blob_id stringlengths 40 40 | directory_id stringlengths 40 40 | path stringlengths 3 616 | content_id stringlengths 40 40 | detected_licenses listlengths 0 112 | license_type stringclasses 2
values | repo_name stringlengths 5 115 | snapshot_id stringlengths 40 40 | revision_id stringlengths 40 40 | branch_name stringclasses 777
values | visit_date timestamp[us]date 2015-08-06 10:31:46 2023-09-06 10:44:38 | revision_date timestamp[us]date 1970-01-01 02:38:32 2037-05-03 13:00:00 | committer_date timestamp[us]date 1970-01-01 02:38:32 2023-09-06 01:08:06 | github_id int64 4.92k 681M ⌀ | star_events_count int64 0 209k | fork_events_count int64 0 110k | gha_license_id stringclasses 22
values | gha_event_created_at timestamp[us]date 2012-06-04 01:52:49 2023-09-14 21:59:50 ⌀ | gha_created_at timestamp[us]date 2008-05-22 07:58:19 2023-08-21 12:35:19 ⌀ | gha_language stringclasses 149
values | src_encoding stringclasses 26
values | language stringclasses 1
value | is_vendor bool 2
classes | is_generated bool 2
classes | length_bytes int64 3 10.2M | extension stringclasses 188
values | content stringlengths 3 10.2M | authors listlengths 1 1 | author_id stringlengths 1 132 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
f4a65671dde5f682aab0a747b66e2ba2cdc09f88 | c9d4d4c78703d009da11999e4e59b6a168a454a2 | /examples/Machine Learning In Action/reducer.py | 67e8edacbbd3347055d42c21781c0208b8451281 | [
"MIT"
] | permissive | AkiraKane/Python | 23df49d7f7ae0f375e0b4ccfe4e1b6a077b1a52b | 12e2dcb9a61e9ab0fc5706e4a902c48e6aeada30 | refs/heads/master | 2020-12-11T07:20:01.524438 | 2015-11-07T12:42:22 | 2015-11-07T12:42:22 | 47,440,128 | 1 | 0 | null | 2015-12-05T03:15:52 | 2015-12-05T03:15:51 | null | UTF-8 | Python | false | false | 1,139 | py | '''
-------------------------------------------------------------------------
Book: Machine Learning In Action
# Lesson: MapReduce - reducer
# Author: Kelly Chan
# Date: Feb 3 2014
-------------------------------------------------------------------------
'''
import sys
from numpy import mat, mean, power
def dataLoad(... | [
"kwailamchan@hotmail.com"
] | kwailamchan@hotmail.com |
574db95533b5d034f658f9a51a1f0232059e0a1b | 7c1b599c5b5be0ec5ad142e52e5c15a7c9c8ea12 | /venv/Lib/site-packages/tensorflow/contrib/quantize/python/fold_batch_norms.py | 61c90dba7d4a688497fdac4d4ba0332fa1d94cd3 | [] | no_license | namtran98/NSTAR---MuddHacks | 88d602a0847bb923088c7f0be6d5c2980b11a36d | cbc04873e1f02cb6b62a7b77c5c44eb4e9422ab8 | refs/heads/master | 2020-04-21T19:41:49.889253 | 2019-02-09T01:02:37 | 2019-02-09T01:02:37 | 169,816,481 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 40,924 | py | # Copyright 2017 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by... | [
"ntranmn@gmail.com"
] | ntranmn@gmail.com |
4e55efc281a0895900555be7d28d0cb370371a1e | 21c098079d2724ffbd3f6cb01c7919c1f59f7875 | /src/aioquic/about.py | 82cd8f33d65dcbf2397d12c83c651cc899e91556 | [
"BSD-3-Clause"
] | permissive | MattyHsueh/aioquic | f9c54717b3acdb84bc8f963a5e8bd5f969ebeb4b | 2163f2d0940edd2a91a3773fb7cb061031fe87fa | refs/heads/master | 2022-09-01T12:33:23.987233 | 2020-05-29T05:57:37 | 2020-05-29T05:57:37 | 263,517,328 | 1 | 0 | BSD-3-Clause | 2020-05-13T03:39:45 | 2020-05-13T03:39:44 | null | UTF-8 | Python | false | false | 227 | py | __author__ = "Jeremy Lainé"
__email__ = "jeremy.laine@m4x.org"
__license__ = "BSD"
__summary__ = "An implementation of QUIC and HTTP/3"
__title__ = "aioquic"
__uri__ = "https://github.com/aiortc/aioquic"
__version__ = "0.8.7"
| [
"jeremy.laine@m4x.org"
] | jeremy.laine@m4x.org |
ad83730199dd2c78f435dea6eee07e6fd00b8033 | c8adae98cd1c2614c1bacc59ecf52fb7e45ce481 | /0x1F-pascal_triangle/0-pascal_triangle.py | 92a551bac2bdfd2d51644f8f5a6ef858cc8ca0fc | [] | no_license | OctopusHugz/holbertonschool-interview | a75f1a9fe72227e46db1005796cc98fa10f1fd2f | 546f659ca128118438200ae1515096407bb438de | refs/heads/master | 2023-07-15T07:34:45.713801 | 2021-08-25T20:29:50 | 2021-08-25T20:29:50 | 319,363,351 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 510 | py | #!/usr/bin/python3
""" This module implements a pascal triangle algorithm """
def pascal_triangle(n):
""" Returns a list of lists of integers representing the Pascal's triangle
of n """
triangle = []
for num in range(n):
row = []
for val in range(num + 1):
if val == 0 or va... | [
"colsonscott53@gmail.com"
] | colsonscott53@gmail.com |
ac5c1a1bf8e0c61d8642c34763349393db9297ab | 4e8674d7c83254aba7f2d327f16d5ad202a189b6 | /src/select_timeout.py | e4c1fdb5f764751985134229c1ae1f4e1ed59f15 | [] | no_license | raysmith619/dots | 0f5e34b17675cfb0903a20eda86493d37676b500 | c44ff3ebf57ec73c6fd8b7898cbc186668f83915 | refs/heads/master | 2021-06-17T02:34:48.850425 | 2021-04-27T13:54:24 | 2021-04-27T13:54:24 | 205,397,035 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 119 | py | # select_timeout.py
class SelectTimeout(Exception):
"""Base class for exceptions in this module."""
pass
| [
"noreply@github.com"
] | raysmith619.noreply@github.com |
7da12be20b0cf7f6dfdaf4b6ed1e6a7b1fb4459c | 62e58c051128baef9452e7e0eb0b5a83367add26 | /x12/6030/195006030.py | daab00096a42ba5ffccaf8a09c37c82a9d3352cd | [] | no_license | dougvanhorn/bots-grammars | 2eb6c0a6b5231c14a6faf194b932aa614809076c | 09db18d9d9bd9d92cefbf00f1c0de1c590fe3d0d | refs/heads/master | 2021-05-16T12:55:58.022904 | 2019-05-17T15:22:23 | 2019-05-17T15:22:23 | 105,274,633 | 0 | 0 | null | 2017-09-29T13:21:21 | 2017-09-29T13:21:21 | null | UTF-8 | Python | false | false | 2,476 | py | from bots.botsconfig import *
from records006030 import recorddefs
syntax = {
'version': '00603',
'functionalgroup': 'LA',
}
structure = [
{ID: 'ST', MIN: 1, MAX: 1, LEVEL: [
{ID: 'BGN', MIN: 1, MAX: 1},
{ID: 'DTM', MIN: 0, MAX: 99999},
{ID: 'QTY', MIN: 0, MAX: 99999},
{ID: 'PWK', MIN: 0, ... | [
"doug.vanhorn@tagglogistics.com"
] | doug.vanhorn@tagglogistics.com |
788d714d928080162d37b7236fd6f219b53d2324 | ad59072be6c46c98782d8c04df97023a1cc6161c | /DL12-10-transfer-add-category.py | 356bc4124d6c2eb230a7631f4c8b09aa920c17f7 | [] | no_license | cyrilvincent/ML | 67c6bda2016bc70168bd197fe58eabc8dc3bfb00 | 42d11fad9b8b6ea3aba3d4173cb3bbdf7bbd638f | refs/heads/master | 2023-05-25T00:36:49.561860 | 2023-05-24T14:14:04 | 2023-05-24T14:14:04 | 191,420,219 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,240 | py | import tensorflow.keras as keras
model = keras.models.load_model('data/dogsvscats/vgg16model-small.h5')
newModel = keras.models.Sequential()
for layer in model.layers[:-1]:
newModel.add(layer)
layer.trainable = False
newModel.add(keras.layers.Dense(3, name="dense3"))
newModel.add(keras.layers.Activation('sof... | [
"contact@cyrilvincent.com"
] | contact@cyrilvincent.com |
72bbbcb0b7231deff3c7aea39bd3d33ec372d704 | 91d1a6968b90d9d461e9a2ece12b465486e3ccc2 | /robomaker_write_f/world-export-job_create.py | 9d9bc5bc86ab9a791055102b84c3526c3069944b | [] | no_license | lxtxl/aws_cli | c31fc994c9a4296d6bac851e680d5adbf7e93481 | aaf35df1b7509abf5601d3f09ff1fece482facda | refs/heads/master | 2023-02-06T09:00:33.088379 | 2020-12-27T13:38:45 | 2020-12-27T13:38:45 | 318,686,394 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 800 | py | #!/usr/bin/python
# -*- codding: utf-8 -*-
import os
import sys
sys.path.append(os.path.dirname(os.path.abspath(os.path.dirname(__file__))))
from common.execute_command import write_parameter
# url : https://awscli.amazonaws.com/v2/documentation/api/latest/reference/ec2/describe-instances.html
if __name__ == '__main__... | [
"hcseo77@gmail.com"
] | hcseo77@gmail.com |
cb50763a06562ed90a40194ed8ec0b365a2b6258 | 7278b31ebd6362bebf6986c2f3eca89d87201eb2 | /apgl/graph/test/MatrixGraphTest.py | 9ebf6bb8a71f60542fbfdb6dbe402a64a68a40d8 | [] | no_license | malcolmreynolds/APGL | c19827b1b834d3491d98a751c91838177aedc29e | 1703510cbb51ec6df0efe1de850cd48ef7004b00 | refs/heads/master | 2020-12-25T05:52:45.826947 | 2013-03-26T12:30:00 | 2013-03-26T12:30:00 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 78,752 | py | from apgl.graph.VertexList import VertexList
from apgl.graph.GeneralVertexList import GeneralVertexList
from apgl.generator.BarabasiAlbertGenerator import BarabasiAlbertGenerator
from apgl.util.PathDefaults import PathDefaults
import numpy
import os
import logging
import pickle
import numpy.testing as nptst
"""
A clas... | [
"charanpal@gmail.com"
] | charanpal@gmail.com |
b586baa8d46a591e777d5a5235059c44e5991d32 | 163bbb4e0920dedd5941e3edfb2d8706ba75627d | /Code/CodeRecords/2773/60662/287216.py | fd60f99029185c3b352f686730065a2f640c4b78 | [] | no_license | AdamZhouSE/pythonHomework | a25c120b03a158d60aaa9fdc5fb203b1bb377a19 | ffc5606817a666aa6241cfab27364326f5c066ff | refs/heads/master | 2022-11-24T08:05:22.122011 | 2020-07-28T16:21:24 | 2020-07-28T16:21:24 | 259,576,640 | 2 | 1 | null | null | null | null | UTF-8 | Python | false | false | 1,176 | py | matrix = []
for i in range(0, 4):
s = input()
if 0 < i < 4:
temp = list(map(int, s.strip(' [],').split(',')))
matrix.append(temp)
a = len(matrix)
dic = {}
nums_max = 1
if a == 0:
nums_max = 0
else:
b = len(matrix[0])
for i in range(a):
for j in range(b):
dic[(i, ... | [
"1069583789@qq.com"
] | 1069583789@qq.com |
d149f7fc4838a57eb5d387bf9dd33399983d202b | e40a882c3717b3982db0fbc7ae42430746636ff0 | /dvalib/yolo/test_yolo.py | e2274640d2ca3e97769741d4a88bb08caeb74ff6 | [] | no_license | longchuan1985/DeepVideoAnalytics | 7dbe4bb9aab3ce15bc5bbcffcd3dbcea7157bea4 | 4264239ad6f9b23e450f90671c0120511c971678 | refs/heads/master | 2021-01-23T04:14:12.516312 | 2017-05-31T07:48:01 | 2017-05-31T07:48:01 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 5,046 | py | #! /usr/bin/env python
"""Run a YOLO_v2 style detection model on test images."""
import argparse
import colorsys
import imghdr
import os
import random
import numpy as np
from keras import backend as K
from keras.models import load_model
from PIL import Image
from yad2k.models.keras_yolo import yolo_eval, yolo_head
... | [
"akshayubhat@gmail.com"
] | akshayubhat@gmail.com |
880f93512f34e2e80dc747776e6ed3b406dd4715 | 0d14a4be28107b9487c16fde5865f661c34f3595 | /examples/common_features/species_2.py | f1c19320ad83c6dcd28d3f54c607a253cde10f4a | [
"MIT"
] | permissive | lamyj/sycomore | 729780544e5ac3940e47493c205797556c7f81b8 | d0335f1b8b26facb2a0581de6c19e6e999517599 | refs/heads/master | 2023-09-01T18:02:56.062085 | 2023-08-06T16:06:53 | 2023-08-06T16:06:53 | 199,385,133 | 22 | 4 | null | null | null | null | UTF-8 | Python | false | false | 445 | py | import sycomore
from sycomore.units import *
species = sycomore.Species(1000*ms, 100*ms)
# Assign the diffusion coefficient as a scalar
species.D = 3*um**2/s
# The diffusion coefficient is stored on the diagonal of the tensor
print(species.D[0,0])
# Assign the diffusion coefficient as a tensor
species.D = [
[3*um... | [
"lamy@unistra.fr"
] | lamy@unistra.fr |
be591fb5e2d1805a2ef27f18908ad61e4fb28266 | 6dfba71133c5b93cef5b944dcfb50d6eebceca26 | /src/acsf_feat.py | 604fa9e5091700a7964e38ab3b336f034d10358e | [] | no_license | matsuken92/molecular | 67b223be7be604cdf907dcd66b9948faf9119433 | 759a697070efaac681aff89f645ff2a6a79f0b78 | refs/heads/master | 2022-02-18T01:41:01.674199 | 2019-08-29T04:01:25 | 2019-08-29T04:01:25 | 190,421,154 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,377 | py | # 基本ライブラリ
import pandas as pd
import pandas.io.sql as psql
import numpy as np
import numpy.random as rd
import gc
import multiprocessing as mp
import os
import sys
import pickle
from collections import defaultdict
from glob import glob
import math
from datetime import datetime as dt
from pathlib import Path
import scip... | [
"matsuken92@gmail.com"
] | matsuken92@gmail.com |
198c683ce8f8d6109e25e666ec663c387887bcf4 | 7c66bba92b484e5fa6ee282ef39f2c26875ca775 | /auto_login/weibo_auto_login.py | adbac7ea6274fa21e0b7a49a1bb7cc6022b031ae | [] | no_license | KqSMea8/PythonTools | a5ac17182b2689a706180dc349d59c2484d3984c | 7279570b82fecbf59b71aa6b58ef975e90c660df | refs/heads/master | 2020-04-13T04:19:19.209243 | 2018-12-24T05:13:12 | 2018-12-24T05:13:12 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 6,876 | py | #!/usr/bin/env python
# encoding: utf-8
"""
@version: 1.0
@author: ‘yuxuecheng‘
@contact: yuxuecheng@baicdata.com
@software: PyCharm Community Edition
@file: weibo_auto_login.py
@time: 26/10/2017 09:49
"""
import sys
import urllib
import urllib2
import cookielib
import base64
import re
import json
import rsa
import b... | [
"xinluomed_yuxuecheng@git.cloud.tencent.com"
] | xinluomed_yuxuecheng@git.cloud.tencent.com |
847889e16e3bd3550569db29c5361a86553d6bf7 | f4b60f5e49baf60976987946c20a8ebca4880602 | /lib64/python2.7/site-packages/acimodel-1.3_2j-py2.7.egg/cobra/modelimpl/ident/contextelement.py | b380cc640393755a40695dbc4560e4f854377a06 | [] | no_license | cqbomb/qytang_aci | 12e508d54d9f774b537c33563762e694783d6ba8 | a7fab9d6cda7fadcc995672e55c0ef7e7187696e | refs/heads/master | 2022-12-21T13:30:05.240231 | 2018-12-04T01:46:53 | 2018-12-04T01:46:53 | 159,911,666 | 0 | 0 | null | 2022-12-07T23:53:02 | 2018-12-01T05:17:50 | Python | UTF-8 | Python | false | false | 4,121 | py | # coding=UTF-8
# **********************************************************************
# Copyright (c) 2013-2016 Cisco Systems, Inc. All rights reserved
# written by zen warriors, do not modify!
# **********************************************************************
from cobra.mit.meta import ClassMeta
from cobra.m... | [
"collinsctk@qytang.com"
] | collinsctk@qytang.com |
9a0e63c5b5b8525ef929e64c55a91bb636cdfab2 | 163bbb4e0920dedd5941e3edfb2d8706ba75627d | /Code/Cases/2938/.mooctest/answer.py | 8566383381c158a21b1b6cefb037db2930fa8950 | [] | no_license | AdamZhouSE/pythonHomework | a25c120b03a158d60aaa9fdc5fb203b1bb377a19 | ffc5606817a666aa6241cfab27364326f5c066ff | refs/heads/master | 2022-11-24T08:05:22.122011 | 2020-07-28T16:21:24 | 2020-07-28T16:21:24 | 259,576,640 | 2 | 1 | null | null | null | null | UTF-8 | Python | false | false | 449 | py | #include<bits/stdc++.h>//头文件
using namespace std;
string a[100];//定义要排序的字符串数组
stringstream ss;//百度一下，你就知道
int main(){
for(int i=1;i<=100;i++){//开始存入1-1000的数
ss<<i;
ss>>a[i-1];
ss.str("");//清空缓存
ss.clear();//充值(重置)状态
}
sort(a,a+100);//排序
for(int i=0;i<100;i++)
cout<<a[... | [
"382335657@qq.com"
] | 382335657@qq.com |
8885b77cdd0914bc461b0303e7c24a2db6ac1e80 | 2be8a9f06d4003d12c0a727fb83d284c31a53050 | /HoudiniHotBox17.0/lib/Cd_Material.py | 78316d6bcb22180bb4bd80f79268dcbe13118016 | [] | no_license | LiuLiangFx/SmileHotBOX | 7551d9578b2defe612950cb8e3bffdb85024cede | 8bd8eac69b3c2a9824b9aa4488ca77789bea8d85 | refs/heads/master | 2021-01-01T10:22:26.959731 | 2020-02-09T03:16:32 | 2020-02-09T03:16:32 | 239,236,801 | 0 | 0 | null | 2020-02-09T02:47:18 | 2020-02-09T02:47:18 | null | UTF-8 | Python | false | false | 1,494 | py | import hou
class Cd_Material:
def __init__(self):
self.pane=hou.ui.paneTabOfType(hou.paneTabType.NetworkEditor)
self.node= hou.selectedNodes()[0]
fl=open('material.txt', 'w')
fl.write(self.node.path())
fl.close()
def run(self):
if self.node.typ... | [
"change52092@yahoo.com"
] | change52092@yahoo.com |
82d781cf2b96438286ea7fd29e2c1490e21df986 | 6191bad7750404bc0bcaec43a8dea51b52980f04 | /Seção_07/Collections/deque.py | b4b481fd5e7d3175e21b72433dcb6f37509d11ff | [] | no_license | Lehcs-py/guppe | abfbab21c1b158b39251fa6234a4a98ce5f31c2a | 2ff007bce88e065e6d3020971efd397ec7f7084b | refs/heads/main | 2023-02-26T18:43:06.052699 | 2021-02-07T18:22:53 | 2021-02-07T18:22:53 | 330,180,078 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 182 | py | from collections import deque
deq = deque('LEHCS')
print(deq)
deq.append('A')
print(deq)
deq.appendleft('D')
print(deq)
print(deq.pop())
print(deq)
print(deq.popleft())
print(deq)
| [
"noreply@github.com"
] | Lehcs-py.noreply@github.com |
438033b0dd31378c6fc09ace40f3c3bee1d9bafe | e5b4ed93d6666e195e96a265d3e7cfe4243a7300 | /hunter/hunter.py | 0914e6258d70bb3bcec304a85ffabec2451f20d3 | [] | no_license | Spider251/python | 934f5b8b923c2b61186a6df8445957290e5c4c74 | 8b1931f862e1d5c29fed9af624bcac94c1d25755 | refs/heads/master | 2020-04-05T11:58:04.558098 | 2018-11-09T12:06:06 | 2018-11-09T12:06:06 | 156,852,553 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,098 | py | '''
实现猎人的功能
需要传入的参数:1.所有人员的字典
'''
# person 所有角色共有的属性
# survival 所有人员存活情况{1:0,2:1...} 键1代表角色号码,值0为死亡,1为存活
class hunter:
def __init__(self,survival):
self.survival = survival
def fun(self):
for i in self.survival:
if i == 2:
if self.survival[i] == 1:
... | [
"1419418693@qq.com"
] | 1419418693@qq.com |
1fc8cb941330ce78d411f3edb862796a171a89fc | e77b92df446f0afed18a923846944b5fd3596bf9 | /Inflearn_algo/section7_dfs_bfs/pro1_maxScore_re.py | 7feac790f2615b319b2bc54fde9f4010284f4fdd | [] | no_license | sds1vrk/Algo_Study | e40ca8eb348d1fc6f88d883b26195b9ee6f35b2e | fbbc21bb06bb5dc08927b899ddc20e6cde9f0319 | refs/heads/main | 2023-06-27T05:49:15.351644 | 2021-08-01T12:43:06 | 2021-08-01T12:43:06 | 356,512,348 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 635 | py | # 최대 점수 구하기 (DFS)
# 문제를 푼다, 안푼다라는 개념으로 가야됨
import sys
sys.stdin=open("input.txt","r")
n,m=map(int,input().split())
ss=[]
tt=[]
for i in range(n):
a,b=map(int,input().split())
ss.append(a)
tt.append(b)
max_score=-1
def dfs(l,s,t):
global max_score
# 가지치기 t가 m을 넘으면 더이상 할 필요 없음
if t>m:
r... | [
"51287886+sds1vrk@users.noreply.github.com"
] | 51287886+sds1vrk@users.noreply.github.com |
3674de65b0e09eba8a92b497cf4a7530fb460826 | d53bc632503254ca0d5099fe457c02c07212a131 | /cookieproject1/cookieproject1/wsgi.py | 0e0d958b3a4961808057c49586b4e5768c75d831 | [] | no_license | srikar1993/django | ba8428f6e1162cc40f2d034126e7baf29eb62edc | 2199d5d94accc7bce5b3fac4a4b7b1444e39b35f | refs/heads/master | 2023-07-14T21:10:52.654992 | 2021-08-26T06:37:04 | 2021-08-26T06:37:04 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 405 | py | """
WSGI config for cookieproject1 project.
It exposes the WSGI callable as a module-level variable named ``application``.
For more information on this file, see
https://docs.djangoproject.com/en/2.2/howto/deployment/wsgi/
"""
import os
from django.core.wsgi import get_wsgi_application
os.environ.setdefault('DJANG... | [
"32321399+srikar.madhavapeddy@users.noreply.github.com"
] | 32321399+srikar.madhavapeddy@users.noreply.github.com |
eb6f175b0c5788c950623020ee524b875e28fc23 | bafd37fdbaf76d5d7dabd9c07985969b3924f9c8 | /example_client/example.py | 9671da3b0660af7e0bb9fe806d6331467f1918ae | [
"Apache-2.0"
] | permissive | k24dizzle/nagios_registration | 2c1c95c7c871ee8ed31de46d555c812f2c0f41c8 | be18dbadd2c08def81e795e4afe2fe2cf41775cf | refs/heads/master | 2020-03-08T11:54:30.569982 | 2015-07-16T18:01:07 | 2015-07-16T18:01:07 | 128,111,583 | 1 | 0 | null | 2018-04-04T19:32:53 | 2018-04-04T19:32:52 | null | UTF-8 | Python | false | false | 3,263 | py | import oauth2
import json
###
#
# This script will create 2 hosts, and add them to a host group.
# It will then create a service, and assign that service to both hosts.
# It will then deploy a new nagios configuration file.
#
###
consumer_key = "OAUTH_KEY"
consumer_secret = "OAUTH_SECRET"
registration_server = "http... | [
"pmichaud@uw.edu"
] | pmichaud@uw.edu |
05546c27ea40660996b98f84d8a1a0f04a42c288 | 85bf9a13bf62c1f074894d134c23dd992ae8688c | /problems/p317/Solution.py | 6d55e5a066806320f5503f718d38b8fa74f2166f | [] | no_license | pololee/oj-leetcode | 4cca3d309b2c9931d15d3cec4b07b5d9d22733ef | 78a8b27ee108ba93aa7b659665976112f48fc2c2 | refs/heads/master | 2020-06-21T02:15:26.882273 | 2020-02-06T04:56:21 | 2020-02-06T04:56:21 | 197,320,113 | 0 | 0 | null | 2020-02-06T04:56:23 | 2019-07-17T05:20:02 | Python | UTF-8 | Python | false | false | 2,336 | py | import collections
import sys
class Solution:
DIRECTIONS = [(1, 0), (0, 1), (-1, 0), (0, -1)]
def shortestDistance(self, grid):
"""
:type grid: List[List[int]]
:rtype: int
"""
if not grid:
return 0
row_size = len(grid)
col_size = len(grid[0]... | [
"pololee1990@gmail.com"
] | pololee1990@gmail.com |
acbbec5e9fde66dc1ec45b08c53724a5018010e7 | e3365bc8fa7da2753c248c2b8a5c5e16aef84d9f | /indices/tenderli.py | 28ba6f38f41106cd5c55dcedcbdf538f5a5cc99c | [] | no_license | psdh/WhatsintheVector | e8aabacc054a88b4cb25303548980af9a10c12a8 | a24168d068d9c69dc7a0fd13f606c080ae82e2a6 | refs/heads/master | 2021-01-25T10:34:22.651619 | 2015-09-23T11:54:06 | 2015-09-23T11:54:06 | 42,749,205 | 2 | 3 | null | 2015-09-23T11:54:07 | 2015-09-18T22:06:38 | Python | UTF-8 | Python | false | false | 835 | py | ii = [('GodwWSL2.py', 4), ('FerrSDO3.py', 3), ('WilbRLW.py', 1), ('WilbRLW4.py', 2), ('AubePRP2.py', 1), ('CookGHP.py', 1), ('KembFJ1.py', 2), ('WilbRLW5.py', 2), ('TennAP.py', 1), ('BailJD2.py', 3), ('WilbRLW2.py', 1), ('LyttELD.py', 3), ('CoopJBT2.py', 1), ('GrimSLE.py', 1), ('AinsWRR3.py', 2), ('RoscTTI2.py', 2), ('... | [
"prabhjyotsingh95@gmail.com"
] | prabhjyotsingh95@gmail.com |
4120d60565a39b46cd5b6d64ed972b8c46931722 | 5a298ece5b17e6e993d50a855027f265e115e2bd | /utilities/filter_data.py | 99687a7e234137d21978c275dd56b29a9d74c2f1 | [] | no_license | hvk3/IR_project | 86b8a1176f6a8ed541f179f1c541eb139dde0295 | ae6deea2276f0a76bfa23482fd1b7a4c1f039264 | refs/heads/master | 2021-10-16T17:33:11.258479 | 2019-02-12T08:45:51 | 2019-02-12T08:45:51 | 118,168,898 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 569 | py | from pymongo import MongoClient
from langdetect import detect
from tqdm import tqdm
client = MongoClient()
db = client.youtube8m
ds_1 = db.iteration3
ds_2 = db.iteration4
ds_2.remove()
print("Before:", ds_1.find().count())
for record in tqdm(ds_1.find()):
title = record['metadata']['title']
description = record['me... | [
"anshuman14021@iiitd.ac.in"
] | anshuman14021@iiitd.ac.in |
87466cd291f6c19586b503ef7109c6a64acf8ca6 | 39157a854806af4db51b986adf5096bd342bacdb | /fuzznumpy/main.py | 68c4295fe915c1b180f9319956c9abc08d8c52e3 | [] | no_license | xcainiao/fuzzing | b6b43550f7a5c05595a180d111d9ec03e4710293 | 5cadbe3e1bcc9090a68b1006cb5b6b76db990ae1 | refs/heads/master | 2020-03-30T01:51:59.811511 | 2018-09-27T14:25:05 | 2018-09-27T14:25:05 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 410 | py | import fuzz
import numpy as np
from ctypes import CDLL
test = CDLL("c/test.so")
test.init()
fuzz.init()
while 1:
func = fuzz.generate()
# func = """import numpy\nnumpy.half(-1).choose(numpy.void(1), numpy.broadcast_arrays((1,)))"""
test.copybuff(func)
try:
exec(func, {"np":np})
except Exception ... | [
"you@example.com"
] | you@example.com |
1df190b393e91b1201a3c30b120bc9a49a40a1b8 | 65329299fca8dcf2e204132624d9b0f8f8f39af7 | /napalm_yang/models/openconfig/network_instances/network_instance/protocols/protocol/ospfv2/areas/area/lsdb/lsa_types/lsa_type/lsas/lsa/opaque_lsa/router_information/tlvs/tlv/segment_routing_sid_label_range/__init__.py | e65b58e4df63d726184cc67034cd38bbeac27625 | [
"Apache-2.0"
] | permissive | darylturner/napalm-yang | bf30420e22d8926efdc0705165ed0441545cdacf | b14946b884ad2019b896ee151285900c89653f44 | refs/heads/master | 2021-05-14T12:17:37.424659 | 2017-11-17T07:32:49 | 2017-11-17T07:32:49 | 116,404,171 | 0 | 0 | null | 2018-01-05T16:21:37 | 2018-01-05T16:21:36 | null | UTF-8 | Python | false | false | 9,972 | py |
from operator import attrgetter
from pyangbind.lib.yangtypes import RestrictedPrecisionDecimalType, RestrictedClassType, TypedListType
from pyangbind.lib.yangtypes import YANGBool, YANGListType, YANGDynClass, ReferenceType
from pyangbind.lib.base import PybindBase
from decimal import Decimal
from bitarray import bitar... | [
"dbarrosop@dravetech.com"
] | dbarrosop@dravetech.com |
d33d903e7de59d03eac8b1c9b2af624e056b3328 | b8faf65ea23a2d8b119b9522a0aa182e9f51d8b1 | /vmraid/website/doctype/social_link_settings/social_link_settings.py | 35954b6ce718f192fa921627f23f3e2a83b1b277 | [
"MIT"
] | permissive | vmraid/vmraid | a52868c57b1999a8d648441eb9cd05815204345d | 3c2e2a952003ba7ea2cf13673b9e79e127f4166e | refs/heads/main | 2022-07-29T18:59:28.585133 | 2022-04-22T08:02:52 | 2022-04-22T08:02:52 | 372,473,120 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 215 | py | # -*- coding: utf-8 -*-
# Copyright (c) 2020, VMRaid Technologies and contributors
# License: MIT. See LICENSE
# import vmraid
from vmraid.model.document import Document
class SocialLinkSettings(Document):
pass
| [
"sowrisurya@outlook.com"
] | sowrisurya@outlook.com |
f819a142bd8930f08e51e57ed6af15a211801e81 | 4bcae7ca3aed842d647d9112547522cffa805d51 | /0674.最长连续递增序列.py | 43854333b238384701a6a84adb3ed71f0d9e3655 | [] | no_license | SLKyrim/vscode-leetcode | fd5a163f801661db0dfae1d4fdfa07b79fdb82b6 | 65a271c05258f447d3e56755726f02179780eb8a | refs/heads/master | 2021-07-03T03:15:28.883786 | 2021-02-23T06:19:18 | 2021-02-23T06:19:18 | 226,062,540 | 2 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,286 | py | #
# @lc app=leetcode.cn id=674 lang=python3
#
# [674] 最长连续递增序列
#
# https://leetcode-cn.com/problems/longest-continuous-increasing-subsequence/description/
#
# algorithms
# Easy (45.18%)
# Likes: 89
# Dislikes: 0
# Total Accepted: 30.7K
# Total Submissions: 68K
# Testcase Example: '[1,3,5,4,7]'
#
# 给定一个未经排序的整数数组，... | [
"623962644@qq.com"
] | 623962644@qq.com |
b26dfc2cc4ffb4aa822cac635d3e83c1522e9304 | 04b3a30ca30c3a9cc459b06fe1842a500dd5ab51 | /addresss/views.py | 06c24539f8cc82d589e80f97797e2431e41d5162 | [] | no_license | rahulsayon/Final-Ecommerce | 17b7830e44ab86b7513f48d80fc1bb7f12c36516 | ca0c860653ec1b80f0a3f012e338ecc2189019ac | refs/heads/master | 2022-12-11T01:12:03.500783 | 2020-09-13T20:09:40 | 2020-09-13T20:09:40 | 295,228,975 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,454 | py | from django.shortcuts import render
from .forms import AddressForm
from django.shortcuts import redirect
from billing.models import BillingProfile
from django.utils.http import is_safe_url
from addresss.models import Address
# Create your views here.
def checkout_address_create_view(request):
form = AddressForm(r... | [
"rahulsayon95@gmail.com"
] | rahulsayon95@gmail.com |
a75d04852aca116b804d4a5aa819b764cddff608 | 5d9636dcae2471d700da5583cfc0359644c7322d | /pugsley/auth/routes.py | 78e16175c4ac581d44b4ba571f9a66b393c72966 | [
"MIT"
] | permissive | kfields/pugsley-lite | 93a4c7c334fd9b4f3ab68acc565b1f29a4a31b99 | 9fdd4868895b38fb81855952f19bdf9cca1635b3 | refs/heads/master | 2023-01-24T18:29:15.338112 | 2019-08-11T20:33:30 | 2019-08-11T20:33:30 | 179,791,236 | 1 | 0 | MIT | 2023-01-09T22:22:33 | 2019-04-06T05:09:26 | CSS | UTF-8 | Python | false | false | 4,521 | py | from flask import render_template, redirect, url_for, flash, request, jsonify
from werkzeug.urls import url_parse
from flask_login import login_user, logout_user, current_user
from flask_babel import _
from pugsley import db
from pugsley.jwt import encode_auth_token
from pugsley.auth import bp
from pugsley.auth.forms i... | [
"kurtisfields@gmail.com"
] | kurtisfields@gmail.com |
d8982a501517e741145cac724e03b59326021d7d | 09e5cfe06e437989a2ccf2aeecb9c73eb998a36c | /modules/dxtbx/command_line/print_header.py | 0927cef0df1adb502a68d0f8709b4377dcad155a | [
"BSD-3-Clause"
] | permissive | jorgediazjr/dials-dev20191018 | b81b19653624cee39207b7cefb8dfcb2e99b79eb | 77d66c719b5746f37af51ad593e2941ed6fbba17 | refs/heads/master | 2020-08-21T02:48:54.719532 | 2020-01-25T01:41:37 | 2020-01-25T01:41:37 | 216,089,955 | 0 | 1 | BSD-3-Clause | 2020-01-25T01:41:39 | 2019-10-18T19:03:17 | Python | UTF-8 | Python | false | false | 1,633 | py | from __future__ import absolute_import, division, print_function
import sys
from scitbx.array_family import flex
from dxtbx.format.FormatMultiImage import FormatMultiImage
from dxtbx.format.Registry import Registry
def print_header():
# this will do the lookup for every frame - this is strictly not needed
... | [
"jorge7soccer@gmail.com"
] | jorge7soccer@gmail.com |
1c930c629d264c1b02af2492b5b962be70f570d9 | d6589ff7cf647af56938a9598f9e2e674c0ae6b5 | /nlp-automl-20191111/setup.py | 7541638ca97742a773686465bb0c04174993e7bc | [
"Apache-2.0"
] | permissive | hazho/alibabacloud-python-sdk | 55028a0605b1509941269867a043f8408fa8c296 | cddd32154bb8c12e50772fec55429a9a97f3efd9 | refs/heads/master | 2023-07-01T17:51:57.893326 | 2021-08-02T08:55:22 | 2021-08-02T08:55:22 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,647 | py | # -*- coding: utf-8 -*-
"""
Licensed to the Apache Software Foundation (ASF) under one
or more contributor license agreements. See the NOTICE file
distributed with this work for additional information
regarding copyright ownership. The ASF licenses this file
to you under the Apache License, Version 2.0 (the
"Li... | [
"sdk-team@alibabacloud.com"
] | sdk-team@alibabacloud.com |
48692f6bb82436458dcda51926e85f92d86ed1ad | 589b5eedb71d83c15d44fedf60c8075542324370 | /project/stock_project/alpha_model/alpha_factor/ARAPIncomeTTM.py | 605a216d31fef56f1a88b39a3a9a2b23dfa799dd | [] | no_license | rlcjj/quant | 4c2be8a8686679ceb675660cb37fad554230e0d4 | c07e8f0f6e1580ae29c78c1998a53774a15a67e1 | refs/heads/master | 2020-03-31T07:15:48.111511 | 2018-08-27T05:29:00 | 2018-08-27T05:29:00 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,685 | py | import pandas as pd
from quant.stock.stock import Stock
from quant.stock.date import Date
from quant.stock.stock_factor_operate import StockFactorOperate
def ARAPIncomeTTM(beg_date, end_date):
"""
因子说明：(预收账款 + 应付账款) / 营业总收入 TTM
最近一期财报 实时更新
若有一个为负值 结果为负值
"""
# param
######################... | [
"1119332482@qq.com"
] | 1119332482@qq.com |
ba5fe81af0632687c14d963ae372ba1b8ee5503f | a8750439f200e4efc11715df797489f30e9828c6 | /CodeForces/EC_46_2_C_1.py | 8ee3122998960e839a22312f1db953f98a96581f | [] | no_license | rajlath/rkl_codes | f657174305dc85c3fa07a6fff1c7c31cfe6e2f89 | d4bcee3df2f501349feed7a26ef9828573aff873 | refs/heads/master | 2023-02-21T10:16:35.800612 | 2021-01-27T11:43:34 | 2021-01-27T11:43:34 | 110,989,354 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 310 | py | n = int(input())
a = []
for i in range(n):
l, r = [int(x) for x in input().split()]
a.append([l, 1])
a.append([r+1, -1])
a = sorted(a)
ans = [0] * (n + 1)
idx = 0
for i in range(len(a) - 1):
idx += a[i][1]
ans[idx] += a[i+1][0] - a[i][0]
for i in range(1, n+1):
print(ans[i], end = " ") | [
"raj.lath@gmail.com"
] | raj.lath@gmail.com |
9b05b73cd5f0370491f151c54c36a981422be0f9 | 16b567ed93c10287f7b9e90ddc819512aadbcaf5 | /filters/stopwords_filter.py | c69ebfd10592f81b4efc0b75d78a5a7c9c1a54df | [] | no_license | Rigel772/python-keyword-density | b3bdfb70e06e53264be7507e4111a923b40ea51a | c3a4469360de3d7c02dd9b8de2dc7eac45a3253a | refs/heads/master | 2020-05-19T11:28:23.854324 | 2018-11-02T13:22:51 | 2018-11-02T13:22:51 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 647 | py | #-*- coding: utf-8 -*-
import os.path
from .base_filter import BaseFilter
class StopwordsFilter(BaseFilter):
def __init__(self, country):
super(StopwordsFilter, self).__init__()
self.country = country
stopword_fname = '%s.txt' % self.country
folder_name = os.path.dirname(__file__)... | [
"you@example.com"
] | you@example.com |
e638da845ef167b11b3122f120cd0e44acefa0de | e93c6e93f612bca7f192adf539b4f489ad114ab5 | /m01_basics/l_07_nested_data.py | 6739ccff73e049c4db47923a80292b1b7f11a800 | [
"MIT"
] | permissive | be1iever/python-52-weeks | 8d57a10af9c0f5309ba21a9503a8fdf4bd82840c | 185d8b3147c6bfb069d58e4933b74792081bf8f2 | refs/heads/main | 2023-08-19T08:21:45.330447 | 2021-09-21T15:00:28 | 2021-09-21T15:00:28 | 409,847,518 | 1 | 0 | MIT | 2021-09-24T05:51:14 | 2021-09-24T05:51:13 | null | UTF-8 | Python | false | false | 2,506 | py | from pprint import pprint
from random import choice
import copy
from util.create_utils import create_network
device = {
"name": "r3-L-n7",
"vendor": "cisco",
"model": "catalyst 2960",
"os": "ios",
"interfaces": [
]
}
print("\n\n----- device with no interfaces --------------------")
for key, ... | [
"chuck.a.black@gmail.com"
] | chuck.a.black@gmail.com |
ce2469650940b0fa5dfceaad6a4836793f0f23b9 | 30fd01dbae99721069d936d5daa6a8050488a248 | /hacker/FirefoxSQLite.py | 7da8415a2e85749f5c5b4f1f6d446bc2933e030b | [] | no_license | chenshuo666/mypython | 6b334ad42b117c2750129028e82037643d99ab6a | 3cfcf49f2d6cc3733d244cc7eb212a4dba6a439a | refs/heads/master | 2020-03-10T04:04:35.530485 | 2018-04-17T04:02:16 | 2018-04-17T04:02:16 | 129,182,623 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 3,999 | py | #!/usr/bin/python
# coding=utf-8
import re
import optparse
import os
import sqlite3
# 解析打印downloads.sqlite文件的内容，输出浏览器下载的相关信息
def printDownloads(downloadDB):
conn = sqlite3.connect(downloadDB)
c = conn.cursor()
c.execute('SELECT name, source, datetime(endTime/1000000, \'unixepoch\') FROM moz_downloads;')
... | [
"929387146@qq.com"
] | 929387146@qq.com |
086f919dc5d77d92ce256911cf93cd83d411d684 | e5f194129752f3f89eed53478416d2c92cde0259 | /.cache/Microsoft/Python Language Server/stubs.v4/PW5N1gWcYNUaFmNEjFpBbn4_TkxeV53eiQaZBrpg6xw=/python3.pyi | 8befe0f027be53bb4d55f3d4c9c1399a04b4cd3d | [] | no_license | stepin-s/st | 1677fc25cb42c36afd76d2e3a48a1c0a5daf1b93 | b4cf346a446d57210197ee7f6f809cbc0a5b8799 | refs/heads/master | 2023-07-27T17:37:39.268414 | 2021-05-25T12:08:10 | 2021-05-25T12:08:10 | 405,090,749 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 230,782 | pyi | class NotImplementedType(object):
__class__ = NotImplementedType
def __init__(self, *args, **kwargs):
pass
@classmethod
def __init_subclass__(cls):
'This method is called when a class is subclassed.\n\nThe default implementation does nothing. It may be\noverridden to extend subclass... | [
"stpn.s@yandex.ru"
] | stpn.s@yandex.ru |
7e39d9636d8d51231c8e255ea73707f11e4c337e | 56ffce29f0d27f83206e11870d95982c38524aae | /apweb/site/view/session_test.py | a77c127ed42f7fbac3078f43a773ba651e4786d4 | [] | no_license | adamandpaul/apweb | cce365085e2ee58cfbc31544c5a7414e67ad56b4 | b1bb81fa7d7b39f19e187462aa3447ff482b46af | refs/heads/master | 2022-10-19T02:09:52.437906 | 2021-05-21T06:10:08 | 2021-05-21T06:10:08 | 201,398,036 | 0 | 3 | null | 2022-09-21T21:39:41 | 2019-08-09T05:41:06 | Python | UTF-8 | Python | false | false | 691 | py | # -*- coding:utf-8 -*-
from . import session
from unittest import TestCase
from unittest.mock import MagicMock
from unittest.mock import patch
class TestSessionView(TestCase):
def setUp(self):
self.request = MagicMock()
self.context = MagicMock()
self.view = session.SessionView(self.conte... | [
"arterrey@gmail.com"
] | arterrey@gmail.com |
99bc5f810433c2c56027c7cadd2f629bb37f2406 | 7f33d68323240d66e610e5a89efc516915a11a96 | /manage.py | cd6b58f7934e4cd956b6d3cad8298609c08f1d21 | [
"Apache-2.0"
] | permissive | dbca-wa/observations | 100df2765ef0f6f62aaf45fc13fbb4af4395f519 | 48b2ad17afa9f0019524cb22a9a0bba74850b87f | refs/heads/master | 2021-05-31T16:29:30.906717 | 2016-04-06T02:42:05 | 2016-04-06T02:42:05 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 297 | py | #!/usr/bin/env python
import os
import sys
import confy
confy.read_environment_file()
if __name__ == "__main__":
os.environ.setdefault("DJANGO_SETTINGS_MODULE", "incredibus.settings")
from django.core.management import execute_from_command_line
execute_from_command_line(sys.argv)
| [
"asi@dpaw.wa.gov.au"
] | asi@dpaw.wa.gov.au |
c538fb5cbdac74431e65498c5bb4964e8dcd47c5 | 63768dc92cde5515a96d774a32facb461a3bf6e9 | /jacket/compute/cloud/vm_mode.py | 7ca85fbd53edb92822a9d5b0385735b37fb28c03 | [
"Apache-2.0"
] | permissive | ljZM33nd/jacket | 6fe9156f6f5789e5c24425afa7ce9237c302673d | d7ad3147fcb43131098c2a5210847634ff5fb325 | refs/heads/master | 2023-04-16T11:02:01.153751 | 2016-11-15T02:48:12 | 2016-11-15T02:48:12 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,212 | py | # Copyright 2012 Red Hat, Inc.
# All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License. You may obtain
# a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by... | [
"nkapotoxin@gmail.com"
] | nkapotoxin@gmail.com |
8beeae688c7148ebe2715f0ca83ccfd8f6ce9996 | 6b9084d234c87d7597f97ec95808e13f599bf9a1 | /data/tracking/sampler/SiamFC/_deprecated/sampler.py | db5571b4db36b29aa180d356235ddcd410d4e57c | [] | no_license | LitingLin/ubiquitous-happiness | 4b46234ce0cb29c4d27b00ec5a60d3eeb52c26fc | aae2d764e136ca4a36c054212b361dd7e8b22cba | refs/heads/main | 2023-07-13T19:51:32.227633 | 2021-08-03T16:02:03 | 2021-08-03T16:02:03 | 316,664,903 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 6,797 | py | import numpy as np
from Dataset.SOT.Storage.MemoryMapped.dataset import SingleObjectTrackingDataset_MemoryMapped
from Dataset.MOT.Storage.MemoryMapped.dataset import MultipleObjectTrackingDataset_MemoryMapped
from Dataset.DET.Storage.MemoryMapped.dataset import DetectionDataset_MemoryMapped
from data.tracking.sampler.... | [
"linliting06@live.com"
] | linliting06@live.com |
7b67372b80781dbc722821dd0e9e4fccabe7148f | 2ad9a73cb3e2da46fb15ae56a6dee11407fe8845 | /ports/kodi/addons/plugin.video.transistortv/scrapers/premiumizev2_scraper.py | 69c8e67f70be1ddef948a478838c26a63220c567 | [] | no_license | hpduong/retropie_configs | cde596b35897a3faeedefabd742fc15820d58255 | ed4e39146e5bebc0212dcef91108541a128d9325 | refs/heads/master | 2021-07-12T15:46:17.589357 | 2018-11-11T19:10:54 | 2018-11-11T19:10:54 | 157,111,040 | 1 | 2 | null | 2020-07-24T03:43:29 | 2018-11-11T18:59:52 | Python | UTF-8 | Python | false | false | 9,637 | py | """
SALTS XBMC Addon
Copyright (C) 2014 tknorris
This program is free software: you can redistribute it and/or modify
it under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
T... | [
"henryduong@gmail.com"
] | henryduong@gmail.com |
bc0c564fc708099ee3a1ee9245efc66093f51371 | 52cb25dca22292fce4d3907cc370098d7a57fcc2 | /BAEKJOON/스택/1874_스택 수열.py | cd390374565cc30f00a17f883e2ac40791b3a1f1 | [] | no_license | shjang1013/Algorithm | c4fc4c52cbbd3b7ecf063c716f600d1dbfc40d1a | 33f2caa6339afc6fc53ea872691145effbce0309 | refs/heads/master | 2022-09-16T12:02:53.146884 | 2022-08-31T16:29:04 | 2022-08-31T16:29:04 | 227,843,135 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 564 | py | # 1부터 n까지의 수를 스택에 넣었다가 뽑아 늘어놓음으로써, 하나의 수열을 만들 수 있다.
# [1,2,3,4,5,6,7,8] => [4,3,6,8,7,5,2,1]
import sys
N = int(input())
stack = []
op = []
count = 1
temp = True
for i in range(N):
n = int(sys.stdin.readline())
while count <= n:
stack.append(count)
op.append("+")
count += 1
... | [
"shjang113@gmail.com"
] | shjang113@gmail.com |
bc7d8ecba2ea3d08d1b0d03ab497311104f63738 | ff93e108a358a40d71b426bb9615587dfcab4d03 | /Python_Basic/9_Class/class_basics_1.py | 626a48139eb7a1d686767ec3a31ac348d0fbd5a3 | [] | no_license | soumya9988/Python_Machine_Learning_Basics | 074ff0e8e55fd925ca50e0f9b56dba76fc93d187 | 3711bc8e618123420985d01304e13051d9fb13e0 | refs/heads/master | 2020-03-31T14:31:49.217429 | 2019-11-16T21:55:54 | 2019-11-16T21:55:54 | 152,298,905 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 3,299 | py | class Menu:
def __init__(self, name, items, start_time, end_time):
self.name = name
self.items = items
self.start_time = start_time
self.end_time = end_time
def __repr__(self):
return '{} menu available from {} to {}'.format(self.name,
... | [
"soumya.9988@gmail.com"
] | soumya.9988@gmail.com |
9efe909c265f82499d2be6a904c8fd902fed2bcb | 19236d9e966cf5bafbe5479d613a175211e1dd37 | /cohesity_management_sdk/models/google_cloud_credentials.py | 7e3886d7a27110ac94aca21b0b5ecde8f814ff97 | [
"MIT"
] | permissive | hemanshu-cohesity/management-sdk-python | 236c44fbd9604809027f8ddd0ae6c36e4e727615 | 07c5adee58810979780679065250d82b4b2cdaab | refs/heads/master | 2020-04-29T23:22:08.909550 | 2019-04-10T02:42:16 | 2019-04-10T02:42:16 | 176,474,523 | 0 | 0 | NOASSERTION | 2019-03-19T09:27:14 | 2019-03-19T09:27:12 | null | UTF-8 | Python | false | false | 3,125 | py | # -*- coding: utf-8 -*-
# Copyright 2019 Cohesity Inc.
class GoogleCloudCredentials(object):
"""Implementation of the 'Google Cloud Credentials.' model.
Specifies the cloud credentials to connect to a Google service account.
Attributes:
client_email_address (string): Specifies the client email ... | [
"ashish@cohesity.com"
] | ashish@cohesity.com |
7932c0ccbe52f6dff8961451ec9518ed9b1d0ba0 | c0d5b7f8e48a26c6ddc63c76c43ab5b397c00028 | /piccolo/apps/user/piccolo_app.py | c01ee635f12d335e6a45650fda81dbfe9fab4925 | [
"MIT"
] | permissive | aminalaee/piccolo | f6c5e5e1c128568f7ccb9ad1dfb4746acedae262 | af8d2d45294dcd84f4f9b6028752aa45b699ec15 | refs/heads/master | 2023-07-14T09:44:04.160116 | 2021-07-11T22:56:27 | 2021-07-11T22:56:27 | 386,398,401 | 0 | 0 | MIT | 2021-07-15T19:32:50 | 2021-07-15T19:08:17 | null | UTF-8 | Python | false | false | 729 | py | import os
from piccolo.conf.apps import AppConfig, Command
from .commands.change_password import change_password
from .commands.change_permissions import change_permissions
from .commands.create import create
from .tables import BaseUser
CURRENT_DIRECTORY = os.path.dirname(os.path.abspath(__file__))
APP_CONFIG = A... | [
"dan@dantownsend.co.uk"
] | dan@dantownsend.co.uk |
db2cdc19635349844c5e850f4b577b0118d4ae0e | 29a4c1e436bc90deaaf7711e468154597fc379b7 | /modules/trigonometric/doc/fast_sind.py | 46fee4678b0eeccbe7f58327e5d8b321d06b825f | [
"BSL-1.0"
] | permissive | brycelelbach/nt2 | 31bdde2338ebcaa24bb76f542bd0778a620f8e7c | 73d7e8dd390fa4c8d251c6451acdae65def70e0b | refs/heads/master | 2021-01-17T12:41:35.021457 | 2011-04-03T17:37:15 | 2011-04-03T17:37:15 | 1,263,345 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,873 | py | [ ## this file was manually modified by jt
{
'functor' : {
'arity' : '1',
'call_types' : [],
'ret_arity' : '0',
'rturn' : {
'default' : 'typename boost::result_of<nt2::meta::floating(T)>::type',
},
'simd_types' : ['real_convert_'],
... | [
"jtlapreste@gmail.com"
] | jtlapreste@gmail.com |
a937f5d7fc87c0d7d50c3d34d25169594f08b310 | 3ef70fe63acaa665e2b163f30f1abd0a592231c1 | /stackoverflow/venv/lib/python3.6/site-packages/twisted/protocols/haproxy/_v1parser.py | b17099f3cc388868573fb479110f29e78e8bce65 | [
"MIT",
"LicenseRef-scancode-unknown-license-reference"
] | permissive | wistbean/learn_python3_spider | 14914b63691ac032955ba1adc29ad64976d80e15 | 40861791ec4ed3bbd14b07875af25cc740f76920 | refs/heads/master | 2023-08-16T05:42:27.208302 | 2023-03-30T17:03:58 | 2023-03-30T17:03:58 | 179,152,420 | 14,403 | 3,556 | MIT | 2022-05-20T14:08:34 | 2019-04-02T20:19:54 | Python | UTF-8 | Python | false | false | 4,326 | py | # -*- test-case-name: twisted.protocols.haproxy.test.test_v1parser -*-
# Copyright (c) Twisted Matrix Laboratories.
# See LICENSE for details.
"""
IProxyParser implementation for version one of the PROXY protocol.
"""
from zope.interface import implementer
from twisted.internet import address
from ._exceptions impo... | [
"354142480@qq.com"
] | 354142480@qq.com |
60bd09afebd2a97319aa608a6ee44a7fd37b29a0 | 53bd30eee243a73bf19921739454a177a8bab127 | /excapp/migrations/0002_datahistory.py | 31da2844c89998a546d9f612985ee6253eeef234 | [] | no_license | kirigaikabuto/bck | 61697fbe2edd7e4f5b866628a368693a05f6dad9 | 2b17f8c5d438248d73aaf9dbebd3d5dea827a42d | refs/heads/master | 2021-02-04T01:20:06.470527 | 2021-01-04T15:24:13 | 2021-01-04T15:24:13 | 243,593,240 | 0 | 0 | null | 2020-06-06T01:30:15 | 2020-02-27T18:55:15 | Python | UTF-8 | Python | false | false | 745 | py | # Generated by Django 2.2.10 on 2020-11-24 18:51
from django.db import migrations, models
import django.db.models.deletion
class Migration(migrations.Migration):
dependencies = [
('excapp', '0001_initial'),
]
operations = [
migrations.CreateModel(
name='DataHistory',
... | [
"ytleugazy@dar.kz"
] | ytleugazy@dar.kz |
095a21f6e7e82a88a8fae7ce3fa8b0c6adccd2dd | dd7cd2d6f613cb7ed1fd1fb917cb351e19db46dd | /week8/codingbat/list-1/make_pi.py | 009f45f2d14784488bdf27cd4bd54aa591d2318f | [] | no_license | ashkeyevli/webdevelopment | 0da187b25f669ff00c2de9662d5d28cde6ad270c | 57f32b384af80780f2578f109357c9451c7fc840 | refs/heads/master | 2023-01-24T03:14:08.574052 | 2020-04-18T02:19:08 | 2020-04-18T02:19:08 | 239,058,404 | 1 | 0 | null | 2023-01-07T15:29:57 | 2020-02-08T02:40:35 | Python | UTF-8 | Python | false | false | 32 | py |
def make_pi():
return [3,1,4]
| [
"ashkeyevli@gmail.com"
] | ashkeyevli@gmail.com |
f9b7ee977762ae5cc9961537a33f3dde790fefac | d24a6e0be809ae3af8bc8daa6dacfc1789d38a84 | /ABC/ABC251-300/ABC261/B.py | 82b39fd3459c8526f81da79d543af2d50a7983b2 | [] | no_license | k-harada/AtCoder | 5d8004ce41c5fc6ad6ef90480ef847eaddeea179 | 02b0a6c92a05c6858b87cb22623ce877c1039f8f | refs/heads/master | 2023-08-21T18:55:53.644331 | 2023-08-05T14:21:25 | 2023-08-05T14:21:25 | 184,904,794 | 9 | 0 | null | 2023-05-22T16:29:18 | 2019-05-04T14:24:18 | Python | UTF-8 | Python | false | false | 547 | py | def solve(n, a):
for i in range(n - 1):
for j in range(i + 1, n):
ij = a[i][j]
ji = a[j][i]
if ij == ji == "D":
continue
elif ij == "W" and ji == "L":
continue
elif ij == "L" and ji == "W":
continue
... | [
"cashfeg@gmail.com"
] | cashfeg@gmail.com |
604783e523d181a3faade46c376579c5a709636a | 26cc5db81f589bf04c1d6f5e69d4727466af3f5f | /server/api/__init__.py | 93a582e7ee0efeb1854e5a3d351c63126c4d386d | [
"MIT"
] | permissive | CSCDP/family-context-api | 1c7f6834d2e004dc48622dde68b2f3fc9157ee99 | ac3415cdc1ef649c10c85012a2bb2b24ab1d009e | refs/heads/master | 2023-01-08T23:33:20.980857 | 2021-02-18T11:14:03 | 2021-02-18T11:14:03 | 213,444,879 | 3 | 1 | MIT | 2022-12-12T08:53:24 | 2019-10-07T17:26:44 | Python | UTF-8 | Python | false | false | 48 | py | from .auth_controller import check_cookie_auth
| [
"kaj@k-si.com"
] | kaj@k-si.com |
b19e296e14053d689e9995c0c3db2c31aae5ef6f | 1c3fb3c990bd07259c1701c709a28ec45cd0c748 | /services/core-api/app/api/exports/response_models.py | 487ed88be6d03eb97e804a09afb57dc551a1dd8e | [
"Apache-2.0"
] | permissive | usingtechnology/mds | f973106232f73f773bb4bb57737094dd32b1bd3c | c9c542f729df21511ee46e184ea752bad0b7d10c | refs/heads/master | 2022-04-13T07:56:59.060216 | 2020-03-21T22:43:05 | 2020-03-21T22:43:05 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 5,537 | py | from app.extensions import api
from flask_restplus import fields
from app.api.mines.response_models import MINE_TENURE_TYPE_CODE_MODEL, MINE_COMMODITY_CODE_MODEL, MINE_DISTURBANCE_CODE_MODEL, MINE_STATUS_CODE_MODEL, MINE_REGION_OPTION, MINE_REPORT_DEFINITION_CATEGORIES, MINE_REPORT_DEFINITION_MODEL, MINE_REPORT_SUBMIS... | [
"bcgov-csnr-cd@gov.bc.ca"
] | bcgov-csnr-cd@gov.bc.ca |
3c46e5cd8e2c42fe17964f81fddb273c2e6424fc | debc9ddbb577ed68e907cfdb85e0f2c801fdc8af | /rx/linq/observable/onerrorresumenext.py | 490579fe1b84b19f1004b2c54d19d968ec1a33e2 | [
"Apache-2.0"
] | permissive | pstiasny/RxPY | 370eefc733de1241c1eac0dcdf8fa10780f71072 | 2bcf25ecbce1fbcd49d119bd73375572fbf9df5a | refs/heads/master | 2021-01-09T20:01:18.664034 | 2014-07-27T22:19:39 | 2014-07-27T22:19:39 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,487 | py | from six import add_metaclass
from rx.observable import Observable
from rx.anonymousobservable import AnonymousObservable
from rx.disposables import CompositeDisposable, SingleAssignmentDisposable, \
SerialDisposable
from rx.concurrency import immediate_scheduler
from rx.internal import ExtensionMethod
@add_metac... | [
"dag@brattli.net"
] | dag@brattli.net |
0f8e34d48b3d1c84947d5930430793223a87c3ef | 5b1e3abd07c4c048e429e0c58c2319e947ab8ffa | /lbforum/__init__.py | 9107c2bfe8fffe679cdfee154b7e961e9f59fd29 | [
"BSD-3-Clause"
] | permissive | MechanisM/LBForum | bdd84890faf28a5a7343fe4c8f3029a0423a9e69 | 5be3aedbba5c4974abc10c8bde245502e7484681 | refs/heads/master | 2021-01-16T23:14:48.432494 | 2011-08-05T13:57:43 | 2011-08-05T13:57:43 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 24 | py | __version__ = '0.9.13'
| [
"zbirder@gmail.com"
] | zbirder@gmail.com |
b6ebbb47ce8ed3feb705ac92c37cae8fce6f828d | 842184bc3c73bef3dd5c2ab523eb33f34b7809ea | /ledger_processor/test_ledger_processor.py | 0f1549e715a92ae4a28e218d752a9cddb2608f8c | [] | no_license | fawkesley/h-work-simulation | 1cb51515fcb57d1f12c13178b049c4e7f8d1702d | 3f150d773a73a2dc2646e7b9c102f298e26cb936 | refs/heads/master | 2021-05-29T22:12:30.148431 | 2015-06-12T16:53:32 | 2015-06-13T07:51:07 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,060 | py | import datetime
from decimal import Decimal
from os.path import dirname, join as pjoin
from nose.tools import assert_equal, assert_raises
from .ledger_processor import LedgerProcessor
EXAMPLE_LEDGER_FILENAME = pjoin(dirname(__file__), 'example_ledger.csv')
TEST_CASES = [
('john', datetime.date(2015, 1, 16), De... | [
"paul@paulfurley.com"
] | paul@paulfurley.com |
6aa3828a32163e80c8d12eaeda888341881c4a0d | f26322b62be667711ca13f3ea73d89b79011459b | /py/models/__init__.py | b4d9c72fe94e27e7ca8052d7c88a8308c3887b88 | [
"Apache-2.0"
] | permissive | zjZSTU/SPP-net | c37c3dcd05bd5fb04cf7ef7efda4ac7dfdc5f89d | e42166dddd37b9493a5aacef18303aa850b21be7 | refs/heads/master | 2022-07-09T22:46:16.254859 | 2020-04-04T15:09:19 | 2020-04-04T15:09:19 | 250,167,176 | 3 | 2 | Apache-2.0 | 2022-06-22T01:36:06 | 2020-03-26T05:12:56 | Python | UTF-8 | Python | false | false | 109 | py | # -*- coding: utf-8 -*-
"""
@date: 2020/3/26 下午4:20
@file: __init__.py.py
@author: zj
@description:
""" | [
"505169307@qq.com"
] | 505169307@qq.com |
d4fdbed76383d85a2fa0b5a4b0e41628313a2037 | 080bbe77da955b3917435c25fc63b90b0f3c724e | /botorch/test_functions/multi_objective.py | 5ea244ee18797620b86ffb02739a044648f09561 | [
"MIT"
] | permissive | irinaespejo/botorch | 3d15d962ff0f5bb34fbd11b2eb7549db755af705 | e4dcf603fdaf83f0e5f8b9b392f943c89dfff7eb | refs/heads/master | 2023-07-11T18:02:11.853790 | 2021-08-19T15:57:21 | 2021-08-19T15:58:12 | 316,017,084 | 0 | 0 | MIT | 2020-11-25T18:02:11 | 2020-11-25T18:02:09 | null | UTF-8 | Python | false | false | 25,982 | py | #! /usr/bin/env python3
# Copyright (c) Facebook, Inc. and its affiliates.
#
# This source code is licensed under the MIT license found in the
# LICENSE file in the root directory of this source tree.
r"""
Multi-objective optimization benchmark problems.
References
.. [Deb2005dtlz]
K. Deb, L. Thiele, M. Laumanns... | [
"facebook-github-bot@users.noreply.github.com"
] | facebook-github-bot@users.noreply.github.com |
4b8524cc460faabc41efc6e9ca0584712bb5bfd6 | ab69c2e3e4ec895fc533a4d37768aab517f86722 | /tests/structures/test_comparisons.py | 995b3acc05d605970a8217e4e74851e623881818 | [
"BSD-3-Clause",
"MIT"
] | permissive | pranavmodx/batavia | 9cf7d7528cb88b16d5b33b64481281b60e84cbec | 084d78eb553f21c787009e1141638e810fcc654f | refs/heads/master | 2020-08-07T19:08:36.105839 | 2019-10-08T06:32:23 | 2019-10-08T06:32:23 | 213,560,529 | 1 | 0 | NOASSERTION | 2019-10-08T06:01:52 | 2019-10-08T06:01:50 | null | UTF-8 | Python | false | false | 5,319 | py | from ..utils import TranspileTestCase
class ComparisonTests(TranspileTestCase):
def test_is(self):
self.assertCodeExecution("""
x = 1
if x is 1:
print('Correct')
else:
print('Incorrect')
print('Done.')
""")
... | [
"russell@keith-magee.com"
] | russell@keith-magee.com |
eda77b3fb111fdadddce59be538af5500de1b8e4 | e9abcb6021cc6fcc15ef2258f09812492b4e093d | /ironic/drivers/modules/pxe_auto_deploy.py | e710fc477b8a458092f3fcfad209f81f16a14b57 | [
"Apache-2.0"
] | permissive | ericxiett/ironic-customized | e6df6a62840ae34180b8004c98ac56790462408b | 3a2ad13969e1497889a0c3be80f9f5f671ff4d1b | refs/heads/master | 2020-07-16T08:29:03.447845 | 2019-09-02T01:31:58 | 2019-09-02T01:31:58 | 205,754,554 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 9,371 | py | import os
import socket
from shutil import rmtree
import jinja2
import time
from oslo_log import log
from oslo_utils import fileutils
from ironic_lib import utils as ironic_utils
from ironic.common import exception, pxe_utils, boot_devices, states
from ironic.common import utils
from ironic.common.i18n import _, _LE,... | [
"eric_xiett@163.com"
] | eric_xiett@163.com |
4d73f1009f9545a495de388d2b5332138d8fc0d7 | 237162607427106ae9564670d47427a62356861f | /users/migrations/0040_auto_20190426_1040.py | 477aac69c7a6db31f52e331f91b20015a89d3272 | [] | no_license | pitipund/basecore | 8648c1f4fa37b6e6075fd710ca422fe159ba930e | a0c20cec1e17dd0eb6abcaaa7d2623e38b60318b | refs/heads/master | 2020-09-13T20:16:02.622903 | 2019-11-20T09:07:15 | 2019-11-20T09:07:15 | 221,885,342 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 524 | py | # -*- coding: utf-8 -*-
# Generated by Django 1.11.13 on 2019-04-26 10:40
from __future__ import unicode_literals
from django.db import migrations
class Migration(migrations.Migration):
dependencies = [
('users', '0039_applicationdefaultrole'),
]
operations = [
migrations.AlterModelOpti... | [
"longman_694@hotmail.com"
] | longman_694@hotmail.com |
f8fd4511a108b8fa1fb60b90cb489e7232eb676d | 9e988c0dfbea15cd23a3de860cb0c88c3dcdbd97 | /sdBs/AllRun/galex_j032139.63+472718.83/sdB_galex_j032139.63+472718.83_coadd.py | 7700527b519c981826539b80b5486dc86e5c9e84 | [] | no_license | tboudreaux/SummerSTScICode | 73b2e5839b10c0bf733808f4316d34be91c5a3bd | 4dd1ffbb09e0a599257d21872f9d62b5420028b0 | refs/heads/master | 2021-01-20T18:07:44.723496 | 2016-08-08T16:49:53 | 2016-08-08T16:49:53 | 65,221,159 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 489 | py | from gPhoton.gMap import gMap
def main():
gMap(band="NUV", skypos=[50.415125,47.455231], skyrange=[0.0333333333333,0.0333333333333], stepsz = 30., cntfile="/data2/fleming/GPHOTON_OUTPUT/LIGHTCURVES/sdBs/sdB_galex_j032139.63+472718.83/sdB_galex_j032139.63+472718.83_movie_count.fits", cntcoaddfile="/data2/fleming/GPHOT... | [
"thomas@boudreauxmail.com"
] | thomas@boudreauxmail.com |
63093190ee20e10698bd99dcea94ccf5d076a006 | 04803c70bb97012b7d500a177ac0240fb2ddbe38 | /1heptane/pdep/network4267_1.py | 8a706002eeed10a53d67be4e75593936ac4c0251 | [] | no_license | shenghuiqin/chpd | 735e0415f6688d88579fc935459c1b0f53596d1d | 396ba54629036e3f2be0b3fabe09b78c90d56939 | refs/heads/master | 2023-03-01T23:29:02.118150 | 2019-10-05T04:02:23 | 2019-10-05T04:02:23 | 192,084,217 | 0 | 0 | null | 2019-06-18T18:33:13 | 2019-06-15T13:52:28 | HTML | UTF-8 | Python | false | false | 69,142 | py | species(
label = 'C=C([CH]C)C(=C)[CH]C(24182)',
structure = SMILES('[CH2]C(=CC)C([CH2])=CC'),
E0 = (249.687,'kJ/mol'),
modes = [
HarmonicOscillator(frequencies=([325,375,415,465,420,450,1700,1750,2750,2770,2790,2810,2830,2850,1350,1400,1450,1500,700,800,1000,1100,1350,1400,900,1100,3000,3033.33,... | [
"qin.she@husky.neu.edu"
] | qin.she@husky.neu.edu |
a7c12c0c81879fc2ae0d9f7d163beeef16b99619 | 4b70a23e74a332c54e70fe33c9b0fe79bb328d85 | /WGB/tests.py | 150266ac3a772eb5520f7750260a12777f21311c | [] | no_license | tevawolf/wgb | 3b095897cbdc9b71c4b233f6b755f65f2693d582 | f30be8575b03f24bf797b305e34b7fda866fa0c0 | refs/heads/master | 2022-12-10T23:18:04.175394 | 2021-01-29T06:40:01 | 2021-01-29T06:40:01 | 159,421,804 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 400 | py | from django.test import TestCase
from . import models
class UserAccountTests(TestCase):
def test_blank_icon(self):
account = models.UserAccount()
account.username = 'test'
account.password = 'test'
account.nickname = 'test'
account.save()
saved = models.UserAccount... | [
"tevawolf@yahoo.co.jp"
] | tevawolf@yahoo.co.jp |
700fa75fb3bd427c2ace99115edf7c741cc1a10c | 9449368b4a4100f1ef6dd0f4a845faad6f1161a4 | /models/Qaw_reactnet_18_bf.py | 658a6b782cca02444f3726bafd5009b17e234335 | [
"MIT"
] | permissive | TrendingTechnology/BNN_NoBN | b6a770fb176a9881d22ccea20381084b4abc0bcc | d2777845d04449cabfcfc5ce72738e1e6287f633 | refs/heads/main | 2023-06-17T13:38:26.296326 | 2021-04-21T22:28:49 | 2021-04-21T22:28:49 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 4,526 | py | '''
React-birealnet-18(modified from resnet)
BN setting: remove all BatchNorm layers
Conv setting: replace conv2d with ScaledstdConv2d (add alpha beta each blocks)
Binary setting: only activation are binarized
'''
import torch
import torch.nn as nn
import torch.utils.model_zoo as model_zoo
import torch.nn.functiona... | [
"wiwjp619@gmail.com"
] | wiwjp619@gmail.com |
4d4dfa1fce2d0ec301b8527dca38e03ba0e4b365 | e371a21cc31c0616da346e386fea411f39dd0f7b | /LAB04/02-CloudAlbum-Chalice/cloudalbum/chalicelib/config.py | 525345eb14cc26298fa3b523b0b550141477e306 | [
"MIT"
] | permissive | aws-kr-tnc/moving-to-serverless-renew | c0152763de822cea64a862cd395f4f940d2e4e03 | 312248c689a19ea9b589025c82f880593fc70f82 | refs/heads/master | 2023-03-21T19:59:23.717295 | 2022-03-12T15:38:59 | 2022-03-12T15:38:59 | 199,081,822 | 6 | 4 | MIT | 2023-03-07T10:02:25 | 2019-07-26T21:26:02 | Python | UTF-8 | Python | false | false | 1,530 | py | """
cloudalbum/chalicelib/cognito.py
~~~~~~~~~~~~~~~~~~~~~~~
Configurations for application.
:description: CloudAlbum is a fully featured sample application for 'Moving to AWS serverless' training course
:copyright: © 2019 written by Dayoungle Jun, Sungshik Jou.
:license: MIT, see LICENSE for m... | [
"liks79@gmail.com"
] | liks79@gmail.com |
eba0648acc9316ce39061499fa08bb07bd36bf3e | 55c250525bd7198ac905b1f2f86d16a44f73e03a | /Python/Scripts/pyinstaller/PyInstaller/hooks/hook-PyQt5.QtQuickWidgets.py | 5bfdb0b29bff0c35d055c5b3a918351177aeea00 | [] | no_license | NateWeiler/Resources | 213d18ba86f7cc9d845741b8571b9e2c2c6be916 | bd4a8a82a3e83a381c97d19e5df42cbababfc66c | refs/heads/master | 2023-09-03T17:50:31.937137 | 2023-08-28T23:50:57 | 2023-08-28T23:50:57 | 267,368,545 | 2 | 1 | null | 2022-09-08T15:20:18 | 2020-05-27T16:18:17 | null | UTF-8 | Python | false | false | 129 | py | version https://git-lfs.github.com/spec/v1
oid sha256:46db77cbf463b412fb237dd8420a2e12c39b4b5c5fd0cc8d34382ca45cfc9ae0
size 1992
| [
"nateweiler84@gmail.com"
] | nateweiler84@gmail.com |
6301edb7062fa45ed01d04ba326e978ab1a9c163 | 6fcfb638fa725b6d21083ec54e3609fc1b287d9e | /python/n1nj4sec_pupy/pupy-master/pupy/modules/screenshot.py | 1a3055e23702c2b625f5306a537f0e3d8a04c751 | [] | no_license | LiuFang816/SALSTM_py_data | 6db258e51858aeff14af38898fef715b46980ac1 | d494b3041069d377d6a7a9c296a14334f2fa5acc | refs/heads/master | 2022-12-25T06:39:52.222097 | 2019-12-12T08:49:07 | 2019-12-12T08:49:07 | 227,546,525 | 10 | 7 | null | 2022-12-19T02:53:01 | 2019-12-12T07:29:39 | Python | UTF-8 | Python | false | false | 3,976 | py | # -*- coding: utf-8 -*-
# --------------------------------------------------------------
# Copyright (c) 2015, Nicolas VERDIER (contact@n1nj4.eu) All rights reserved.
#
# Redistribution and use in source and binary forms, with or without
# modification, are permitted provided that the following conditions are met:
#
#... | [
"659338505@qq.com"
] | 659338505@qq.com |
727d7ace2d7e5bb03b05240b8fb2e711a818186e | 09e5cfe06e437989a2ccf2aeecb9c73eb998a36c | /modules/cctbx_project/xfel/ui/components/xfel_gui_controls.py | 3d08fe4ffe7f49a0c8341e17313896eb3ca5a7db | [
"BSD-3-Clause",
"BSD-3-Clause-LBNL"
] | permissive | jorgediazjr/dials-dev20191018 | b81b19653624cee39207b7cefb8dfcb2e99b79eb | 77d66c719b5746f37af51ad593e2941ed6fbba17 | refs/heads/master | 2020-08-21T02:48:54.719532 | 2020-01-25T01:41:37 | 2020-01-25T01:41:37 | 216,089,955 | 0 | 1 | BSD-3-Clause | 2020-01-25T01:41:39 | 2019-10-18T19:03:17 | Python | UTF-8 | Python | false | false | 29,197 | py | from __future__ import absolute_import, division, print_function
import six
'''
Author : Lyubimov, A.Y.
Created : 06/03/2016
Last Changed: 06/03/2016
Description : XFEL UI Custom Widgets and Controls
'''
import os
import wx
import wx.lib.agw.floatspin as fs
from wxtbx import metallicbutton as mb
# Platform-... | [
"jorge7soccer@gmail.com"
] | jorge7soccer@gmail.com |
337d27c4666d08ff02e5ac3fb7470dae4cbe5a9c | 2e682fd72e3feaa70e3f7bf2a3b83c50d783ec02 | /PyTorch/contrib/cv/detection/SSD/mmdet/models/roi_heads/point_rend_roi_head.py | 3642628ea91a376a39ce5e5813e50509d0ea712a | [
"Apache-2.0",
"BSD-2-Clause",
"MIT",
"BSD-3-Clause",
"LicenseRef-scancode-generic-cla",
"LicenseRef-scancode-unknown-license-reference",
"GPL-1.0-or-later"
] | permissive | Ascend/ModelZoo-PyTorch | 4c89414b9e2582cef9926d4670108a090c839d2d | 92acc188d3a0f634de58463b6676e70df83ef808 | refs/heads/master | 2023-07-19T12:40:00.512853 | 2023-07-17T02:48:18 | 2023-07-17T02:48:18 | 483,502,469 | 23 | 6 | Apache-2.0 | 2022-10-15T09:29:12 | 2022-04-20T04:11:18 | Python | UTF-8 | Python | false | false | 10,905 | py | # Copyright 2021 Huawei Technologies Co., Ltd
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agree... | [
"wangjiangben@huawei.com"
] | wangjiangben@huawei.com |
a8639e979db7d895673d5f6b9e4d845b351e3782 | dac57de9c28700ebacc25331d5ff04dec129b74b | /MxOnline/users/adminx.py | 59f3b2e3d6b9d7bc1ab58c529d848aaef9f1bd53 | [] | no_license | zmm064/Django- | 08144522ef9afcc3d85c11faa848554282fc6fcd | 1f8836ebb4902a738efc6c626ab10aa91fdde720 | refs/heads/master | 2021-08-09T03:00:01.049464 | 2017-11-12T01:52:34 | 2017-11-12T01:52:34 | 110,396,352 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 931 | py | import xadmin
from xadmin import views
from .models import EmailVerifyRecord, Banner
class BaseSetting:
enable_themes = True
use_bootswatch = True
class GlobalSettings:
site_title = "慕学后台管理系统"
site_footer = "慕学在线网"
menu_style = "accordion"
class EmailVerifyRecordAdmin:
list_display = ['cod... | [
"zmm064@foxmail.com"
] | zmm064@foxmail.com |
0b9fdfc19478cd3711fb29d2dcfef928d5c522aa | f67dec556fe0dddc0be1cf28c44964425ee38019 | /venv/lib/python3.7/types.py | b685ab0b6897f18501ae1598f2ada4d95cbdb929 | [] | no_license | AdamC66/July-18--Avoiding-Bugs-with-Linters | 3b3a050227ee7865373adec6084a16fdc21334e7 | 1a5060efc23774941606b7c70a0ec56599f4ab39 | refs/heads/master | 2020-06-22T02:06:14.023492 | 2019-07-18T14:52:12 | 2019-07-18T14:52:12 | 197,469,940 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 54 | py | /home/oem/.pyenv/versions/3.7.3/lib/python3.7/types.py | [
"adam.cote66@gmail.com"
] | adam.cote66@gmail.com |
463d4a3035c7536df43458eb4be4d53450af98d3 | 5fee6afe91711fbb1ca87845f502776fbfab7851 | /examples/pymanopt_autograd_demo.py | 1761abe78a82061ff7149582fca5d90df8e0d786 | [
"MIT"
] | permissive | chenxofhit/pyprobml | f66ad4c1186f0ba22e520e14700ac0bd6fee400d | fe48d6111bd121e01cfbdefe3361a993fa14abe1 | refs/heads/master | 2021-01-24T09:39:29.828935 | 2016-09-17T03:34:59 | 2016-09-17T03:34:59 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 290 | py | #https://github.com/pymanopt/pymanopt/blob/master/pymanopt/core/problem.py
import autograd.numpy as np
from pymanopt import Problem
def cost(theta):
return np.square(theta)
problem = Problem(manifold=None, cost=cost, verbosity=1)
print problem.cost(5)
print problem.egrad(5.0) | [
"murphyk@gmail.com"
] | murphyk@gmail.com |
eaca63e5e424fa56715f10e05ddfbe09b2ff2f4c | 44064ed79f173ddca96174913910c1610992b7cb | /Second_Processing_app/temboo/Library/RunKeeper/Weight/UpdateEntry.py | e7d943997a26bf0fc309b517c6fea8f1ba7349e6 | [] | no_license | dattasaurabh82/Final_thesis | 440fb5e29ebc28dd64fe59ecd87f01494ed6d4e5 | 8edaea62f5987db026adfffb6b52b59b119f6375 | refs/heads/master | 2021-01-20T22:25:48.999100 | 2014-10-14T18:58:00 | 2014-10-14T18:58:00 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 3,005 | py | # -*- coding: utf-8 -*-
###############################################################################
#
# UpdateEntry
# Updates a weight entry in a user’s feed.
#
# Python version 2.6
#
###############################################################################
from temboo.core.choreography import Choreography
... | [
"dattasaurabh82@gmail.com"
] | dattasaurabh82@gmail.com |
6af51bf8cb1672b3a526dc92325dd61f00709985 | 63cbfedc2e6141ae12fc113a81e147e9b5769670 | /Chapt 13/sample2.py | 842aeb8880e4bceca85a07e275a5080323161ffd | [] | no_license | DamoM73/Learn-to-program-in-Python | 82d5fdfbb456186d63aa8ae244e87bf96955ff86 | 44b6b9ffa81735739180dc2055e2e803f4526c79 | refs/heads/master | 2020-04-23T06:51:58.591548 | 2019-04-27T09:16:14 | 2019-04-27T09:16:14 | 170,988,387 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,427 | py | # Program name: Ch 13 Sample app 2 validate password aaaaa.py
# Program askss use to login, then checks password
# in this program password is "aaaaaa"
from tkinter import *
from tkinter import messagebox
def submit():
password = entry_password.get()
username = entry_username.get()
messageAlert = Label(ro... | [
"damomurtagh@gmail.com"
] | damomurtagh@gmail.com |
61809667b75b77ed0658b2764d8a6580eff27210 | ba3231b25c60b73ca504cd788efa40d92cf9c037 | /nitro-python-13.0.36/nssrc/com/citrix/netscaler/nitro/resource/config/lb/lbvserver_cachepolicy_binding.py | 69f8f99dd0ca1e599fbfdbfaa6887a306492e901 | [
"Apache-2.0",
"Python-2.0",
"LicenseRef-scancode-unknown-license-reference"
] | permissive | zhuweigh/vpx13 | f6d559ae85341e56472e3592cbc67062dac34b93 | b36caa3729d3ca5515fa725f2d91aeaabdb2daa9 | refs/heads/master | 2020-07-04T22:15:16.595728 | 2019-09-20T00:19:56 | 2019-09-20T00:19:56 | 202,435,307 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 10,840 | py | #
# Copyright (c) 2008-2019 Citrix Systems, Inc.
#
# Licensed under the Apache License, Version 2.0 (the "License")
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable l... | [
"zhuwei@xsky.com"
] | zhuwei@xsky.com |
d02c4a0793ee279dabe9c0b95d2105dcd9706e63 | 7b3743f052da9a74808b7d2145418ce5c3e1a477 | /v2/api.thewatcher.io/api/models/saviors.py | 89626aa29873222a92953c0510d71808dfbb67f1 | [
"MIT"
] | permissive | quebecsti/kdm-manager | 5547cbf8928d485c6449650dc77805877a67ee37 | a5fcda27d04135429e43a21ac655e6f6acc7768e | refs/heads/master | 2020-11-26T19:22:53.197651 | 2019-10-22T20:53:40 | 2019-10-22T20:53:40 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,129 | py | #!/usr/bin/python2.7
from api.assets import saviors
from api import Models
import utils
class Assets(Models.AssetCollection):
def __init__(self, *args, **kwargs):
self.root_module = saviors
Models.AssetCollection.__init__(self, *args, **kwargs)
def get_asset_by_color(self, color=None):
... | [
"toconnell@tyrannybelle.com"
] | toconnell@tyrannybelle.com |
14940a0b39f1f7c4e8107e47cdc734cdf845df28 | 28bf7793cde66074ac6cbe2c76df92bd4803dab9 | /answers/MridulMohanta/Day29/question1.py | bd0a470a4989c366aa27de5d8ad3952e877f35eb | [
"MIT"
] | permissive | Codechef-SRM-NCR-Chapter/30-DaysOfCode-March-2021 | 2dee33e057ba22092795a6ecc6686a9d31607c9d | 66c7d85025481074c93cfda7853b145c88a30da4 | refs/heads/main | 2023-05-29T10:33:31.795738 | 2021-06-10T14:57:30 | 2021-06-10T14:57:30 | 348,153,476 | 22 | 135 | MIT | 2021-06-10T14:57:31 | 2021-03-15T23:37:26 | Java | UTF-8 | Python | false | false | 534 | py | a=[]
b=[]
x=int(input("Enter length of the two variables"))
n=int(input("Enter test number"))
y=0
for i in range(0,x):
p=int(input("Enter element in a:"))
a.append(p)
q=int(input("Enter element in b:"))
b.append(q)
for i in range(x-1,-1,-1):
for j in range(i,-1,-1):
if ((a[i]+b[j])<=n):
... | [
"noreply@github.com"
] | Codechef-SRM-NCR-Chapter.noreply@github.com |
fdfaf5133245d102f34dbb38f190dc97481a6095 | bdc0b8809d52933c10f8eb77442bd0b4453f28f9 | /build/std_msgs/rosidl_generator_py/std_msgs/msg/_header.py | 9b81821f0602af102a642cfc19c4bb22e9f5e525 | [] | no_license | ClaytonCalabrese/BuiltRos2Eloquent | 967f688bbca746097016dbd34563716bd98379e3 | 76bca564bfd73ef73485e5c7c48274889032e408 | refs/heads/master | 2021-03-27T22:42:12.976367 | 2020-03-17T14:24:07 | 2020-03-17T14:24:07 | 247,810,969 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 5,074 | py | # generated from rosidl_generator_py/resource/_idl.py.em
# with input from std_msgs:msg/Header.idl
# generated code does not contain a copyright notice
# Import statements for member types
import rosidl_parser.definition # noqa: E402, I100
class Metaclass_Header(type):
"""Metaclass of message 'Header'."""
... | [
"calabreseclayton@gmail.com"
] | calabreseclayton@gmail.com |
76248405f1c00343fddef1efe2213d5897023cdc | 51086c09f2c920d057db12e373a01b08571c4cbf | /pebble-sdk/SDKs/4.3/sdk-core/pebble/common/tools/inject_metadata.py | 132a3d5457b902f386c30f11dc86721ecedec725 | [] | no_license | JohnHoder/pebble-dev | 66dc69258dfd009313c23ba5c2eb518aec257652 | e9d95bd564ba6f58b539a1a68f21fe82b6d0992b | refs/heads/master | 2022-11-23T17:32:26.573394 | 2018-12-26T03:17:37 | 2018-12-26T03:17:37 | 163,131,045 | 0 | 1 | null | 2022-10-31T10:03:38 | 2018-12-26T03:15:57 | Python | UTF-8 | Python | false | false | 11,374 | py | #!/usr/bin/env python
from __future__ import with_statement
from struct import pack, unpack
import os
import os.path
import sys
import time
from subprocess import Popen, PIPE
from shutil import copy2
from binascii import crc32
from struct import pack
from pbpack import ResourcePack
import stm32_crc
# Pebble App M... | [
"hoder.john@gmail.com"
] | hoder.john@gmail.com |
0edb15c99b81287d2f5f4c1a226de09d6b692c6c | ce0a34a4a1f44cda31042e4294e6cef334392a37 | /tests/test_gui_klgui.py | 9c28eb7d7c5c47e2c9694da7f660414fd1c1df94 | [
"GPL-3.0-only"
] | permissive | PhonologicalCorpusTools/CorpusTools | ba6644f90a9790d3f61d923b3b5622eaeaa24caa | 314bd30be24b1cb7ee0c252a6529bbfe964056ad | refs/heads/master | 2022-09-29T20:36:12.148289 | 2022-09-16T01:57:47 | 2022-09-16T01:57:47 | 18,848,568 | 108 | 24 | BSD-3-Clause | 2021-05-07T23:58:03 | 2014-04-16T17:14:55 | Python | UTF-8 | Python | false | false | 188 | py |
from corpustools.gui.klgui import *
def test_klgui(qtbot, specified_test_corpus, settings):
dialog = KLDialog(None, settings,specified_test_corpus, True)
qtbot.addWidget(dialog)
| [
"michael.e.mcauliffe@gmail.com"
] | michael.e.mcauliffe@gmail.com |
aec5cebc7c02dfa2d6a9bd26431eef3f3eb82c51 | 9870d2c6880fd3fa558c46e3bf160aae20c74157 | /permuteUnique.py | f104cb1cf5024240cfeb1b15ac8dd83327f3196d | [] | no_license | Yigang0622/LeetCode | e7f7f115c6e730c486296ef2f1a3dd1a3fdca526 | c873cd1ee70a2bdb54571bdd50733db9f6475e9e | refs/heads/master | 2023-03-03T14:32:25.498633 | 2021-02-15T13:59:00 | 2021-02-15T13:59:00 | 281,423,565 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 950 | py | # LeetCode
# permuteUnique
# Created by Yigang Zhou on 2020/9/18.
# Copyright © 2020 Yigang Zhou. All rights reserved.
# 47. 全排列 II
# https://leetcode-cn.com/problems/permutations-ii/
from typing import List
class Solution:
def permuteUnique(self, nums: List[int]) -> List[List[int]]:
ans = []
vi... | [
"zhou@zygmail.com"
] | zhou@zygmail.com |
b74676e45149ad9bbe55f3f25d2e2048b5786119 | 930c207e245c320b108e9699bbbb036260a36d6a | /BRICK-RDFAlchemy/generatedCode/brick/brickschema/org/schema/_1_0_2/Brick/AHU_Heating_Demand_Setpoint.py | ec0c93fb165063c910beab5029a9309ddd5da42c | [] | no_license | InnovationSE/BRICK-Generated-By-OLGA | 24d278f543471e1ce622f5f45d9e305790181fff | 7874dfa450a8a2b6a6f9927c0f91f9c7d2abd4d2 | refs/heads/master | 2021-07-01T14:13:11.302860 | 2017-09-21T12:44:17 | 2017-09-21T12:44:17 | 104,251,784 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 427 | py | from rdflib import Namespace, Graph, Literal, RDF, URIRef
from rdfalchemy.rdfSubject import rdfSubject
from rdfalchemy import rdfSingle, rdfMultiple, rdfList
from brick.brickschema.org.schema._1_0_2.Brick.Heating_Demand_Setpoint import Heating_Demand_Setpoint
class AHU_Heating_Demand_Setpoint(Heating_Demand_Setpoint... | [
"Andre.Ponnouradjane@non.schneider-electric.com"
] | Andre.Ponnouradjane@non.schneider-electric.com |
570db6accc88fe50729a6579d12fd3b3c150c75c | 65c3e7139829829dd1410228e17f85c285ab0706 | /Aniyom Ebenezer/Phase 2/STRINGS/Day_29_Challenge_Solution/Question 8 Solution.py | d443f353ceb9d57814ceb49adf93228d5ddd05d5 | [
"MIT"
] | permissive | eaniyom/python-challenge-solutions | 167e9d897d0a72f1e264ff2fed0e4cc5541b0164 | 21f91e06421afe06b472d391429ee2138c918c38 | refs/heads/master | 2022-11-24T02:57:39.920755 | 2020-08-05T09:23:04 | 2020-08-05T09:23:04 | 277,686,791 | 1 | 0 | MIT | 2020-07-07T01:31:00 | 2020-07-07T01:30:59 | null | UTF-8 | Python | false | false | 308 | py | """
Write a Python program that takes a list of words and retuerns the length of the longest one.
"""
def longest_words(word_list):
word_len = []
for n in word_list:
word_len.append((len(n), n))
word_len.sort()
return word_len[-1][1]
print(longest_words(["PHP", "Python", "Backend"])) | [
"eaniyom@gmail.com"
] | eaniyom@gmail.com |
28d5e3dae132663d27b2d5c4430019896f8b3eef | d094ba0c8a9b1217fbf014aa79a283a49aabe88c | /env/lib/python3.6/site-packages/sympy/combinatorics/free_groups.py | 2150e670e4015d91706a458585d33802adc1eba1 | [
"Apache-2.0"
] | permissive | Raniac/NEURO-LEARN | d9274e0baadd97bb02da54bdfcf6ca091fc1c703 | 3c3acc55de8ba741e673063378e6cbaf10b64c7a | refs/heads/master | 2022-12-25T23:46:54.922237 | 2020-09-06T03:15:14 | 2020-09-06T03:15:14 | 182,013,100 | 9 | 2 | Apache-2.0 | 2022-12-09T21:01:00 | 2019-04-18T03:57:00 | CSS | UTF-8 | Python | false | false | 40,158 | py | # -*- coding: utf-8 -*-
from __future__ import print_function, division
from sympy.core.basic import Basic
from sympy.core.compatibility import is_sequence, as_int, string_types
from sympy.core.expr import Expr
from sympy.core.symbol import Symbol, symbols as _symbols
from sympy.core.sympify import CantSympify
from sy... | [
"leibingye@outlook.com"
] | leibingye@outlook.com |
e4b140bd4a3681c4aff2b85b0c7660c38588549f | 9c0eebdeb427db1ea1ce33987947e22b2c897440 | /map.py | 1925fc08dc7034e1f11acc9e148e356e5ec8fb80 | [] | no_license | dkotenko/npuzz | 6d52c2ca9d733c8d59450af65f89c8bbac938134 | 461a864659893ec8276fafe3e58f73d853d1e42c | refs/heads/main | 2023-06-22T06:30:10.979771 | 2021-07-13T23:54:21 | 2021-07-13T23:54:21 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,075 | py | from Printer import Printer
import sys
def parse_int(s):
n = 0
try:
n = int(s)
except ValueError:
s_value = s.strip() if s.strip() else '{empty value}'
Printer.print_error_exit(f"map error: string {s_value} is not an integer")
return n
def validate_map(b):
... | [
"you@example.com"
] | you@example.com |
d58c5d69ac4d4936a7aeabe6f33219107db46479 | 56f5b2ea36a2258b8ca21e2a3af9a5c7a9df3c6e | /CMGTools/H2TauTau/prod/25aug_corrMC/up/mc/SUSYBBHToTauTau_M-1000_8TeV-pythia6-tauola/Summer12_DR53X-PU_S10_START53_V7A-v1/AODSIM/PAT_CMG_V5_16_0_1377467519/HTT_24Jul_newTES_manzoni_Up_Jobs/Job_7/run_cfg.py | ecd7e088550ddaf95adcd0944c067d9074645308 | [] | no_license | rmanzoni/HTT | 18e6b583f04c0a6ca10142d9da3dd4c850cddabc | a03b227073b2d4d8a2abe95367c014694588bf98 | refs/heads/master | 2016-09-06T05:55:52.602604 | 2014-02-20T16:35:34 | 2014-02-20T16:35:34 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,161 | py | import FWCore.ParameterSet.Config as cms
import os,sys
sys.path.append('/afs/cern.ch/user/m/manzoni/summer13/CMGTools/CMSSW_5_3_9/src/CMGTools/H2TauTau/prod/25aug_corrMC/up/mc/SUSYBBHToTauTau_M-1000_8TeV-pythia6-tauola/Summer12_DR53X-PU_S10_START53_V7A-v1/AODSIM/PAT_CMG_V5_16_0_1377467519/HTT_24Jul_newTES_manzoni_Up_J... | [
"riccardo.manzoni@cern.ch"
] | riccardo.manzoni@cern.ch |
ecc3e6b8d119081e510084e3005d631f9d895d53 | 23c4f6d8a2a6b97077628c2a012b2b402c816d91 | /LeetCode算法题/0190_颠倒二进制位/颠倒二进制.py | a253597ca1dc577aa84d9985492621b0937a38bc | [] | no_license | exueyuanAlgorithm/AlgorithmDemo | 7ef6ff8104e8da5a81037795184115fb0ac8ca9a | d34d4b592d05e9e0e724d8834eaf9587a64c5034 | refs/heads/master | 2023-07-16T19:00:05.664780 | 2021-09-04T11:31:07 | 2021-09-04T11:31:07 | 277,327,574 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 405 | py | class Solution:
def reverseBits(self, n: int) -> int:
result_num = 0
for i in range(31):
if n % 2 == 1:
result_num = result_num + 1 << 1
else:
result_num = result_num << 1
n = n >> 1
if n % 2 == 1:
result_num += ... | [
"1079240024@qq.com"
] | 1079240024@qq.com |
bcd1c2f1c3fdc0f2088fe69ccbcb0cb8fb88b0de | 960dd60c263cea329e27584b03bb430b025fe05a | /venv/lib/python3.6/site-packages/bigquery/client.py | eedafc23b7799a04e4b141860937b508bc7d12ac | [] | no_license | RuchiBhardwaj/covid_pipeline | 18b3c0ae5836487b150ad112d86e312544d19f9d | f21a98593383caed532b9e7178e70172984cd635 | refs/heads/master | 2022-12-04T09:02:47.076901 | 2020-06-08T14:12:18 | 2020-06-08T14:12:18 | 268,835,744 | 0 | 2 | null | 2022-11-27T19:32:17 | 2020-06-02T15:17:20 | Python | UTF-8 | Python | false | false | 70,802 | py | import calendar
import json
from logging import getLogger, NullHandler
from collections import defaultdict
from datetime import datetime, timedelta
from hashlib import sha256
from io import StringIO
from time import sleep, time
from functools import reduce
import six
from bigquery.errors import (BigQueryTimeoutExcepti... | [
"ruchi.bhardwaj@nineleaps.com"
] | ruchi.bhardwaj@nineleaps.com |
10b5605b4bccd6d1f948a4c6810b3e573adb67ae | a961aa04d7c7d18fd2ac7da8a8016bacfabc6e1b | /elevennote/src/notes/migrations/0007_auto_20200509_1450.py | 38a6a80a43cd9fce7abbf51b8a93bfb99cfc98ae | [] | no_license | EgorovM/cs102 | a4f6423f3e96064c68a9015118cd141a8a7eea14 | 0f72f9027dbcda510c67f815348a8ce58f76d857 | refs/heads/master | 2021-06-21T16:21:10.880523 | 2020-06-06T08:34:28 | 2020-06-06T08:34:28 | 214,231,423 | 0 | 1 | null | 2021-06-10T22:52:37 | 2019-10-10T16:24:08 | JavaScript | UTF-8 | Python | false | false | 440 | py | # Generated by Django 2.0.1 on 2020-05-09 14:50
from django.conf import settings
from django.db import migrations, models
class Migration(migrations.Migration):
dependencies = [
('notes', '0006_note_shared'),
]
operations = [
migrations.AlterField(
model_name='note',
... | [
"EgorovM@bitbucket.org"
] | EgorovM@bitbucket.org |
cde9c5c591a0868fda460d5f45c15e0897cb2d77 | 89c4a43a505df8fdf1f0d7386988c4896c2e631b | /google/ads/googleads/v6/services/services/gender_view_service/transports/base.py | c2715ba063f55d3fe0da66e820e30cd4ad4a3ba0 | [
"Apache-2.0"
] | permissive | hurricanelennane/google-ads-python | a0a1fed690776a8bb2e81f637eb7eae10fb4992f | 310a488b6fdad9d5beea8fa4b166edce779a2511 | refs/heads/master | 2023-07-04T03:07:53.344466 | 2021-07-16T19:06:36 | 2021-07-16T19:06:36 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 3,582 | py | # -*- coding: utf-8 -*-
# Copyright 2020 Google LLC
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law o... | [
"noreply@github.com"
] | hurricanelennane.noreply@github.com |
0a86e75c70dcb21815b1a3f7ca3483db5fd939cc | 707c6a7f3b3213c8a996967ede905aeb18a8c6d9 | /solutions/Insert-Interval.py | d680a3144665d7fbb6a2e681c4be95c980267521 | [] | no_license | Ziyilan/Pyleetcode | d35b9c2ae6c890dfd42804264b139bfddb8db563 | 81a9d98607b4ce554507d16763ee82f7dad49edd | refs/heads/master | 2020-12-11T02:11:38.470153 | 2015-10-27T18:46:47 | 2015-10-27T18:46:47 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,486 | py | """
Author: Jing (https://github.com/gnijuohz)
Insert Interval: https://oj.leetcode.com/problems/insert-interval
Given a set of non-overlapping intervals, insert a new interval into the intervals (merge if necessary).
You may assume that the intervals were initially sorted according to their start times.
Example... | [
"gnijuohz@gmail.com"
] | gnijuohz@gmail.com |
fe49918b93bc0175098d4277f76f2d191bfbce49 | 5a69cab2b5ed410f944b57f3ec586b9c624a735c | /lib/demo_test/multi_platform_demo | 0cd943b292114efcecb53e660e9883bb98850ba5 | [
"Apache-2.0"
] | permissive | T3kton/architect | 214a176dd5f9a9bc340d358d692e16a61f362ebe | 3368a66c0c1836eca12dbc7af97f01d5ba13984a | refs/heads/master | 2021-01-20T09:03:25.451300 | 2018-09-17T23:03:24 | 2018-09-17T23:03:24 | 90,217,916 | 0 | 2 | Apache-2.0 | 2018-09-17T23:03:24 | 2017-05-04T03:29:18 | Python | UTF-8 | Python | false | false | 2,211 | #!/usr/bin/env python3
import os
import django
os.environ.setdefault( 'DJANGO_SETTINGS_MODULE', 'architect.settings' )
django.setup()
from datetime import datetime, timezone, timedelta
from architect.Contractor.models import Complex, BluePrint
from architect.Plan.models import Plan, PlanComplex, PlanBluePrint, Plan... | [
"pnhowe@gmail.com"
] | pnhowe@gmail.com | |
f4a5841f5d31f26e0da2530d937bbf5ce64db363 | ac1bbabc7c1b3149711c416dd8b5f5969a0dbd04 | /Programming Fundamentals/objects_and_classes/class.py | 7289e5275a0ea25652981f2f7b0b49c310acc71b | [] | no_license | AssiaHristova/SoftUni-Software-Engineering | 9e904221e50cad5b6c7953c81bc8b3b23c1e8d24 | d4910098ed5aa19770d30a7d9cdf49f9aeaea165 | refs/heads/main | 2023-07-04T04:47:00.524677 | 2021-08-08T23:31:51 | 2021-08-08T23:31:51 | 324,847,727 | 1 | 0 | null | 2021-08-08T23:31:52 | 2020-12-27T20:58:01 | Python | UTF-8 | Python | false | false | 701 | py | class Class:
def __init__(self, name):
self.name = name
self.students = []
self.grades = []
__students_count = 22
def add_student(self, name, grade):
if len(self.students) < Class.__students_count:
self.students.append(name)
self.grades.append(grade)... | [
"assiaphristova@gmail.com"
] | assiaphristova@gmail.com |
dda48464dce73f3af0af909f3571d348d3d0d84e | f8dd8d046100f1223713e047074f30c7ce5a59cd | /testing/epilogue/decorators.py | 35dbdffbffc9e1b88e69fb384d455179a4f387c3 | [] | no_license | dotslash227/98fitcortex | 57aed99270799eff68fdff62db0b8c1d9aabd4a2 | bd4002151e5def00c3dea1f5a1abfb06ba3e809a | refs/heads/master | 2022-12-17T00:51:20.302948 | 2019-02-27T13:54:22 | 2019-02-27T13:54:22 | 197,362,824 | 0 | 0 | null | 2022-12-08T00:02:42 | 2019-07-17T09:55:14 | HTML | UTF-8 | Python | false | false | 3,694 | py | import functools
import datetime
from django.db import models
def last_days(days = 6):
today = datetime.datetime.today().date()
while days >= 0:
val = today - datetime.timedelta(days = days)
days -= 1
yield val
def last_weeks(weeks = 6):
today = datetime.datetime.today().date()
current_year , current_week... | [
"shikhar.chauhan@live.com"
] | shikhar.chauhan@live.com |
3ac83d2ac2af4145c059505d5214c148e2fa8ab9 | f80ef3a3cf859b13e8af8433af549b6b1043bf6e | /pyobjc-framework-MailKit/PyObjCTest/test_memessagedecoder.py | 9ebaeafd6990e8c6d9d71d48d0c727eca4fb01ad | [
"MIT"
] | permissive | ronaldoussoren/pyobjc | 29dc9ca0af838a56105a9ddd62fb38ec415f0b86 | 77b98382e52818690449111cd2e23cd469b53cf5 | refs/heads/master | 2023-09-01T05:15:21.814504 | 2023-06-13T20:00:17 | 2023-06-13T20:00:17 | 243,933,900 | 439 | 49 | null | 2023-06-25T02:49:07 | 2020-02-29T08:43:12 | Python | UTF-8 | Python | false | false | 198 | py | from PyObjCTools.TestSupport import TestCase
import MailKit # noqa: F401
class TestMEMessageDecoder(TestCase):
def test_protocols(self):
self.assertProtocolExists("MEMessageDecoder")
| [
"ronaldoussoren@mac.com"
] | ronaldoussoren@mac.com |
ee62c946bacf7cf765e57fe18224aea84ff72185 | 2fcf361eb89f1f01fe4d677d4772ddaba89b06ad | /hydrus/HydrusGlobals.py | 06ab47dbf5399492ca0bfda15b4892944f211c47 | [
"WTFPL"
] | permissive | matjojo/hydrus | 9f13f35e817bfe7e170ec7be22e18b64e393cb01 | 8f87206ea6ef242bc38235d7053bb33b5a785e68 | refs/heads/master | 2021-05-17T03:26:19.183503 | 2020-03-27T23:32:58 | 2020-03-27T23:32:58 | 250,597,596 | 0 | 0 | NOASSERTION | 2020-03-27T17:18:53 | 2020-03-27T17:18:52 | null | UTF-8 | Python | false | false | 1,239 | py | import threading
controller = None
client_controller = None
server_controller = None
test_controller = None
view_shutdown = False
model_shutdown = False
no_daemons = False
no_wal = False
no_db_temp_files = False
db_memory_journaling = False
db_synchronous_override = None
import_folders_running = False
export_folders... | [
"hydrus.admin@gmail.com"
] | hydrus.admin@gmail.com |
f6ced2b4805a2ac25e3a6f5f5bc67b175ac0c922 | 69d3680f881833a0a4906ad708eac11401bc03c6 | /python3/515. 在每个树行中找最大值.py | 7f9663db2eb82e0576ad697414cd72b43c7432df | [] | no_license | menghuu/YALeetcode | 21df4b5ea6cb0a249263b0ce2df37e7580477ddd | 1959a884bb1cc9f2f1acb1ba6f413498ea0d1aca | refs/heads/master | 2023-08-18T03:55:41.470428 | 2021-09-11T12:39:02 | 2021-09-11T12:39:02 | 269,104,152 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 882 | py | #! /usr/bin/env python
# -*- coding: utf-8 -*-
# vim:fenc=utf-8
#
# Copyright © 2020 m <m@meng.hu>
#
# Distributed under terms of the MIT license.
"""
"""
# Definition for a binary tree node.
# class TreeNode:
# def __init__(self, x):
# self.val = x
# self.left = None
# self.right = None
... | [
"m@meng.hu"
] | m@meng.hu |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.