p0GJSuS9hLXlecg5EgqTvL+XJEQGTu1sNBqv1yYWx5TQlKt5XLwGBTAg+KYeARiLnDqO3/cgUT93Tb6JWXwjyukmlO6t+LwLz52gZ0shpCeC/SIq5mgziyNluzMxPuwq5TSomWHNWSTmd8wSKxEGs1VEhRfruK4P1Q9vCjdFMlE+FyPJGhi1C9Ld0wT9dRZKjz1qOR9TP8oztBhQv5+Ft44G9Zj27kkMi++lDT5Dq+kT6Qi7mxtiC8icggN89RaK1/1ttZ1F2FSt5vJIjm8bh0n1fQoRP2WFokl0M1NtaJ/sTNBqAiFTkzGlyTcLU54hPX7688Xby1LHHEsltYrLI2nIO1FydwQNK2qSzJKfuUbzTVpFSUiH09PhtG1BiJCQXcxmHXW1dddqFf5A/LpZW/0chAiRQGX7I2MwppeXBfSIJQixQ0HyhaoXisnmTE2jqZf7w7X50/DOkSAeopjlaJhJMzlZLy8LNLojvLYHCWeqXtJUXzlhZ5pe7g9mik54J1DMtmJSxfMrRY24Ti8vF1VUooMQIefhuR0Iyb6Limu4uI4Gi1fyjmPwx/XSfoEbkkryuWIOpJDHM3uo6uml/mCGeJ2mTj8lhUIe5DG5RC/tF1hMLIcD/wpCBPvuUwa7Ry/1BxJvHTzjlTo/RflCx+wa/Jm6uvKGuXwgRAMTESCCS17fRNCVX8A19mQQIj3DnHprYbS9pP7hh4oTQVdfDGUHgpRCrXQvM1TfSgOg4kQQWnORI11Br7Q9lUZ0No4uYSr1QcWJNIebJ0LhF0FKIYk3lpvqIKpOO71l1GpKRsWJhEIdVa7F10JpoF4COU+nh267H/m1aHb17LJe45RStQISwaXKSLnKkr+UcjP0Om4cJ2PJVY7p3EHvfmeFZl2lVRaFG+MrKk4kGUmGpSk/ChpevUKbeG9aLPU9t+U6umezKGvkCdxBfMSNu/Nc252vopk4NURUy9MVJUJAh38UHjpYzn2dTkffs7ulLQ/j+++kq1Dw96OYnPeKmGhBOFNnL1r2SybCxzbVwkMflkMkX2i9RyxP6NTopTam7BMCfYvykpmsA88XzcuSiRBwXV2gLLWn1BArJkQO9/ljSPCO1LhZI7y9Kl+1LkGVMMRSxPuR/p5Mr5AeGHuCGfyllH3xRfVAEwklRyXH4LL1CuL3dCXCDMaehtGdbu2CsXoLDwNOhIAKE5EWX4/ELftlnbcO9xyE1KuO5dRo1RcwGESG0JcmJD8S82Vly0OUM8U2zBea2zD2dCtbbeBhHvG0FmBQTgTwyCycvHAkhsrHsOFOSLeO939sli/683PCVJuaY8z2tPmgpM5uqrKJXAIZdWfCgxsQKvux+Rkqpz3T8qVGkFGemOoDOSEzSS/3hWvyFTjps2TohXUFQvq9d1uW+oHH+H16af9Qn6gf7kbdBzhyByHzDUKHGtzZ3k17+wW897GIiFv0sssCBWUZdBwnx8AJpy4nPaGluipyIvmgibfFapkmDfkI5qxXuSk+ESb/Ft79EYZtScf4bfrRPiEjch5um6scm3WyOFvtL87qDAbatOUszSRUXC8dGIiaphudhHOrY4j6ZE2y//9pCoRQ6G8oxV0jL1garQAAAABJRU5ErkJggg==' vAppLogo = b'iVBORw0KGgoAAAANSUhEUgAAAEgAAABICAMAAABiM0N1AAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAzUExURQAAACCPjxiXhxuVihyXhx2WiRuXihuWiRyXiR2YixuYihyYihyYihyYihuYihyYihyYinvhKU4AAAAQdFJOUwAQIDBAUGBwgI+fr7/P3+8jGoKKAAAACXBIWXMAAA7DAAAOwwHHb6hkAAADHUlEQVRYR+2X25asIAxERfCCN/z/rz0VSBAEWvusNW+9H6btFiNJVYDpfvz4e9Q88+fS+4v/ZTvPHRHUep4H//Qlyv+dTuCm8aDP6fr9Pdqd69gZRwEEZ5RZ3Gl4yDuQSouVh7zD51LH8ZBXaH6oysvclDG9+ZAZ5DNaDzy6jcrqC459tXbdilyfbDXwOI/bJs2/d2qCpxKe5pRUx83BNErL22e+QzwF6nnceW6YjDLzHnI9LNW4X/wX4qnkMiM3UjZ5Zcjahq+fAoleDjM3e7i+OBAdnvfssXolGg0QcH2nLF9nWMwzTnNtzSoqj/lQv9fYVKpHvYUV3z3PsRkHkZI6tcwkkqAtq3kFcDcZWIXN6HRuyzvIO141CLdtpwq9PFxDtD87s9UmoYpQzC+MBUfPCc8ypYZqY3gjEq+uRgfeHyJhSlwlv/reiDrNiSoJFEfWhqEb/SdsWRogdlGf9aYQ4nDtlssqS3g6QQTHrlPJLItDucll2PYy+NYu4mF87LY8DjmaF6dKapL/ElcS+ImfvcdB+lz2aueGAtrYS2Q3/3QRB7qHQJXEQHCPTWfkny/jIFAQpCZ/14car5ciIdJaxkFqQWSYt0B8hO4OFyCW4BYHxebRkOaOmAfSXvJzpHucxCJtH0VFPFKnHBhSFsFyJYmjp2wRQaQiDvSUIXR4KuCevzXt5cqIkxK5qb7WhmbFsPoyEsEyIs3bwN8ll1W67QJvYmXq87mW2v7zUjt3PZca21wVWZEgaVxUSrC1iazwXBWRlHLPjx4J6HdeSkFNMxiA7wJo3ogEvWXT9kWoYuLDqGdqywurLlu5raka6s2jyNG3swhw6HbNv+66pVkgbuz0ttxP3n7x6P1hNp7rhGCpAIPlB91qEEbJVyrjZ5KjBglN9DjF+jSSMM8ntnxPw78RghrWJMxzaokHAvu6zNZufJSMtJRPGIwW7ers2gzmOY7nOttWeEoq45ZICpn1PR+atnVMqwPxtknlErpBDZs/OH+FN5zffN08+Uz9tqpeVvkO5KP1vafPr2pzR1n0OzH7DffHjz+l6/4Bmz911Xhw3/QAAAAASUVORK5CYII=' def add_to_log(text): if v_enable_logging: print('Timestamp '+str(docnow.strftime("%m-%d-%Y %H%M"))) print(str(docnow.strftime("%m-%d-%Y %H%M%S")) + ' : ' + text) logging.info(text) # Add your new theme colors and settings sg.LOOK_AND_FEEL_TABLE['Ally'] = {'BACKGROUND': '#FFFFFF', 'TEXT': '#000000', 'INPUT': '#FFF7F0', 'TEXT_INPUT': '#000000', 'SCROLL': '#FFF7F0', 'BUTTON': ('#FFFFFF' , '#8A3575'), 'PROGRESS': "#FFF7F0", 'SCROLL': '#FFF7F0', 'BORDER': 1, 'SLIDER_DEPTH':0, 'PROGRESS_DEPTH':0 } sg.ChangeLookAndFeel('Ally') column_input_padding = [[sg.Text('', size=vSzInput)]] column_button_padding = [[sg.Text('', size=vSzButton)]] column_icon_padding = [[sg.Text('', size=vSzIcon)]] column_input = [[sg.Text('Save Document here', size=(20, 1), justification='left'), sg.InputText(vDesktopPath), sg.FolderBrowse( size=(8,1))], [sg.Text('Process Name ', size=(20, 1), justification='left'),sg.InputText('')], [sg.Text('Process Description ', size=(20, 1), justification='left'), sg.MLine(default_text='', size=(45, 3),no_scrollbar = True)], [sg.Text('Systems Impacted ', size=(20, 1), justification='left'), sg.InputText(default_text='', size=(45, 3))]] column_button = [[sg.Button("Start", size =(8,1)), sg.Button("Pause",disabled=True, size =(8,1)), sg.Button("Continue",disabled=True, size =(8,1)), sg.Button("Stop",disabled=True, size =(8,1))]] column_ally_logo = [[sg.Image(data=vLogoOnScreen)]] #Preparing layout with input fields and button layout = [[ [ sg.Column(column_input_padding, element_justification='c' ), sg.Column(column_input, element_justification='l')], [sg.Column(column_button_padding, element_justification='c' ), sg.Column(column_button, element_justification='l')], [sg.Column(column_ally_logo, element_justification='l') ] ]] #Function to capture mouse Move def on_move(x, y): pass #Function to paste image 2(fg_img) on image 1(bg_img) # alpha represent opacity # Box represent position on Image 1 where image 2 will be added def trans_paste(fg_img,bg_img,alpha=1.0,box=(0,0)): fg_img_trans = Image.new("RGBA",fg_img.size) fg_img_trans = Image.blend(fg_img_trans,fg_img,alpha) bg_img.paste(fg_img_trans,box,fg_img_trans) return bg_img #Function to prepare word file with inputs provided by users def prepare_word_file(document,values): try: add_to_log('Started preparing word file in Current temaplet folder') document.add_heading('Process Name', level=1) document.add_paragraph(values[1]) #document.add_page_break() document.add_heading('Process Description', level=1) document.add_paragraph(values[2]) #document.add_page_break() document.add_heading('System Impacted', level=1) document.add_paragraph(values[3]) #document.add_page_break() document.add_heading('As-Is Process', level=1) document.add_paragraph('Process screenshot will be added below') except Exception as e: add_to_log(' Error while preparing Word file '+ str(e)) #Function to capture Screenshot and Add to word file def capture_and_save(x, y): add_to_log('Mouse Clicked ') myScreenshot = pyautogui.screenshot() now = datetime.now() timestamp = datetime.timestamp(now) path_to_save=vFilePath+r'/file_name'+str(timestamp)+'.png' path_to_save_bg=vFilePath+r'/file_name_bg'+str(timestamp)+'.png' path_to_save_fg=vFilePath+r'/file_name_fg'+str(timestamp)+'.png' myScreenshot.save(path_to_save) add_to_log('Screenshot Saved ') #path_to_save_ret = pii_DetectBlur_Image.main(path_to_save) path_to_save_ret = path_to_save bg_img = Image.open(path_to_save_ret) fg_img = Image.open('Mouse Icon.png') add_to_log('Screenshot Saved ') p = trans_paste(fg_img.convert('RGBA'),bg_img.convert('RGBA'),1,(x,y)) #p = p.crop((left, top, right, bottom)) p.save(path_to_save_bg) add_to_log('Image Saved ') document.add_picture(path_to_save_bg, width=Inches(6.25)) document.save(vFilePath+r'/'+vFilename) add_to_log('Image Added to file ') if os.path.exists(path_to_save): os.remove(path_to_save) if os.path.exists(path_to_save_ret): os.remove(path_to_save_ret) if os.path.exists(path_to_save_bg): os.remove(path_to_save_bg) add_to_log('Image deleted ') #Function to capture on click event and add it to screenshot def on_click(x, y, button, pressed): if pressed and vContinueProcessCapture: capture_and_save(x, y) #Function to skip scroll event( can be extended in Future) def on_scroll(x, y, dx, dy): pass #Create Window and add fetch input window = sg.Window(' ABC Doc - Automated Business process Capture and Documentation ', layout, default_element_size=(45, 22), grab_anywhere=False, icon = vAppLogo, progress_bar_color='red', font = vScreenTextFont, element_padding=5 ) #Create Base Documentcls try: document = Document() document.add_heading('Process Definition Document (PDD)', 0) docnow = datetime.now() doctimestamp = docnow.strftime("%m-%d-%Y %H%M") vFilename = vFilename+' '+ str(doctimestamp)+'.docx' vFilePrepared = False except Exception as e: add_to_log(' Error while getting date , time and preparing file name '+ str(e)) # Create window exists, fetch events on window while True: try: #Create Base Document event, values = window.read() vFilePath = values[0] add_to_log(str(values )) if vFilePrepared == False: add_to_log(' 3 ') prepare_word_file(document,values) add_to_log(' 4 ') vFilePrepared = True add_to_log(' 5 ') except Exception as e: add_to_log(' Error while Preparing window '+ str(e)) # Steps to be performed on Click "Start" if event == "Start": vContinueProcessCapture=True window.Minimize() add_to_log('Start Clicked') listener = mouse.Listener(on_move=on_move,on_click=on_click,on_scroll=on_scroll) listener.start() window.find_element("Pause").Update(disabled=False) window.find_element("Stop").Update(disabled=False) window.find_element("Start").Update(disabled=True) window.find_element("Continue").Update(disabled=True) window.Refresh() # Steps to be performed on Click "Stop or Window Closed" if event == "Stop" or event == sg.WIN_CLOSED: try: os.rename(vFilePath+r'/'+vFilename,vFinalFilenameStartWith+values[1]+r'/'+' '+str(doctimestamp)+'.docx') add_to_log('Stop Clicked')#listener.stop() break except: break if event == "Pause": vContinueProcessCapture=False add_to_log('Pause Clicked') window.find_element("Continue").Update(disabled=False) window.find_element("Pause").Update(disabled=True) window.Refresh() if event == "Continue": vContinueProcessCapture=True add_to_log('Continue Clicked') window.find_element("Continue").Update(disabled=True) window.find_element("Pause").Update(disabled=False) window.Refresh() window.close()

53.063745

2,471

0.736617

186abbbb52a54ec3c6aabd3c8a9e35ea862462d1

1,086

py

Python

examples/simple_example.py

ri-gilfanov/aiohttp-sqlalchemy

5324f753f76ea31424e5e5b95e4f92ca68b781f9

[ "MIT" ]

5

2021-04-14T15:08:59.000Z

2021-12-01T08:05:27.000Z

examples/simple_example.py

ri-gilfanov/aiohttp-sqlalchemy

5324f753f76ea31424e5e5b95e4f92ca68b781f9

[ "MIT" ]

5

2021-06-29T08:17:26.000Z

2021-07-12T08:17:33.000Z

examples/simple_example.py

ri-gilfanov/aiohttp-sqlalchemy

5324f753f76ea31424e5e5b95e4f92ca68b781f9

[ "MIT" ]

2

2021-06-07T23:23:08.000Z

2021-06-21T20:12:48.000Z

from datetime import datetime import sqlalchemy as sa from aiohttp import web from sqlalchemy import orm import aiohttp_sqlalchemy metadata = sa.MetaData() Base = orm.declarative_base(metadata=metadata) class MyModel(Base): __tablename__ = 'my_table' pk = sa.Column(sa.Integer, primary_key=True) timestamp = sa.Column(sa.DateTime(), default=datetime.now) async def main(request): sa_session = aiohttp_sqlalchemy.get_session(request) async with sa_session.begin(): sa_session.add(MyModel()) result = await sa_session.execute(sa.select(MyModel)) result = result.scalars() data = { instance.pk: instance.timestamp.isoformat() for instance in result } return web.json_response(data) async def app_factory(): app = web.Application() aiohttp_sqlalchemy.setup(app, [ aiohttp_sqlalchemy.bind('sqlite+aiosqlite:///'), ]) await aiohttp_sqlalchemy.init_db(app, metadata) app.add_routes([web.get('/', main)]) return app if __name__ == '__main__': web.run_app(app_factory())

22.163265

62

0.69337

053aabd5d2d7fdc51444b85991535ec5437c701f

964

py

Python

src/sentry/api/endpoints/organization_config_integrations.py

apragacz/sf-sentry

2fdd6c1195c29a1d401d1cd538c22ea68556699a

[ "BSD-3-Clause" ]

1

2021-04-04T07:26:13.000Z

src/sentry/api/endpoints/organization_config_integrations.py

pkaminski/sentry

27e948283e27d93ca5192ca7b580830e092c25c7

[ "BSD-3-Clause" ]

1

2018-08-22T16:49:48.000Z

src/sentry/api/endpoints/organization_config_integrations.py

pkaminski/sentry

27e948283e27d93ca5192ca7b580830e092c25c7

[ "BSD-3-Clause" ]

1

2018-07-02T09:46:44.000Z

from __future__ import absolute_import from rest_framework.response import Response from sentry import integrations from sentry.api.bases.organization import OrganizationEndpoint class OrganizationConfigIntegrationsEndpoint(OrganizationEndpoint): def get(self, request, organization): providers = [] for provider in integrations.all(): providers.append( { 'key': provider.key, 'name': provider.name, 'config': provider.get_config(), 'setupDialog': dict( url='/organizations/{}/integrations/{}/setup/'.format( organization.slug, provider.key, ), **provider.setup_dialog_config ) } ) return Response({ 'providers': providers, })

31.096774

78

0.51556

467b693f0eec7842205b50b0d4285f5205329cf9

908

py

Python

service-3/app.py

PhilipL1/project-2

e59890708585f5c99dfcdd15080c2411db935cbb

[ "Unlicense" ]

null

service-3/app.py

PhilipL1/project-2

e59890708585f5c99dfcdd15080c2411db935cbb

[ "Unlicense" ]

null

service-3/app.py

PhilipL1/project-2

e59890708585f5c99dfcdd15080c2411db935cbb

[ "Unlicense" ]

null

from flask import Flask,request import random from os import getenv import random import datetime import calendar app = Flask(__name__) app.config['SQLALCHEMY_DATABASE_URI'] = getenv("DATABASE_URI") @app.route('/get_day',methods=['GET']) def get_day(): start_date = datetime.date(2022, 6, 1) end_date = datetime.date(2022, 7, 1) time_between_dates = end_date - start_date days_between_dates = time_between_dates.days random_number_of_days = random.randrange(days_between_dates) random_date = start_date + datetime.timedelta(days=random_number_of_days) date = str(random_date) #print(date) day = datetime.datetime.strptime(date, '%Y-%m-%d').weekday() #print(day) answer_day = calendar.day_name[day] return_value =str(answer_day) + "("+str(date) + ")" return return_value if __name__ == "__main__": app.run(host="0.0.0.0", port=5000, debug=True)

28.375

77

0.714758

b64297c8889d3169b9cc4ede4d3352e12f403ed2

5,585

py

Python

rutypograph/rule.py

nanopony/rutypograph

c7b02c3d39dedffca403a486c93410320bd204ef

[ "MIT" ]

null

rutypograph/rule.py

nanopony/rutypograph

c7b02c3d39dedffca403a486c93410320bd204ef

[ "MIT" ]

null

rutypograph/rule.py

nanopony/rutypograph

c7b02c3d39dedffca403a486c93410320bd204ef

[ "MIT" ]

null

import logging import re import sys from typing import Dict, Union, Callable, Match from typing import List from typing import Tuple from .environment import TypographEnvironment logger = logging.getLogger(__name__) def compile_pcre_pattern(pattern, additional_flags=0): """ Compiles Perl Compatible Regular Expressions into python (parses /.../keys ) :param additional_flags: :param pattern: :return: """ try: if pattern[0] != '/': return re.compile(pattern, additional_flags) parts = pattern.split('/') modifiers = parts[-1] newpattern = pattern[1:-1 - len(modifiers)] flags_lut = {'i': re.I, 's': re.S, 'm': re.M, 'u': re.U} flags = re.U for i in modifiers: if i in flags_lut: flags |= flags_lut[i] flags |= additional_flags return re.compile(newpattern, flags) except Exception as e: raise type(e)(str(e) + "\nFailed pattern: %s, %s" % (pattern, newpattern)) \ .with_traceback(sys.exc_info()[2]) class Rule: # pylint: disable=too-few-public-methods """ Base class for a rule of text conversion """ def __init__(self) -> None: self.rule_id = "N/A" self.disabled = False self.debug = False self.description = "" self.doctests = [] # type: List[Tuple[str, str]] def apply(self, text: str, environment: TypographEnvironment) -> str: """ apply specific rule to text with environment :param text: :param environment: :return: """ return text def __str__(self): return '[%s] %s' % (self.rule_id, self.description) def __repr__(self): return self.__str__() class RuleRegex(Rule): # pylint: disable=too-few-public-methods, too-many-instance-attributes def __init__(self, patterns: Union[List[str], str], replacements: List[Union[str, Callable[[Match[str], TypographEnvironment], str]]] = None, pcre_keys=0, cycled=False) -> None: """ Set of Regex rules of text transformation :param patterns: Search pattern :param replacements: Replace pattern :param pcre_keys: PCRE-compatible regex keys :param cycled: Run multiple passes until the string is unchanged """ super().__init__() if not isinstance(patterns, list): patterns = [patterns] if not isinstance(replacements, list): replacements = [replacements] self.compiled_patterns = [compile_pcre_pattern(pattern, pcre_keys) for pattern in patterns] if len(replacements) == 1: self.replacements = replacements * len(patterns) elif len(replacements) == len(patterns): self.replacements = replacements else: raise ValueError("Number of patterns and replacements dont match!") self.cycled = cycled def apply(self, text: str, environment: TypographEnvironment) -> str: for pattern, replacement in zip(self.compiled_patterns, self.replacements): while True: text_dry = text if callable(replacement): text_wet = pattern.sub(lambda match: replacement(match, environment), text_dry) # pylint: disable=cell-var-from-loop else: text_wet = pattern.sub(replacement, text_dry) logger.debug("pattern: %s || dry: %s || result: %s", pattern, text_dry , text_wet) text = text_wet if not self.cycled: break if text_dry == text: break return text class RuleFunction(Rule): # pylint: disable=too-few-public-methods """ Rule for pass text through function """ def __init__(self, fn) -> None: super().__init__() self.fn = fn def apply(self, text: str, environment: TypographEnvironment) -> str: return self.fn(text, environment) class RuleReplace(RuleRegex): # pylint: disable=too-few-public-methods """ simple replace rule """ def __init__(self, pattern, replacement, icase) -> None: """ :param pattern: search pattern :param replacement: replacement pattern :param icase: ignore case """ super().__init__(re.escape(pattern), replacement, re.IGNORECASE if icase else 0) def _ruledef_to_rule(ruledef) -> Rule: fn = ruledef.get('function', None) if fn is not None: # @todo check signature return RuleFunction(fn) elif ruledef.get('simple_replace'): icase = ruledef.get('case_sensitive', False) return RuleReplace(ruledef['pattern'], ruledef['replacement'], icase) cycled = ruledef.get('cycled', False) return RuleRegex(ruledef['pattern'], ruledef['replacement'], cycled=cycled) def _parse_ruledef(ruledef) -> Rule: """ :param ruledef: dict, in a format comatible with mdash's own definitions :return: Rule """ rule = _ruledef_to_rule(ruledef) if rule is not None: rule.rule_id = ruledef.get('rule_id', 'N/A') rule.disabled = ruledef.get('disabled', False) rule.description = ruledef.get('description', '-') rule.debug = ruledef.get('debug', False) rule.doctests = ruledef.get('doctests', []) return rule def convert_ruledefs_to_rules(ruledefs: List[Dict]) -> List[Rule]: rules = [_parse_ruledef(ruledef) for ruledef in ruledefs] return rules

31.027778

137

0.610743

7b330f58c85ab3d35d646dca4622c0e89854faf8

391

bzl

Python

tools/build_defs/shell_toolchain/toolchains/function_and_call.bzl

slsyy/rules_foreign_cc

34ab7f86a3ab1b2381cb4820d08a1c892f55bf54

[ "Apache-2.0" ]

2

2021-03-18T04:14:56.000Z

2021-03-18T05:11:09.000Z

tools/build_defs/shell_toolchain/toolchains/function_and_call.bzl

slsyy/rules_foreign_cc

34ab7f86a3ab1b2381cb4820d08a1c892f55bf54

[ "Apache-2.0" ]

null

tools/build_defs/shell_toolchain/toolchains/function_and_call.bzl

slsyy/rules_foreign_cc

34ab7f86a3ab1b2381cb4820d08a1c892f55bf54

[ "Apache-2.0" ]

1

2021-03-01T17:51:22.000Z

# buildifier: disable=module-docstring # buildifier: disable=name-conventions FunctionAndCall = provider( doc = "Wrapper to pass function definition and (if custom) function call", fields = { "call": "How to call defined function, if different from <function-name> <arg1> ...<argn>", "text": "Function body, without wrapping function <name>() {} fragment.", }, )

39.1

99

0.675192

fc5a5e1186141eea8bc2e301d3cef9461b9ce8f9

124

py

Python

29_Comparison_Operator/main.py

jmmedel/Python-Tutorials-

243ae9a6b51a4fce03dd90c02da13b859cbfbe5f

[ "MIT" ]

null

29_Comparison_Operator/main.py

jmmedel/Python-Tutorials-

243ae9a6b51a4fce03dd90c02da13b859cbfbe5f

[ "MIT" ]

null

29_Comparison_Operator/main.py

jmmedel/Python-Tutorials-

243ae9a6b51a4fce03dd90c02da13b859cbfbe5f

[ "MIT" ]

null

#Operator Name Example # == Equal x == y x = 5 y = 3 print(x == y) # false x = 3 y = 3 print(x == y ) # true

10.333333

24

0.459677

6abdff12170dcfc180bbe59be8cb5158d9b760f7

30,223

py

Python

nuitka/MainControl.py

leojay/Nuitka

131aaca9b858279233dd60f546d0eb8e37c3828f

[ "Apache-2.0" ]

null

nuitka/MainControl.py

leojay/Nuitka

131aaca9b858279233dd60f546d0eb8e37c3828f

[ "Apache-2.0" ]

null

nuitka/MainControl.py

leojay/Nuitka

131aaca9b858279233dd60f546d0eb8e37c3828f

[ "Apache-2.0" ]

null

# Copyright 2018, Kay Hayen, mailto:kay.hayen@gmail.com # # Part of "Nuitka", an optimizing Python compiler that is compatible and # integrates with CPython, but also works on its own. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # """ This is the main actions of Nuitka. This can do all the steps to translate one module to a target language using the Python C/API, to compile it to either an executable or an extension module, potentially with bytecode included and used library copied into a distribution folder. """ import os import shutil import subprocess import sys from logging import info, warning from nuitka.finalizations.FinalizeMarkups import getImportedNames from nuitka.importing import Importing, Recursion from nuitka.Options import getPythonFlags from nuitka.plugins.Plugins import Plugins from nuitka.PythonVersions import ( getPythonABI, getSupportedPythonVersions, isUninstalledPython, python_version, python_version_str ) from nuitka.tree import SyntaxErrors from nuitka.utils import Execution, InstanceCounters, MemoryUsage, Utils from nuitka.utils.AppDirs import getCacheDir from nuitka.utils.FileOperations import ( deleteFile, hasFilenameExtension, listDir, makePath, removeDirectory ) from . import ModuleRegistry, Options, TreeXML from .build import SconsInterface from .codegen import CodeGeneration, ConstantCodes, Reports from .finalizations import Finalization from .freezer.BytecodeModuleFreezer import generateBytecodeFrozenCode from .freezer.Standalone import copyUsedDLLs, detectEarlyImports from .optimizations import Optimization from .tree import Building def createNodeTree(filename): """ Create a node tree. Turn that source code into a node tree structure. If recursion into imported modules is available, more trees will be available during optimization, or immediately through recursed directory paths. """ # First, build the raw node tree from the source code. main_module = Building.buildModuleTree( filename = filename, package = None, is_top = True, is_main = not Options.shallMakeModule() ) ModuleRegistry.addRootModule(main_module) # First remove old object files and old generated files, old binary or # module, and standalone mode program directory if any, they can only do # harm. source_dir = getSourceDirectoryPath(main_module) if not Options.shallOnlyExecCCompilerCall(): cleanSourceDirectory(source_dir) # Prepare the ".dist" directory, throwing away what was there before. if Options.isStandaloneMode(): standalone_dir = getStandaloneDirectoryPath(main_module) removeDirectory( path = standalone_dir, ignore_errors = True ) makePath(standalone_dir) deleteFile( path = getResultFullpath(main_module), must_exist = False ) # Second, do it for the directories given. for plugin_filename in Options.getShallFollowExtra(): Recursion.checkPluginPath( plugin_filename = plugin_filename, module_package = None ) for pattern in Options.getShallFollowExtraFilePatterns(): Recursion.checkPluginFilenamePattern( pattern = pattern ) for package_name in Options.getMustIncludePackages(): package_package, package_directory, kind = Importing.findModule( importing = None, module_name = package_name, parent_package = None, level = 0, warn = False ) if kind != "absolute": sys.exit("Error, failed to locate package %r." % package_name) Recursion.checkPluginPath( plugin_filename = package_directory, module_package = package_package ) for module_name in Options.getMustIncludeModules(): module_package, module_filename, kind = Importing.findModule( importing = None, module_name = module_name, parent_package = None, level = 0, warn = False ) if kind != "absolute": sys.exit("Error, failed to locate module %r." % module_name) Recursion.checkPluginSinglePath( plugin_filename = module_filename, module_package = module_package ) # Then optimize the tree and potentially recursed modules. Optimization.optimize(main_module.getOutputFilename()) if Options.isExperimental("check_xml_persistence"): for module in ModuleRegistry.getRootModules(): if module.isMainModule(): return module assert False else: # Main module might change behind our back, look it up again. return main_module def dumpTreeXML(tree): xml_root = tree.asXml() TreeXML.dump(xml_root) def getTreeFilenameWithSuffix(tree, suffix): return tree.getOutputFilename() + suffix def getSourceDirectoryPath(main_module): assert main_module.isCompiledPythonModule() return Options.getOutputPath( path = os.path.basename( getTreeFilenameWithSuffix(main_module, ".build") ) ) def getStandaloneDirectoryPath(main_module): return Options.getOutputPath( path = os.path.basename( getTreeFilenameWithSuffix(main_module, ".dist") ) ) def getResultBasepath(main_module): assert main_module.isCompiledPythonModule() if Options.isStandaloneMode(): return os.path.join( getStandaloneDirectoryPath(main_module), os.path.basename( getTreeFilenameWithSuffix(main_module, "") ) ) else: return Options.getOutputPath( path = os.path.basename( getTreeFilenameWithSuffix(main_module, "") ) ) def getResultFullpath(main_module): """ Get the final output binary result full path. """ result = getResultBasepath(main_module) if Options.shallMakeModule(): result += Utils.getSharedLibrarySuffix() else: if Options.getOutputFilename() is not None: result = Options.getOutputFilename() elif Utils.getOS() == "Windows": result += ".exe" elif not Options.isStandaloneMode(): result += ".bin" return result def cleanSourceDirectory(source_dir): extensions = ( ".bin", ".c", ".cpp", ".exp", ".h", ".lib", ".manifest", ".o", ".obj", ".os", ".rc", ".res", ".S", ".txt" ) if os.path.isdir(source_dir): for path, _filename in listDir(source_dir): if hasFilenameExtension(path, extensions): deleteFile(path, must_exist = True) else: makePath(source_dir) def pickSourceFilenames(source_dir, modules): collision_filenames = set() seen_filenames = set() # Our output. module_filenames = {} def getFilenames(module): base_filename = os.path.join( source_dir, "module." + module.getFullName() if not module.isInternalModule() else module.getFullName() ) # Note: Could detect if the file system is cases sensitive in source_dir # or not, but that's probably not worth the effort. False positives do # no harm at all. collision_filename = os.path.normcase(base_filename) return base_filename, collision_filename # First pass, check for collisions. for module in modules: if module.isPythonShlibModule(): continue base_filename = base_filename, collision_filename = getFilenames(module) if collision_filename in seen_filenames: collision_filenames.add(collision_filename) seen_filenames.add(collision_filename) # Count up for colliding filenames. collision_counts = {} # Second pass, this time sorted, so we get deterministic results. We will # apply an @1/@2 to disambiguate the filenames. for module in sorted(modules, key = lambda x : x.getFullName()): if module.isPythonShlibModule(): continue base_filename = base_filename, collision_filename = getFilenames(module) if collision_filename in collision_filenames: collision_counts[ collision_filename ] = \ collision_counts.get(collision_filename, 0) + 1 hash_suffix = "@%d" % collision_counts[ collision_filename ] else: hash_suffix = "" base_filename += hash_suffix module_filenames[module] = base_filename + ".c" return module_filenames standalone_entry_points = [] def makeSourceDirectory(main_module): """ Get the full list of modules imported, create code for all of them. """ # We deal with a lot of details here, but rather one by one, and split makes # no sense, pylint: disable=too-many-branches,too-many-locals,too-many-statements assert main_module.isCompiledPythonModule() # The global context used to generate code. global_context = CodeGeneration.makeGlobalContext() # assert main_module in ModuleRegistry.getDoneModules() # We might have chosen to include it as bytecode, and only compiled it for # fun, and to find its imports. In this case, now we just can drop it. Or # a module may shadow a frozen module, but be a different one, then we can # drop the frozen one. # TODO: This really should be done when the compiled module comes into # existence. for module in ModuleRegistry.getDoneUserModules(): if module.isCompiledPythonModule(): uncompiled_module = ModuleRegistry.getUncompiledModule( module_name = module.getFullName(), module_filename = module.getCompileTimeFilename() ) if uncompiled_module is not None: # We now need to decide which one to keep, compiled or uncompiled # module. Some uncompiled modules may have been asked by the user # or technically required. By default, frozen code if it exists # is preferred, as it will be from standalone mode adding it. if uncompiled_module.isUserProvided() or \ uncompiled_module.isTechnical(): ModuleRegistry.removeDoneModule(module) else: ModuleRegistry.removeUncompiledModule(uncompiled_module) # Lets check if the recurse-to modules are actually present, and warn the # user if one of those was not found. for any_case_module in Options.getShallFollowModules(): if '*' in any_case_module or '{' in any_case_module: continue for module in ModuleRegistry.getDoneUserModules(): if module.getFullName() == any_case_module: break else: warning( "Didn't recurse to '%s', apparently not used." % \ any_case_module ) # Prepare code generation, i.e. execute finalization for it. for module in ModuleRegistry.getDoneModules(): if module.isCompiledPythonModule(): Finalization.prepareCodeGeneration(module) # Pick filenames. source_dir = getSourceDirectoryPath(main_module) module_filenames = pickSourceFilenames( source_dir = source_dir, modules = ModuleRegistry.getDoneModules() ) # First pass, generate code and use constants doing so, but prepare the # final code generation only, because constants code will be added at the # end only. prepared_modules = {} for module in ModuleRegistry.getDoneModules(): if module.isCompiledPythonModule(): c_filename = module_filenames[module] prepared_modules[c_filename] = CodeGeneration.prepareModuleCode( global_context = global_context, module = module, module_name = module.getFullName(), ) # Main code constants need to be allocated already too. if module is main_module and not Options.shallMakeModule(): prepared_modules[c_filename][1].getConstantCode(0) # Second pass, generate the actual module code into the files. for module in ModuleRegistry.getDoneModules(): if module.isCompiledPythonModule(): c_filename = module_filenames[module] template_values, module_context = prepared_modules[c_filename] source_code = CodeGeneration.generateModuleCode( module_context = module_context, template_values = template_values ) writeSourceCode( filename = c_filename, source_code = source_code ) if Options.isShowInclusion(): info("Included compiled module '%s'." % module.getFullName()) elif module.isPythonShlibModule(): target_filename = os.path.join( getStandaloneDirectoryPath(main_module), *module.getFullName().split('.') ) if Utils.getOS() == "Windows": target_filename += ".pyd" else: target_filename += ".so" target_dir = os.path.dirname(target_filename) if not os.path.isdir(target_dir): makePath(target_dir) shutil.copyfile( module.getFilename(), target_filename ) standalone_entry_points.append( ( module.getFilename(), target_filename, module.getPackage() ) ) elif module.isUncompiledPythonModule(): pass else: assert False, module writeSourceCode( filename = os.path.join( source_dir, "__constants.c" ), source_code = ConstantCodes.getConstantsDefinitionCode( context = global_context ) ) helper_decl_code, helper_impl_code = CodeGeneration.generateHelpersCode( ModuleRegistry.getDoneUserModules() ) writeSourceCode( filename = os.path.join( source_dir, "__helpers.h" ), source_code = helper_decl_code ) writeSourceCode( filename = os.path.join( source_dir, "__helpers.c" ), source_code = helper_impl_code ) def _asBoolStr(value): return "true" if value else "false" def runScons(main_module, quiet): # Scons gets transported many details, that we express as variables, and # have checks for them, leading to many branches and statements, # pylint: disable=too-many-branches,too-many-statements options = { "name" : os.path.basename( getTreeFilenameWithSuffix(main_module, "") ), "result_name" : getResultBasepath(main_module), "source_dir" : getSourceDirectoryPath(main_module), "debug_mode" : _asBoolStr(Options.isDebug()), "python_debug" : _asBoolStr(Options.isPythonDebug()), "unstripped_mode" : _asBoolStr(Options.isUnstripped()), "module_mode" : _asBoolStr(Options.shallMakeModule()), "full_compat" : _asBoolStr(Options.isFullCompat()), "experimental" : ','.join(Options.getExperimentalIndications()), "trace_mode" : _asBoolStr(Options.shallTraceExecution()), "python_version" : python_version_str, "target_arch" : Utils.getArchitecture(), "python_prefix" : sys.prefix, "nuitka_src" : SconsInterface.getSconsDataPath(), "nuitka_cache" : getCacheDir(), "module_count" : "%d" % ( 1 + \ len(ModuleRegistry.getDoneUserModules()) + \ len(ModuleRegistry.getUncompiledNonTechnicalModules()) ) } if not Options.shallMakeModule(): options["result_exe"] = getResultFullpath(main_module) # Ask Scons to cache on Windows, except where the directory is thrown # away. On non-Windows you can should use ccache instead. if not Options.isRemoveBuildDir() and Utils.getOS() == "Windows": options["cache_mode"] = "true" if Options.isLto(): options["lto_mode"] = "true" if Options.shallDisableConsoleWindow(): options["win_disable_console"] = "true" if Options.isStandaloneMode(): options["standalone_mode"] = "true" if not Options.isStandaloneMode() and \ not Options.shallMakeModule() and \ isUninstalledPython(): options["uninstalled_python"] = "true" if ModuleRegistry.getUncompiledTechnicalModules(): options["frozen_modules"] = str( len(ModuleRegistry.getUncompiledTechnicalModules()) ) if Options.isShowScons(): options["show_scons"] = "true" if Options.isMingw64(): options["mingw_mode"] = "true" if Options.getMsvcVersion(): msvc_version = Options.getMsvcVersion() msvc_version = msvc_version.replace("exp", "Exp") if '.' not in msvc_version: msvc_version += ".0" options["msvc_version"] = msvc_version if Options.isClang(): options["clang_mode"] = "true" if Options.getIconPath(): options["icon_path"] = Options.getIconPath() if Options.isProfile(): options["profile_mode"] = "true" if "no_warnings" in getPythonFlags(): options["no_python_warnings"] = "true" if python_version < 300 and sys.flags.py3k_warning: options["python_sysflag_py3k_warning"] = "true" if python_version < 300 and (sys.flags.division_warning or sys.flags.py3k_warning): options["python_sysflag_division_warning"] = "true" if sys.flags.bytes_warning: options["python_sysflag_bytes_warning"] = "true" if int(os.environ.get("NUITKA_SITE_FLAG", "no_site" in Options.getPythonFlags())): options["python_sysflag_no_site"] = "true" if "trace_imports" in Options.getPythonFlags(): options["python_sysflag_verbose"] = "true" if python_version < 300 and sys.flags.unicode: options["python_sysflag_unicode"] = "true" if python_version >= 370 and sys.flags.utf8_mode: options["python_sysflag_utf8"] = "true" abiflags = getPythonABI() if abiflags: options["abiflags"] = abiflags return SconsInterface.runScons(options, quiet), options def writeSourceCode(filename, source_code): # Prevent accidental overwriting. When this happens the collision detection # or something else has failed. assert not os.path.isfile(filename), filename if python_version >= 300: with open(filename, "wb") as output_file: output_file.write(source_code.encode("latin1")) else: with open(filename, 'w') as output_file: output_file.write(source_code) def writeBinaryData(filename, binary_data): # Prevent accidental overwriting. When this happens the collision detection # or something else has failed. assert not os.path.isfile(filename), filename assert type(binary_data) is bytes with open(filename, "wb") as output_file: output_file.write(binary_data) def callExecPython(args, clean_path, add_path): old_python_path = os.environ.get("PYTHONPATH", None) if clean_path and old_python_path is not None: os.environ["PYTHONPATH"] = "" if add_path: if "PYTHONPATH" in os.environ: os.environ["PYTHONPATH"] += ':' + Options.getOutputDir() else: os.environ["PYTHONPATH"] = Options.getOutputDir() # We better flush these, "os.execl" won't do it anymore. sys.stdout.flush() sys.stderr.flush() # Add the main arguments, previous separated. args += Options.getPositionalArgs()[1:] + Options.getMainArgs() Execution.callExec(args) def executeMain(binary_filename, clean_path): args = (binary_filename, binary_filename) if Options.shallRunInDebugger(): gdb_path = Execution.getExecutablePath("gdb") if gdb_path is None: sys.exit("Error, no 'gdb' binary found in path.") args = (gdb_path, "gdb", "-ex=run", "-ex=where", "--args", binary_filename) callExecPython( clean_path = clean_path, add_path = False, args = args ) def executeModule(tree, clean_path): python_command = "__import__('%s')" % tree.getName() args = ( sys.executable, "python", "-c", python_command, ) callExecPython( clean_path = clean_path, add_path = True, args = args ) def compileTree(main_module): source_dir = getSourceDirectoryPath(main_module) if not Options.shallOnlyExecCCompilerCall(): # Now build the target language code for the whole tree. makeSourceDirectory( main_module = main_module ) frozen_code = generateBytecodeFrozenCode() if frozen_code is not None: writeSourceCode( filename = os.path.join( source_dir, "__frozen.c" ), source_code = frozen_code ) writeBinaryData( filename = os.path.join( source_dir, "__constants.bin" ), binary_data = ConstantCodes.stream_data.getBytes() ) else: source_dir = getSourceDirectoryPath(main_module) if not os.path.isfile(os.path.join(source_dir, "__helpers.h")): sys.exit("Error, no previous build directory exists.") if Options.isShowProgress() or Options.isShowMemory(): info( "Total memory usage before running scons: {memory}:".format( memory = MemoryUsage.getHumanReadableProcessMemoryUsage() ) ) if Options.isShowMemory(): InstanceCounters.printStats() if Options.isDebug(): Reports.doMissingOptimizationReport() if Options.shallNotDoExecCCompilerCall(): return True, {} # Run the Scons to build things. result, options = runScons( main_module = main_module, quiet = not Options.isShowScons() ) return result, options def handleSyntaxError(e): # Syntax or indentation errors, output them to the user and abort. If # we are not in full compat, and user has not specified the Python # versions he wants, tell him about the potential version problem. error_message = SyntaxErrors.formatOutput(e) if not Options.isFullCompat(): if python_version < 300: suggested_python_version_str = getSupportedPythonVersions()[-1] else: suggested_python_version_str = "2.7" error_message += """ Nuitka is very syntax compatible with standard Python. It is currently running with Python version '%s', you might want to specify more clearly with the use of the precise Python interpreter binary and '-m nuitka', e.g. use this 'python%s -m nuitka' option, if that's not the one the program expects. """ % (python_version_str, suggested_python_version_str) sys.exit(error_message) data_files = [] def main(): """ Main program flow of Nuitka At this point, options will be parsed already, Nuitka will be executing in the desired version of Python with desired flags, and we just get to execute the task assigned. We might be asked to only re-compile generated C, dump only an XML representation of the internal node tree after optimization, etc. """ # Main has to fulfill many options, leading to many branches and statements # to deal with them. pylint: disable=too-many-branches filename = Options.getPositionalArgs()[0] # Inform the importing layer about the main script directory, so it can use # it when attempting to follow imports. Importing.setMainScriptDirectory( main_dir = os.path.dirname(os.path.abspath(filename)) ) # Detect to be frozen modules if any, so we can consider to not recurse # to them. if Options.isStandaloneMode(): for module in detectEarlyImports(): ModuleRegistry.addUncompiledModule(module) if module.getName() == "site": origin_prefix_filename = os.path.join( os.path.dirname(module.getCompileTimeFilename()), "orig-prefix.txt" ) if os.path.isfile(origin_prefix_filename): data_files.append( (filename, "orig-prefix.txt") ) # Turn that source code into a node tree structure. try: main_module = createNodeTree( filename = filename ) except (SyntaxError, IndentationError) as e: handleSyntaxError(e) if Options.shallDumpBuiltTreeXML(): # XML output only. for module in ModuleRegistry.getDoneModules(): dumpTreeXML(module) else: # Make the actual compilation. result, options = compileTree( main_module = main_module ) # Exit if compilation failed. if not result: sys.exit(1) if Options.shallNotDoExecCCompilerCall(): if Options.isShowMemory(): MemoryUsage.showMemoryTrace() sys.exit(0) if Options.isStandaloneMode(): binary_filename = options["result_exe"] standalone_entry_points.insert( 0, (binary_filename, binary_filename, None) ) dist_dir = getStandaloneDirectoryPath(main_module) for module in ModuleRegistry.getDoneUserModules(): standalone_entry_points.extend( Plugins.considerExtraDlls(dist_dir, module) ) for module in ModuleRegistry.getUncompiledModules(): standalone_entry_points.extend( Plugins.considerExtraDlls(dist_dir, module) ) copyUsedDLLs( source_dir = getSourceDirectoryPath(main_module), dist_dir = dist_dir, standalone_entry_points = standalone_entry_points ) for module in ModuleRegistry.getDoneModules(): data_files.extend( Plugins.considerDataFiles(module) ) for source_filename, target_filename in data_files: target_filename = os.path.join( getStandaloneDirectoryPath(main_module), target_filename ) makePath(os.path.dirname(target_filename)) shutil.copy2( source_filename, target_filename ) # Remove the source directory (now build directory too) if asked to. if Options.isRemoveBuildDir(): removeDirectory( path = getSourceDirectoryPath(main_module), ignore_errors = False ) # Modules should not be executable, but Scons creates them like it, fix # it up here. TODO: Move inside scons file and avoid subprocess call. if Utils.getOS() != "Windows" and Options.shallMakeModule(): subprocess.call( ( "chmod", "-x", getResultFullpath(main_module) ) ) if Options.shallMakeModule() and Options.shallCreatePyiFile(): pyi_filename = getResultBasepath(main_module) + ".pyi" with open(pyi_filename, 'w') as pyi_file: pyi_file.write( """\ # This file was generated by Nuitka and describes the types of the # created shared library. # At this time it lists only the imports made and can be used by the # tools that bundle libraries, including Nuitka itself. For instance # standalone mode usage of the created library will need it. # In the future, this will also contain type information for values # in the module, so IDEs will use this. Therefore please include it # when you make software releases of the extension module that it # describes. %(imports)s # This is not Python source even if it looks so. Make it clear for # now. This was decided by PEP 484 designers. __name__ = ... """ % { "imports" : '\n'.join( "import %s" % module_name for module_name in getImportedNames() ) } ) # Execute the module immediately if option was given. if Options.shallExecuteImmediately(): if Options.shallMakeModule(): executeModule( tree = main_module, clean_path = Options.shallClearPythonPathEnvironment() ) else: executeMain( binary_filename = getResultFullpath(main_module), clean_path = Options.shallClearPythonPathEnvironment() )

32.497849

87

0.625881

75fd85527ec7798b7a07ac20d1a5b91cbfab1b46

14,090

py

Python

NLI_task/roberta_large_nli_LF.py

jizhi-zhang/Counterfactual_Reasoning_Model

3c4eb3e022e66e8626facc6fc772141a0079b807

[ "MIT" ]

7

2021-07-21T07:11:56.000Z

2022-01-10T13:01:14.000Z

NLI_task/roberta_large_nli_LF.py

jizhi-zhang/Counterfactual_Reasoning_Model

3c4eb3e022e66e8626facc6fc772141a0079b807

[ "MIT" ]

1

2021-07-28T08:58:49.000Z

2021-08-02T08:04:03.000Z

NLI_task/roberta_large_nli_LF.py

jizhi-zhang/Counterfactual_Reasoning_Model

3c4eb3e022e66e8626facc6fc772141a0079b807

[ "MIT" ]

1

2021-07-30T13:52:52.000Z

from transformers import AutoTokenizer # from transformers import AutoTokenizer, AutoModelForSequenceClassification import torch #from pytorch_pretrained_bert import BertTokenizer, BertModel from transformers import BertModel,BertTokenizer, BertForSequenceClassification, AdamW, get_linear_schedule_with_warmup import argparse import numpy as np import sys import torch.optim as optim from torch import nn import pandas as pd import numpy as np from sklearn.metrics import accuracy_score from collections import namedtuple from tqdm import tqdm import os import torch.nn as nn import matplotlib.pyplot as plt import random import copy parser = argparse.ArgumentParser() parser.add_argument("--device", type= int, default= 0) parser.add_argument("--train_file", type =str, default= "./dataset/NLI/all_combined/train.tsv") parser.add_argument("--val_file", type =str, default= "./dataset/NLI/all_combined/dev.tsv") parser.add_argument("--test_file", type=str, default= "./dataset/NLI/all_combined/test.tsv") parser.add_argument("--orig_train_file", type =str, default= "./dataset/NLI/original/train.tsv") parser.add_argument("--orig_val_file", type =str, default= "./dataset/NLI/original/dev.tsv") parser.add_argument("--orig_test_file", type=str, default= "./dataset/NLI/original/test.tsv") parser.add_argument("--revised_train_file", type =str, default= "./dataset/NLI/revised_combined/train.tsv") parser.add_argument("--revised_val_file", type =str, default= "./dataset/NLI/revised_combined/dev.tsv") parser.add_argument("--revised_test_file", type=str, default= "./dataset/NLI/revised_combined/test.tsv") parser.add_argument("--lr", type=float, default= 1e-3) parser.add_argument("--batchsize", type=int , default= 8) parser.add_argument("--epochs", type=int , default= 20) parser.add_argument("--run_seed", type = int, default= 4) parser.add_argument("--save_folder", type=str, default ="./NLI_tasks/roberta_large_nli_EF/") parser.add_argument("--log_name", type= str, default= "cf_inference_out.log") parser.add_argument("--plot_name", type = str, default= "result_plot.jpg") parser.add_argument("--cf_model_folder", type = str, default="./NLI_tasks/roberta_large_nli_cf/") args = parser.parse_args() device = torch.device("cuda:"+str(args.device)) tokenizer = AutoTokenizer.from_pretrained("roberta-large-mnli") class cf_conv_linear_net (nn.Module): def __init__(self, hidde_channels): super().__init__() self.conv1 = nn.Conv2d(1, hidde_channels, (3,1)) self.fc = nn.Linear(hidde_channels * 3, 3) def forward(self, x): out = torch.flatten(self.conv1(x), start_dim= 1) return self.fc(out) def get_label(text): if text == "neutral": return 1 elif text == "contradiction": return 0 elif text == "entailment": return 2 def create_batch_with_delta_cf(orig_data, cf_data, batchsize, model, tokenizer): model.eval() with torch.no_grad(): count = 0 batch_list = [] data_indexs = [i for i in range(len(orig_data))] random.shuffle(data_indexs) for index in tqdm(data_indexs): if count == 0: label =torch.stack([torch.tensor(get_label(orig_data["gold_label"][index]))]) sent_list = [(orig_data["sentence1"][index],orig_data['sentence2'][index])] for i in range(4*index, 4 * index + 4): sent_list.append((cf_data["sentence1"][i],cf_data['sentence2'][i])) delta_embed, output =calc_cf_sent_list(sent_list, model, tokenizer) delta_embed_list = [delta_embed] output = torch.cat(output) output_list = [output] count = count + 1 else: # label =torch.stack([torch.tensor(get_label(orig_data["gold_label"][index]))]) sent_list = [(orig_data["sentence1"][index],orig_data['sentence2'][index])] for i in range(4*index, 4 * index + 4): sent_list.append((cf_data["sentence1"][i],cf_data['sentence2'][i])) delta_embed, output =calc_cf_sent_list(sent_list, model, tokenizer) delta_embed_list.append(delta_embed) output = torch.cat(output) output_list.append(output) label = torch.cat([label, torch.stack([torch.tensor(get_label(orig_data["gold_label"][index]))])]) count = count + 1 if count == batchsize: count = 0 # embed_list = torch.stack([torch.stack([j]) for j in embed_list]) batch_list.append((label, delta_embed_list, output_list)) if count != 0: # embed_list = torch.stack([torch.stack([j]) for j in embed_list]) batch_list.append((label, delta_embed_list, output_list)) return batch_list def calc_cf_sent_list(sent_list, model, tokenizer): model.eval() with torch.no_grad(): real_out = model(**tokenizer(sent_list[:1], padding=True, truncation=True, max_length=512, return_tensors='pt' ).to(device)).logits.detach() cf_out = model(**tokenizer(sent_list[1:5], padding=True, truncation=True, max_length=512, return_tensors='pt').to(device)).logits.detach() delta_embed = model.roberta(**tokenizer(sent_list[1:5], padding=True, truncation=True, max_length=512, return_tensors='pt').to(device)).last_hidden_state.detach()[:,:1,:]\ - torch.cat([model.roberta(**tokenizer(sent_list[:1], padding=True, truncation=True, max_length=512, return_tensors='pt').to(device)).last_hidden_state.detach()[:,:1,:] for k in range(4)]) # delta_out = model.classifier(delta_embed).detach() return delta_embed, [cf_out, real_out] def isNan_2(a): return a != a def mk_dir(path): try: os.mkdir(path) except: pass train_data = pd.read_csv(args.train_file, sep= "\t") val_data = pd.read_csv(args.val_file, sep ="\t") test_data = pd.read_csv(args.test_file, sep = "\t") orig_train_data = pd.read_csv(args.orig_train_file, sep= "\t") orig_val_data = pd.read_csv(args.orig_val_file, sep ="\t") orig_test_data = pd.read_csv(args.orig_test_file, sep = "\t") revised_train_data = pd.read_csv(args.revised_train_file, sep= "\t") revised_val_data = pd.read_csv(args.revised_val_file, sep ="\t") revised_test_data = pd.read_csv(args.revised_test_file, sep = "\t") def model_test(batch_train, classifier, cf_net): cf_net = cf_net.eval() classifier = classifier.eval() correct=0 total=0 with torch.no_grad(): for index in tqdm(range(len(batch_train))): label = batch_train[index][0].to(device) # encoder = tokenizer(batch_train[index][1], padding=True, truncation=True, max_length=512, return_tensors='pt' ) out= classifier(torch.cat(batch_train[index][1])).view(len(label),4,3).mean(1) output = cf_net(torch.cat([torch.stack(batch_train[index][2]).view(len(label),2,3),out.view(len(label),1,3)], dim=1).view(len(label),1,3,3)) # output = out_net(output) _,predict = torch.max(output,1) total+=label.size(0) correct += (predict == label).sum().item() return 100 * correct/total def model_test_for_option2(batch_train, classifier, cf_net): classifier = classifier.eval() cf_net = cf_net.eval() total = 0 correct = 0 with torch.no_grad(): for index in tqdm(range(len(batch_train))): label = batch_train[index][0].to(device) delta_classifier_out = classifier(torch.cat(batch_train[index][1])).view(len(label),4,3) for k in range(len(batch_train[index][2])): label_temp = label[k].view(1) real_classifier1_out = batch_train[index][2][k][-1] cf_classifier1_out = batch_train[index][2][k][0:4] delta_classifier_out_temp = delta_classifier_out[k] for m in range(4): input_for_conv_network = torch.cat([real_classifier1_out,cf_classifier1_out[m],delta_classifier_out_temp[m]]).view(1,1,3,3) if m==0: conv_network_out = cf_net(input_for_conv_network) else: conv_network_out += cf_net(input_for_conv_network) conv_network_out = conv_network_out/4 total += 1 _,predict = torch.max(conv_network_out,1) if predict == label_temp: correct += 1 return correct/total * 100 def shuffle_from_bs_1(batch_train_bs_1, batchsize): batch_train_bs = copy.deepcopy(batch_train_bs_1) count = 0 batch_list = [] index_list = [i for i in range(len(batch_train_bs))] random.shuffle(index_list) for index in index_list: item = batch_train_bs[index] if count == 0: label_1 = item[0] delta_1 = item[1] out_1 = item[2] count += 1 else: label_1 = torch.cat([label_1, item[0]]) delta_1 += item[1] out_1 += item[2] count += 1 if count >= batchsize: batch_list.append((label_1, delta_1, out_1)) count = 0 if count != 0: batch_list.append((label_1, delta_1, out_1)) return batch_list def setup_seed(seed): torch.manual_seed(seed) torch.cuda.manual_seed_all(seed) torch.cuda.manual_seed(seed) np.random.seed(seed) random.seed(seed) torch.backends.cudnn.deterministic = True torch.backends.cudnn.benchmark = False seed= args.run_seed max_val_acc = 0 final_test_acc = 0 setup_seed(seed) model = torch.load(args.cf_model_folder +str(seed) + "/roberta-large-mnli.pt", map_location= device) batch_train_bs_1 = create_batch_with_delta_cf(orig_train_data, revised_train_data, 1, model, tokenizer) batch_val = create_batch_with_delta_cf(orig_val_data, revised_val_data, args.batchsize, model, tokenizer) batch_test = create_batch_with_delta_cf(orig_test_data, revised_test_data, args.batchsize, model, tokenizer) classifier = copy.deepcopy(model.classifier).to(device) cf_net = cf_conv_linear_net(10).to(device) optimizer = optim.Adam([{"params":cf_net.parameters(),"lr":args.lr}, {"params":classifier.parameters(),"lr":args.lr}]) Loss = nn.CrossEntropyLoss() acc_train_list = [] acc_val_list = [] acc_test_list = [] mk_dir(args.save_folder) final_saving_folder = args.save_folder + "/" + str(seed) + "/" mk_dir(final_saving_folder) for i in range(0, args.epochs): print("epoch:" + str(i)) loss_total = 0 batch_train = shuffle_from_bs_1(batch_train_bs_1, args.batchsize) with open(final_saving_folder + "/" + args.log_name,"a+") as f: if i == 0: f.write("settings:\n") f.write("lr:" + str(args.lr) + "\n") f.write("net_struc:" + "\n") print(cf_net, file=f) print(classifier, file=f) cf_net = cf_net.train() classifier = classifier.train() for index in tqdm(range(len(batch_train))): loss = 0 # encoder = tokenizer(batch_train[index][1], padding=True, truncation=True, max_length=512, return_tensors='pt' ) label = batch_train[index][0].to(device) delta_classifier_out = classifier(torch.cat(batch_train[index][1])).view(len(label),4,3) for k in range(len(batch_train[index][2])): label_temp = label[k] real_classifier1_out = batch_train[index][2][k][-1] cf_classifier1_out = batch_train[index][2][k][0:4] delta_classifier_out_temp = delta_classifier_out[k] for m in range(4): input_for_conv_network = torch.cat([real_classifier1_out,cf_classifier1_out[m],delta_classifier_out_temp[m]]).view(1,1,3,3) if m==0: conv_network_out = cf_net(input_for_conv_network) else: conv_network_out += cf_net(input_for_conv_network) conv_network_out = conv_network_out/4 loss += Loss(conv_network_out, label_temp.view(1)) optimizer.zero_grad() loss.backward() optimizer.step() loss_total += loss.item() print(loss_total/len(batch_train)) # batch_train = create_batch(train_data, 64) acc1 = model_test_for_option2(batch_train, classifier, cf_net) acc2 = model_test_for_option2(batch_val, classifier, cf_net) acc3 = model_test_for_option2(batch_test, classifier, cf_net) acc_train_list.append(acc1) acc_val_list.append(acc2) acc_test_list.append(acc3) # acc4 = model_test(orig_batch_val, model) # acc5 = model_test(orig_batch_test, model) # print(loss_total/len(batch_train)) print(acc1, acc2, acc3) # torch.save(model, args.save_folder + "roberta-large-mnli" + "save_epoch_" + str(i) + ".pt") with open(final_saving_folder + "/" + args.log_name,"a+") as f: if i == 0: f.write("settings:\n") f.write("net_struc:" + "\n") print(cf_net, file=f) f.write("epoch:" + str(i) + " train_acc:" + str(acc1) + " val_acc:" + str(acc2) + " test_acc:" + str(acc3) + "\n") if acc2 > max_val_acc: max_val_acc = acc2 final_test_acc = acc3 torch.save(classifier, final_saving_folder + "/classifier.pt") torch.save(cf_net, final_saving_folder + "/cf_net.pt") with open(args.save_folder + "/final_acc", "a+") as f: f.write("random seed:" + str(seed) + "max_val_acc: " + str(max_val_acc) + " final_test_acc: " + str(final_test_acc) + "\n") x = [i for i in range(len(acc_train_list))] p1 = plt.plot(x, acc_train_list, "b", marker = "o", label = "train") p2 = plt.plot(x, acc_val_list, "g", marker = "v", label = "val") p3 = plt.plot(x, acc_test_list, "y", marker = "^", label = "test") plt.xlabel("epochs") plt.ylabel("acc") plt.title("cf_net result") # plt.legend([p1,p2,p3], ["train", "val", "test"]) # plt.title("cf_net result") plt.legend(labels = ["train", "val", "test"]) plt.savefig(final_saving_folder + args.plot_name) plt.cla() # end

45.305466

200

0.650887

5e65d9ee6f7ad6cab9622de3cff18b6627565a78

2,240

py

Python

conans/test/functional/old/user_info_test.py

noverby/conan

5e560ce806be28416e80544e767b1bca3f48d11e

[ "MIT" ]

1

2019-01-09T14:14:58.000Z

conans/test/functional/old/user_info_test.py

noverby/conan

5e560ce806be28416e80544e767b1bca3f48d11e

[ "MIT" ]

null

conans/test/functional/old/user_info_test.py

noverby/conan

5e560ce806be28416e80544e767b1bca3f48d11e

[ "MIT" ]

null

import os import unittest from conans.paths import CONANFILE from conans.test.utils.tools import TestClient from conans.util.files import load class UserInfoTest(unittest.TestCase): def test_user_info_propagation(self): client = TestClient() def export_lib(name, requires, infolines): base = ''' import os from conans import ConanFile class MyConanfile(ConanFile): name = "%s" version = "0.1" requires = "%s" def build(self): pass def package_info(self): %s ''' client.save({CONANFILE: base % (name, requires, infolines)}, clean_first=True) client.run("export . lasote/stable") export_lib("LIB_A", "", "self.user_info.VAR1=2") export_lib("LIB_B", "LIB_A/0.1@lasote/stable", "self.user_info.VAR1=2\n " "self.user_info.VAR2=3") export_lib("LIB_C", "LIB_B/0.1@lasote/stable", "self.user_info.VAR1=2") export_lib("LIB_D", "LIB_C/0.1@lasote/stable", "self.user_info.var1=2") reuse = ''' import os from conans import ConanFile class MyConanfile(ConanFile): name = "reuse" version = "0.1" requires = "LIB_D/0.1@lasote/stable" def build(self): assert(self.deps_user_info["LIB_A"].VAR1=="2") assert(self.deps_user_info["LIB_B"].VAR1=="2") assert(self.deps_user_info["LIB_B"].VAR2=="3") assert(self.deps_user_info["LIB_C"].VAR1=="2") assert(self.deps_user_info["LIB_D"].var1=="2") ''' client.save({CONANFILE: reuse}, clean_first=True) client.run("export . lasote/stable") client.run('install reuse/0.1@lasote/stable --build -g txt') # Assert generator TXT txt_contents = client.load("conanbuildinfo.txt") self.assertIn("[USER_LIB_A]%sVAR1=2" % os.linesep, txt_contents) self.assertIn("[USER_LIB_B]%sVAR1=2%sVAR2=3" % (os.linesep, os.linesep), txt_contents) self.assertIn("[USER_LIB_C]%sVAR1=2" % os.linesep, txt_contents) self.assertIn("[USER_LIB_D]%svar1=2" % os.linesep, txt_contents) # Now try local command with a consumer client.run('install . --build') client.run("build .")

32

94

0.61875

b4cf8733fafbdf11e19d7a3997e47b55865facc5

6,080

py

Python

pygame_gui/core/ui_container.py

halfninja/pygame_gui

71b1150cb0c789339a9f8d781da15bdfad604f6c

[ "MIT" ]

null

pygame_gui/core/ui_container.py

halfninja/pygame_gui

71b1150cb0c789339a9f8d781da15bdfad604f6c

[ "MIT" ]

null

pygame_gui/core/ui_container.py

halfninja/pygame_gui

71b1150cb0c789339a9f8d781da15bdfad604f6c

[ "MIT" ]

null

import pygame from pygame_gui.core.ui_element import UIElement class UIContainer(UIElement): """ A UI Container holds any number of other UI elements inside of a rectangle. When we move the UIContainer all the UI elements contained within it can be moved as well. This class helps us make UI Windows, but likely will have wider uses as well as the GUI system develops. :param relative_rect: A pygame.Rect whose position is relative to whatever UIContainer it is inside of, if any. :param manager: The UIManager that manages this UIElement. :param container: The UIContainer that this UIElement is contained within. :param parent_element: The element this element 'belongs to' in the theming hierarchy. :param object_id: A custom defined ID for fine tuning of theming. """ def __init__(self, relative_rect, manager, container=None, parent_element=None, object_id=None): self._layer = 0 self.ui_manager = manager new_element_ids, new_object_ids = self.create_valid_ids(parent_element=parent_element, object_id=object_id, element_id='container') super().__init__(relative_rect, manager, container, object_ids=new_object_ids, element_ids=new_element_ids, starting_height=1, layer_thickness=1) self.sprite_group = self.ui_manager.get_sprite_group() self.image = pygame.Surface((0, 0)) self.elements = [] self.layer_thickness = 1 self.hovered = False def add_element(self, element): """ Add a UIElement to the container. The UI's relative_rect parameter will be relative to this container. :param element: A UIElement to add to this container. """ element.change_layer(self._layer + element.starting_height) self.elements.append(element) self.recalculate_container_layer_thickness() def remove_element(self, element): """ Remove a UIElement from this container. :param element: A UIElement to remove from this container. """ if element in self.elements: self.elements.remove(element) self.recalculate_container_layer_thickness() def recalculate_container_layer_thickness(self): """ This function will iterate through the elements in our container and determine the maximum 'height' that they reach in the 'layer stack'. We then use that to determine the overall 'thickness' of this container. The thickness value is used to determine where to place overlapping windows in the layers """ max_element_top_layer = 0 for element in self.elements: if element.top_layer > max_element_top_layer: max_element_top_layer = element.top_layer self.layer_thickness = max_element_top_layer - self._layer def change_container_layer(self, new_layer): """ Change the layer of this container. Layers are used by the GUI to control the order in which things are drawn and which things should currently be interactive (so you can't interact with things behind other things). This particular method is most often used to shift the visible contents of a window in front of any others when it is moved to the front of the window stack. :param new_layer: The layer to move our container to. """ if new_layer != self._layer: self._layer = new_layer self.sprite_group.change_layer(self, self._layer) for element in self.elements: element.change_layer(self._layer + element.starting_height) def update_containing_rect_position(self): """ This function is called when we move the container to update all the contained UI Elements to move as well. """ super().update_containing_rect_position() for element in self.elements: element.update_containing_rect_position() def get_top_layer(self): """ Assuming we have correctly calculated the 'thickness' of this container, this method will return the 'highest' layer in the LayeredUpdates UI Group. :return int: An integer representing the current highest layer being used by this container. """ return self._layer + self.layer_thickness def kill(self): """ Overrides the standard kill method of UI Elements (and pygame sprites beyond that) to also call the kill method on all contained UI Elements. """ self.clear() super().kill() def clear(self): """ Removes and kills all the UI elements inside this container. """ while len(self.elements) > 0: self.elements.pop().kill() # noinspection PyUnusedLocal def check_hover(self, time_delta, hovered_higher_element): """ A method that helps us to determine which, if any, UI Element is currently being hovered by the mouse. :param time_delta: A float, the time in seconds between the last call to this function and now (roughly). :param hovered_higher_element: A boolean, representing whether we have already hovered a 'higher' element. :return bool: A boolean that is true if we have hovered a UI element, either just now or before this method. """ if self.alive(): mouse_x, mouse_y = pygame.mouse.get_pos() if self.rect.collidepoint(mouse_x, mouse_y) and not hovered_higher_element: if not self.hovered: self.hovered = True hovered_higher_element = True else: if self.hovered: self.hovered = False elif self.hovered: self.hovered = False return hovered_higher_element

41.360544

119

0.647204

2e3b0c91ea33c0cfebfc04c6f62c3f693a887a63

399

py

Python

tests/python/pants_test/projects/test_python_testprojects_integration.py

anthonyjpratti/pants

d98e53af6ddd877861231bce8343f8204da0a9d1

[ "Apache-2.0" ]

null

tests/python/pants_test/projects/test_python_testprojects_integration.py

anthonyjpratti/pants

d98e53af6ddd877861231bce8343f8204da0a9d1

[ "Apache-2.0" ]

1

2020-01-21T16:34:02.000Z

tests/python/pants_test/projects/test_python_testprojects_integration.py

anthonyjpratti/pants

d98e53af6ddd877861231bce8343f8204da0a9d1

[ "Apache-2.0" ]

null

# Copyright 2019 Pants project contributors (see CONTRIBUTORS.md). # Licensed under the Apache License, Version 2.0 (see LICENSE). from pants_test.projects.projects_test_base import ProjectsTestBase class TestPythonTestprojectsIntegration(ProjectsTestBase): def test_python_testprojects(self) -> None: self.assert_valid_projects("testprojects/src/python::", "testprojects/tests/python::")

36.272727

90

0.807018

f006cbf907ac4349fa410e629f50e2b482ba6b80

1,911

py

Python

app/game/game_repository.py

hmajid2301/banter-bus-management-api

d51a40c2d5254d4197cbe5bb84aa576df2c24893

[ "Apache-2.0" ]

null

app/game/game_repository.py

hmajid2301/banter-bus-management-api

d51a40c2d5254d4197cbe5bb84aa576df2c24893

[ "Apache-2.0" ]

null

app/game/game_repository.py

hmajid2301/banter-bus-management-api

d51a40c2d5254d4197cbe5bb84aa576df2c24893

[ "Apache-2.0" ]

null

import abc from typing import List from omnibus.database.repository import AbstractRepository from pymongo.errors import DuplicateKeyError from app.game.game_exceptions import GameExistsException, GameNotFound from app.game.game_models import Game class AbstractGameRepository(AbstractRepository[Game]): @abc.abstractmethod async def update_enable_status(self, game_name: str, enabled: bool) -> Game: raise NotImplementedError @abc.abstractmethod async def get_all_game_names(self, enabled: bool = None) -> List[str]: raise NotImplementedError class GameRepository(AbstractGameRepository): @staticmethod async def add(game: Game): try: await Game.insert(game) except DuplicateKeyError: raise GameExistsException(f"game {game.name=} already exists") @staticmethod async def get(game_name: str) -> Game: game = await Game.find_one(Game.name == game_name) if not game: raise GameNotFound(game_name=game_name) return game async def remove(self, game_name: str): game = await self.get(game_name=game_name) await game.delete() async def get_all_game_names(self, enabled: bool = None) -> List[str]: if enabled is not None: games = await Game.find(Game.enabled == enabled).to_list() else: games = await Game.find().to_list() return self._get_game_names(games) # TODO: use projection https://roman-right.github.io/beanie/tutorial/finding-documents/ @staticmethod def _get_game_names(games: List[Game]): game_names: List[str] = [game.name for game in games] return game_names async def update_enable_status(self, game_name: str, enabled: bool) -> Game: game = await self.get(game_name=game_name) game.enabled = enabled await game.save() return game

32.948276

91

0.685505

6f278f2ea0df76471a5f4d7877ff42e07a5cdf52

7,109

py

Python

src/python/photosphere_parallax_pyopenvr.py

cmbruns/vr_samples

8dee056766bccca1a602c6dd58fd0a641c5033a5

[ "MIT" ]

1

2017-01-29T21:15:23.000Z

src/python/photosphere_parallax_pyopenvr.py

cmbruns/vr_samples

8dee056766bccca1a602c6dd58fd0a641c5033a5

[ "MIT" ]

2

2017-01-29T20:34:39.000Z

2017-01-29T23:26:05.000Z

src/python/photosphere_parallax_pyopenvr.py

cmbruns/vr_samples

8dee056766bccca1a602c6dd58fd0a641c5033a5

[ "MIT" ]

null

#!/bin/env python # Example program for viewing a 360 photosphere in a virtual reality headset # using parallax shifting to place the ground plane on the floor import os from textwrap import dedent import numpy from OpenGL import GL from OpenGL.GL.shaders import compileShader, compileProgram try: from PIL import Image except ImportError: import Image from openvr.glframework.glfw_app import GlfwApp from openvr.gl_renderer import OpenVrGlRenderer class SphericalPanorama(object): def __init__(self, image): self.image = image self.shader = None self.vao = None self.texture_handle = None def init_gl(self): self.vao = GL.glGenVertexArrays(1) GL.glBindVertexArray(self.vao) # Set up photosphere image texture for OpenGL self.texture_handle = GL.glGenTextures(1) GL.glBindTexture(GL.GL_TEXTURE_2D, self.texture_handle); GL.glTexParameterf(GL.GL_TEXTURE_2D, GL.GL_TEXTURE_MAG_FILTER, GL.GL_LINEAR); GL.glTexParameterf(GL.GL_TEXTURE_2D, GL.GL_TEXTURE_MIN_FILTER, GL.GL_LINEAR); GL.glTexParameterf(GL.GL_TEXTURE_2D, GL.GL_TEXTURE_WRAP_S, GL.GL_REPEAT); GL.glTexParameterf(GL.GL_TEXTURE_2D, GL.GL_TEXTURE_WRAP_T, GL.GL_MIRRORED_REPEAT); GL.glTexImage2D(GL.GL_TEXTURE_2D, 0, GL.GL_RGB8, self.image.shape[1], # width self.image.shape[0], # height 0, GL.GL_RGB, GL.GL_UNSIGNED_BYTE, self.image); GL.glBindTexture(GL.GL_TEXTURE_2D, 0); # Set up shaders for rendering vertex_shader = compileShader(dedent( """#version 450 core #line 52 layout(location = 1) uniform mat4 projection = mat4(1); layout(location = 2) uniform mat4 model_view = mat4(1); out vec3 viewDir; out vec3 camPos; // projected screen quad const vec4 SCREEN_QUAD[4] = vec4[4]( vec4(-1, -1, 1, 1), vec4( 1, -1, 1, 1), vec4( 1, 1, 1, 1), vec4(-1, 1, 1, 1)); const int TRIANGLE_STRIP_INDICES[4] = int[4]( 0, 1, 3, 2); void main() { int vertexIndex = TRIANGLE_STRIP_INDICES[gl_VertexID]; gl_Position = vec4(SCREEN_QUAD[vertexIndex]); mat4 xyzFromNdc = inverse(projection * model_view); vec4 campos4 = xyzFromNdc * vec4(0, 0, 0, 1); vec4 vpos = xyzFromNdc * SCREEN_QUAD[vertexIndex]; camPos = campos4.xyz /campos4.w; viewDir = vpos.xyz/vpos.w - camPos; } """), GL.GL_VERTEX_SHADER) fragment_shader = compileShader(dedent( """#version 450 core #line 84 const vec3 original_cam_pos = vec3(0, 2.0, 0); const float floor_level = -0.40; const vec4 ground_plane = vec4(0, 1, 0, -floor_level); layout(binding = 0) uniform sampler2D image; in vec3 viewDir; in vec3 camPos; out vec4 pixelColor; const float PI = 3.1415926535897932384626433832795; // this function abstracts away equirectangular vs cubemap fetch vec4 color_for_original_direction(in vec3 d) { float longitude = 0.5 * atan(d.z, d.x) / PI + 0.5; // range [0-1] float r = length(d.xz); float latitude = -atan(d.y, r) / PI + 0.5; // range [0-1] return texture(image, vec2(longitude, latitude)); } vec3 intersect_plane(vec3 ray_point, vec3 ray_direction, vec4 plane) { // intersection of view direction and plane // http://math.stackexchange.com/questions/400268/equation-for-a-line-through-a-plane-in-homogeneous-coordinates const vec3 w = plane.xyz; const float e = plane.w; vec3 l = ray_direction; vec3 m = cross(ray_point, l); // r is the point on the floor we are looking at vec3 r = (cross(w, m) - e*l) / dot(w,l); return r; } // intersect_proxy_geometry() will change depending on nature of proxy geometry vec3 intersect_proxy_geometry(vec3 ray_point, vec3 ray_direction) { return intersect_plane(ray_point, ray_direction, ground_plane); } vec4 color_for_direction(in vec3 d) { if (d.y < 0) { // below the horizon, shift parallax to infinite plane at finite distance vec3 r = intersect_proxy_geometry(camPos, viewDir); vec3 dir2 = r - original_cam_pos; return color_for_original_direction(dir2); } else { // above the horizon, view to infinity in all directions return color_for_original_direction(d); } } void main() { pixelColor = color_for_direction(viewDir); } """), GL.GL_FRAGMENT_SHADER) self.shader = compileProgram(vertex_shader, fragment_shader) def display_gl(self, modelview, projection): GL.glBindVertexArray(self.vao) GL.glBindTexture(GL.GL_TEXTURE_2D, self.texture_handle) GL.glUseProgram(self.shader) GL.glUniformMatrix4fv(1, 1, False, projection) GL.glUniformMatrix4fv(2, 1, False, modelview) GL.glDrawArrays(GL.GL_TRIANGLE_STRIP, 0, 4) def dispose_gl(self): GL.glDeleteTextures([self.texture_handle,]) if self.shader is not None: GL.glDeleteProgram(self.shader) GL.glDeleteVertexArrays(1, [self.vao,]) if __name__ == "__main__": # Open equirectangular photosphere src_folder = os.path.dirname(os.path.abspath(__file__)) img_path = os.path.join(src_folder, '../../assets/images/_0010782_stitch2.jpg') img = Image.open(img_path) arr = numpy.array(img) actor = SphericalPanorama(arr) renderer = OpenVrGlRenderer(actor) with GlfwApp(renderer, "parallax shifted photosphere test") as glfwApp: glfwApp.run_loop()

41.573099

133

0.522999

c744054939c4515bec3835bc476c25562dfd15c4

261

py

Python

retangulos de #.py

knapoli/programas-python

51c3f8f84c3237866a20f37859ef0bcfe9850d15

[ "MIT" ]

null

retangulos de #.py

knapoli/programas-python

51c3f8f84c3237866a20f37859ef0bcfe9850d15

[ "MIT" ]

null

retangulos de #.py

knapoli/programas-python

51c3f8f84c3237866a20f37859ef0bcfe9850d15

[ "MIT" ]

null

largura = int(input('Digite a largura: ')) altura = int(input('Digite a altura: ')) guardar = largura while altura > 0: largura = guardar while largura >0: print('#', end = '') largura = largura - 1 altura = altura - 1 print ()

21.75

42

0.574713

1a285827407684171f5dedb4508ae47f04a484b9

20,091

py

Python

salt/modules/systemd.py

petersanchez/salt

0e8f1a15b4bb7299220001f3cab6d2c002d4689c

[ "Apache-2.0" ]

null

salt/modules/systemd.py

petersanchez/salt

0e8f1a15b4bb7299220001f3cab6d2c002d4689c

[ "Apache-2.0" ]

null

salt/modules/systemd.py

petersanchez/salt

0e8f1a15b4bb7299220001f3cab6d2c002d4689c

[ "Apache-2.0" ]

null

# -*- coding: utf-8 -*- ''' Provide the service module for systemd ''' # Import python libs from __future__ import absolute_import import glob import logging import os import re import shlex # Import 3rd-party libs import salt.ext.six as six import salt.utils.itertools import salt.utils.systemd from salt.exceptions import CommandExecutionError, CommandNotFoundError log = logging.getLogger(__name__) __func_alias__ = { 'reload_': 'reload' } LOCAL_CONFIG_PATH = '/etc/systemd/system' LEGACY_INIT_SCRIPT_PATH = '/etc/init.d' VALID_UNIT_TYPES = ('service', 'socket', 'device', 'mount', 'automount', 'swap', 'target', 'path', 'timer') # Define the module's virtual name __virtualname__ = 'service' def __virtual__(): ''' Only work on systems that have been booted with systemd ''' if __grains__['kernel'] == 'Linux' \ and salt.utils.systemd.booted(__context__): return __virtualname__ return ( False, 'The systemd execution module failed to load: only available on Linux ' 'systems which have been booted with systemd.' ) def _canonical_unit_name(name): ''' Build a canonical unit name treating unit names without one of the valid suffixes as a service. ''' if not isinstance(name, six.string_types): name = str(name) if any(name.endswith(suffix) for suffix in VALID_UNIT_TYPES): return name return '{0}.service'.format(name) def _systemctl_cmd(action, name=None): ''' Build a systemctl command line. Treat unit names without one of the valid suffixes as a service. ''' ret = ['systemctl'] ret.extend(shlex.split(action)) if name: ret.append(_canonical_unit_name(name)) if 'status' in ret: ret.extend(['-n', '0']) return ret def _get_all_units(): ''' Get all units and their state. Units ending in .service are normalized so that they can be referenced without a type suffix. ''' rexp = re.compile(r'(?m)^(?P<name>.+)\.(?P<type>' + '|'.join(VALID_UNIT_TYPES) + r')\s+loaded\s+(?P<active>[^\s]+)') out = __salt__['cmd.run_stdout']( _systemctl_cmd('--all --full --no-legend --no-pager list-units'), python_shell=False ) ret = {} for match in rexp.finditer(out): name = match.group('name') if match.group('type') != 'service': name += '.' + match.group('type') ret[name] = match.group('active') return ret def _get_all_unit_files(): ''' Get all unit files and their state. Unit files ending in .service are normalized so that they can be referenced without a type suffix. ''' rexp = re.compile(r'(?m)^(?P<name>.+)\.(?P<type>' + '|'.join(VALID_UNIT_TYPES) + r')\s+(?P<state>.+)$') out = __salt__['cmd.run_stdout']( _systemctl_cmd( 'systemctl --full --no-legend --no-pager list-unit-files' ), python_shell=False ) ret = {} for match in rexp.finditer(out): name = match.group('name') if match.group('type') != 'service': name += '.' + match.group('type') ret[name] = match.group('state') return ret def _get_all_legacy_init_scripts(): ''' Get all old-fashioned init-style scripts. State is always inactive, because systemd would already show them otherwise. ''' ret = {} if not os.path.isdir(LEGACY_INIT_SCRIPT_PATH): return ret for initscript_name in os.listdir(LEGACY_INIT_SCRIPT_PATH): if initscript_name.startswith('rc'): continue full_path = os.path.join(LEGACY_INIT_SCRIPT_PATH, initscript_name) if os.path.isfile(full_path) and os.access(full_path, os.X_OK): log.info('Legacy init script: \'%s\'.', initscript_name) ret[initscript_name] = 'inactive' return ret def _untracked_custom_unit_found(name): ''' If the passed service name is not available, but a unit file exist in /etc/systemd/system, return True. Otherwise, return False. ''' unit_path = os.path.join('/etc/systemd/system', _canonical_unit_name(name)) return os.access(unit_path, os.R_OK) and not available(name) def _unit_file_changed(name): ''' Returns True if systemctl reports that the unit file has changed, otherwise returns False. ''' out = __salt__['cmd.run'](_systemctl_cmd('status', name), python_shell=False, ignore_retcode=True).lower() return "'systemctl daemon-reload'" in out def systemctl_reload(): ''' Reloads systemctl, an action needed whenever unit files are updated. CLI Example: .. code-block:: bash salt '*' service.systemctl_reload ''' out = __salt__['cmd.run_all']( _systemctl_cmd('--system daemon-reload'), python_shell=False, redirect_stderr=True ) if out['retcode'] != 0: raise CommandExecutionError( 'Problem performing systemctl daemon-reload', info=out['stdout'] ) return True def _default_runlevel(): ''' Try to figure out the default runlevel. It is kept in /etc/init/rc-sysinit.conf, but can be overridden with entries in /etc/inittab, or via the kernel command-line at boot ''' # Try to get the "main" default. If this fails, throw up our # hands and just guess "2", because things are horribly broken try: with salt.utils.fopen('/etc/init/rc-sysinit.conf') as fp_: for line in fp_: if line.startswith('env DEFAULT_RUNLEVEL'): runlevel = line.split('=')[-1].strip() except Exception: return '2' # Look for an optional "legacy" override in /etc/inittab try: with salt.utils.fopen('/etc/inittab') as fp_: for line in fp_: if not line.startswith('#') and 'initdefault' in line: runlevel = line.split(':')[1] except Exception: pass # The default runlevel can also be set via the kernel command-line. # Kinky. try: valid_strings = set( ('0', '1', '2', '3', '4', '5', '6', 's', 'S', '-s', 'single')) with salt.utils.fopen('/proc/cmdline') as fp_: for line in fp_: for arg in line.strip().split(): if arg in valid_strings: runlevel = arg break except Exception: pass return runlevel def _runlevel(): ''' Return the current runlevel ''' if 'systemd._runlevel' in __context__: return __context__['systemd._runlevel'] out = __salt__['cmd.run']('runlevel', python_shell=False) try: ret = out.split()[1] except IndexError: # The runlevel is unknown, return the default ret = _default_runlevel() __context__['systemd._runlevel'] = ret return ret def _get_service_exec(): ''' Debian uses update-rc.d to manage System-V style services. http://www.debian.org/doc/debian-policy/ch-opersys.html#s9.3.3 ''' executable = 'update-rc.d' salt.utils.check_or_die(executable) return executable def _check_for_unit_changes(name): ''' Check for modified/updated unit files, and run a daemon-reload if any are found. ''' contextkey = 'systemd._check_for_unit_changes' if contextkey not in __context__: if _untracked_custom_unit_found(name) or _unit_file_changed(name): systemctl_reload() # Set context key to avoid repeating this check __context__[contextkey] = True def _has_sysv_exec(): ''' Return the current runlevel ''' if 'systemd._has_sysv_exec' not in __context__: try: __context__['systemd._has_sysv_exec'] = bool(_get_service_exec()) except (CommandExecutionError, CommandNotFoundError): __context__['systemd._has_sysv_exec'] = False return __context__['systemd._has_sysv_exec'] def _sysv_exists(name): script = '/etc/init.d/{0}'.format(name) return os.access(script, os.X_OK) def _service_is_sysv(name): ''' A System-V style service will have a control script in /etc/init.d. Return True only if the service doesnt also provide a systemd unit file. ''' return (_has_sysv_exec() and name in _get_all_units() and name not in _get_all_unit_files() and _sysv_exists(name)) def _sysv_is_enabled(name): ''' A System-V style service is assumed disabled if the "startup" symlink (starts with "S") to its script is found in /etc/init.d in the current runlevel. ''' return bool(glob.glob('/etc/rc{0}.d/S*{1}'.format(_runlevel(), name))) def get_enabled(): ''' Return a list of all enabled services CLI Example: .. code-block:: bash salt '*' service.get_enabled ''' ret = [] units = _get_all_unit_files() services = _get_all_units() for name, state in six.iteritems(units): if state.strip() == 'enabled': ret.append(name) for name, state in six.iteritems(services): if name in units: continue # performance; if the legacy initscript doesnt exists, # don't contiue up with systemd query if not _service_is_sysv(name): continue if _sysv_is_enabled(name): ret.append(name) return sorted(ret) def get_disabled(): ''' Return a list of all disabled services CLI Example: .. code-block:: bash salt '*' service.get_disabled ''' ret = [] known_services = _get_all_unit_files() known_services.update(_get_all_legacy_init_scripts()) for name, state in six.iteritems(known_services): if state == 'disabled': ret.append(name) return sorted(ret) def get_all(): ''' Return a list of all available services CLI Example: .. code-block:: bash salt '*' service.get_all ''' ret = set(_get_all_units()) ret.update(_get_all_unit_files()) ret.update(_get_all_legacy_init_scripts()) return sorted(ret) def available(name): ''' Check that the given service is available taking into account template units. CLI Example: .. code-block:: bash salt '*' service.available sshd ''' out = __salt__['cmd.run'](_systemctl_cmd('status', name), python_shell=False, ignore_retcode=True) for line in salt.utils.itertools.split(out.lower(), '\n'): match = re.match(r'\s+loaded:\s+(\S+)', line) if match: ret = match.group(1) != 'not-found' break else: raise CommandExecutionError( 'Failed to get information on service unit \'{0}\''.format(name), info=out ) return ret def missing(name): ''' The inverse of service.available. Returns ``True`` if the specified service is not available, otherwise returns ``False``. CLI Example: .. code-block:: bash salt '*' service.missing sshd ''' return not available(name) def unmask(name): ''' Unmask the specified service with systemd CLI Example: .. code-block:: bash salt '*' service.unmask <service name> ''' _check_for_unit_changes(name) mask_status = masked(name) if not mask_status: log.debug('Service \'{0}\' is not masked'.format(name)) return True cmd = 'unmask --runtime' if 'runtime' in mask_status else 'unmask' out = __salt__['cmd.run_all'](_systemctl_cmd(cmd, name), python_shell=False, redirect_stderr=True) if out['retcode'] != 0: raise CommandExecutionError( 'Failed to unmask service \'{0}\''.format(name), info=out['stdout'] ) return True def mask(name, runtime=False): ''' Mask the specified service with systemd runtime : False Set to ``True`` to mask this service only until the next reboot .. versionadded:: Boron CLI Example: .. code-block:: bash salt '*' service.mask <service name> ''' _check_for_unit_changes(name) cmd = 'mask --runtime' if runtime else 'mask' out = __salt__['cmd.run_all'](_systemctl_cmd(cmd, name), python_shell=False, redirect_stderr=True) if out['retcode'] != 0: raise CommandExecutionError( 'Failed to mask service \'{0}\''.format(name), info=out['stdout'] ) return True def masked(name): ''' .. versionadded:: 2015.8.0 .. versionchanged:: Boron The return data for this function has changed. If the service is masked, the return value will now be the output of the ``systemctl is-enabled`` command (so that a persistent mask can be distinguished from a runtime mask). If the service is not masked, then ``False`` will be returned. Check whether or not a service is masked CLI Example: .. code-block:: bash salt '*' service.masked <service name> ''' _check_for_unit_changes(name) out = __salt__['cmd.run']( _systemctl_cmd('is-enabled', name), python_shell=False, ignore_retcode=True, ) return out if 'masked' in out else False def start(name): ''' Start the specified service with systemd CLI Example: .. code-block:: bash salt '*' service.start <service name> ''' _check_for_unit_changes(name) unmask(name) return __salt__['cmd.retcode'](_systemctl_cmd('start', name), python_shell=False) == 0 def stop(name): ''' Stop the specified service with systemd CLI Example: .. code-block:: bash salt '*' service.stop <service name> ''' _check_for_unit_changes(name) return __salt__['cmd.retcode'](_systemctl_cmd('stop', name), python_shell=False) == 0 def restart(name): ''' Restart the specified service with systemd CLI Example: .. code-block:: bash salt '*' service.restart <service name> ''' _check_for_unit_changes(name) unmask(name) return __salt__['cmd.retcode'](_systemctl_cmd('restart', name), python_shell=False) == 0 def reload_(name): ''' Reload the specified service with systemd CLI Example: .. code-block:: bash salt '*' service.reload <service name> ''' _check_for_unit_changes(name) unmask(name) return __salt__['cmd.retcode'](_systemctl_cmd('reload', name), python_shell=False) == 0 def force_reload(name): ''' Force-reload the specified service with systemd CLI Example: .. code-block:: bash salt '*' service.force_reload <service name> ''' _check_for_unit_changes(name) unmask(name) return __salt__['cmd.retcode'](_systemctl_cmd('force-reload', name), python_shell=False) == 0 # The sig argument is required to maintain consistency with service states. It # is unused in this function. def status(name, sig=None): ''' Return the status for a service via systemd, returns ``True`` if the service is running and ``False`` if it is not. CLI Example: .. code-block:: bash salt '*' service.status <service name> ''' _check_for_unit_changes(name) return __salt__['cmd.retcode'](_systemctl_cmd('is-active', name), python_shell=False, ignore_retcode=True) == 0 def enable(name, **kwargs): ''' Enable the named service to start when the system boots CLI Example: .. code-block:: bash salt '*' service.enable <service name> ''' _check_for_unit_changes(name) unmask(name) if _service_is_sysv(name): cmd = [_get_service_exec(), '-f', name, 'defaults', '99'] return __salt__['cmd.retcode'](cmd, python_shell=False, ignore_retcode=True) == 0 return __salt__['cmd.retcode'](_systemctl_cmd('enable', name), python_shell=False, ignore_retcode=True) == 0 def disable(name, **kwargs): ''' Disable the named service to not start when the system boots CLI Example: .. code-block:: bash salt '*' service.disable <service name> ''' _check_for_unit_changes(name) if _service_is_sysv(name): cmd = [_get_service_exec(), '-f', name, 'remove'] return __salt__['cmd.retcode'](cmd, python_shell=False, ignore_retcode=True) == 0 return __salt__['cmd.retcode'](_systemctl_cmd('disable', name), python_shell=False, ignore_retcode=True) == 0 def _enabled(name): ''' Try ``systemctl is-enabled`` first, then look for a symlink created by systemctl (older systemd releases did not support using is-enabled to check templated services), and lastly check for a sysvinit service. ''' if __salt__['cmd.retcode'](_systemctl_cmd('is-enabled', name), python_shell=False, ignore_retcode=True) == 0: return True elif '@' in name: # On older systemd releases, templated services could not be checked # with ``systemctl is-enabled``. As a fallback, look for the symlinks # created by systemctl when enabling templated services. cmd = ['find', LOCAL_CONFIG_PATH, '-name', name, '-type', 'l', '-print', '-quit'] # If the find command returns any matches, there will be output and the # string will be non-empty. if bool(__salt__['cmd.run'](cmd, python_shell=False)): return True else: return _sysv_is_enabled(name) def enabled(name, **kwargs): ''' Return if the named service is enabled to start on boot CLI Example: .. code-block:: bash salt '*' service.enabled <service name> ''' return _enabled(name) def disabled(name): ''' Return if the named service is disabled to start on boot CLI Example: .. code-block:: bash salt '*' service.disabled <service name> ''' return not _enabled(name) def show(name): ''' Show properties of one or more units/jobs or the manager CLI Example: salt '*' service.show <service name> ''' ret = {} out = __salt__['cmd.run'](_systemctl_cmd('show', name), python_shell=False) for line in salt.utils.itertools.split(out, '\n'): comps = line.split('=') name = comps[0] value = '='.join(comps[1:]) if value.startswith('{'): value = value.replace('{', '').replace('}', '') ret[name] = {} for item in value.split(' ; '): comps = item.split('=') ret[name][comps[0].strip()] = comps[1].strip() elif name in ('Before', 'After', 'Wants'): ret[name] = value.split() else: ret[name] = value return ret def execs(): ''' Return a list of all files specified as ``ExecStart`` for all services. CLI Example: salt '*' service.execs ''' ret = {} for service in get_all(): data = show(service) if 'ExecStart' not in data: continue ret[service] = data['ExecStart']['path'] return ret

27.484268

81

0.589617